diff --git a/.github/workflows/pr_title.yml b/.github/workflows/pr_title.yml index 9ac43e4..cc067ce 100644 --- a/.github/workflows/pr_title.yml +++ b/.github/workflows/pr_title.yml @@ -7,6 +7,7 @@ on: - synchronize branches: - main + - main-design-system # Remove this once the design system is merged into main concurrency: group: ${{ github.workflow }}-${{ github.ref }} @@ -20,13 +21,13 @@ jobs: with: scopes: | llc + ui repo requireScope: true env: GITHUB_TOKEN: ${{ secrets.GITHUB_TOKEN }} semantic_changelog_update: - if: ${{ false }} # TODO: Enable after the first release needs: conventional_pr_title # Trigger after the [conventional_pr_title] completes runs-on: ubuntu-latest steps: diff --git a/.github/workflows/publish_gallery.yml b/.github/workflows/publish_gallery.yml new file mode 100644 index 0000000..82207d4 --- /dev/null +++ b/.github/workflows/publish_gallery.yml @@ -0,0 +1,40 @@ +name: Publish Design System Gallery + +on: + push: + branches: + - main-design-system + workflow_dispatch: + +env: + FLUTTER_CHANNEL: stable + +concurrency: + group: ${{ github.workflow }}-${{ github.ref }} + cancel-in-progress: true + +jobs: + build_and_deploy_gallery: + runs-on: ubuntu-latest + timeout-minutes: 10 + steps: + - name: Checkout code + uses: actions/checkout@v6 + + - name: config git + run: | + git config --global user.email "$(git log --format='%ae' HEAD^!)" + git config --global user.name "$(git log --format='%an' HEAD^!)" + + - name: Setup Flutter + uses: subosito/flutter-action@v2 + with: + cache: true + channel: ${{ env.FLUTTER_CHANNEL }} + flutter-version: ${{ env.FLUTTER_VERSION }} + + - name: Build and Deploy + uses: bluefireteam/flutter-gh-pages@v9 + with: + baseHref: /stream-core-flutter/ + workingDir: apps/design_system_gallery diff --git a/.github/workflows/stream_core_flutter_workflow.yml b/.github/workflows/stream_core_flutter_workflow.yml index 8985e9a..cb023a5 100644 --- a/.github/workflows/stream_core_flutter_workflow.yml +++ b/.github/workflows/stream_core_flutter_workflow.yml @@ -23,9 +23,11 @@ jobs: analyze: timeout-minutes: 15 runs-on: ubuntu-latest + env: + IS_CI: 'true' steps: - name: Git Checkout - uses: actions/checkout@v3 + uses: actions/checkout@v6 with: fetch-depth: 0 diff --git a/.github/workflows/update_goldens.yml b/.github/workflows/update_goldens.yml new file mode 100644 index 0000000..458532e --- /dev/null +++ b/.github/workflows/update_goldens.yml @@ -0,0 +1,38 @@ +name: update_goldens + +on: workflow_dispatch + +jobs: + update_goldens: + runs-on: ubuntu-latest + steps: + - name: 📚 Checkout branch + uses: actions/checkout@v6 + with: + ssh-key: ${{ secrets.BOT_SSH_PRIVATE_KEY }} + + - name: 🐦 Install Flutter + uses: subosito/flutter-action@v2 + with: + flutter-version: "3.x" + channel: stable + cache: true + cache-key: flutter-:os:-:channel:-:version:-:arch:-:hash:-${{ hashFiles('**/pubspec.lock') }} + + - name: 📦 Install Tools + run: flutter pub global activate melos + + - name: 🔧 Bootstrap Workspace + run: melos bootstrap --verbose + + - name: 🖼️ Update Goldens + continue-on-error: true + run: melos run update:goldens + + - name: 📤 Commit Changes + uses: stefanzweifel/git-auto-commit-action@v7 + with: + commit_message: "chore: Update Goldens" + file_pattern: "**/test/**/goldens/*.png" + commit_user_name: "Stream SDK Bot" + commit_user_email: "60655709+Stream-SDK-Bot@users.noreply.github.com" \ No newline at end of file diff --git a/CLAUDE.md b/CLAUDE.md new file mode 100644 index 0000000..aabf9c2 --- /dev/null +++ b/CLAUDE.md @@ -0,0 +1,94 @@ +# CLAUDE.md + +This file provides guidance to Claude Code (claude.ai/code) when working with code in this repository. + +## Project Overview + +A Flutter monorepo managed with **Melos** containing: +- `packages/stream_core` — Pure Dart SDK (WebSocket, HTTP, models, utilities) +- `packages/stream_core_flutter` — Flutter UI component library with a full design system +- `apps/design_system_gallery` — Widgetbook-based interactive component showcase + +## Common Commands + +All commands use Melos and should be run from the repo root. + +```bash +# Setup +melos bootstrap + +# Linting & formatting +melos run lint:all # analyze + format check +melos run analyze +melos run format +melos run format:verify # check only, no changes + +# Testing +melos run test:all # all tests with coverage +melos run test:dart # stream_core only +melos run test:flutter # stream_core_flutter only + +# Golden tests +melos run update:goldens # regenerate golden images + +# Code generation (run after model/theme changes) +melos run generate:all +melos run generate:icons # regenerate icon font from SVGs +melos run gen-l10n # regenerate localizations +``` + +**Line width:** 120 characters (set in `analysis_options.yaml`). + +## Design + +UI components are designed in **Figma**. When implementing or modifying components, use the **Figma MCP** to inspect designs directly — check spacing, colors, typography, and component structure from the source rather than guessing. + +## Architecture + +### Theme System (`stream_core_flutter/lib/src/theme/`) + +Uses `theme_extensions_builder` to generate Material 3 theme extensions. The hierarchy is: + +1. **Primitives** — raw design tokens: colors, typography, spacing, radius, icons +2. **Semantics** — semantic mappings (e.g., `primaryColor`, `bodyText`) +3. **Component themes** — per-widget theme classes (50+ components), defined in `theme/components/` +4. **Tokens** — light/dark concrete values in `theme/tokens/` + +Generated files have `.g.theme.dart` extension. After modifying `.theme.dart` files, run `melos run generate:flutter`. + +### Component Structure (`stream_core_flutter/lib/src/components/`) + +Components are organized by category: `avatar/`, `buttons/`, `badge/`, `list/`, `message_composer/`, `emoji/`, `context_menu/`, `controls/`, `common/`, `accessories/`. + +Each component typically has: +- A widget file +- A theme file in `theme/components/` +- A golden test in `test/components//` +- A Widgetbook use-case in `apps/design_system_gallery/` + +### stream_core Package + +Pure Dart. Key modules: +- `src/ws/` — WebSocket client with reconnect/backoff logic (RxDart-based) +- `src/api/` — Dio HTTP client with interceptors +- `src/attachment/` — File upload and CDN client +- `src/query/` — Query builders and filter models +- `src/logger/` — Structured logging +- `src/user/` — User models and token management + +### Golden Testing + +Golden tests use **Alchemist** (`^0.13.0`). Goldens are stored under: +- `test/components//goldens/ci/` — for CI +- `test/components//goldens/macos/` — for local macOS development + +Golden tests are tagged with `golden` in `dart_test.yaml`. Run `melos run update:goldens` to regenerate after visual changes. + +### Code Generation + +- **json_serializable** — model serialization (`.g.dart` files) +- **build_runner** — orchestrates all generation +- **theme_extensions_builder** — generates theme extension classes (`.g.theme.dart`) +- **widgetbook_generator** — auto-generates Widgetbook entries + +After any model or theme annotation changes, run the appropriate generate command before running tests. diff --git a/all_lint_rules.yaml b/all_lint_rules.yaml index 8ed068a..0fb9e4b 100644 --- a/all_lint_rules.yaml +++ b/all_lint_rules.yaml @@ -3,10 +3,10 @@ linter: - always_declare_return_types - always_put_control_body_on_new_line - always_put_required_named_parameters_first - - always_require_non_null_named_parameters - always_specify_types - always_use_package_imports - annotate_overrides + - annotate_redeclares - avoid_annotating_with_dynamic - avoid_bool_literals_in_conditional_expressions - avoid_catches_without_on_clauses @@ -20,6 +20,7 @@ linter: - avoid_field_initializers_in_const_classes - avoid_final_parameters - avoid_function_literals_in_foreach_calls + - avoid_futureor_void - avoid_implementing_value_types - avoid_init_to_null - avoid_js_rounded_ints @@ -32,8 +33,6 @@ linter: - avoid_relative_lib_imports - avoid_renaming_method_parameters - avoid_return_types_on_setters - - avoid_returning_null - - avoid_returning_null_for_future - avoid_returning_null_for_void - avoid_returning_this - avoid_setters_without_getters @@ -61,12 +60,15 @@ linter: - constant_identifier_names - control_flow_in_finally - curly_braces_in_flow_control_structures + - dangling_library_doc_comments - depend_on_referenced_packages - deprecated_consistency + - deprecated_member_use_from_same_package - diagnostic_describe_all_properties - directives_ordering - discarded_futures - do_not_use_environment + - document_ignores - empty_catches - empty_constructor_bodies - empty_statements @@ -76,32 +78,41 @@ linter: - flutter_style_todos - hash_and_equals - implementation_imports - - iterable_contains_unrelated_type + - implicit_call_tearoffs + - implicit_reopen + - invalid_case_patterns + - invalid_runtime_check_with_js_interop_types - join_return_with_assignment - leading_newlines_in_multiline_strings + - library_annotations - library_names - library_prefixes - library_private_types_in_public_api - lines_longer_than_80_chars - - list_remove_unrelated_type - literal_only_boolean_expressions + - matching_super_parameters + - missing_code_block_language_in_doc_comment - missing_whitespace_between_adjacent_strings - no_adjacent_strings_in_list - no_default_cases - no_duplicate_case_values - no_leading_underscores_for_library_prefixes - no_leading_underscores_for_local_identifiers + - no_literal_bool_comparisons - no_logic_in_create_state - no_runtimeType_toString + - no_self_assignments + - no_wildcard_variable_uses - non_constant_identifier_names - noop_primitive_operations - null_check_on_nullable_type_parameter - null_closures - omit_local_variable_types + - omit_obvious_local_variable_types + - omit_obvious_property_types - one_member_abstracts - only_throw_errors - overridden_fields - - package_api_docs - package_names - package_prefixed_library_names - parameter_assignments @@ -117,7 +128,6 @@ linter: - prefer_constructors_over_static_methods - prefer_contains - prefer_double_quotes - - prefer_equal_for_default_values - prefer_expression_function_bodies - prefer_final_fields - prefer_final_in_for_each @@ -148,8 +158,10 @@ linter: - provide_deprecation_message - public_member_api_docs - recursive_getters + - remove_deprecations_in_breaking_versions - require_trailing_commas - secure_pubspec_urls + - simplify_variable_pattern - sized_box_for_whitespace - sized_box_shrink_expand - slash_for_doc_comments @@ -157,20 +169,31 @@ linter: - sort_constructors_first - sort_pub_dependencies - sort_unnamed_constructors_first + - specify_nonobvious_local_variable_types + - specify_nonobvious_property_types + - strict_top_level_inference + - switch_on_type - test_types_in_equals - throw_in_finally - tighten_type_of_initializing_formals - type_annotate_public_apis - type_init_formals + - type_literal_in_constant_pattern - unawaited_futures + - unintended_html_in_doc_comment + - unnecessary_async - unnecessary_await_in_return - unnecessary_brace_in_string_interps + - unnecessary_breaks - unnecessary_const - unnecessary_constructor_name - unnecessary_final - unnecessary_getters_setters + - unnecessary_ignore - unnecessary_lambdas - unnecessary_late + - unnecessary_library_directive + - unnecessary_library_name - unnecessary_new - unnecessary_null_aware_assignments - unnecessary_null_aware_operator_on_extension_on_nullable @@ -185,9 +208,11 @@ linter: - unnecessary_string_interpolations - unnecessary_this - unnecessary_to_list_in_spreads + - unnecessary_unawaited + - unnecessary_underscores - unreachable_from_main - unrelated_type_equality_checks - - unsafe_html + - unsafe_variance - use_build_context_synchronously - use_colored_box - use_decorated_box @@ -199,6 +224,7 @@ linter: - use_key_in_widget_constructors - use_late_for_private_fields_and_variables - use_named_constants + - use_null_aware_elements - use_raw_strings - use_rethrow_when_possible - use_setters_to_change_properties @@ -207,5 +233,6 @@ linter: - use_super_parameters - use_test_throws_matchers - use_to_and_as_if_applicable + - use_truncating_division - valid_regexps - - void_checks \ No newline at end of file + - void_checks diff --git a/analysis_options.yaml b/analysis_options.yaml index b873dbc..09b7cd4 100644 --- a/analysis_options.yaml +++ b/analysis_options.yaml @@ -10,17 +10,20 @@ analyzer: # We explicitly enabled even conflicting rules and are fixing the conflict # in this file. included_file_warning: ignore - - todo: ignore exclude: # exclude all the generated files - packages/*/lib/**/*.*.dart +formatter: + page_width: 120 + trailing_commas: preserve + linter: rules: ## Disabled rules because the repository doesn't respect them (yet) avoid_setters_without_getters: false discarded_futures: false + comment_references: false ############# @@ -93,6 +96,19 @@ linter: # There are situations where we use default in enums on purpose no_default_cases: false + # Sometimes static methods are more readable + prefer_constructors_over_static_methods: false + + # Conflicts with `omit_local_variable_types` + specify_nonobvious_local_variable_types: false + specify_nonobvious_property_types: false + + # Makes the code more verbose without adding much value + document_ignores: false + + # False positives + unsafe_variance: false + # Temporarily disabled to find more important issues public_member_api_docs: false avoid_print: false diff --git a/apps/design_system_gallery/.metadata b/apps/design_system_gallery/.metadata new file mode 100644 index 0000000..05a8ab4 --- /dev/null +++ b/apps/design_system_gallery/.metadata @@ -0,0 +1,45 @@ +# This file tracks properties of this Flutter project. +# Used by Flutter tool to assess capabilities and perform upgrades etc. +# +# This file should be version controlled and should not be manually edited. + +version: + revision: "05db9689081f091050f01aed79f04dce0c750154" + channel: "stable" + +project_type: app + +# Tracks metadata for the flutter migrate command +migration: + platforms: + - platform: root + create_revision: 05db9689081f091050f01aed79f04dce0c750154 + base_revision: 05db9689081f091050f01aed79f04dce0c750154 + - platform: android + create_revision: 05db9689081f091050f01aed79f04dce0c750154 + base_revision: 05db9689081f091050f01aed79f04dce0c750154 + - platform: ios + create_revision: 05db9689081f091050f01aed79f04dce0c750154 + base_revision: 05db9689081f091050f01aed79f04dce0c750154 + - platform: linux + create_revision: 05db9689081f091050f01aed79f04dce0c750154 + base_revision: 05db9689081f091050f01aed79f04dce0c750154 + - platform: macos + create_revision: 05db9689081f091050f01aed79f04dce0c750154 + base_revision: 05db9689081f091050f01aed79f04dce0c750154 + - platform: web + create_revision: 05db9689081f091050f01aed79f04dce0c750154 + base_revision: 05db9689081f091050f01aed79f04dce0c750154 + - platform: windows + create_revision: 05db9689081f091050f01aed79f04dce0c750154 + base_revision: 05db9689081f091050f01aed79f04dce0c750154 + + # User provided section + + # List of Local paths (relative to this file) that should be + # ignored by the migrate tool. + # + # Files that are not part of the templates will be ignored by default. + unmanaged_files: + - 'lib/main.dart' + - 'ios/Runner.xcodeproj/project.pbxproj' diff --git a/apps/design_system_gallery/AGENTS.md b/apps/design_system_gallery/AGENTS.md new file mode 100644 index 0000000..d36e5a6 --- /dev/null +++ b/apps/design_system_gallery/AGENTS.md @@ -0,0 +1,447 @@ +# Design System Gallery - Agent Guide + +This document provides guidance for AI agents working on the Stream Design System Gallery (Widgetbook). + +--- + +## Table of Contents + +1. [Overview](#overview) +2. [Project Structure](#project-structure) +3. [Common Commands](#common-commands) +4. [Theme & Styling](#theme--styling) + - [Accessing Theme](#accessing-theme-in-use-cases-context-extensions) + - [Styling Guidelines](#styling-guidelines) + - [Keeping Material Theme in Sync](#keeping-material-theme-in-sync) +5. [Adding Content](#adding-content) + - [Adding Components](#adding-new-components) + - [Adding Semantic Tokens](#adding-semantic-token-showcases) + - [Adding Primitives](#adding-primitive-token-showcases) + - [Showcase Structure Patterns](#showcase-structure-patterns) + - [Category Ordering](#category-ordering) + - [Knobs Best Practices](#knobs-best-practices) +6. [Technical Details](#technical-details) + - [ThemeConfiguration](#themeconfiguration) + - [Preview Wrapper](#preview-wrapper) +7. [Troubleshooting](#troubleshooting) + +--- + +## Overview + +The gallery showcases Stream's design system components and foundation tokens. It uses: +- **Widgetbook** for component documentation +- **Provider** for state management +- **device_frame_plus** for device previews + +## Project Structure + +``` +apps/design_system_gallery/ +├── lib/ +│ ├── app/ +│ │ ├── gallery_app.dart # Entry point with ChangeNotifierProvider setup +│ │ ├── gallery_app.directories.g.dart # Generated widgetbook directories (DO NOT EDIT) +│ │ └── gallery_shell.dart # Main shell with toolbar and layout +│ ├── components/ # Component use cases +│ │ ├── button.dart +│ │ ├── stream_avatar.dart +│ │ ├── stream_avatar_stack.dart +│ │ └── stream_online_indicator.dart +│ ├── semantics/ # Semantic token showcases (design system level) +│ │ ├── typography.dart # StreamTextTheme showcase +│ │ └── elevations.dart # StreamBoxShadow showcase +│ ├── primitives/ # Primitive token showcases (raw values) +│ │ ├── radius.dart # StreamRadius showcase +│ │ ├── spacing.dart # StreamSpacing showcase +│ │ └── colors.dart # StreamColors showcase +│ ├── config/ +│ │ ├── theme_configuration.dart # Theme state (colors, brightness, etc.) +│ │ └── preview_configuration.dart # Preview state (device, text scale) +│ ├── core/ +│ │ └── preview_wrapper.dart # Wraps use cases with theme/device frame +│ └── widgets/ +│ ├── toolbar/ # Top toolbar widgets +│ └── theme_studio/ # Theme customization panel widgets +``` + +## Common Commands + +```bash +# Regenerate widgetbook directories (after adding/modifying use cases) +dart run build_runner build --delete-conflicting-outputs + +# Format code +dart format lib/ + +# Analyze +flutter analyze + +# Run gallery +flutter run -d chrome # or macos/windows +``` + +--- + +# Theme & Styling + +## Accessing Theme in Use Cases (Context Extensions) + +**Preferred:** Use context extensions for clean, concise access: + +```dart +// Recommended - use context extensions +final colorScheme = context.streamColorScheme; +final textTheme = context.streamTextTheme; +final boxShadow = context.streamBoxShadow; +final radius = context.streamRadius; +final spacing = context.streamSpacing; + +// For component themes +final avatarTheme = context.streamAvatarTheme; +final indicatorTheme = context.streamOnlineIndicatorTheme; +``` + +**Alternative:** Direct access via `StreamTheme.of(context)`: + +```dart +final streamTheme = StreamTheme.of(context); +final colorScheme = streamTheme.colorScheme; +final textTheme = streamTheme.textTheme; +``` + +## Styling Guidelines + +### Use context extensions (preferred) + +```dart +// Good - use context extensions +final colorScheme = context.streamColorScheme; +final textTheme = context.streamTextTheme; +style: textTheme.captionDefault.copyWith(color: colorScheme.textSecondary) + +// Avoid - passing parameters through widget tree +MyWidget({required this.colorScheme, required this.textTheme}) +``` + +### Don't pass theme data as parameters + +Widgets should access theme from context, not receive it as constructor parameters: + +```dart +// Good - access from context in build method +class _MyWidget extends StatelessWidget { + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + return Text('Hello', style: textTheme.bodyDefault); + } +} + +// Bad - passing through constructor +class _MyWidget extends StatelessWidget { + final StreamColorScheme colorScheme; + final StreamTextTheme textTheme; + // ... +} +``` + +### Use StreamTheme tokens + +```dart +// Good +style: textTheme.captionDefault.copyWith(color: colorScheme.textSecondary) + +// Bad - hardcoded values +style: TextStyle(fontSize: 12, color: Colors.grey) +``` + +### Use StreamBoxShadow + +```dart +// Good +boxShadow: context.streamBoxShadow.elevation2 + +// Bad - custom shadows +boxShadow: [BoxShadow(blurRadius: 10, ...)] +``` + +### Use StreamRadius + +```dart +// Good +borderRadius: BorderRadius.all(context.streamRadius.md) + +// Bad - hardcoded values +borderRadius: BorderRadius.circular(8) +``` + +### Border handling + +Use `foregroundDecoration` for borders to prevent clipping: + +```dart +Container( + clipBehavior: Clip.antiAlias, + decoration: BoxDecoration( + color: colorScheme.backgroundSurface, + borderRadius: BorderRadius.circular(12), + ), + foregroundDecoration: BoxDecoration( + borderRadius: BorderRadius.circular(12), + border: Border.all(color: colorScheme.borderSubtle), + ), + child: ..., +) +``` + +## Keeping Material Theme in Sync + +When modifying `ThemeConfiguration`, ensure `buildMaterialTheme()` stays updated: + +1. **New color properties** → Add to `ColorScheme` mapping and relevant theme components (buttons, inputs, dialogs, etc.) +2. **New text styles** → Update `TextTheme` mapping to use appropriate Stream styles +3. **New radius/spacing** → Update component themes that use borders/padding + +**Check these areas in `buildMaterialTheme()`:** +- `ColorScheme` - maps Stream colors to Material semantic colors +- `ThemeData` properties - `primaryColor`, `scaffoldBackgroundColor`, etc. +- Component themes - `dialogTheme`, `appBarTheme`, `filledButtonTheme`, etc. +- `TextTheme` - maps Stream text styles to Material text styles +- `extensions` - must include `[themeData]` for `StreamTheme.of(context)` to work + +--- + +# Adding Content + +## Adding New Components + +### 1. Create Use Case File + +Create a new file in `lib/components/`: + +```dart +import 'package:flutter/material.dart'; +import 'package:stream_core_flutter/stream_core_flutter.dart'; +import 'package:widgetbook/widgetbook.dart'; +import 'package:widgetbook_annotation/widgetbook_annotation.dart' as widgetbook; + +@widgetbook.UseCase( + name: 'Playground', + type: MyComponent, + path: '[Components]/MyComponent', // Category in brackets, then folder +) +Widget buildMyComponentPlayground(BuildContext context) { + // Use knobs for interactive controls + final label = context.knobs.string( + label: 'Label', + initialValue: 'Default', + description: 'Description for this knob.', + ); + + // Access theme + final streamTheme = StreamTheme.of(context); + final colorScheme = streamTheme.colorScheme; + + return MyComponent(label: label); +} +``` + +### 2. Use Case Naming Convention + +Each component should have these use cases (in order): +1. **Playground** - Interactive with knobs +2. **Type/Size Variants** - Shows all variants side by side +3. **Real-world Example** - Contextual usage + +### 3. Regenerate Directories + +After adding/modifying use cases: + +```bash +cd apps/design_system_gallery +dart run build_runner build --delete-conflicting-outputs +dart format lib/ +flutter analyze +``` + +## Adding Semantic Token Showcases + +Semantic tokens (like `StreamTextTheme`, `StreamBoxShadow`) are showcased in `lib/semantics/`: + +1. Create a new file in `lib/semantics/` +2. Use path `[App Foundation]/Semantics/TokenName` in the `@UseCase` annotation +3. Follow the same regeneration process as components + +**Example:** +```dart +@widgetbook.UseCase( + name: 'All Styles', + type: StreamTextTheme, + path: '[App Foundation]/Semantics/Typography', +) +Widget buildStreamTextThemeShowcase(BuildContext context) { + // Showcase implementation +} +``` + +## Adding Primitive Token Showcases + +Primitives (raw values like `StreamRadius`, `StreamSpacing`, `StreamColors`) are showcased in `lib/primitives/`: + +1. Create a new file in `lib/primitives/` +2. Use path `[App Foundation]/Primitives/TokenName` in the `@UseCase` annotation + +**Example:** +```dart +@widgetbook.UseCase( + name: 'Scale', + type: StreamRadius, + path: '[App Foundation]/Primitives/Radius', +) +Widget buildStreamRadiusShowcase(BuildContext context) { + // Showcase implementation +} +``` + +## Showcase Structure Patterns + +All primitives and semantics showcases follow a consistent structure. Reference existing files (`radius.dart`, `spacing.dart`, `typography.dart`, `elevations.dart`) for implementation examples. + +### Required Elements + +1. **`_SectionLabel` widget** - Accent-colored label for section headers (uppercase, letter-spacing) +2. **`_QuickReference` section** - Usage patterns and common choices at the bottom +3. **Token cards** - Visual preview (left) + info (right) layout + +### Card Styling Conventions + +- Token names: `accentPrimary` color, monospace font +- Value chips: `backgroundSurfaceSubtle` background, `textSecondary` color +- Usage descriptions: `textTertiary` color +- Borders: Use `foregroundDecoration` (not `border:` in BoxDecoration) +- Shadows: `boxShadow.elevation1` + +## Category Ordering + +The widgetbook generator sorts categories **alphabetically**. To control order, use prefixes: + +- `[App Foundation]` - Sorts first (for tokens/foundations) +- `[Components]` - Sorts second + +**Current structure:** +``` +├── App Foundation +│ ├── Primitives +│ │ ├── Colors +│ │ ├── Radius +│ │ └── Spacing +│ └── Semantics +│ ├── Elevations +│ └── Typography +└── Components + ├── Avatar (StreamAvatar, StreamAvatarStack) + ├── Button + └── Indicator (StreamOnlineIndicator) +``` + +## Knobs Best Practices + +### Do's +- Always add `description` parameter to knobs +- Use `context.knobs.object.dropdown` for enums +- Remove knobs for properties controlled by Theme Studio + +### Don'ts +- Don't add knobs that duplicate Theme Studio controls +- Don't use deprecated `context.knobs.list` (use `object.dropdown`) + +--- + +# Technical Details + +## ThemeConfiguration + +### Accessing ThemeConfiguration + +Use `context.read()` for calling methods (no rebuild on change): + +```dart +// For calling setters/methods - use read +context.read().setAccentPrimary(color); +context.read().resetToDefaults(); +``` + +Use `context.watch()` only when you need to rebuild on changes (typically only in `gallery_app.dart`). + +### Adding New Theme Properties + +1. Add private field and getter in `theme_configuration.dart` +2. Add setter using `_update()` pattern +3. Include in `_rebuildTheme()` colorScheme.copyWith() +4. Add to `resetToDefaults()` +5. Add UI control in `theme_customization_panel.dart` + +### Best Practices + +**Use class getters directly** in `buildMaterialTheme()`: + +```dart +// Good - uses class getters directly +ThemeData buildMaterialTheme() { + return ThemeData( + primaryColor: accentPrimary, // Class getter + scaffoldBackgroundColor: backgroundApp, // Class getter + ); +} + +// Avoid - unnecessary indirection +ThemeData buildMaterialTheme() { + final cs = themeData.colorScheme; + return ThemeData( + primaryColor: cs.accentPrimary, // Through colorScheme + ); +} +``` + +**Use public getters** instead of private fields within the class: + +```dart +// Good +final isDark = brightness == Brightness.dark; + +// Avoid +final isDark = _brightness == Brightness.dark; +``` + +## Preview Wrapper + +The `PreviewWrapper` applies: +- StreamTheme as a Material theme extension +- Device frame (optional) +- Text scale + +**Important:** StreamTheme is provided via `ThemeData.extensions` so `StreamTheme.of(context)` works correctly. + +--- + +## Troubleshooting + +### Theme changes not reflecting in use cases +Ensure `StreamTheme` is added to `ThemeData.extensions`: +```dart +ThemeData( + extensions: [streamTheme], // Required for StreamTheme.of(context)! +) +``` + +This is done in `ThemeConfiguration.buildMaterialTheme()`. + +### Generated file has wrong order +The generator sorts alphabetically. Use category name prefixes to control order (e.g., "App Foundation" before "Components"). + +### Widgets not updating when theme changes +Ensure you're using context extensions (`context.streamColorScheme`) which properly depend on the inherited theme. Don't cache theme values in state. + + diff --git a/apps/design_system_gallery/README.md b/apps/design_system_gallery/README.md new file mode 100644 index 0000000..c50af4b --- /dev/null +++ b/apps/design_system_gallery/README.md @@ -0,0 +1,39 @@ +# Stream Design System Gallery + +Production Widgetbook app for documenting and validating `stream_core_flutter` +components and design tokens. + +## What This App Provides + +- Interactive component use cases with knobs (Widgetbook). +- Foundation token showcases (primitives + semantic tokens). +- Theme Studio controls for live visual tuning. +- Device preview wrapper for realistic UI evaluation. + +## Run Locally + +```bash +cd apps/design_system_gallery +flutter pub get +dart run build_runner build --delete-conflicting-outputs +flutter run -d chrome +``` + +## Quality Checks + +```bash +cd apps/design_system_gallery +dart run build_runner build --delete-conflicting-outputs +dart format lib +flutter analyze +``` + +## Adding A New Component Showcase + +1. Create a use-case file in `lib/components//`. +2. Add `@widgetbook.UseCase(...)` entries (at minimum: Playground + Showcase). +3. Regenerate directories with `build_runner`. +4. Run format and analyze checks. + +The generated file `lib/app/gallery_app.directories.g.dart` is owned by +`widgetbook_generator` and should not be edited manually. diff --git a/apps/design_system_gallery/assets/attachment_image.png b/apps/design_system_gallery/assets/attachment_image.png new file mode 100644 index 0000000..7c129f1 Binary files /dev/null and b/apps/design_system_gallery/assets/attachment_image.png differ diff --git a/apps/design_system_gallery/assets/stream_logo.svg b/apps/design_system_gallery/assets/stream_logo.svg new file mode 100644 index 0000000..b0a5cca --- /dev/null +++ b/apps/design_system_gallery/assets/stream_logo.svg @@ -0,0 +1,30 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/apps/design_system_gallery/lib/app/gallery_app.dart b/apps/design_system_gallery/lib/app/gallery_app.dart new file mode 100644 index 0000000..48a5c37 --- /dev/null +++ b/apps/design_system_gallery/lib/app/gallery_app.dart @@ -0,0 +1,61 @@ +import 'package:flutter/material.dart'; +import 'package:provider/provider.dart'; +import 'package:widgetbook_annotation/widgetbook_annotation.dart' as widgetbook; + +import '../config/preview_configuration.dart'; +import '../config/theme_configuration.dart'; +import 'gallery_shell.dart'; + +/// Stream Design System Gallery +/// +/// A production-level design system gallery for exploring and customizing +/// Stream components. Inspired by Moon Design System and FlexColorScheme. +@widgetbook.App() +class StreamDesignSystemGallery extends StatefulWidget { + const StreamDesignSystemGallery({super.key}); + + @override + State createState() => _StreamDesignSystemGalleryState(); +} + +class _StreamDesignSystemGalleryState extends State { + final _themeConfig = ThemeConfiguration.light(); + final _previewConfig = PreviewConfiguration(); + var _showThemePanel = true; + + @override + void dispose() { + _themeConfig.dispose(); + _previewConfig.dispose(); + super.dispose(); + } + + @override + Widget build(BuildContext context) { + return MultiProvider( + providers: [ + ChangeNotifierProvider.value(value: _themeConfig), + ChangeNotifierProvider.value(value: _previewConfig), + ], + child: Consumer( + builder: (context, themeConfig, _) { + final isDark = themeConfig.brightness == .dark; + final materialTheme = themeConfig.buildMaterialTheme(); + + return MaterialApp( + title: 'Stream Design System', + debugShowCheckedModeBanner: false, + // Use Stream-themed Material theme for all regular widgets + theme: materialTheme, + darkTheme: materialTheme, + themeMode: isDark ? .dark : .light, + home: GalleryShell( + showThemePanel: _showThemePanel, + onToggleThemePanel: () => setState(() => _showThemePanel = !_showThemePanel), + ), + ); + }, + ), + ); + } +} diff --git a/apps/design_system_gallery/lib/app/gallery_app.directories.g.dart b/apps/design_system_gallery/lib/app/gallery_app.directories.g.dart new file mode 100644 index 0000000..d6494aa --- /dev/null +++ b/apps/design_system_gallery/lib/app/gallery_app.directories.g.dart @@ -0,0 +1,619 @@ +// dart format width=80 +// coverage:ignore-file +// ignore_for_file: type=lint +// ignore_for_file: unused_import, prefer_relative_imports, directives_ordering + +// GENERATED CODE - DO NOT MODIFY BY HAND + +// ************************************************************************** +// AppGenerator +// ************************************************************************** + +// ignore_for_file: no_leading_underscores_for_library_prefixes +import 'package:design_system_gallery/components/accessories/stream_audio_waveform.dart' + as _design_system_gallery_components_accessories_stream_audio_waveform; +import 'package:design_system_gallery/components/accessories/stream_emoji.dart' + as _design_system_gallery_components_accessories_stream_emoji; +import 'package:design_system_gallery/components/accessories/stream_file_type_icons.dart' + as _design_system_gallery_components_accessories_stream_file_type_icons; +import 'package:design_system_gallery/components/avatar/stream_avatar.dart' + as _design_system_gallery_components_avatar_stream_avatar; +import 'package:design_system_gallery/components/avatar/stream_avatar_group.dart' + as _design_system_gallery_components_avatar_stream_avatar_group; +import 'package:design_system_gallery/components/avatar/stream_avatar_stack.dart' + as _design_system_gallery_components_avatar_stream_avatar_stack; +import 'package:design_system_gallery/components/badge/stream_badge_count.dart' + as _design_system_gallery_components_badge_stream_badge_count; +import 'package:design_system_gallery/components/badge/stream_badge_notification.dart' + as _design_system_gallery_components_badge_stream_badge_notification; +import 'package:design_system_gallery/components/badge/stream_online_indicator.dart' + as _design_system_gallery_components_badge_stream_online_indicator; +import 'package:design_system_gallery/components/buttons/button.dart' + as _design_system_gallery_components_buttons_button; +import 'package:design_system_gallery/components/buttons/stream_emoji_button.dart' + as _design_system_gallery_components_buttons_stream_emoji_button; +import 'package:design_system_gallery/components/common/stream_checkbox.dart' + as _design_system_gallery_components_common_stream_checkbox; +import 'package:design_system_gallery/components/common/stream_flex.dart' + as _design_system_gallery_components_common_stream_flex; +import 'package:design_system_gallery/components/common/stream_progress_bar.dart' + as _design_system_gallery_components_common_stream_progress_bar; +import 'package:design_system_gallery/components/context_menu/stream_context_menu.dart' + as _design_system_gallery_components_context_menu_stream_context_menu; +import 'package:design_system_gallery/components/controls/stream_emoji_chip.dart' + as _design_system_gallery_components_controls_stream_emoji_chip; +import 'package:design_system_gallery/components/controls/stream_emoji_chip_bar.dart' + as _design_system_gallery_components_controls_stream_emoji_chip_bar; +import 'package:design_system_gallery/components/emoji/stream_emoji_picker_sheet.dart' + as _design_system_gallery_components_emoji_stream_emoji_picker_sheet; +import 'package:design_system_gallery/components/message_composer/message_composer.dart' + as _design_system_gallery_components_message_composer_message_composer; +import 'package:design_system_gallery/components/message_composer/message_composer_attachment_link_preview.dart' + as _design_system_gallery_components_message_composer_message_composer_attachment_link_preview; +import 'package:design_system_gallery/components/message_composer/message_composer_attachment_media_file.dart' + as _design_system_gallery_components_message_composer_message_composer_attachment_media_file; +import 'package:design_system_gallery/components/message_composer/message_composer_attachment_reply.dart' + as _design_system_gallery_components_message_composer_message_composer_attachment_reply; +import 'package:design_system_gallery/components/reaction/stream_reactions.dart' + as _design_system_gallery_components_reaction_stream_reaction; +import 'package:design_system_gallery/components/tiles/stream_list_tile.dart' + as _design_system_gallery_components_tiles_stream_list_tile; +import 'package:design_system_gallery/primitives/colors.dart' + as _design_system_gallery_primitives_colors; +import 'package:design_system_gallery/primitives/icons.dart' + as _design_system_gallery_primitives_icons; +import 'package:design_system_gallery/primitives/radius.dart' + as _design_system_gallery_primitives_radius; +import 'package:design_system_gallery/primitives/spacing.dart' + as _design_system_gallery_primitives_spacing; +import 'package:design_system_gallery/semantics/elevations.dart' + as _design_system_gallery_semantics_elevations; +import 'package:design_system_gallery/semantics/typography.dart' + as _design_system_gallery_semantics_typography; +import 'package:widgetbook/widgetbook.dart' as _widgetbook; + +final directories = <_widgetbook.WidgetbookNode>[ + _widgetbook.WidgetbookCategory( + name: 'App Foundation', + children: [ + _widgetbook.WidgetbookFolder( + name: 'Primitives', + children: [ + _widgetbook.WidgetbookFolder( + name: 'Colors', + children: [ + _widgetbook.WidgetbookComponent( + name: 'StreamColors', + useCases: [ + _widgetbook.WidgetbookUseCase( + name: 'All Colors', + builder: _design_system_gallery_primitives_colors + .buildStreamColorsShowcase, + ), + ], + ), + ], + ), + _widgetbook.WidgetbookFolder( + name: 'Icons', + children: [ + _widgetbook.WidgetbookComponent( + name: 'StreamIcons', + useCases: [ + _widgetbook.WidgetbookUseCase( + name: 'All Icons', + builder: _design_system_gallery_primitives_icons + .buildStreamIconsShowcase, + ), + ], + ), + ], + ), + _widgetbook.WidgetbookFolder( + name: 'Radius', + children: [ + _widgetbook.WidgetbookComponent( + name: 'StreamRadius', + useCases: [ + _widgetbook.WidgetbookUseCase( + name: 'All Values', + builder: _design_system_gallery_primitives_radius + .buildStreamRadiusShowcase, + ), + ], + ), + ], + ), + _widgetbook.WidgetbookFolder( + name: 'Spacing', + children: [ + _widgetbook.WidgetbookComponent( + name: 'StreamSpacing', + useCases: [ + _widgetbook.WidgetbookUseCase( + name: 'All Values', + builder: _design_system_gallery_primitives_spacing + .buildStreamSpacingShowcase, + ), + ], + ), + ], + ), + ], + ), + _widgetbook.WidgetbookFolder( + name: 'Semantics', + children: [ + _widgetbook.WidgetbookFolder( + name: 'Elevations', + children: [ + _widgetbook.WidgetbookComponent( + name: 'StreamBoxShadow', + useCases: [ + _widgetbook.WidgetbookUseCase( + name: 'All Elevations', + builder: _design_system_gallery_semantics_elevations + .buildStreamBoxShadowShowcase, + ), + ], + ), + ], + ), + _widgetbook.WidgetbookFolder( + name: 'Typography', + children: [ + _widgetbook.WidgetbookComponent( + name: 'StreamTextTheme', + useCases: [ + _widgetbook.WidgetbookUseCase( + name: 'All Styles', + builder: _design_system_gallery_semantics_typography + .buildStreamTextThemeShowcase, + ), + ], + ), + ], + ), + ], + ), + ], + ), + _widgetbook.WidgetbookCategory( + name: 'Components', + children: [ + _widgetbook.WidgetbookFolder( + name: 'Accessories', + children: [ + _widgetbook.WidgetbookComponent( + name: 'StreamAudioWaveformSlider', + useCases: [ + _widgetbook.WidgetbookUseCase( + name: 'Playground', + builder: + _design_system_gallery_components_accessories_stream_audio_waveform + .buildStreamAudioWaveformSliderPlayground, + ), + _widgetbook.WidgetbookUseCase( + name: 'Showcase', + builder: + _design_system_gallery_components_accessories_stream_audio_waveform + .buildStreamAudioWaveformSliderShowcase, + ), + ], + ), + _widgetbook.WidgetbookComponent( + name: 'StreamEmoji', + useCases: [ + _widgetbook.WidgetbookUseCase( + name: 'Playground', + builder: + _design_system_gallery_components_accessories_stream_emoji + .buildStreamEmojiPlayground, + ), + _widgetbook.WidgetbookUseCase( + name: 'Showcase', + builder: + _design_system_gallery_components_accessories_stream_emoji + .buildStreamEmojiShowcase, + ), + ], + ), + _widgetbook.WidgetbookComponent( + name: 'StreamFileTypeIcon', + useCases: [ + _widgetbook.WidgetbookUseCase( + name: 'Playground', + builder: + _design_system_gallery_components_accessories_stream_file_type_icons + .buildFileTypeIconPlayground, + ), + _widgetbook.WidgetbookUseCase( + name: 'Showcase', + builder: + _design_system_gallery_components_accessories_stream_file_type_icons + .buildFileTypeIconShowcase, + ), + ], + ), + ], + ), + _widgetbook.WidgetbookFolder( + name: 'Avatar', + children: [ + _widgetbook.WidgetbookComponent( + name: 'StreamAvatar', + useCases: [ + _widgetbook.WidgetbookUseCase( + name: 'Playground', + builder: _design_system_gallery_components_avatar_stream_avatar + .buildStreamAvatarPlayground, + ), + _widgetbook.WidgetbookUseCase( + name: 'Showcase', + builder: _design_system_gallery_components_avatar_stream_avatar + .buildStreamAvatarShowcase, + ), + ], + ), + _widgetbook.WidgetbookComponent( + name: 'StreamAvatarGroup', + useCases: [ + _widgetbook.WidgetbookUseCase( + name: 'Playground', + builder: + _design_system_gallery_components_avatar_stream_avatar_group + .buildStreamAvatarGroupPlayground, + ), + _widgetbook.WidgetbookUseCase( + name: 'Showcase', + builder: + _design_system_gallery_components_avatar_stream_avatar_group + .buildStreamAvatarGroupShowcase, + ), + ], + ), + _widgetbook.WidgetbookComponent( + name: 'StreamAvatarStack', + useCases: [ + _widgetbook.WidgetbookUseCase( + name: 'Playground', + builder: + _design_system_gallery_components_avatar_stream_avatar_stack + .buildStreamAvatarStackPlayground, + ), + _widgetbook.WidgetbookUseCase( + name: 'Showcase', + builder: + _design_system_gallery_components_avatar_stream_avatar_stack + .buildStreamAvatarStackShowcase, + ), + ], + ), + ], + ), + _widgetbook.WidgetbookFolder( + name: 'Badge', + children: [ + _widgetbook.WidgetbookComponent( + name: 'StreamBadgeCount', + useCases: [ + _widgetbook.WidgetbookUseCase( + name: 'Playground', + builder: + _design_system_gallery_components_badge_stream_badge_count + .buildStreamBadgeCountPlayground, + ), + _widgetbook.WidgetbookUseCase( + name: 'Showcase', + builder: + _design_system_gallery_components_badge_stream_badge_count + .buildStreamBadgeCountShowcase, + ), + ], + ), + _widgetbook.WidgetbookComponent( + name: 'StreamBadgeNotification', + useCases: [ + _widgetbook.WidgetbookUseCase( + name: 'Playground', + builder: + _design_system_gallery_components_badge_stream_badge_notification + .buildStreamBadgeNotificationPlayground, + ), + _widgetbook.WidgetbookUseCase( + name: 'Showcase', + builder: + _design_system_gallery_components_badge_stream_badge_notification + .buildStreamBadgeNotificationShowcase, + ), + ], + ), + _widgetbook.WidgetbookComponent( + name: 'StreamOnlineIndicator', + useCases: [ + _widgetbook.WidgetbookUseCase( + name: 'Playground', + builder: + _design_system_gallery_components_badge_stream_online_indicator + .buildStreamOnlineIndicatorPlayground, + ), + _widgetbook.WidgetbookUseCase( + name: 'Showcase', + builder: + _design_system_gallery_components_badge_stream_online_indicator + .buildStreamOnlineIndicatorShowcase, + ), + ], + ), + ], + ), + _widgetbook.WidgetbookFolder( + name: 'Buttons', + children: [ + _widgetbook.WidgetbookComponent( + name: 'StreamButton', + useCases: [ + _widgetbook.WidgetbookUseCase( + name: 'Playground', + builder: _design_system_gallery_components_buttons_button + .buildStreamButtonPlayground, + ), + _widgetbook.WidgetbookUseCase( + name: 'Showcase', + builder: _design_system_gallery_components_buttons_button + .buildStreamButtonShowcase, + ), + ], + ), + _widgetbook.WidgetbookComponent( + name: 'StreamEmojiButton', + useCases: [ + _widgetbook.WidgetbookUseCase( + name: 'Playground', + builder: + _design_system_gallery_components_buttons_stream_emoji_button + .buildStreamEmojiButtonPlayground, + ), + _widgetbook.WidgetbookUseCase( + name: 'Showcase', + builder: + _design_system_gallery_components_buttons_stream_emoji_button + .buildStreamEmojiButtonShowcase, + ), + ], + ), + ], + ), + _widgetbook.WidgetbookFolder( + name: 'Common', + children: [ + _widgetbook.WidgetbookComponent( + name: 'StreamCheckbox', + useCases: [ + _widgetbook.WidgetbookUseCase( + name: 'Playground', + builder: + _design_system_gallery_components_common_stream_checkbox + .buildStreamCheckboxPlayground, + ), + _widgetbook.WidgetbookUseCase( + name: 'Showcase', + builder: + _design_system_gallery_components_common_stream_checkbox + .buildStreamCheckboxShowcase, + ), + ], + ), + _widgetbook.WidgetbookComponent( + name: 'StreamFlex', + useCases: [ + _widgetbook.WidgetbookUseCase( + name: 'Playground', + builder: _design_system_gallery_components_common_stream_flex + .buildStreamFlexPlayground, + ), + _widgetbook.WidgetbookUseCase( + name: 'Showcase', + builder: _design_system_gallery_components_common_stream_flex + .buildStreamFlexShowcase, + ), + ], + ), + _widgetbook.WidgetbookComponent( + name: 'StreamProgressBar', + useCases: [ + _widgetbook.WidgetbookUseCase( + name: 'Playground', + builder: + _design_system_gallery_components_common_stream_progress_bar + .buildStreamProgressBarPlayground, + ), + _widgetbook.WidgetbookUseCase( + name: 'Showcase', + builder: + _design_system_gallery_components_common_stream_progress_bar + .buildStreamProgressBarShowcase, + ), + ], + ), + ], + ), + _widgetbook.WidgetbookFolder( + name: 'Context Menu', + children: [ + _widgetbook.WidgetbookComponent( + name: 'StreamContextMenu', + useCases: [ + _widgetbook.WidgetbookUseCase( + name: 'Playground', + builder: + _design_system_gallery_components_context_menu_stream_context_menu + .buildStreamContextMenuPlayground, + ), + _widgetbook.WidgetbookUseCase( + name: 'Showcase', + builder: + _design_system_gallery_components_context_menu_stream_context_menu + .buildStreamContextMenuShowcase, + ), + ], + ), + ], + ), + _widgetbook.WidgetbookFolder( + name: 'Controls', + children: [ + _widgetbook.WidgetbookComponent( + name: 'StreamEmojiChip', + useCases: [ + _widgetbook.WidgetbookUseCase( + name: 'Playground', + builder: + _design_system_gallery_components_controls_stream_emoji_chip + .buildStreamEmojiChipPlayground, + ), + _widgetbook.WidgetbookUseCase( + name: 'Showcase', + builder: + _design_system_gallery_components_controls_stream_emoji_chip + .buildStreamEmojiChipShowcase, + ), + ], + ), + _widgetbook.WidgetbookComponent( + name: 'StreamEmojiChipBar', + useCases: [ + _widgetbook.WidgetbookUseCase( + name: 'Playground', + builder: + _design_system_gallery_components_controls_stream_emoji_chip_bar + .buildStreamEmojiChipBarPlayground, + ), + _widgetbook.WidgetbookUseCase( + name: 'Showcase', + builder: + _design_system_gallery_components_controls_stream_emoji_chip_bar + .buildStreamEmojiChipBarShowcase, + ), + ], + ), + ], + ), + _widgetbook.WidgetbookFolder( + name: 'Emoji', + children: [ + _widgetbook.WidgetbookComponent( + name: 'StreamEmojiPickerSheet', + useCases: [ + _widgetbook.WidgetbookUseCase( + name: 'Playground', + builder: + _design_system_gallery_components_emoji_stream_emoji_picker_sheet + .buildStreamEmojiPickerSheetDefault, + ), + ], + ), + ], + ), + _widgetbook.WidgetbookFolder( + name: 'Message Composer', + children: [ + _widgetbook.WidgetbookComponent( + name: 'MessageComposerLinkPreviewAttachment', + useCases: [ + _widgetbook.WidgetbookUseCase( + name: 'Playground', + builder: + _design_system_gallery_components_message_composer_message_composer_attachment_link_preview + .buildMessageComposerAttachmentLinkPreviewPlayground, + ), + ], + ), + _widgetbook.WidgetbookComponent( + name: 'MessageComposerMediaFileAttachment', + useCases: [ + _widgetbook.WidgetbookUseCase( + name: 'Playground', + builder: + _design_system_gallery_components_message_composer_message_composer_attachment_media_file + .buildMessageComposerAttachmentMediaFilePlayground, + ), + ], + ), + _widgetbook.WidgetbookComponent( + name: 'MessageComposerReplyAttachment', + useCases: [ + _widgetbook.WidgetbookUseCase( + name: 'Playground', + builder: + _design_system_gallery_components_message_composer_message_composer_attachment_reply + .buildMessageComposerAttachmentReplyPlayground, + ), + ], + ), + _widgetbook.WidgetbookComponent( + name: 'StreamCoreMessageComposer', + useCases: [ + _widgetbook.WidgetbookUseCase( + name: 'Playground', + builder: + _design_system_gallery_components_message_composer_message_composer + .buildStreamMessageComposerPlayground, + ), + _widgetbook.WidgetbookUseCase( + name: 'Real-world Example', + builder: + _design_system_gallery_components_message_composer_message_composer + .buildStreamMessageComposerExample, + ), + ], + ), + ], + ), + _widgetbook.WidgetbookFolder( + name: 'Reactions', + children: [ + _widgetbook.WidgetbookComponent( + name: 'StreamReactions', + useCases: [ + _widgetbook.WidgetbookUseCase( + name: 'Playground', + builder: + _design_system_gallery_components_reaction_stream_reaction + .buildStreamReactionsPlayground, + ), + _widgetbook.WidgetbookUseCase( + name: 'Showcase', + builder: + _design_system_gallery_components_reaction_stream_reaction + .buildStreamReactionsShowcase, + ), + ], + ), + ], + ), + _widgetbook.WidgetbookFolder( + name: 'Tiles', + children: [ + _widgetbook.WidgetbookComponent( + name: 'StreamListTile', + useCases: [ + _widgetbook.WidgetbookUseCase( + name: 'Playground', + builder: + _design_system_gallery_components_tiles_stream_list_tile + .buildStreamListTilePlayground, + ), + _widgetbook.WidgetbookUseCase( + name: 'Showcase', + builder: + _design_system_gallery_components_tiles_stream_list_tile + .buildStreamListTileShowcase, + ), + ], + ), + ], + ), + ], + ), +]; diff --git a/apps/design_system_gallery/lib/app/gallery_shell.dart b/apps/design_system_gallery/lib/app/gallery_shell.dart new file mode 100644 index 0000000..9911658 --- /dev/null +++ b/apps/design_system_gallery/lib/app/gallery_shell.dart @@ -0,0 +1,136 @@ +import 'package:flutter/material.dart'; +import 'package:stream_core_flutter/stream_core_flutter.dart'; +import 'package:widgetbook/widgetbook.dart'; + +import '../core/preview_wrapper.dart'; +import '../widgets/theme_studio/theme_customization_panel.dart'; +import '../widgets/toolbar/toolbar.dart'; +import 'gallery_app.directories.g.dart'; +import 'home.dart'; + +/// Width of the theme customization panel. +const kThemePanelWidth = 340.0; + +/// Widgetbook's breakpoint for desktop mode. +const kWidgetbookDesktopBreakpoint = 840.0; + +/// Animation duration for panel transitions. +const kPanelAnimationDuration = Duration(milliseconds: 250); + +/// The main shell that wraps the widgetbook with custom Stream branding. +class GalleryShell extends StatelessWidget { + const GalleryShell({ + super.key, + required this.showThemePanel, + required this.onToggleThemePanel, + }); + + final bool showThemePanel; + final VoidCallback onToggleThemePanel; + + @override + Widget build(BuildContext context) { + final materialTheme = Theme.of(context); + final isDark = materialTheme.brightness == .dark; + final screenWidth = MediaQuery.sizeOf(context).width; + + // Use overlay on small screens, side-by-side on large screens + final widgetbookWidth = showThemePanel ? screenWidth - kThemePanelWidth : screenWidth; + final useOverlay = widgetbookWidth < kWidgetbookDesktopBreakpoint; + + final widgetbook = Widgetbook.material( + lightTheme: materialTheme, + darkTheme: materialTheme, + themeMode: isDark ? .dark : .light, + directories: _collapseDirectories(directories), + home: const GalleryHomePage(), + appBuilder: (context, child) => PreviewWrapper(child: child), + ); + + return Scaffold( + backgroundColor: context.streamColorScheme.backgroundApp, + body: Column( + children: [ + // Toolbar spans across the entire width + GalleryToolbar( + showThemePanel: showThemePanel, + onToggleThemePanel: onToggleThemePanel, + ), + // Content area below toolbar + Expanded( + child: Stack( + children: [ + // Widgetbook area + AnimatedPadding( + curve: Curves.easeInOut, + duration: kPanelAnimationDuration, + padding: .only(right: (!useOverlay && showThemePanel) ? kThemePanelWidth : 0), + child: widgetbook, + ), + // Theme customization panel + Align( + alignment: .centerRight, + child: AnimatedSlide( + duration: kPanelAnimationDuration, + curve: Curves.easeInOut, + offset: showThemePanel ? Offset.zero : const Offset(1, 0), + child: const SizedBox(width: kThemePanelWidth, child: ThemeCustomizationPanel()), + ), + ), + ], + ), + ), + ], + ), + ); + } +} + +// Transforms a list of [WidgetbookNode]s to have their children collapsed +// by default. +// +// This recursively processes all nodes and creates new instances with +// `isInitiallyExpanded: false` for nodes that have children. +List _collapseDirectories( + List nodes, +) => nodes.map(_collapseNode).toList(); + +WidgetbookNode _collapseNode( + WidgetbookNode node, +) { + if (node is WidgetbookCategory) { + // Keep the category expanded by default, but collapse its children + return WidgetbookCategory( + name: node.name, + children: node.children?.map(_collapseNode).toList(), + ); + } + + if (node is WidgetbookFolder) { + // Keep the folder and its children collapsed by default + return WidgetbookFolder( + name: node.name, + isInitiallyExpanded: false, + children: node.children?.map(_collapseNode).toList(), + ); + } + + if (node is WidgetbookComponent) { + // Keep the component and its use cases collapsed by default + return WidgetbookComponent( + name: node.name, + isInitiallyExpanded: false, + useCases: [ + ...node.useCases.map( + (useCase) => WidgetbookUseCase( + name: useCase.name, + builder: useCase.builder, + designLink: useCase.designLink, + ), + ), + ], + ); + } + + return node; +} diff --git a/apps/design_system_gallery/lib/app/home.dart b/apps/design_system_gallery/lib/app/home.dart new file mode 100644 index 0000000..16e0569 --- /dev/null +++ b/apps/design_system_gallery/lib/app/home.dart @@ -0,0 +1,191 @@ +import 'package:flutter/material.dart'; +import 'package:stream_core_flutter/stream_core_flutter.dart'; +import 'package:svg_icon_widget/svg_icon_widget.dart'; + +import '../core/stream_icons.dart'; + +/// The home page content for the gallery. +/// Displayed when no component is selected in the sidebar. +class GalleryHomePage extends StatelessWidget { + const GalleryHomePage({super.key}); + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final spacing = context.streamSpacing; + + return ColoredBox( + color: colorScheme.backgroundApp, + child: Center( + child: SingleChildScrollView( + padding: EdgeInsets.all(spacing.xl), + child: ConstrainedBox( + constraints: const BoxConstraints(maxWidth: 560), + child: Column( + mainAxisAlignment: MainAxisAlignment.center, + children: [ + // Logo + const _StreamLogo(), + SizedBox(height: spacing.xl), + + // Title + Text( + 'Stream Design System', + style: textTheme.headingLg.copyWith( + color: colorScheme.textPrimary, + fontWeight: FontWeight.w700, + letterSpacing: -0.5, + ), + textAlign: TextAlign.center, + ), + SizedBox(height: spacing.sm), + + // Subtitle + Text( + 'A comprehensive design system for building beautiful, ' + 'consistent chat and activity feed experiences.', + style: textTheme.bodyDefault.copyWith( + color: colorScheme.textSecondary, + height: 1.5, + ), + textAlign: TextAlign.center, + ), + SizedBox(height: spacing.xl), + + // Feature chips + const _FeatureChips(), + SizedBox(height: spacing.xl + spacing.lg), + + // Getting started hint + const _GettingStartedHint(), + ], + ), + ), + ), + ), + ); + } +} + +class _StreamLogo extends StatelessWidget { + const _StreamLogo(); + + @override + Widget build(BuildContext context) { + return const SvgIcon( + StreamSvgIcons.logo, + size: 80, + ); + } +} + +class _FeatureChips extends StatelessWidget { + const _FeatureChips(); + + @override + Widget build(BuildContext context) { + final spacing = context.streamSpacing; + + return Wrap( + spacing: spacing.sm, + runSpacing: spacing.sm, + alignment: WrapAlignment.center, + children: const [ + _FeatureChip(icon: Icons.palette_outlined, label: 'Themeable'), + _FeatureChip(icon: Icons.dark_mode_outlined, label: 'Dark Mode'), + _FeatureChip(icon: Icons.devices_outlined, label: 'Responsive'), + _FeatureChip(icon: Icons.accessibility_new_outlined, label: 'Accessible'), + ], + ); + } +} + +class _FeatureChip extends StatelessWidget { + const _FeatureChip({ + required this.icon, + required this.label, + }); + + final IconData icon; + final String label; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Container( + padding: EdgeInsets.symmetric( + horizontal: spacing.sm, + vertical: spacing.xs, + ), + decoration: BoxDecoration( + color: colorScheme.backgroundSurfaceSubtle, + borderRadius: BorderRadius.all(radius.md), + border: Border.all(color: colorScheme.borderDefault), + ), + child: Row( + mainAxisSize: MainAxisSize.min, + children: [ + Icon( + icon, + size: 16, + color: colorScheme.textSecondary, + ), + SizedBox(width: spacing.xs), + Text( + label, + style: textTheme.captionDefault.copyWith( + color: colorScheme.textSecondary, + ), + ), + ], + ), + ); + } +} + +class _GettingStartedHint extends StatelessWidget { + const _GettingStartedHint(); + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Container( + padding: EdgeInsets.all(spacing.md), + decoration: BoxDecoration( + color: colorScheme.accentPrimary.withValues(alpha: 0.08), + borderRadius: BorderRadius.all(radius.lg), + border: Border.all( + color: colorScheme.accentPrimary.withValues(alpha: 0.2), + ), + ), + child: Row( + mainAxisSize: MainAxisSize.min, + children: [ + Icon( + Icons.arrow_back, + size: 18, + color: colorScheme.accentPrimary, + ), + SizedBox(width: spacing.sm), + Flexible( + child: Text( + 'Select a component from the sidebar to get started', + style: textTheme.captionDefault.copyWith( + color: colorScheme.accentPrimary, + ), + ), + ), + ], + ), + ); + } +} diff --git a/apps/design_system_gallery/lib/components/accessories/stream_audio_waveform.dart b/apps/design_system_gallery/lib/components/accessories/stream_audio_waveform.dart new file mode 100644 index 0000000..f26db0d --- /dev/null +++ b/apps/design_system_gallery/lib/components/accessories/stream_audio_waveform.dart @@ -0,0 +1,452 @@ +import 'dart:math' as math; + +import 'package:flutter/material.dart'; +import 'package:stream_core_flutter/stream_core_flutter.dart'; +import 'package:widgetbook/widgetbook.dart'; +import 'package:widgetbook_annotation/widgetbook_annotation.dart' as widgetbook; + +// ============================================================================= +// Playground +// ============================================================================= + +@widgetbook.UseCase( + name: 'Playground', + type: StreamAudioWaveformSlider, + path: '[Components]/Accessories', +) +Widget buildStreamAudioWaveformSliderPlayground(BuildContext context) { + final isActive = context.knobs.boolean( + label: 'Is Active', + description: 'Whether the waveform is in the active (playing) state.', + ); + + final limit = context.knobs.double.slider( + label: 'Bar Limit', + min: 20, + max: 150, + initialValue: 100, + divisions: 13, + description: 'Maximum number of bars to display.', + ); + + final inverse = context.knobs.boolean( + label: 'Inverse', + initialValue: true, + description: 'If true, bars grow from right to left.', + ); + + return _SliderPlayground( + isActive: isActive, + limit: limit.toInt(), + inverse: inverse, + ); +} + +class _SliderPlayground extends StatefulWidget { + const _SliderPlayground({ + required this.isActive, + required this.limit, + required this.inverse, + }); + + final bool isActive; + final int limit; + final bool inverse; + + @override + State<_SliderPlayground> createState() => _SliderPlaygroundState(); +} + +class _SliderPlaygroundState extends State<_SliderPlayground> { + var _progress = 0.4; + + @override + Widget build(BuildContext context) { + final spacing = context.streamSpacing; + + return Center( + child: Padding( + padding: EdgeInsets.all(spacing.lg), + child: ConstrainedBox( + constraints: const BoxConstraints(maxWidth: 300), + child: SizedBox( + height: 40, + child: StreamAudioWaveformSlider( + waveform: _sampleWaveform, + progress: _progress, + isActive: widget.isActive, + limit: widget.limit, + inverse: widget.inverse, + onChanged: (value) => setState(() => _progress = value), + ), + ), + ), + ), + ); + } +} + +// ============================================================================= +// Showcase +// ============================================================================= + +@widgetbook.UseCase( + name: 'Showcase', + type: StreamAudioWaveformSlider, + path: '[Components]/Accessories', +) +Widget buildStreamAudioWaveformSliderShowcase(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final spacing = context.streamSpacing; + + return DefaultTextStyle( + style: textTheme.bodyDefault.copyWith(color: colorScheme.textPrimary), + child: SingleChildScrollView( + padding: EdgeInsets.all(spacing.lg), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + const _StatesSection(), + SizedBox(height: spacing.xl), + const _ProgressSection(), + SizedBox(height: spacing.xl), + const _WaveformOnlySection(), + ], + ), + ), + ); +} + +// ============================================================================= +// States Section +// ============================================================================= + +class _StatesSection extends StatelessWidget { + const _StatesSection(); + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final boxShadow = context.streamBoxShadow; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + const _SectionLabel(label: 'STATES'), + SizedBox(height: spacing.md), + Container( + width: double.infinity, + clipBehavior: Clip.antiAlias, + padding: EdgeInsets.all(spacing.md), + decoration: BoxDecoration( + color: colorScheme.backgroundSurface, + borderRadius: BorderRadius.all(radius.lg), + boxShadow: boxShadow.elevation1, + ), + foregroundDecoration: BoxDecoration( + borderRadius: BorderRadius.all(radius.lg), + border: Border.all(color: colorScheme.borderSubtle), + ), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + spacing: spacing.md, + children: [ + _StateDemo( + label: 'Idle', + description: 'Not playing, thumb uses idle color', + child: SizedBox( + height: 36, + child: StreamAudioWaveformSlider( + waveform: _sampleWaveform, + progress: 0.3, + onChanged: (_) {}, + ), + ), + ), + Divider(height: 1, color: colorScheme.borderSubtle), + _StateDemo( + label: 'Active', + description: 'Playing, thumb uses active color', + child: SizedBox( + height: 36, + child: StreamAudioWaveformSlider( + waveform: _sampleWaveform, + progress: 0.5, + isActive: true, + onChanged: (_) {}, + ), + ), + ), + Divider(height: 1, color: colorScheme.borderSubtle), + _StateDemo( + label: 'Empty waveform', + description: 'No waveform data, bars show at minimum height', + child: SizedBox( + height: 36, + child: StreamAudioWaveformSlider( + waveform: const [], + onChanged: (_) {}, + ), + ), + ), + ], + ), + ), + ], + ); + } +} + +class _StateDemo extends StatelessWidget { + const _StateDemo({ + required this.label, + required this.description, + required this.child, + }); + + final String label; + final String description; + final Widget child; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final spacing = context.streamSpacing; + + return Column( + crossAxisAlignment: CrossAxisAlignment.start, + spacing: spacing.sm, + children: [ + Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + Text( + label, + style: textTheme.captionEmphasis.copyWith( + color: colorScheme.textPrimary, + ), + ), + Text( + description, + style: textTheme.metadataDefault.copyWith( + color: colorScheme.textTertiary, + ), + ), + ], + ), + child, + ], + ); + } +} + +// ============================================================================= +// Progress Section +// ============================================================================= + +class _ProgressSection extends StatelessWidget { + const _ProgressSection(); + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final boxShadow = context.streamBoxShadow; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + const _SectionLabel(label: 'PROGRESS SCALE'), + SizedBox(height: spacing.md), + Container( + width: double.infinity, + clipBehavior: Clip.antiAlias, + padding: EdgeInsets.all(spacing.md), + decoration: BoxDecoration( + color: colorScheme.backgroundSurface, + borderRadius: BorderRadius.all(radius.lg), + boxShadow: boxShadow.elevation1, + ), + foregroundDecoration: BoxDecoration( + borderRadius: BorderRadius.all(radius.lg), + border: Border.all(color: colorScheme.borderSubtle), + ), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + Text( + 'Progress fills bars from the leading edge', + style: textTheme.captionDefault.copyWith( + color: colorScheme.textSecondary, + ), + ), + SizedBox(height: spacing.md), + for (final percent in [0, 25, 50, 75, 100]) ...[ + _ProgressDemo(percentage: percent), + if (percent < 100) SizedBox(height: spacing.sm), + ], + ], + ), + ), + ], + ); + } +} + +class _ProgressDemo extends StatelessWidget { + const _ProgressDemo({required this.percentage}); + + final int percentage; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final spacing = context.streamSpacing; + + return Row( + children: [ + SizedBox( + width: 40, + child: Text( + '$percentage%', + style: textTheme.metadataEmphasis.copyWith( + color: colorScheme.accentPrimary, + fontFamily: 'monospace', + ), + ), + ), + SizedBox(width: spacing.sm), + Expanded( + child: SizedBox( + height: 32, + child: StreamAudioWaveformSlider( + waveform: _sampleWaveform, + progress: percentage / 100, + isActive: percentage > 0 && percentage < 100, + onChanged: (_) {}, + ), + ), + ), + ], + ); + } +} + +// ============================================================================= +// Waveform Only Section +// ============================================================================= + +class _WaveformOnlySection extends StatelessWidget { + const _WaveformOnlySection(); + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final boxShadow = context.streamBoxShadow; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + const _SectionLabel(label: 'WAVEFORM ONLY'), + SizedBox(height: spacing.md), + Container( + width: double.infinity, + clipBehavior: Clip.antiAlias, + padding: EdgeInsets.all(spacing.md), + decoration: BoxDecoration( + color: colorScheme.backgroundSurface, + borderRadius: BorderRadius.all(radius.lg), + boxShadow: boxShadow.elevation1, + ), + foregroundDecoration: BoxDecoration( + borderRadius: BorderRadius.all(radius.lg), + border: Border.all(color: colorScheme.borderSubtle), + ), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + spacing: spacing.md, + children: [ + Text( + 'StreamAudioWaveform without the slider thumb', + style: textTheme.captionDefault.copyWith( + color: colorScheme.textSecondary, + ), + ), + SizedBox( + height: 32, + width: double.infinity, + child: StreamAudioWaveform( + waveform: _sampleWaveform, + progress: 0.6, + ), + ), + SizedBox( + height: 32, + width: double.infinity, + child: StreamAudioWaveform( + waveform: _sampleWaveform, + ), + ), + ], + ), + ), + ], + ); + } +} + +// ============================================================================= +// Shared Widgets +// ============================================================================= + +class _SectionLabel extends StatelessWidget { + const _SectionLabel({required this.label}); + + final String label; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Container( + padding: EdgeInsets.symmetric( + horizontal: spacing.sm, + vertical: spacing.xs, + ), + decoration: BoxDecoration( + color: colorScheme.accentPrimary, + borderRadius: BorderRadius.all(radius.xs), + ), + child: Text( + label, + style: textTheme.metadataEmphasis.copyWith( + color: colorScheme.textOnAccent, + letterSpacing: 1, + fontSize: 9, + ), + ), + ); + } +} + +// ============================================================================= +// Sample Data +// ============================================================================= + +final List _sampleWaveform = List.generate( + 120, + (i) => (math.sin(i * 0.15) * 0.3 + 0.5 + math.sin(i * 0.4) * 0.2).clamp(0.0, 1.0), +); diff --git a/apps/design_system_gallery/lib/components/accessories/stream_emoji.dart b/apps/design_system_gallery/lib/components/accessories/stream_emoji.dart new file mode 100644 index 0000000..806717e --- /dev/null +++ b/apps/design_system_gallery/lib/components/accessories/stream_emoji.dart @@ -0,0 +1,386 @@ +import 'package:flutter/material.dart'; +import 'package:stream_core_flutter/stream_core_flutter.dart'; +import 'package:unicode_emojis/unicode_emojis.dart'; +import 'package:widgetbook/widgetbook.dart'; +import 'package:widgetbook_annotation/widgetbook_annotation.dart' as widgetbook; + +// ============================================================================= +// Playground +// ============================================================================= + +@widgetbook.UseCase( + name: 'Playground', + type: StreamEmoji, + path: '[Components]/Accessories', +) +Widget buildStreamEmojiPlayground(BuildContext context) { + final size = context.knobs.object.dropdown( + label: 'Size', + options: StreamEmojiSize.values, + initialOption: StreamEmojiSize.md, + labelBuilder: (option) => '${option.name.toUpperCase()} (${option.value.toInt()}px)', + description: 'Emoji size preset.', + ); + + final emoji = context.knobs.object.dropdown( + label: 'Emoji', + options: _sampleEmojis, + initialOption: _sampleEmojis.first, + labelBuilder: (option) => '${option.emoji} ${option.name}', + description: 'The emoji to display.', + ); + + final showBounds = context.knobs.boolean( + label: 'Show Bounds', + description: 'Show a border around the emoji bounding box.', + ); + + final emojiWidget = StreamEmoji( + size: size, + emoji: Text(emoji.emoji), + ); + + return Center( + child: switch (showBounds) { + true => DecoratedBox( + decoration: BoxDecoration( + borderRadius: BorderRadius.all(context.streamRadius.xs), + border: Border.all(color: context.streamColorScheme.borderDefault), + ), + child: emojiWidget, + ), + false => emojiWidget, + }, + ); +} + +// ============================================================================= +// Showcase +// ============================================================================= + +@widgetbook.UseCase( + name: 'Showcase', + type: StreamEmoji, + path: '[Components]/Accessories', +) +Widget buildStreamEmojiShowcase(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final spacing = context.streamSpacing; + + return DefaultTextStyle( + style: textTheme.bodyDefault.copyWith(color: colorScheme.textPrimary), + child: SingleChildScrollView( + padding: EdgeInsets.all(spacing.lg), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + const _SizeVariantsSection(), + SizedBox(height: spacing.xl), + const _EmojiSamplerSection(), + SizedBox(height: spacing.xl), + const _IconUsageSection(), + ], + ), + ), + ); +} + +// ============================================================================= +// Size Variants Section +// ============================================================================= + +class _SizeVariantsSection extends StatelessWidget { + const _SizeVariantsSection(); + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final boxShadow = context.streamBoxShadow; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + const _SectionLabel(label: 'SIZE VARIANTS'), + SizedBox(height: spacing.md), + Container( + width: double.infinity, + clipBehavior: Clip.antiAlias, + padding: EdgeInsets.all(spacing.md), + decoration: BoxDecoration( + color: colorScheme.backgroundSurface, + borderRadius: BorderRadius.all(radius.lg), + boxShadow: boxShadow.elevation1, + ), + foregroundDecoration: BoxDecoration( + borderRadius: BorderRadius.all(radius.lg), + border: Border.all(color: colorScheme.borderSubtle), + ), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + Text( + 'Emoji scales across predefined sizes', + style: textTheme.captionDefault.copyWith( + color: colorScheme.textSecondary, + ), + ), + SizedBox(height: spacing.md), + Wrap( + spacing: spacing.xl, + runSpacing: spacing.xl, + children: [ + for (final size in StreamEmojiSize.values) _SizeDemo(size: size), + ], + ), + ], + ), + ), + ], + ); + } +} + +class _SizeDemo extends StatelessWidget { + const _SizeDemo({required this.size}); + + final StreamEmojiSize size; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final spacing = context.streamSpacing; + + return Column( + children: [ + SizedBox( + width: 64, + height: 64, + child: Center( + child: StreamEmoji( + size: size, + emoji: const Text('🔥'), + ), + ), + ), + SizedBox(height: spacing.sm), + Text( + size.name.toUpperCase(), + style: textTheme.metadataEmphasis.copyWith( + color: colorScheme.accentPrimary, + fontFamily: 'monospace', + ), + ), + Text( + '${size.value.toInt()}px', + style: textTheme.metadataDefault.copyWith( + color: colorScheme.textTertiary, + fontFamily: 'monospace', + fontSize: 10, + ), + ), + ], + ); + } +} + +// ============================================================================= +// Emoji Sampler Section +// ============================================================================= + +class _EmojiSamplerSection extends StatelessWidget { + const _EmojiSamplerSection(); + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final boxShadow = context.streamBoxShadow; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + const _SectionLabel(label: 'EMOJI SAMPLER'), + SizedBox(height: spacing.md), + Container( + width: double.infinity, + clipBehavior: Clip.antiAlias, + padding: EdgeInsets.all(spacing.md), + decoration: BoxDecoration( + color: colorScheme.backgroundSurface, + borderRadius: BorderRadius.all(radius.lg), + boxShadow: boxShadow.elevation1, + ), + foregroundDecoration: BoxDecoration( + borderRadius: BorderRadius.all(radius.lg), + border: Border.all(color: colorScheme.borderSubtle), + ), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + Text( + 'Various emojis rendered at consistent sizing', + style: textTheme.captionDefault.copyWith( + color: colorScheme.textSecondary, + ), + ), + SizedBox(height: spacing.md), + Wrap( + spacing: spacing.sm, + runSpacing: spacing.sm, + children: [ + for (final emoji in _sampleEmojis) + StreamEmoji( + size: StreamEmojiSize.lg, + emoji: Text(emoji.emoji), + ), + ], + ), + ], + ), + ), + ], + ); + } +} + +// ============================================================================= +// Icon Usage Section +// ============================================================================= + +class _IconUsageSection extends StatelessWidget { + const _IconUsageSection(); + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final boxShadow = context.streamBoxShadow; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + const _SectionLabel(label: 'WITH ICONS'), + SizedBox(height: spacing.md), + Container( + width: double.infinity, + clipBehavior: Clip.antiAlias, + padding: EdgeInsets.all(spacing.md), + decoration: BoxDecoration( + color: colorScheme.backgroundSurface, + borderRadius: BorderRadius.all(radius.lg), + boxShadow: boxShadow.elevation1, + ), + foregroundDecoration: BoxDecoration( + borderRadius: BorderRadius.all(radius.lg), + border: Border.all(color: colorScheme.borderSubtle), + ), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + Text( + 'StreamEmoji can display any widget, not just emoji', + style: textTheme.captionDefault.copyWith( + color: colorScheme.textSecondary, + ), + ), + SizedBox(height: spacing.md), + Wrap( + spacing: spacing.sm, + runSpacing: spacing.sm, + children: [ + for (final iconData in _sampleIcons) + StreamEmoji( + size: StreamEmojiSize.lg, + emoji: Icon(iconData, color: colorScheme.textPrimary), + ), + ], + ), + ], + ), + ), + ], + ); + } +} + +// ============================================================================= +// Shared Widgets +// ============================================================================= + +class _SectionLabel extends StatelessWidget { + const _SectionLabel({required this.label}); + + final String label; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Container( + padding: EdgeInsets.symmetric( + horizontal: spacing.sm, + vertical: spacing.xs, + ), + decoration: BoxDecoration( + color: colorScheme.accentPrimary, + borderRadius: BorderRadius.all(radius.xs), + ), + child: Text( + label, + style: textTheme.metadataEmphasis.copyWith( + color: colorScheme.textOnAccent, + letterSpacing: 1, + fontSize: 9, + ), + ), + ); + } +} + +// ============================================================================= +// Helpers +// ============================================================================= + +Emoji _byName(String name) => UnicodeEmojis.allEmojis.firstWhere((e) => e.name == name); + +final _sampleEmojis = [ + _byName('thumbs up sign'), + _byName('heavy black heart'), + _byName('face with tears of joy'), + _byName('fire'), + _byName('clapping hands sign'), + _byName('thinking face'), + _byName('eyes'), + _byName('rocket'), + _byName('party popper'), + _byName('waving hand sign'), + _byName('white medium star'), + _byName('white heavy check mark'), +]; + +const _sampleIcons = [ + Icons.thumb_up, + Icons.favorite, + Icons.sentiment_very_satisfied, + Icons.local_fire_department, + Icons.celebration, + Icons.lightbulb, + Icons.visibility, + Icons.rocket_launch, + Icons.star, + Icons.check_circle, + Icons.emoji_emotions, + Icons.cake, +]; diff --git a/apps/design_system_gallery/lib/components/accessories/stream_file_type_icons.dart b/apps/design_system_gallery/lib/components/accessories/stream_file_type_icons.dart new file mode 100644 index 0000000..6fee487 --- /dev/null +++ b/apps/design_system_gallery/lib/components/accessories/stream_file_type_icons.dart @@ -0,0 +1,801 @@ +import 'package:flutter/material.dart'; +import 'package:stream_core_flutter/stream_core_flutter.dart'; +import 'package:widgetbook/widgetbook.dart'; +import 'package:widgetbook_annotation/widgetbook_annotation.dart' as widgetbook; + +/// Returns a typical file extension for the given file type. +String _getExtension(StreamFileType fileType) { + return switch (fileType) { + StreamFileType.pdf => 'pdf', + StreamFileType.text => 'doc', + StreamFileType.presentation => 'ppt', + StreamFileType.spreadsheet => 'xls', + StreamFileType.code => 'dart', + StreamFileType.video => 'mp4', + StreamFileType.audio => 'mp3', + StreamFileType.compression => 'zip', + StreamFileType.other => 'wkq', + }; +} + +// ============================================================================= +// Playground +// ============================================================================= + +@widgetbook.UseCase( + name: 'Playground', + type: StreamFileTypeIcon, + path: '[Components]/Accessories', +) +Widget buildFileTypeIconPlayground(BuildContext context) { + final fileType = context.knobs.object.dropdown( + label: 'File Type', + options: StreamFileType.values, + initialOption: StreamFileType.pdf, + labelBuilder: (option) => option.name, + description: 'The file type determines which icon is shown.', + ); + + final size = context.knobs.object.dropdown( + label: 'Size', + options: StreamFileTypeIconSize.values, + initialOption: StreamFileTypeIconSize.s40, + labelBuilder: (option) => option.name, + description: 'Icon size preset.', + ); + + final extension = context.knobs.string( + label: 'Extension', + initialValue: 'pdf', + description: 'File extension text displayed on the icon (e.g., pdf, doc, mp4).', + ); + + return Center( + child: StreamFileTypeIcon( + type: fileType, + size: size, + extension: extension.isNotEmpty ? extension : null, + ), + ); +} + +// ============================================================================= +// Showcase +// ============================================================================= + +@widgetbook.UseCase( + name: 'Showcase', + type: StreamFileTypeIcon, + path: '[Components]/Accessories', +) +Widget buildFileTypeIconShowcase(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final spacing = context.streamSpacing; + + return DefaultTextStyle( + style: textTheme.bodyDefault.copyWith(color: colorScheme.textPrimary), + child: SingleChildScrollView( + padding: EdgeInsets.all(spacing.lg), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + // File type variants + const _FileTypeVariantsSection(), + SizedBox(height: spacing.xl), + + // Size variants + const _SizeVariantsSection(), + SizedBox(height: spacing.xl), + + // Quick reference + const _QuickReferenceSection(), + SizedBox(height: spacing.xl), + + // Usage patterns + const _UsagePatternsSection(), + ], + ), + ), + ); +} + +// ============================================================================= +// File Type Variants Section +// ============================================================================= + +class _FileTypeVariantsSection extends StatelessWidget { + const _FileTypeVariantsSection(); + + @override + Widget build(BuildContext context) { + final spacing = context.streamSpacing; + + return Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + const _SectionLabel(label: 'FILE TYPES'), + SizedBox(height: spacing.md), + ...StreamFileType.values.map((fileType) => _FileTypeCard(fileType: fileType)), + ], + ); + } +} + +class _FileTypeCard extends StatelessWidget { + const _FileTypeCard({required this.fileType}); + + final StreamFileType fileType; + + String _getDescription(StreamFileType fileType) { + return switch (fileType) { + StreamFileType.pdf => 'PDF documents (.pdf)', + StreamFileType.text => 'Text documents (.doc, .docx, .txt, .rtf)', + StreamFileType.presentation => 'Presentations (.ppt, .pptx, .key)', + StreamFileType.spreadsheet => 'Spreadsheets (.xls, .xlsx, .csv)', + StreamFileType.code => 'Code files (.js, .py, .dart, .html)', + StreamFileType.video => 'Video files (.mp4, .mov, .avi)', + StreamFileType.audio => 'Audio files (.mp3, .wav, .aac)', + StreamFileType.compression => 'Archives (.zip, .rar, .7z, .tar)', + StreamFileType.other => 'Other file types', + }; + } + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final boxShadow = context.streamBoxShadow; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Padding( + padding: EdgeInsets.only(bottom: spacing.sm), + child: Container( + clipBehavior: Clip.antiAlias, + padding: EdgeInsets.all(spacing.md), + decoration: BoxDecoration( + color: colorScheme.backgroundSurface, + borderRadius: BorderRadius.all(radius.lg), + boxShadow: boxShadow.elevation1, + ), + foregroundDecoration: BoxDecoration( + borderRadius: BorderRadius.all(radius.lg), + border: Border.all(color: colorScheme.borderSubtle), + ), + child: Row( + children: [ + // Icon preview + SizedBox( + width: 80, + height: 80, + child: Center( + child: StreamFileTypeIcon( + type: fileType, + size: StreamFileTypeIconSize.s48, + extension: _getExtension(fileType), + ), + ), + ), + SizedBox(width: spacing.md + spacing.xs), + // Info + Expanded( + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + Text( + 'StreamFileType.${fileType.name}', + style: textTheme.captionEmphasis.copyWith( + color: colorScheme.accentPrimary, + fontFamily: 'monospace', + ), + ), + SizedBox(height: spacing.xs + spacing.xxs), + Text( + _getDescription(fileType), + style: textTheme.captionDefault.copyWith( + color: colorScheme.textTertiary, + ), + ), + ], + ), + ), + ], + ), + ), + ); + } +} + +// ============================================================================= +// Size Variants Section +// ============================================================================= + +class _SizeVariantsSection extends StatelessWidget { + const _SizeVariantsSection(); + + @override + Widget build(BuildContext context) { + final spacing = context.streamSpacing; + + return Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + const _SectionLabel(label: 'SIZE SCALE'), + SizedBox(height: spacing.md), + ...StreamFileTypeIconSize.values.map((size) => _SizeCard(size: size)), + ], + ); + } +} + +class _SizeCard extends StatelessWidget { + const _SizeCard({required this.size}); + + final StreamFileTypeIconSize size; + + String _getDimensions(StreamFileTypeIconSize size) { + return switch (size) { + StreamFileTypeIconSize.s48 => '40×48', + StreamFileTypeIconSize.s40 => '32×40', + }; + } + + String _getUsage(StreamFileTypeIconSize size) { + return switch (size) { + StreamFileTypeIconSize.s48 => 'File previews, galleries, detail views', + StreamFileTypeIconSize.s40 => 'List items, compact views, messages', + }; + } + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final boxShadow = context.streamBoxShadow; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Padding( + padding: EdgeInsets.only(bottom: spacing.sm), + child: Container( + clipBehavior: Clip.antiAlias, + padding: EdgeInsets.all(spacing.md), + decoration: BoxDecoration( + color: colorScheme.backgroundSurface, + borderRadius: BorderRadius.all(radius.lg), + boxShadow: boxShadow.elevation1, + ), + foregroundDecoration: BoxDecoration( + borderRadius: BorderRadius.all(radius.lg), + border: Border.all(color: colorScheme.borderSubtle), + ), + child: Row( + children: [ + // Icon preview + SizedBox( + width: 80, + height: 80, + child: Center( + child: StreamFileTypeIcon( + type: StreamFileType.pdf, + size: size, + extension: 'pdf', + ), + ), + ), + SizedBox(width: spacing.md + spacing.xs), + // Info + Expanded( + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + Row( + children: [ + Text( + 'StreamFileTypeIconSize.${size.name}', + style: textTheme.captionEmphasis.copyWith( + color: colorScheme.accentPrimary, + fontFamily: 'monospace', + ), + ), + SizedBox(width: spacing.sm), + Container( + padding: EdgeInsets.symmetric( + horizontal: spacing.xs + spacing.xxs, + vertical: spacing.xxs, + ), + decoration: BoxDecoration( + color: colorScheme.backgroundSurfaceSubtle, + borderRadius: BorderRadius.all(radius.xs), + ), + child: Text( + _getDimensions(size), + style: textTheme.metadataEmphasis.copyWith( + color: colorScheme.textSecondary, + fontFamily: 'monospace', + fontSize: 10, + ), + ), + ), + ], + ), + SizedBox(height: spacing.xs + spacing.xxs), + Text( + _getUsage(size), + style: textTheme.captionDefault.copyWith( + color: colorScheme.textTertiary, + ), + ), + ], + ), + ), + ], + ), + ), + ); + } +} + +// ============================================================================= +// Quick Reference Section +// ============================================================================= + +class _QuickReferenceSection extends StatelessWidget { + const _QuickReferenceSection(); + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final boxShadow = context.streamBoxShadow; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + const _SectionLabel(label: 'QUICK REFERENCE'), + SizedBox(height: spacing.md), + Container( + width: double.infinity, + clipBehavior: Clip.antiAlias, + padding: EdgeInsets.all(spacing.md), + decoration: BoxDecoration( + color: colorScheme.backgroundSurface, + borderRadius: BorderRadius.all(radius.lg), + boxShadow: boxShadow.elevation1, + ), + foregroundDecoration: BoxDecoration( + borderRadius: BorderRadius.all(radius.lg), + border: Border.all(color: colorScheme.borderSubtle), + ), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + Text( + 'Creating from MIME type', + style: textTheme.captionEmphasis.copyWith( + color: colorScheme.textPrimary, + ), + ), + SizedBox(height: spacing.xs), + Text( + 'Use the factory constructor to automatically resolve icon and extension:', + style: textTheme.captionDefault.copyWith( + color: colorScheme.textSecondary, + ), + ), + SizedBox(height: spacing.md), + // MIME type examples + Wrap( + spacing: spacing.sm, + runSpacing: spacing.sm, + children: const [ + _MimeTypeExample(mimeType: 'application/pdf'), + _MimeTypeExample(mimeType: 'audio/mpeg'), + _MimeTypeExample(mimeType: 'video/mp4'), + _MimeTypeExample(mimeType: 'application/zip'), + ], + ), + SizedBox(height: spacing.md), + Divider(color: colorScheme.borderSubtle), + SizedBox(height: spacing.sm), + Row( + children: [ + Icon( + Icons.lightbulb_outline, + size: 14, + color: colorScheme.textTertiary, + ), + SizedBox(width: spacing.xs + spacing.xxs), + Expanded( + child: Text( + 'StreamFileTypeIcon.fromMimeType(mimeType: "...")', + style: textTheme.metadataDefault.copyWith( + color: colorScheme.accentPrimary, + fontFamily: 'monospace', + ), + ), + ), + ], + ), + ], + ), + ), + ], + ); + } +} + +class _MimeTypeExample extends StatelessWidget { + const _MimeTypeExample({required this.mimeType}); + + final String mimeType; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Container( + padding: EdgeInsets.symmetric( + horizontal: spacing.sm, + vertical: spacing.xs, + ), + decoration: BoxDecoration( + color: colorScheme.backgroundSurfaceSubtle, + borderRadius: BorderRadius.all(radius.sm), + border: Border.all(color: colorScheme.borderSubtle), + ), + child: Row( + mainAxisSize: MainAxisSize.min, + children: [ + StreamFileTypeIcon.fromMimeType(mimeType: mimeType), + SizedBox(width: spacing.sm), + Text( + mimeType, + style: textTheme.metadataDefault.copyWith( + color: colorScheme.textPrimary, + fontFamily: 'monospace', + fontSize: 11, + ), + ), + ], + ), + ); + } +} + +// ============================================================================= +// Usage Patterns Section +// ============================================================================= + +class _UsagePatternsSection extends StatelessWidget { + const _UsagePatternsSection(); + + @override + Widget build(BuildContext context) { + final spacing = context.streamSpacing; + + return Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + const _SectionLabel(label: 'USAGE PATTERNS'), + SizedBox(height: spacing.md), + + // File attachment list example + _ExampleCard( + title: 'File Attachment List', + description: 'Display uploaded files with type indicators', + child: Column( + children: [ + for (var i = 0; i < 3; i++) ...[ + _FileListItem( + fileType: [StreamFileType.pdf, StreamFileType.spreadsheet, StreamFileType.compression][i], + fileName: ['Report_Q4_2024.pdf', 'Budget_2024.xlsx', 'project_assets.zip'][i], + fileSize: ['2.4 MB', '1.2 MB', '45.8 MB'][i], + ), + if (i < 2) SizedBox(height: spacing.sm), + ], + ], + ), + ), + SizedBox(height: spacing.sm), + + // File grid example + _ExampleCard( + title: 'File Grid', + description: 'Gallery view for file browsing', + child: Wrap( + spacing: spacing.md, + runSpacing: spacing.md, + children: [ + for (final fileType in [ + StreamFileType.pdf, + StreamFileType.video, + StreamFileType.audio, + StreamFileType.code, + ]) + _FileGridItem(fileType: fileType), + ], + ), + ), + SizedBox(height: spacing.sm), + + // Message attachment example + const _ExampleCard( + title: 'Message Attachment', + description: 'File shared in a chat conversation', + child: _MessageAttachmentExample(), + ), + ], + ); + } +} + +class _MessageAttachmentExample extends StatelessWidget { + const _MessageAttachmentExample(); + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Container( + padding: EdgeInsets.all(spacing.sm), + decoration: BoxDecoration( + color: colorScheme.backgroundSurfaceSubtle, + borderRadius: BorderRadius.all(radius.md), + border: Border.all(color: colorScheme.borderSubtle), + ), + child: Row( + children: [ + StreamFileTypeIcon( + type: StreamFileType.presentation, + size: StreamFileTypeIconSize.s48, + extension: 'pptx', + ), + SizedBox(width: spacing.sm), + Expanded( + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + mainAxisSize: MainAxisSize.min, + children: [ + Text( + 'Q4_Presentation_Final.pptx', + style: textTheme.captionEmphasis.copyWith( + color: colorScheme.textPrimary, + ), + overflow: TextOverflow.ellipsis, + ), + SizedBox(height: spacing.xxs), + Text( + '4.8 MB • Tap to download', + style: textTheme.metadataDefault.copyWith( + color: colorScheme.textTertiary, + ), + ), + ], + ), + ), + SizedBox(width: spacing.sm), + Icon( + Icons.download_outlined, + size: 20, + color: colorScheme.accentPrimary, + ), + ], + ), + ); + } +} + +class _FileListItem extends StatelessWidget { + const _FileListItem({ + required this.fileType, + required this.fileName, + required this.fileSize, + }); + + final StreamFileType fileType; + final String fileName; + final String fileSize; + + String? _extractExtension(String fileName) { + final parts = fileName.split('.'); + if (parts.length > 1) { + return parts.last.toLowerCase(); + } + return null; + } + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final spacing = context.streamSpacing; + + return Row( + children: [ + StreamFileTypeIcon( + type: fileType, + extension: _extractExtension(fileName), + ), + SizedBox(width: spacing.sm), + Expanded( + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + mainAxisSize: MainAxisSize.min, + children: [ + Text( + fileName, + style: textTheme.captionEmphasis.copyWith( + color: colorScheme.textPrimary, + ), + overflow: TextOverflow.ellipsis, + ), + Text( + fileSize, + style: textTheme.metadataDefault.copyWith( + color: colorScheme.textTertiary, + ), + ), + ], + ), + ), + ], + ); + } +} + +class _FileGridItem extends StatelessWidget { + const _FileGridItem({required this.fileType}); + + final StreamFileType fileType; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Container( + width: 72, + padding: EdgeInsets.all(spacing.sm), + decoration: BoxDecoration( + color: colorScheme.backgroundSurfaceSubtle, + borderRadius: BorderRadius.all(radius.md), + ), + child: Column( + mainAxisSize: MainAxisSize.min, + children: [ + StreamFileTypeIcon( + type: fileType, + size: StreamFileTypeIconSize.s48, + extension: _getExtension(fileType), + ), + SizedBox(height: spacing.xs), + Text( + fileType.name, + style: textTheme.metadataDefault.copyWith( + color: colorScheme.textSecondary, + fontSize: 10, + ), + overflow: TextOverflow.ellipsis, + ), + ], + ), + ); + } +} + +class _ExampleCard extends StatelessWidget { + const _ExampleCard({ + required this.title, + required this.description, + required this.child, + }); + + final String title; + final String description; + final Widget child; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final boxShadow = context.streamBoxShadow; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Container( + width: double.infinity, + clipBehavior: Clip.antiAlias, + decoration: BoxDecoration( + color: colorScheme.backgroundSurfaceSubtle, + borderRadius: BorderRadius.all(radius.lg), + boxShadow: boxShadow.elevation1, + ), + foregroundDecoration: BoxDecoration( + borderRadius: BorderRadius.all(radius.lg), + border: Border.all(color: colorScheme.borderSubtle), + ), + child: Column( + crossAxisAlignment: CrossAxisAlignment.stretch, + children: [ + // Header + Padding( + padding: EdgeInsets.fromLTRB(spacing.md, spacing.sm, spacing.md, spacing.sm), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + Text( + title, + style: textTheme.captionEmphasis.copyWith( + color: colorScheme.textPrimary, + ), + ), + Text( + description, + style: textTheme.metadataDefault.copyWith( + color: colorScheme.textTertiary, + ), + ), + ], + ), + ), + Divider( + height: 1, + color: colorScheme.borderSubtle, + ), + // Content + Container( + padding: EdgeInsets.all(spacing.md), + color: colorScheme.backgroundSurface, + child: child, + ), + ], + ), + ); + } +} + +// ============================================================================= +// Shared Widgets +// ============================================================================= + +class _SectionLabel extends StatelessWidget { + const _SectionLabel({required this.label}); + + final String label; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Container( + padding: EdgeInsets.symmetric(horizontal: spacing.sm, vertical: spacing.xs), + decoration: BoxDecoration( + color: colorScheme.accentPrimary, + borderRadius: BorderRadius.all(radius.xs), + ), + child: Text( + label, + style: textTheme.metadataEmphasis.copyWith( + color: colorScheme.textOnAccent, + letterSpacing: 1, + fontSize: 9, + ), + ), + ); + } +} diff --git a/apps/design_system_gallery/lib/components/avatar/stream_avatar.dart b/apps/design_system_gallery/lib/components/avatar/stream_avatar.dart new file mode 100644 index 0000000..84aad6d --- /dev/null +++ b/apps/design_system_gallery/lib/components/avatar/stream_avatar.dart @@ -0,0 +1,568 @@ +import 'package:flutter/material.dart'; +import 'package:stream_core_flutter/stream_core_flutter.dart'; +import 'package:widgetbook/widgetbook.dart'; +import 'package:widgetbook_annotation/widgetbook_annotation.dart' as widgetbook; + +const _sampleImageUrl = 'https://images.unsplash.com/photo-1494790108377-be9c29b29330?w=200'; + +// ============================================================================= +// Playground +// ============================================================================= + +@widgetbook.UseCase( + name: 'Playground', + type: StreamAvatar, + path: '[Components]/Avatar', +) +Widget buildStreamAvatarPlayground(BuildContext context) { + final imageUrl = context.knobs.stringOrNull( + label: 'Image URL', + initialValue: _sampleImageUrl, + description: 'URL for the avatar image. Leave empty to show placeholder.', + ); + + final size = context.knobs.object.dropdown( + label: 'Size', + options: StreamAvatarSize.values, + initialOption: StreamAvatarSize.lg, + labelBuilder: (option) => '${option.name.toUpperCase()} (${option.value.toInt()}px)', + description: 'Avatar diameter size preset.', + ); + + final showBorder = context.knobs.boolean( + label: 'Show Border', + initialValue: true, + description: 'Whether to show a border around the avatar.', + ); + + final initials = context.knobs.string( + label: 'Initials', + initialValue: 'JD', + description: 'Text shown when no image is available (max 2 chars).', + ); + + return Center( + child: StreamAvatar( + imageUrl: (imageUrl?.isNotEmpty ?? false) ? imageUrl : null, + size: size, + showBorder: showBorder, + placeholder: (context) => Text( + initials.substring(0, initials.length.clamp(0, 2)).toUpperCase(), + ), + ), + ); +} + +// ============================================================================= +// Showcase +// ============================================================================= + +@widgetbook.UseCase( + name: 'Showcase', + type: StreamAvatar, + path: '[Components]/Avatar', +) +Widget buildStreamAvatarShowcase(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final spacing = context.streamSpacing; + + return DefaultTextStyle( + style: textTheme.bodyDefault.copyWith(color: colorScheme.textPrimary), + child: SingleChildScrollView( + padding: EdgeInsets.all(spacing.lg), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + // Size variants + const _SizeVariantsSection(), + SizedBox(height: spacing.xl), + + // Color palette + const _PaletteSection(), + SizedBox(height: spacing.xl), + + // Usage patterns + const _UsagePatternsSection(), + ], + ), + ), + ); +} + +// ============================================================================= +// Size Variants Section +// ============================================================================= + +class _SizeVariantsSection extends StatelessWidget { + const _SizeVariantsSection(); + + @override + Widget build(BuildContext context) { + final spacing = context.streamSpacing; + + return Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + const _SectionLabel(label: 'SIZE SCALE'), + SizedBox(height: spacing.md), + ...StreamAvatarSize.values.map((size) => _SizeCard(size: size)), + ], + ); + } +} + +class _SizeCard extends StatelessWidget { + const _SizeCard({required this.size}); + + final StreamAvatarSize size; + + String _getUsage(StreamAvatarSize size) { + return switch (size) { + StreamAvatarSize.xs => 'Compact lists, inline mentions', + StreamAvatarSize.sm => 'Chat list items, notifications', + StreamAvatarSize.md => 'Message bubbles, comments', + StreamAvatarSize.lg => 'Profile headers, user cards', + StreamAvatarSize.xl => 'Channel list items, conversation lists', + StreamAvatarSize.xxl => 'Hero sections, large profile displays', + }; + } + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final boxShadow = context.streamBoxShadow; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Padding( + padding: EdgeInsets.only(bottom: spacing.sm), + child: Container( + clipBehavior: Clip.antiAlias, + padding: EdgeInsets.all(spacing.md), + decoration: BoxDecoration( + color: colorScheme.backgroundSurface, + borderRadius: BorderRadius.all(radius.lg), + boxShadow: boxShadow.elevation1, + ), + foregroundDecoration: BoxDecoration( + borderRadius: BorderRadius.all(radius.lg), + border: Border.all(color: colorScheme.borderSubtle), + ), + child: Row( + children: [ + // Avatar preview + SizedBox( + width: 80, + height: 80, + child: Center( + child: StreamAvatar( + imageUrl: _sampleImageUrl, + size: size, + placeholder: (context) => const Text('AB'), + ), + ), + ), + SizedBox(width: spacing.md + spacing.xs), + // Info + Expanded( + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + Row( + children: [ + Text( + 'StreamAvatarSize.${size.name}', + style: textTheme.captionEmphasis.copyWith( + color: colorScheme.accentPrimary, + fontFamily: 'monospace', + ), + ), + SizedBox(width: spacing.sm), + Container( + padding: EdgeInsets.symmetric( + horizontal: spacing.xs + spacing.xxs, + vertical: spacing.xxs, + ), + decoration: BoxDecoration( + color: colorScheme.backgroundSurfaceSubtle, + borderRadius: BorderRadius.all(radius.xs), + ), + child: Text( + '${size.value.toInt()}px', + style: textTheme.metadataEmphasis.copyWith( + color: colorScheme.textSecondary, + fontFamily: 'monospace', + fontSize: 10, + ), + ), + ), + ], + ), + SizedBox(height: spacing.xs + spacing.xxs), + Text( + _getUsage(size), + style: textTheme.captionDefault.copyWith( + color: colorScheme.textTertiary, + ), + ), + ], + ), + ), + ], + ), + ), + ); + } +} + +// ============================================================================= +// Palette Section +// ============================================================================= + +class _PaletteSection extends StatelessWidget { + const _PaletteSection(); + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final boxShadow = context.streamBoxShadow; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + final palette = colorScheme.avatarPalette; + + return Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + const _SectionLabel(label: 'COLOR PALETTE'), + SizedBox(height: spacing.md), + Container( + width: double.infinity, + clipBehavior: Clip.antiAlias, + padding: EdgeInsets.all(spacing.md), + decoration: BoxDecoration( + color: colorScheme.backgroundSurface, + borderRadius: BorderRadius.all(radius.lg), + boxShadow: boxShadow.elevation1, + ), + foregroundDecoration: BoxDecoration( + borderRadius: BorderRadius.all(radius.lg), + border: Border.all(color: colorScheme.borderSubtle), + ), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + Text( + 'Theme-defined color pairs for placeholder avatars', + style: textTheme.captionDefault.copyWith( + color: colorScheme.textSecondary, + ), + ), + SizedBox(height: spacing.md), + Wrap( + spacing: spacing.sm, + runSpacing: spacing.sm, + children: [ + for (var i = 0; i < palette.length; i++) _PaletteItem(index: i, entry: palette[i]), + ], + ), + SizedBox(height: spacing.md), + Divider(color: colorScheme.borderSubtle), + SizedBox(height: spacing.sm), + Row( + children: [ + Icon( + Icons.info_outline, + size: 14, + color: colorScheme.textTertiary, + ), + SizedBox(width: spacing.xs + spacing.xxs), + Expanded( + child: Text( + 'Colors are automatically assigned based on user ID hash', + style: textTheme.metadataDefault.copyWith( + color: colorScheme.textTertiary, + ), + ), + ), + ], + ), + ], + ), + ), + ], + ); + } +} + +class _PaletteItem extends StatelessWidget { + const _PaletteItem({required this.index, required this.entry}); + + final int index; + final StreamAvatarColorPair entry; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final spacing = context.streamSpacing; + + return Column( + mainAxisSize: MainAxisSize.min, + children: [ + StreamAvatar( + size: StreamAvatarSize.lg, + backgroundColor: entry.backgroundColor, + foregroundColor: entry.foregroundColor, + placeholder: (context) => Text(_getInitials(index)), + ), + SizedBox(height: spacing.xs + spacing.xxs), + Text( + 'palette[$index]', + style: textTheme.metadataDefault.copyWith( + color: colorScheme.textTertiary, + fontFamily: 'monospace', + fontSize: 10, + ), + ), + ], + ); + } +} + +// ============================================================================= +// Usage Patterns Section +// ============================================================================= + +class _UsagePatternsSection extends StatelessWidget { + const _UsagePatternsSection(); + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final spacing = context.streamSpacing; + final palette = colorScheme.avatarPalette; + + return Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + const _SectionLabel(label: 'USAGE PATTERNS'), + SizedBox(height: spacing.md), + + // Profile header example + _ExampleCard( + title: 'Profile Header', + description: 'Large avatar with user details', + child: Row( + children: [ + StreamAvatar( + imageUrl: _sampleImageUrl, + size: StreamAvatarSize.lg, + placeholder: (context) => const Text('JD'), + ), + SizedBox(width: spacing.md), + Column( + crossAxisAlignment: CrossAxisAlignment.start, + mainAxisSize: MainAxisSize.min, + children: [ + Text( + 'Jane Doe', + style: textTheme.headingSm.copyWith( + color: colorScheme.textPrimary, + ), + ), + Text( + 'Product Designer', + style: textTheme.bodyDefault.copyWith( + color: colorScheme.textSecondary, + ), + ), + ], + ), + ], + ), + ), + SizedBox(height: spacing.sm), + + // Message item example + _ExampleCard( + title: 'Message List Item', + description: 'Medium avatar in conversation list', + child: Row( + children: [ + StreamAvatar( + size: StreamAvatarSize.md, + backgroundColor: palette[0].backgroundColor, + foregroundColor: palette[0].foregroundColor, + placeholder: (context) => const Text('JD'), + ), + SizedBox(width: spacing.sm), + Column( + crossAxisAlignment: CrossAxisAlignment.start, + mainAxisSize: MainAxisSize.min, + children: [ + Text( + 'John Doe', + style: textTheme.bodyEmphasis.copyWith( + color: colorScheme.textPrimary, + ), + ), + Text( + 'Hey! Are you free for a call?', + style: textTheme.captionDefault.copyWith( + color: colorScheme.textSecondary, + ), + ), + ], + ), + ], + ), + ), + SizedBox(height: spacing.sm), + + // Compact list example + _ExampleCard( + title: 'Compact List', + description: 'Small avatars for dense layouts', + child: Column( + children: [ + for (var i = 0; i < 3; i++) ...[ + Row( + children: [ + StreamAvatar( + size: StreamAvatarSize.sm, + backgroundColor: palette[i % palette.length].backgroundColor, + foregroundColor: palette[i % palette.length].foregroundColor, + placeholder: (context) => Text(_getInitials(i)), + ), + SizedBox(width: spacing.sm + spacing.xxs), + Text( + ['Alice Brown', 'Bob Smith', 'Carol White'][i], + style: textTheme.captionDefault.copyWith( + color: colorScheme.textPrimary, + ), + ), + ], + ), + if (i < 2) SizedBox(height: spacing.sm), + ], + ], + ), + ), + ], + ); + } +} + +class _ExampleCard extends StatelessWidget { + const _ExampleCard({ + required this.title, + required this.description, + required this.child, + }); + + final String title; + final String description; + final Widget child; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final boxShadow = context.streamBoxShadow; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Container( + width: double.infinity, + clipBehavior: Clip.antiAlias, + decoration: BoxDecoration( + color: colorScheme.backgroundSurfaceSubtle, + borderRadius: BorderRadius.all(radius.lg), + boxShadow: boxShadow.elevation1, + ), + foregroundDecoration: BoxDecoration( + borderRadius: BorderRadius.all(radius.lg), + border: Border.all(color: colorScheme.borderSubtle), + ), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + // Header + Padding( + padding: EdgeInsets.fromLTRB(spacing.md, spacing.sm, spacing.md, spacing.sm), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + Text( + title, + style: textTheme.captionEmphasis.copyWith( + color: colorScheme.textPrimary, + ), + ), + Text( + description, + style: textTheme.metadataDefault.copyWith( + color: colorScheme.textTertiary, + ), + ), + ], + ), + ), + Divider( + height: 1, + color: colorScheme.borderSubtle, + ), + // Content + Container( + padding: EdgeInsets.all(spacing.md), + color: colorScheme.backgroundSurface, + child: child, + ), + ], + ), + ); + } +} + +// ============================================================================= +// Shared Widgets +// ============================================================================= + +class _SectionLabel extends StatelessWidget { + const _SectionLabel({required this.label}); + + final String label; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Container( + padding: EdgeInsets.symmetric(horizontal: spacing.sm, vertical: spacing.xs), + decoration: BoxDecoration( + color: colorScheme.accentPrimary, + borderRadius: BorderRadius.all(radius.xs), + ), + child: Text( + label, + style: textTheme.metadataEmphasis.copyWith( + color: colorScheme.textOnAccent, + letterSpacing: 1, + fontSize: 9, + ), + ), + ); + } +} + +String _getInitials(int index) { + const names = ['AB', 'CD', 'EF', 'GH', 'IJ']; + return names[index % names.length]; +} diff --git a/apps/design_system_gallery/lib/components/avatar/stream_avatar_group.dart b/apps/design_system_gallery/lib/components/avatar/stream_avatar_group.dart new file mode 100644 index 0000000..5efe6b2 --- /dev/null +++ b/apps/design_system_gallery/lib/components/avatar/stream_avatar_group.dart @@ -0,0 +1,552 @@ +import 'package:flutter/material.dart'; +import 'package:stream_core_flutter/stream_core_flutter.dart'; +import 'package:widgetbook/widgetbook.dart'; +import 'package:widgetbook_annotation/widgetbook_annotation.dart' as widgetbook; + +const _sampleImages = [ + 'https://images.unsplash.com/photo-1494790108377-be9c29b29330?w=200', + 'https://images.unsplash.com/photo-1507003211169-0a1dd7228f2d?w=200', + 'https://images.unsplash.com/photo-1517841905240-472988babdf9?w=200', + 'https://images.unsplash.com/photo-1539571696357-5a69c17a67c6?w=200', + 'https://images.unsplash.com/photo-1524504388940-b1c1722653e1?w=200', +]; + +// ============================================================================= +// Playground +// ============================================================================= + +@widgetbook.UseCase( + name: 'Playground', + type: StreamAvatarGroup, + path: '[Components]/Avatar', +) +Widget buildStreamAvatarGroupPlayground(BuildContext context) { + final size = context.knobs.object.dropdown( + label: 'Size', + options: StreamAvatarGroupSize.values, + initialOption: StreamAvatarGroupSize.xl, + labelBuilder: (option) => '${option.name.toUpperCase()} (${option.value.toInt()}px)', + description: 'Avatar group diameter size preset.', + ); + + final avatarCount = context.knobs.int.slider( + label: 'Avatar Count', + initialValue: 4, + min: 1, + max: 5, + description: 'Number of avatars to display.', + ); + + final showImages = context.knobs.boolean( + label: 'Show Images', + initialValue: true, + description: 'Use images or show initials placeholder.', + ); + + final palette = context.streamColorScheme.avatarPalette; + + return Center( + child: StreamAvatarGroup( + size: size, + children: List.generate( + avatarCount, + (index) => StreamAvatar( + imageUrl: showImages ? _sampleImages[index % _sampleImages.length] : null, + backgroundColor: palette[index % palette.length].backgroundColor, + foregroundColor: palette[index % palette.length].foregroundColor, + placeholder: (context) => Text(_getInitials(index)), + ), + ), + ), + ); +} + +// ============================================================================= +// Showcase +// ============================================================================= + +@widgetbook.UseCase( + name: 'Showcase', + type: StreamAvatarGroup, + path: '[Components]/Avatar', +) +Widget buildStreamAvatarGroupShowcase(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final spacing = context.streamSpacing; + + return DefaultTextStyle( + style: textTheme.bodyDefault.copyWith(color: colorScheme.textPrimary), + child: SingleChildScrollView( + padding: EdgeInsets.all(spacing.lg), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + // Size variants + const _SizeVariantsSection(), + SizedBox(height: spacing.xl), + + // Avatar count variants + const _AvatarCountSection(), + SizedBox(height: spacing.xl), + + // Usage patterns + const _UsagePatternsSection(), + ], + ), + ), + ); +} + +// ============================================================================= +// Size Variants Section +// ============================================================================= + +class _SizeVariantsSection extends StatelessWidget { + const _SizeVariantsSection(); + + @override + Widget build(BuildContext context) { + final spacing = context.streamSpacing; + + return Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + const _SectionLabel(label: 'SIZE SCALE'), + SizedBox(height: spacing.md), + ...StreamAvatarGroupSize.values.map((size) => _SizeCard(size: size)), + ], + ); + } +} + +class _SizeCard extends StatelessWidget { + const _SizeCard({required this.size}); + + final StreamAvatarGroupSize size; + + String _getUsage(StreamAvatarGroupSize size) { + return switch (size) { + StreamAvatarGroupSize.lg => 'Channel list items, compact group displays', + StreamAvatarGroupSize.xl => 'Channel list items, standard group displays', + StreamAvatarGroupSize.xxl => 'Channel headers, prominent group displays', + }; + } + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final boxShadow = context.streamBoxShadow; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + final palette = colorScheme.avatarPalette; + + return Padding( + padding: EdgeInsets.only(bottom: spacing.sm), + child: Container( + clipBehavior: Clip.antiAlias, + padding: EdgeInsets.all(spacing.md), + decoration: BoxDecoration( + color: colorScheme.backgroundSurface, + borderRadius: BorderRadius.all(radius.lg), + boxShadow: boxShadow.elevation1, + ), + foregroundDecoration: BoxDecoration( + borderRadius: BorderRadius.all(radius.lg), + border: Border.all(color: colorScheme.borderSubtle), + ), + child: Row( + children: [ + // Avatar group preview + SizedBox( + width: 80, + height: 80, + child: Center( + child: StreamAvatarGroup( + size: size, + children: List.generate( + 4, + (index) => StreamAvatar( + imageUrl: _sampleImages[index % _sampleImages.length], + backgroundColor: palette[index % palette.length].backgroundColor, + foregroundColor: palette[index % palette.length].foregroundColor, + placeholder: (context) => Text(_getInitials(index)), + ), + ), + ), + ), + ), + SizedBox(width: spacing.md + spacing.xs), + // Info + Expanded( + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + Row( + children: [ + Text( + 'StreamAvatarGroupSize.${size.name}', + style: textTheme.captionEmphasis.copyWith( + color: colorScheme.accentPrimary, + fontFamily: 'monospace', + ), + ), + SizedBox(width: spacing.sm), + Container( + padding: EdgeInsets.symmetric( + horizontal: spacing.xs + spacing.xxs, + vertical: spacing.xxs, + ), + decoration: BoxDecoration( + color: colorScheme.backgroundSurfaceSubtle, + borderRadius: BorderRadius.all(radius.xs), + ), + child: Text( + '${size.value.toInt()}px', + style: textTheme.metadataEmphasis.copyWith( + color: colorScheme.textSecondary, + fontFamily: 'monospace', + fontSize: 10, + ), + ), + ), + ], + ), + SizedBox(height: spacing.xs + spacing.xxs), + Text( + _getUsage(size), + style: textTheme.captionDefault.copyWith( + color: colorScheme.textTertiary, + ), + ), + ], + ), + ), + ], + ), + ), + ); + } +} + +// ============================================================================= +// Avatar Count Section +// ============================================================================= + +class _AvatarCountSection extends StatelessWidget { + const _AvatarCountSection(); + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final boxShadow = context.streamBoxShadow; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + final palette = colorScheme.avatarPalette; + + return Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + const _SectionLabel(label: 'AVATAR COUNT'), + SizedBox(height: spacing.md), + Container( + width: double.infinity, + clipBehavior: Clip.antiAlias, + padding: EdgeInsets.all(spacing.md), + decoration: BoxDecoration( + color: colorScheme.backgroundSurface, + borderRadius: BorderRadius.all(radius.lg), + boxShadow: boxShadow.elevation1, + ), + foregroundDecoration: BoxDecoration( + borderRadius: BorderRadius.all(radius.lg), + border: Border.all(color: colorScheme.borderSubtle), + ), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + Text( + 'Group displays adapt based on member count', + style: textTheme.captionDefault.copyWith( + color: colorScheme.textSecondary, + ), + ), + SizedBox(height: spacing.md), + Wrap( + spacing: spacing.lg, + runSpacing: spacing.md, + children: [ + for (var count = 1; count <= 5; count++) + _CountDemo( + count: count, + children: List.generate( + count, + (index) => StreamAvatar( + imageUrl: _sampleImages[index % _sampleImages.length], + backgroundColor: palette[index % palette.length].backgroundColor, + foregroundColor: palette[index % palette.length].foregroundColor, + placeholder: (context) => Text(_getInitials(index)), + ), + ), + ), + ], + ), + ], + ), + ), + ], + ); + } +} + +class _CountDemo extends StatelessWidget { + const _CountDemo({ + required this.count, + required this.children, + }); + + final int count; + final List children; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final spacing = context.streamSpacing; + + return Column( + children: [ + StreamAvatarGroup( + size: StreamAvatarGroupSize.lg, + children: children, + ), + SizedBox(height: spacing.sm), + Text( + '$count ${count == 1 ? 'member' : 'members'}', + style: textTheme.metadataDefault.copyWith( + color: colorScheme.textTertiary, + ), + ), + ], + ); + } +} + +// ============================================================================= +// Usage Patterns Section +// ============================================================================= + +class _UsagePatternsSection extends StatelessWidget { + const _UsagePatternsSection(); + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final spacing = context.streamSpacing; + final palette = colorScheme.avatarPalette; + + return Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + const _SectionLabel(label: 'USAGE PATTERNS'), + SizedBox(height: spacing.md), + + // Channel list item example + _ExampleCard( + title: 'Channel List Item', + description: 'Group avatar in channel list', + child: Row( + children: [ + StreamAvatarGroup( + size: StreamAvatarGroupSize.lg, + children: List.generate( + 3, + (index) => StreamAvatar( + imageUrl: _sampleImages[index % _sampleImages.length], + backgroundColor: palette[index % palette.length].backgroundColor, + foregroundColor: palette[index % palette.length].foregroundColor, + placeholder: (context) => Text(_getInitials(index)), + ), + ), + ), + SizedBox(width: spacing.md), + Column( + crossAxisAlignment: CrossAxisAlignment.start, + mainAxisSize: MainAxisSize.min, + children: [ + Text( + 'Design Team', + style: textTheme.bodyEmphasis.copyWith( + color: colorScheme.textPrimary, + ), + ), + Text( + '3 members', + style: textTheme.captionDefault.copyWith( + color: colorScheme.textSecondary, + ), + ), + ], + ), + ], + ), + ), + SizedBox(height: spacing.sm), + + // Channel header example + _ExampleCard( + title: 'Channel Header', + description: 'Large group avatar for channel details', + child: Row( + children: [ + StreamAvatarGroup( + size: StreamAvatarGroupSize.xl, + children: List.generate( + 4, + (index) => StreamAvatar( + imageUrl: _sampleImages[index % _sampleImages.length], + backgroundColor: palette[index % palette.length].backgroundColor, + foregroundColor: palette[index % palette.length].foregroundColor, + placeholder: (context) => Text(_getInitials(index)), + ), + ), + ), + SizedBox(width: spacing.md), + Column( + crossAxisAlignment: CrossAxisAlignment.start, + mainAxisSize: MainAxisSize.min, + children: [ + Text( + 'Product Launch', + style: textTheme.headingSm.copyWith( + color: colorScheme.textPrimary, + ), + ), + Text( + '4 participants', + style: textTheme.bodyDefault.copyWith( + color: colorScheme.textSecondary, + ), + ), + ], + ), + ], + ), + ), + ], + ); + } +} + +class _ExampleCard extends StatelessWidget { + const _ExampleCard({ + required this.title, + required this.description, + required this.child, + }); + + final String title; + final String description; + final Widget child; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final boxShadow = context.streamBoxShadow; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Container( + width: double.infinity, + clipBehavior: Clip.antiAlias, + decoration: BoxDecoration( + color: colorScheme.backgroundSurfaceSubtle, + borderRadius: BorderRadius.all(radius.lg), + boxShadow: boxShadow.elevation1, + ), + foregroundDecoration: BoxDecoration( + borderRadius: BorderRadius.all(radius.lg), + border: Border.all(color: colorScheme.borderSubtle), + ), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + // Header + Padding( + padding: EdgeInsets.fromLTRB(spacing.md, spacing.sm, spacing.md, spacing.sm), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + Text( + title, + style: textTheme.captionEmphasis.copyWith( + color: colorScheme.textPrimary, + ), + ), + Text( + description, + style: textTheme.metadataDefault.copyWith( + color: colorScheme.textTertiary, + ), + ), + ], + ), + ), + Divider( + height: 1, + color: colorScheme.borderSubtle, + ), + // Content + Container( + padding: EdgeInsets.all(spacing.md), + color: colorScheme.backgroundSurface, + child: child, + ), + ], + ), + ); + } +} + +// ============================================================================= +// Shared Widgets +// ============================================================================= + +class _SectionLabel extends StatelessWidget { + const _SectionLabel({required this.label}); + + final String label; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Container( + padding: EdgeInsets.symmetric(horizontal: spacing.sm, vertical: spacing.xs), + decoration: BoxDecoration( + color: colorScheme.accentPrimary, + borderRadius: BorderRadius.all(radius.xs), + ), + child: Text( + label, + style: textTheme.metadataEmphasis.copyWith( + color: colorScheme.textOnAccent, + letterSpacing: 1, + fontSize: 9, + ), + ), + ); + } +} + +String _getInitials(int index) { + const names = ['AB', 'CD', 'EF', 'GH', 'IJ']; + return names[index % names.length]; +} diff --git a/apps/design_system_gallery/lib/components/avatar/stream_avatar_stack.dart b/apps/design_system_gallery/lib/components/avatar/stream_avatar_stack.dart new file mode 100644 index 0000000..9d41655 --- /dev/null +++ b/apps/design_system_gallery/lib/components/avatar/stream_avatar_stack.dart @@ -0,0 +1,538 @@ +import 'package:flutter/material.dart'; +import 'package:stream_core_flutter/stream_core_flutter.dart'; +import 'package:widgetbook/widgetbook.dart'; +import 'package:widgetbook_annotation/widgetbook_annotation.dart' as widgetbook; + +const _sampleImages = [ + 'https://images.unsplash.com/photo-1494790108377-be9c29b29330?w=200', + 'https://images.unsplash.com/photo-1507003211169-0a1dd7228f2d?w=200', + 'https://images.unsplash.com/photo-1517841905240-472988babdf9?w=200', + 'https://images.unsplash.com/photo-1539571696357-5a69c17a67c6?w=200', + 'https://images.unsplash.com/photo-1524504388940-b1c1722653e1?w=200', +]; + +// ============================================================================= +// Playground +// ============================================================================= + +@widgetbook.UseCase( + name: 'Playground', + type: StreamAvatarStack, + path: '[Components]/Avatar', +) +Widget buildStreamAvatarStackPlayground(BuildContext context) { + final avatarCount = context.knobs.int.slider( + label: 'Avatar Count', + initialValue: 4, + min: 1, + max: 10, + description: 'Total number of avatars in the stack.', + ); + + final size = context.knobs.object.dropdown( + label: 'Size', + options: StreamAvatarStackSize.values, + initialOption: StreamAvatarStackSize.sm, + labelBuilder: (option) => '${option.name.toUpperCase()} (${option.value.toInt()}px)', + description: 'Size of each avatar in the stack.', + ); + + final overlap = context.knobs.double.slider( + label: 'Overlap', + initialValue: 0.3, + max: 0.8, + description: 'How much avatars overlap (0 = none, 0.8 = 80%).', + ); + + final maxAvatars = context.knobs.int.slider( + label: 'Max Visible', + initialValue: 5, + min: 2, + max: 10, + description: 'Max avatars shown before "+N" indicator.', + ); + + final showImages = context.knobs.boolean( + label: 'Show Images', + initialValue: true, + description: 'Use images or show initials placeholder.', + ); + + final colorScheme = context.streamColorScheme; + final palette = colorScheme.avatarPalette; + + return Center( + child: StreamAvatarStack( + size: size, + overlap: overlap, + max: maxAvatars, + children: [ + for (var i = 0; i < avatarCount; i++) + StreamAvatar( + imageUrl: showImages ? _sampleImages[i % _sampleImages.length] : null, + backgroundColor: palette[i % palette.length].backgroundColor, + foregroundColor: palette[i % palette.length].foregroundColor, + placeholder: (context) => Text(_getInitials(i)), + ), + ], + ), + ); +} + +// ============================================================================= +// Showcase +// ============================================================================= + +@widgetbook.UseCase( + name: 'Showcase', + type: StreamAvatarStack, + path: '[Components]/Avatar', +) +Widget buildStreamAvatarStackShowcase(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final spacing = context.streamSpacing; + + return DefaultTextStyle( + style: textTheme.bodyDefault.copyWith(color: colorScheme.textPrimary), + child: SingleChildScrollView( + padding: EdgeInsets.all(spacing.lg), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + // Configuration options + const _ConfigurationSection(), + SizedBox(height: spacing.xl), + + // Usage patterns + const _UsagePatternsSection(), + ], + ), + ), + ); +} + +// ============================================================================= +// Configuration Section +// ============================================================================= + +class _ConfigurationSection extends StatelessWidget { + const _ConfigurationSection(); + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final boxShadow = context.streamBoxShadow; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + final palette = colorScheme.avatarPalette; + + return Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + const _SectionLabel(label: 'CONFIGURATION'), + SizedBox(height: spacing.md), + Container( + width: double.infinity, + clipBehavior: Clip.antiAlias, + padding: EdgeInsets.all(spacing.md), + decoration: BoxDecoration( + color: colorScheme.backgroundSurface, + borderRadius: BorderRadius.all(radius.lg), + boxShadow: boxShadow.elevation1, + ), + foregroundDecoration: BoxDecoration( + borderRadius: BorderRadius.all(radius.lg), + border: Border.all(color: colorScheme.borderSubtle), + ), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + // Overlap demonstration + Text( + 'Overlap', + style: textTheme.captionEmphasis.copyWith( + color: colorScheme.textPrimary, + ), + ), + SizedBox(height: spacing.sm), + Text( + 'Controls how much avatars overlap each other', + style: textTheme.metadataDefault.copyWith( + color: colorScheme.textTertiary, + ), + ), + SizedBox(height: spacing.sm), + Row( + children: [ + _OverlapDemo( + label: '0.0', + overlap: 0, + palette: palette, + ), + SizedBox(width: spacing.lg), + _OverlapDemo( + label: '0.3', + overlap: 0.3, + palette: palette, + ), + SizedBox(width: spacing.lg), + _OverlapDemo( + label: '0.5', + overlap: 0.5, + palette: palette, + ), + ], + ), + SizedBox(height: spacing.md), + Divider(color: colorScheme.borderSubtle), + SizedBox(height: spacing.md), + // Max avatars demonstration + Text( + 'Max Visible', + style: textTheme.captionEmphasis.copyWith( + color: colorScheme.textPrimary, + ), + ), + SizedBox(height: spacing.sm), + Text( + 'Shows "+N" indicator when avatars exceed max', + style: textTheme.metadataDefault.copyWith( + color: colorScheme.textTertiary, + ), + ), + SizedBox(height: spacing.sm), + Row( + children: [ + _MaxDemo( + label: 'max: 3', + max: 3, + count: 6, + palette: palette, + ), + SizedBox(width: spacing.lg), + _MaxDemo( + label: 'max: 5', + max: 5, + count: 8, + palette: palette, + ), + ], + ), + ], + ), + ), + ], + ); + } +} + +class _OverlapDemo extends StatelessWidget { + const _OverlapDemo({ + required this.label, + required this.overlap, + required this.palette, + }); + + final String label; + final double overlap; + final List palette; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final spacing = context.streamSpacing; + + return Column( + children: [ + StreamAvatarStack( + size: StreamAvatarStackSize.sm, + overlap: overlap, + children: [ + for (var i = 0; i < 3; i++) + StreamAvatar( + backgroundColor: palette[i % palette.length].backgroundColor, + foregroundColor: palette[i % palette.length].foregroundColor, + placeholder: (context) => Text(_getInitials(i)), + ), + ], + ), + SizedBox(height: spacing.xs + spacing.xxs), + Text( + label, + style: textTheme.metadataDefault.copyWith( + color: colorScheme.textTertiary, + fontFamily: 'monospace', + ), + ), + ], + ); + } +} + +class _MaxDemo extends StatelessWidget { + const _MaxDemo({ + required this.label, + required this.max, + required this.count, + required this.palette, + }); + + final String label; + final int max; + final int count; + final List palette; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final spacing = context.streamSpacing; + + return Column( + children: [ + StreamAvatarStack( + size: StreamAvatarStackSize.sm, + max: max, + children: [ + for (var i = 0; i < count; i++) + StreamAvatar( + imageUrl: _sampleImages[i % _sampleImages.length], + backgroundColor: palette[i % palette.length].backgroundColor, + foregroundColor: palette[i % palette.length].foregroundColor, + placeholder: (context) => Text(_getInitials(i)), + ), + ], + ), + SizedBox(height: spacing.xs + spacing.xxs), + Text( + label, + style: textTheme.metadataDefault.copyWith( + color: colorScheme.textTertiary, + fontFamily: 'monospace', + ), + ), + ], + ); + } +} + +// ============================================================================= +// Usage Patterns Section +// ============================================================================= + +class _UsagePatternsSection extends StatelessWidget { + const _UsagePatternsSection(); + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final spacing = context.streamSpacing; + final palette = colorScheme.avatarPalette; + + return Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + const _SectionLabel(label: 'USAGE PATTERNS'), + SizedBox(height: spacing.md), + + // Group chat example + _ExampleCard( + title: 'Group Chat', + description: 'Show participants in a conversation', + child: Row( + children: [ + StreamAvatarStack( + size: StreamAvatarStackSize.sm, + children: [ + for (var i = 0; i < 3; i++) + StreamAvatar( + imageUrl: _sampleImages[i], + backgroundColor: palette[i % palette.length].backgroundColor, + foregroundColor: palette[i % palette.length].foregroundColor, + placeholder: (context) => Text(_getInitials(i)), + ), + ], + ), + SizedBox(width: spacing.sm), + Column( + crossAxisAlignment: CrossAxisAlignment.start, + mainAxisSize: MainAxisSize.min, + children: [ + Text( + 'John, Sarah, Mike', + style: textTheme.bodyEmphasis.copyWith( + color: colorScheme.textPrimary, + ), + ), + Text( + 'Active now', + style: textTheme.captionDefault.copyWith( + color: colorScheme.accentSuccess, + ), + ), + ], + ), + ], + ), + ), + SizedBox(height: spacing.sm), + + // Team with overflow example + _ExampleCard( + title: 'Team Members', + description: 'Show team with overflow indicator', + child: Row( + children: [ + StreamAvatarStack( + size: StreamAvatarStackSize.sm, + max: 4, + children: [ + for (var i = 0; i < 8; i++) + StreamAvatar( + imageUrl: _sampleImages[i % _sampleImages.length], + backgroundColor: palette[i % palette.length].backgroundColor, + foregroundColor: palette[i % palette.length].foregroundColor, + placeholder: (context) => Text(_getInitials(i)), + ), + ], + ), + SizedBox(width: spacing.sm), + Column( + crossAxisAlignment: CrossAxisAlignment.start, + mainAxisSize: MainAxisSize.min, + children: [ + Text( + 'Design Team', + style: textTheme.bodyEmphasis.copyWith( + color: colorScheme.textPrimary, + ), + ), + Text( + '8 members', + style: textTheme.captionDefault.copyWith( + color: colorScheme.textSecondary, + ), + ), + ], + ), + ], + ), + ), + ], + ); + } +} + +class _ExampleCard extends StatelessWidget { + const _ExampleCard({ + required this.title, + required this.description, + required this.child, + }); + + final String title; + final String description; + final Widget child; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final boxShadow = context.streamBoxShadow; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Container( + width: double.infinity, + clipBehavior: Clip.antiAlias, + decoration: BoxDecoration( + color: colorScheme.backgroundSurfaceSubtle, + borderRadius: BorderRadius.all(radius.lg), + boxShadow: boxShadow.elevation1, + ), + foregroundDecoration: BoxDecoration( + borderRadius: BorderRadius.all(radius.lg), + border: Border.all(color: colorScheme.borderSubtle), + ), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + // Header + Padding( + padding: EdgeInsets.fromLTRB(spacing.md, spacing.sm, spacing.md, spacing.sm), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + Text( + title, + style: textTheme.captionEmphasis.copyWith( + color: colorScheme.textPrimary, + ), + ), + Text( + description, + style: textTheme.metadataDefault.copyWith( + color: colorScheme.textTertiary, + ), + ), + ], + ), + ), + Divider( + height: 1, + color: colorScheme.borderSubtle, + ), + // Content + Container( + padding: EdgeInsets.all(spacing.md), + color: colorScheme.backgroundSurface, + child: child, + ), + ], + ), + ); + } +} + +// ============================================================================= +// Shared Widgets +// ============================================================================= + +class _SectionLabel extends StatelessWidget { + const _SectionLabel({required this.label}); + + final String label; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Container( + padding: EdgeInsets.symmetric(horizontal: spacing.sm, vertical: spacing.xs), + decoration: BoxDecoration( + color: colorScheme.accentPrimary, + borderRadius: BorderRadius.all(radius.xs), + ), + child: Text( + label, + style: textTheme.metadataEmphasis.copyWith( + color: colorScheme.textOnAccent, + letterSpacing: 1, + fontSize: 9, + ), + ), + ); + } +} + +String _getInitials(int index) { + const names = ['AB', 'CD', 'EF', 'GH', 'IJ', 'KL', 'MN', 'OP']; + return names[index % names.length]; +} diff --git a/apps/design_system_gallery/lib/components/badge/stream_badge_count.dart b/apps/design_system_gallery/lib/components/badge/stream_badge_count.dart new file mode 100644 index 0000000..cad714e --- /dev/null +++ b/apps/design_system_gallery/lib/components/badge/stream_badge_count.dart @@ -0,0 +1,560 @@ +import 'package:flutter/material.dart'; +import 'package:stream_core_flutter/stream_core_flutter.dart'; +import 'package:widgetbook/widgetbook.dart'; +import 'package:widgetbook_annotation/widgetbook_annotation.dart' as widgetbook; + +// ============================================================================= +// Playground +// ============================================================================= + +@widgetbook.UseCase( + name: 'Playground', + type: StreamBadgeCount, + path: '[Components]/Badge', +) +Widget buildStreamBadgeCountPlayground(BuildContext context) { + final label = context.knobs.string( + label: 'Label', + initialValue: '5', + description: 'The text to display in the badge.', + ); + + final size = context.knobs.object.dropdown( + label: 'Size', + options: StreamBadgeCountSize.values, + initialOption: StreamBadgeCountSize.xs, + labelBuilder: (option) => '${option.name.toUpperCase()} (${option.value.toInt()}px)', + description: 'The size of the badge.', + ); + + return Center( + child: StreamBadgeCount( + label: label, + size: size, + ), + ); +} + +// ============================================================================= +// Showcase +// ============================================================================= + +@widgetbook.UseCase( + name: 'Showcase', + type: StreamBadgeCount, + path: '[Components]/Badge', +) +Widget buildStreamBadgeCountShowcase(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final spacing = context.streamSpacing; + + return DefaultTextStyle( + style: textTheme.bodyDefault.copyWith(color: colorScheme.textPrimary), + child: SingleChildScrollView( + padding: EdgeInsets.all(spacing.lg), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + // Size variants + const _SizeVariantsSection(), + SizedBox(height: spacing.xl), + + // Count variants + const _CountVariantsSection(), + SizedBox(height: spacing.xl), + + // Usage patterns + const _UsagePatternsSection(), + ], + ), + ), + ); +} + +// ============================================================================= +// Size Variants Section +// ============================================================================= + +class _SizeVariantsSection extends StatelessWidget { + const _SizeVariantsSection(); + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final boxShadow = context.streamBoxShadow; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + const _SectionLabel(label: 'SIZE VARIANTS'), + SizedBox(height: spacing.md), + Container( + width: double.infinity, + clipBehavior: Clip.antiAlias, + padding: EdgeInsets.all(spacing.md), + decoration: BoxDecoration( + color: colorScheme.backgroundSurface, + borderRadius: BorderRadius.all(radius.lg), + boxShadow: boxShadow.elevation1, + ), + foregroundDecoration: BoxDecoration( + borderRadius: BorderRadius.all(radius.lg), + border: Border.all(color: colorScheme.borderSubtle), + ), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + Text( + 'Badge sizes scale with count display', + style: textTheme.captionDefault.copyWith( + color: colorScheme.textSecondary, + ), + ), + SizedBox(height: spacing.md), + Row( + children: [ + for (final size in StreamBadgeCountSize.values) ...[ + _SizeDemo(size: size), + if (size != StreamBadgeCountSize.values.last) SizedBox(width: spacing.xl), + ], + ], + ), + ], + ), + ), + ], + ); + } +} + +class _SizeDemo extends StatelessWidget { + const _SizeDemo({required this.size}); + + final StreamBadgeCountSize size; + + String _getPixelSize(StreamBadgeCountSize size) { + return switch (size) { + StreamBadgeCountSize.xs => '20px', + StreamBadgeCountSize.sm => '24px', + StreamBadgeCountSize.md => '32px', + }; + } + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final spacing = context.streamSpacing; + + return Column( + children: [ + SizedBox( + width: 48, + height: 32, + child: Center( + child: StreamBadgeCount( + label: '5', + size: size, + ), + ), + ), + SizedBox(height: spacing.sm), + Text( + size.name.toUpperCase(), + style: textTheme.metadataEmphasis.copyWith( + color: colorScheme.accentPrimary, + fontFamily: 'monospace', + ), + ), + Text( + _getPixelSize(size), + style: textTheme.metadataDefault.copyWith( + color: colorScheme.textTertiary, + fontFamily: 'monospace', + fontSize: 10, + ), + ), + ], + ); + } +} + +// ============================================================================= +// Count Variants Section +// ============================================================================= + +class _CountVariantsSection extends StatelessWidget { + const _CountVariantsSection(); + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final boxShadow = context.streamBoxShadow; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + const _SectionLabel(label: 'COUNT VARIANTS'), + SizedBox(height: spacing.md), + Container( + width: double.infinity, + clipBehavior: Clip.antiAlias, + padding: EdgeInsets.all(spacing.md), + decoration: BoxDecoration( + color: colorScheme.backgroundSurface, + borderRadius: BorderRadius.all(radius.lg), + boxShadow: boxShadow.elevation1, + ), + foregroundDecoration: BoxDecoration( + borderRadius: BorderRadius.all(radius.lg), + border: Border.all(color: colorScheme.borderSubtle), + ), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + Text( + 'Badge adapts width based on count', + style: textTheme.captionDefault.copyWith( + color: colorScheme.textSecondary, + ), + ), + SizedBox(height: spacing.md), + Wrap( + spacing: spacing.md, + runSpacing: spacing.md, + children: const [ + _CountDemo(count: 1), + _CountDemo(count: 9), + _CountDemo(count: 25), + _CountDemo(count: 99), + _CountDemo(count: 100), + ], + ), + ], + ), + ), + ], + ); + } +} + +class _CountDemo extends StatelessWidget { + const _CountDemo({required this.count}); + + final int count; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final spacing = context.streamSpacing; + + final displayText = count > 99 ? '99+' : '$count'; + + return Column( + children: [ + StreamBadgeCount(label: displayText), + SizedBox(height: spacing.xs), + Text( + displayText, + style: textTheme.metadataDefault.copyWith( + color: colorScheme.textTertiary, + fontFamily: 'monospace', + ), + ), + ], + ); + } +} + +// ============================================================================= +// Usage Patterns Section +// ============================================================================= + +class _UsagePatternsSection extends StatelessWidget { + const _UsagePatternsSection(); + + @override + Widget build(BuildContext context) { + final spacing = context.streamSpacing; + + return Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + const _SectionLabel(label: 'USAGE PATTERNS'), + SizedBox(height: spacing.md), + + // Avatar with badge + const _ExampleCard( + title: 'Avatar with Badge', + description: 'Badge positioned on avatar corner', + child: _AvatarWithBadgeGroup(), + ), + SizedBox(height: spacing.sm), + + // List item with badge + const _ExampleCard( + title: 'List Item', + description: 'Badge in channel list item', + child: _ListItemExample(), + ), + ], + ); + } +} + +class _AvatarWithBadgeGroup extends StatelessWidget { + const _AvatarWithBadgeGroup(); + + @override + Widget build(BuildContext context) { + final spacing = context.streamSpacing; + + return Row( + children: [ + const _AvatarWithBadge(name: 'John', count: 3), + SizedBox(width: spacing.lg), + const _AvatarWithBadge(name: 'Sarah', count: 12), + SizedBox(width: spacing.lg), + const _AvatarWithBadge(name: 'Alex', count: 99), + SizedBox(width: spacing.lg), + const _AvatarWithBadge(name: 'Team', count: 150), + ], + ); + } +} + +class _AvatarWithBadge extends StatelessWidget { + const _AvatarWithBadge({ + required this.name, + required this.count, + }); + + final String name; + final int count; + + @override + Widget build(BuildContext context) { + final textTheme = context.streamTextTheme; + final colorScheme = context.streamColorScheme; + final spacing = context.streamSpacing; + + return Column( + children: [ + Stack( + clipBehavior: Clip.none, + children: [ + StreamAvatar( + size: StreamAvatarSize.lg, + placeholder: (context) => Text(name[0]), + ), + Positioned( + right: -4, + top: -4, + child: StreamBadgeCount( + label: count > 99 ? '99+' : '$count', + size: StreamBadgeCountSize.xs, + ), + ), + ], + ), + SizedBox(height: spacing.sm), + Text( + name, + style: textTheme.captionDefault.copyWith( + color: colorScheme.textPrimary, + ), + ), + ], + ); + } +} + +class _ListItemExample extends StatelessWidget { + const _ListItemExample(); + + @override + Widget build(BuildContext context) { + final spacing = context.streamSpacing; + + return Column( + children: [ + const _ChannelListItem( + name: 'Design Team', + message: 'New mockups ready for review', + count: 3, + ), + SizedBox(height: spacing.sm), + const _ChannelListItem( + name: 'Engineering', + message: 'PR merged successfully', + count: 12, + ), + ], + ); + } +} + +class _ChannelListItem extends StatelessWidget { + const _ChannelListItem({ + required this.name, + required this.message, + required this.count, + }); + + final String name; + final String message; + final int count; + + @override + Widget build(BuildContext context) { + final textTheme = context.streamTextTheme; + final colorScheme = context.streamColorScheme; + final spacing = context.streamSpacing; + + return Row( + children: [ + StreamAvatar( + size: StreamAvatarSize.lg, + placeholder: (context) => Text(name[0]), + ), + SizedBox(width: spacing.sm), + Expanded( + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + Text( + name, + style: textTheme.bodyEmphasis.copyWith( + color: colorScheme.textPrimary, + ), + ), + Text( + message, + style: textTheme.captionDefault.copyWith( + color: colorScheme.textSecondary, + ), + maxLines: 1, + overflow: TextOverflow.ellipsis, + ), + ], + ), + ), + SizedBox(width: spacing.sm), + StreamBadgeCount(label: '$count'), + ], + ); + } +} + +class _ExampleCard extends StatelessWidget { + const _ExampleCard({ + required this.title, + required this.description, + required this.child, + }); + + final String title; + final String description; + final Widget child; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final boxShadow = context.streamBoxShadow; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Container( + width: double.infinity, + clipBehavior: Clip.antiAlias, + decoration: BoxDecoration( + color: colorScheme.backgroundSurfaceSubtle, + borderRadius: BorderRadius.all(radius.lg), + boxShadow: boxShadow.elevation1, + ), + foregroundDecoration: BoxDecoration( + borderRadius: BorderRadius.all(radius.lg), + border: Border.all(color: colorScheme.borderSubtle), + ), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + // Header + Padding( + padding: EdgeInsets.fromLTRB(spacing.md, spacing.sm, spacing.md, spacing.sm), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + Text( + title, + style: textTheme.captionEmphasis.copyWith( + color: colorScheme.textPrimary, + ), + ), + Text( + description, + style: textTheme.metadataDefault.copyWith( + color: colorScheme.textTertiary, + ), + ), + ], + ), + ), + Divider( + height: 1, + color: colorScheme.borderSubtle, + ), + // Content + Container( + padding: EdgeInsets.all(spacing.md), + color: colorScheme.backgroundSurface, + child: child, + ), + ], + ), + ); + } +} + +// ============================================================================= +// Shared Widgets +// ============================================================================= + +class _SectionLabel extends StatelessWidget { + const _SectionLabel({required this.label}); + + final String label; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Container( + padding: EdgeInsets.symmetric(horizontal: spacing.sm, vertical: spacing.xs), + decoration: BoxDecoration( + color: colorScheme.accentPrimary, + borderRadius: BorderRadius.all(radius.xs), + ), + child: Text( + label, + style: textTheme.metadataEmphasis.copyWith( + color: colorScheme.textOnAccent, + letterSpacing: 1, + fontSize: 9, + ), + ), + ); + } +} diff --git a/apps/design_system_gallery/lib/components/badge/stream_badge_notification.dart b/apps/design_system_gallery/lib/components/badge/stream_badge_notification.dart new file mode 100644 index 0000000..8e64506 --- /dev/null +++ b/apps/design_system_gallery/lib/components/badge/stream_badge_notification.dart @@ -0,0 +1,400 @@ +import 'package:flutter/material.dart'; +import 'package:stream_core_flutter/stream_core_flutter.dart'; +import 'package:widgetbook/widgetbook.dart'; +import 'package:widgetbook_annotation/widgetbook_annotation.dart' as widgetbook; + +// ============================================================================= +// Playground +// ============================================================================= + +@widgetbook.UseCase( + name: 'Playground', + type: StreamBadgeNotification, + path: '[Components]/Badge', +) +Widget buildStreamBadgeNotificationPlayground(BuildContext context) { + final label = context.knobs.string( + label: 'Label', + initialValue: '1', + description: 'The text to display in the badge.', + ); + + final type = context.knobs.object.dropdown( + label: 'Type', + options: StreamBadgeNotificationType.values, + initialOption: StreamBadgeNotificationType.primary, + labelBuilder: (option) => option.name[0].toUpperCase() + option.name.substring(1), + description: 'The visual type of the badge.', + ); + + final size = context.knobs.object.dropdown( + label: 'Size', + options: StreamBadgeNotificationSize.values, + initialOption: StreamBadgeNotificationSize.sm, + labelBuilder: (option) => '${option.name.toUpperCase()} (${option.value.toInt()}px)', + description: 'The size of the badge.', + ); + + return Center( + child: StreamBadgeNotification( + label: label, + type: type, + size: size, + ), + ); +} + +// ============================================================================= +// Showcase +// ============================================================================= + +@widgetbook.UseCase( + name: 'Showcase', + type: StreamBadgeNotification, + path: '[Components]/Badge', +) +Widget buildStreamBadgeNotificationShowcase(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final spacing = context.streamSpacing; + + return DefaultTextStyle( + style: textTheme.bodyDefault.copyWith(color: colorScheme.textPrimary), + child: SingleChildScrollView( + padding: EdgeInsets.all(spacing.lg), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + const _TypeVariantsSection(), + SizedBox(height: spacing.xl), + const _SizeVariantsSection(), + SizedBox(height: spacing.xl), + const _CountVariantsSection(), + ], + ), + ), + ); +} + +// ============================================================================= +// Type Variants Section +// ============================================================================= + +class _TypeVariantsSection extends StatelessWidget { + const _TypeVariantsSection(); + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final boxShadow = context.streamBoxShadow; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + const _SectionLabel(label: 'TYPE VARIANTS'), + SizedBox(height: spacing.md), + Container( + width: double.infinity, + clipBehavior: Clip.antiAlias, + padding: EdgeInsets.all(spacing.md), + decoration: BoxDecoration( + color: colorScheme.backgroundSurface, + borderRadius: BorderRadius.all(radius.lg), + boxShadow: boxShadow.elevation1, + ), + foregroundDecoration: BoxDecoration( + borderRadius: BorderRadius.all(radius.lg), + border: Border.all(color: colorScheme.borderSubtle), + ), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + Text( + 'Badge types determine background color', + style: textTheme.captionDefault.copyWith( + color: colorScheme.textSecondary, + ), + ), + SizedBox(height: spacing.md), + Row( + children: [ + for (final type in StreamBadgeNotificationType.values) ...[ + _TypeDemo(type: type), + if (type != StreamBadgeNotificationType.values.last) SizedBox(width: spacing.xl), + ], + ], + ), + ], + ), + ), + ], + ); + } +} + +class _TypeDemo extends StatelessWidget { + const _TypeDemo({required this.type}); + + final StreamBadgeNotificationType type; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final spacing = context.streamSpacing; + + return Column( + children: [ + SizedBox( + width: 48, + height: 32, + child: Center( + child: StreamBadgeNotification( + label: '1', + type: type, + ), + ), + ), + SizedBox(height: spacing.sm), + Text( + type.name[0].toUpperCase() + type.name.substring(1), + style: textTheme.metadataEmphasis.copyWith( + color: colorScheme.accentPrimary, + fontFamily: 'monospace', + ), + ), + ], + ); + } +} + +// ============================================================================= +// Size Variants Section +// ============================================================================= + +class _SizeVariantsSection extends StatelessWidget { + const _SizeVariantsSection(); + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final boxShadow = context.streamBoxShadow; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + const _SectionLabel(label: 'SIZE VARIANTS'), + SizedBox(height: spacing.md), + Container( + width: double.infinity, + clipBehavior: Clip.antiAlias, + padding: EdgeInsets.all(spacing.md), + decoration: BoxDecoration( + color: colorScheme.backgroundSurface, + borderRadius: BorderRadius.all(radius.lg), + boxShadow: boxShadow.elevation1, + ), + foregroundDecoration: BoxDecoration( + borderRadius: BorderRadius.all(radius.lg), + border: Border.all(color: colorScheme.borderSubtle), + ), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + Text( + 'Two sizes for different contexts', + style: textTheme.captionDefault.copyWith( + color: colorScheme.textSecondary, + ), + ), + SizedBox(height: spacing.md), + Row( + children: [ + for (final size in StreamBadgeNotificationSize.values) ...[ + _SizeDemo(size: size), + if (size != StreamBadgeNotificationSize.values.last) SizedBox(width: spacing.xl), + ], + ], + ), + ], + ), + ), + ], + ); + } +} + +class _SizeDemo extends StatelessWidget { + const _SizeDemo({required this.size}); + + final StreamBadgeNotificationSize size; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final spacing = context.streamSpacing; + + return Column( + children: [ + SizedBox( + width: 48, + height: 32, + child: Center( + child: StreamBadgeNotification( + label: '5', + size: size, + ), + ), + ), + SizedBox(height: spacing.sm), + Text( + size.name.toUpperCase(), + style: textTheme.metadataEmphasis.copyWith( + color: colorScheme.accentPrimary, + fontFamily: 'monospace', + ), + ), + Text( + '${size.value.toInt()}px', + style: textTheme.metadataDefault.copyWith( + color: colorScheme.textTertiary, + fontFamily: 'monospace', + fontSize: 10, + ), + ), + ], + ); + } +} + +// ============================================================================= +// Count Variants Section +// ============================================================================= + +class _CountVariantsSection extends StatelessWidget { + const _CountVariantsSection(); + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final boxShadow = context.streamBoxShadow; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + const _SectionLabel(label: 'COUNT VARIANTS'), + SizedBox(height: spacing.md), + Container( + width: double.infinity, + clipBehavior: Clip.antiAlias, + padding: EdgeInsets.all(spacing.md), + decoration: BoxDecoration( + color: colorScheme.backgroundSurface, + borderRadius: BorderRadius.all(radius.lg), + boxShadow: boxShadow.elevation1, + ), + foregroundDecoration: BoxDecoration( + borderRadius: BorderRadius.all(radius.lg), + border: Border.all(color: colorScheme.borderSubtle), + ), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + Text( + 'Badge adapts width based on count', + style: textTheme.captionDefault.copyWith( + color: colorScheme.textSecondary, + ), + ), + SizedBox(height: spacing.md), + Wrap( + spacing: spacing.md, + runSpacing: spacing.md, + children: const [ + _CountDemo(count: 1), + _CountDemo(count: 9), + _CountDemo(count: 25), + _CountDemo(count: 99), + _CountDemo(count: 100), + ], + ), + ], + ), + ), + ], + ); + } +} + +class _CountDemo extends StatelessWidget { + const _CountDemo({required this.count}); + + final int count; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final spacing = context.streamSpacing; + + final displayText = count > 99 ? '99+' : '$count'; + + return Column( + children: [ + StreamBadgeNotification(label: displayText), + SizedBox(height: spacing.xs), + Text( + displayText, + style: textTheme.metadataDefault.copyWith( + color: colorScheme.textTertiary, + fontFamily: 'monospace', + ), + ), + ], + ); + } +} + +// ============================================================================= +// Shared Widgets +// ============================================================================= + +class _SectionLabel extends StatelessWidget { + const _SectionLabel({required this.label}); + + final String label; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Container( + padding: EdgeInsets.symmetric(horizontal: spacing.sm, vertical: spacing.xs), + decoration: BoxDecoration( + color: colorScheme.accentPrimary, + borderRadius: BorderRadius.all(radius.xs), + ), + child: Text( + label, + style: textTheme.metadataEmphasis.copyWith( + color: colorScheme.textOnAccent, + letterSpacing: 1, + fontSize: 9, + ), + ), + ); + } +} diff --git a/apps/design_system_gallery/lib/components/badge/stream_online_indicator.dart b/apps/design_system_gallery/lib/components/badge/stream_online_indicator.dart new file mode 100644 index 0000000..1dee61b --- /dev/null +++ b/apps/design_system_gallery/lib/components/badge/stream_online_indicator.dart @@ -0,0 +1,636 @@ +import 'package:flutter/material.dart'; +import 'package:stream_core_flutter/stream_core_flutter.dart'; +import 'package:widgetbook/widgetbook.dart'; +import 'package:widgetbook_annotation/widgetbook_annotation.dart' as widgetbook; + +// ============================================================================= +// Playground +// ============================================================================= + +@widgetbook.UseCase( + name: 'Playground', + type: StreamOnlineIndicator, + path: '[Components]/Badge', +) +Widget buildStreamOnlineIndicatorPlayground(BuildContext context) { + final isOnline = context.knobs.boolean( + label: 'Is Online', + initialValue: true, + description: 'Whether the user is currently online.', + ); + + final size = context.knobs.object.dropdown( + label: 'Size', + options: StreamOnlineIndicatorSize.values, + initialOption: StreamOnlineIndicatorSize.lg, + labelBuilder: (option) => option.name.toUpperCase(), + description: 'The size of the indicator.', + ); + + final withChild = context.knobs.boolean( + label: 'With Child', + description: 'Wrap an avatar as child (Badge-like behavior).', + ); + + final alignment = context.knobs.object.dropdown( + label: 'Alignment', + options: const [ + AlignmentDirectional.topStart, + AlignmentDirectional.topCenter, + AlignmentDirectional.topEnd, + AlignmentDirectional.centerStart, + AlignmentDirectional.center, + AlignmentDirectional.centerEnd, + AlignmentDirectional.bottomStart, + AlignmentDirectional.bottomCenter, + AlignmentDirectional.bottomEnd, + ], + initialOption: AlignmentDirectional.topEnd, + labelBuilder: (option) => switch (option) { + AlignmentDirectional.topStart => 'Top Start', + AlignmentDirectional.topCenter => 'Top Center', + AlignmentDirectional.topEnd => 'Top End', + AlignmentDirectional.centerStart => 'Center Start', + AlignmentDirectional.center => 'Center', + AlignmentDirectional.centerEnd => 'Center End', + AlignmentDirectional.bottomStart => 'Bottom Start', + AlignmentDirectional.bottomCenter => 'Bottom Center', + AlignmentDirectional.bottomEnd => 'Bottom End', + _ => option.toString(), + }, + description: 'Alignment of indicator relative to child (directional for RTL support).', + ); + + final offsetX = context.knobs.double.slider( + label: 'Offset X', + min: -10, + max: 10, + description: 'Horizontal offset for fine-tuning position.', + ); + + final offsetY = context.knobs.double.slider( + label: 'Offset Y', + min: -10, + max: 10, + description: 'Vertical offset for fine-tuning position.', + ); + + if (withChild) { + return Center( + child: StreamOnlineIndicator( + isOnline: isOnline, + size: size, + alignment: alignment, + offset: Offset(offsetX, offsetY), + child: StreamAvatar( + size: StreamAvatarSize.lg, + placeholder: (context) => const Text('AB'), + ), + ), + ); + } + + return Center( + child: StreamOnlineIndicator( + isOnline: isOnline, + size: size, + ), + ); +} + +// ============================================================================= +// Showcase +// ============================================================================= + +@widgetbook.UseCase( + name: 'Showcase', + type: StreamOnlineIndicator, + path: '[Components]/Badge', +) +Widget buildStreamOnlineIndicatorShowcase(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final spacing = context.streamSpacing; + + return DefaultTextStyle( + style: textTheme.bodyDefault.copyWith(color: colorScheme.textPrimary), + child: SingleChildScrollView( + padding: EdgeInsets.all(spacing.lg), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + // Size variants + const _SizeVariantsSection(), + SizedBox(height: spacing.xl), + + // Alignment variants + const _AlignmentVariantsSection(), + SizedBox(height: spacing.xl), + + // Usage patterns + const _UsagePatternsSection(), + ], + ), + ), + ); +} + +// ============================================================================= +// Size Variants Section +// ============================================================================= + +class _SizeVariantsSection extends StatelessWidget { + const _SizeVariantsSection(); + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final boxShadow = context.streamBoxShadow; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + const _SectionLabel(label: 'SIZE VARIANTS'), + SizedBox(height: spacing.md), + Container( + width: double.infinity, + clipBehavior: Clip.antiAlias, + padding: EdgeInsets.all(spacing.md), + decoration: BoxDecoration( + color: colorScheme.backgroundSurface, + borderRadius: BorderRadius.all(radius.lg), + boxShadow: boxShadow.elevation1, + ), + foregroundDecoration: BoxDecoration( + borderRadius: BorderRadius.all(radius.lg), + border: Border.all(color: colorScheme.borderSubtle), + ), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + // Online states + Text( + 'Online', + style: textTheme.captionEmphasis.copyWith( + color: colorScheme.textPrimary, + ), + ), + SizedBox(height: spacing.sm), + Row( + children: [ + for (final size in StreamOnlineIndicatorSize.values) ...[ + _SizeDemo(size: size, isOnline: true), + if (size != StreamOnlineIndicatorSize.values.last) SizedBox(width: spacing.xl), + ], + ], + ), + SizedBox(height: spacing.md), + Divider(color: colorScheme.borderSubtle), + SizedBox(height: spacing.md), + // Offline states + Text( + 'Offline', + style: textTheme.captionEmphasis.copyWith( + color: colorScheme.textPrimary, + ), + ), + SizedBox(height: spacing.sm), + Row( + children: [ + for (final size in StreamOnlineIndicatorSize.values) ...[ + _SizeDemo(size: size, isOnline: false), + if (size != StreamOnlineIndicatorSize.values.last) SizedBox(width: spacing.xl), + ], + ], + ), + ], + ), + ), + ], + ); + } +} + +class _SizeDemo extends StatelessWidget { + const _SizeDemo({required this.size, required this.isOnline}); + + final StreamOnlineIndicatorSize size; + final bool isOnline; + + String _getPixelSize(StreamOnlineIndicatorSize size) { + return switch (size) { + StreamOnlineIndicatorSize.sm => '8px', + StreamOnlineIndicatorSize.md => '12px', + StreamOnlineIndicatorSize.lg => '14px', + StreamOnlineIndicatorSize.xl => '16px', + }; + } + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final spacing = context.streamSpacing; + + return Column( + children: [ + SizedBox( + width: 32, + height: 32, + child: Center( + child: StreamOnlineIndicator( + isOnline: isOnline, + size: size, + ), + ), + ), + SizedBox(height: spacing.sm), + Text( + size.name.toUpperCase(), + style: textTheme.metadataEmphasis.copyWith( + color: colorScheme.accentPrimary, + fontFamily: 'monospace', + ), + ), + Text( + _getPixelSize(size), + style: textTheme.metadataDefault.copyWith( + color: colorScheme.textTertiary, + fontFamily: 'monospace', + fontSize: 10, + ), + ), + ], + ); + } +} + +// ============================================================================= +// Alignment Variants Section +// ============================================================================= + +class _AlignmentVariantsSection extends StatelessWidget { + const _AlignmentVariantsSection(); + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final boxShadow = context.streamBoxShadow; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + const _SectionLabel(label: 'ALIGNMENT VARIANTS'), + SizedBox(height: spacing.md), + Container( + width: double.infinity, + clipBehavior: Clip.antiAlias, + padding: EdgeInsets.all(spacing.md), + decoration: BoxDecoration( + color: colorScheme.backgroundSurface, + borderRadius: BorderRadius.all(radius.lg), + boxShadow: boxShadow.elevation1, + ), + foregroundDecoration: BoxDecoration( + borderRadius: BorderRadius.all(radius.lg), + border: Border.all(color: colorScheme.borderSubtle), + ), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + Text( + 'Badge-like positioning with child', + style: textTheme.captionEmphasis.copyWith( + color: colorScheme.textPrimary, + ), + ), + SizedBox(height: spacing.md), + Wrap( + spacing: spacing.xl, + runSpacing: spacing.lg, + children: const [ + _AlignmentDemo( + alignment: AlignmentDirectional.topStart, + label: 'topStart', + ), + _AlignmentDemo( + alignment: AlignmentDirectional.topEnd, + label: 'topEnd', + ), + _AlignmentDemo( + alignment: AlignmentDirectional.bottomStart, + label: 'bottomStart', + ), + _AlignmentDemo( + alignment: AlignmentDirectional.bottomEnd, + label: 'bottomEnd', + ), + ], + ), + ], + ), + ), + ], + ); + } +} + +class _AlignmentDemo extends StatelessWidget { + const _AlignmentDemo({required this.alignment, required this.label}); + + final AlignmentGeometry alignment; + final String label; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final spacing = context.streamSpacing; + + return Column( + children: [ + StreamOnlineIndicator( + isOnline: true, + size: StreamOnlineIndicatorSize.lg, + alignment: alignment, + child: StreamAvatar( + size: StreamAvatarSize.lg, + placeholder: (context) => const Text('AB'), + ), + ), + SizedBox(height: spacing.sm), + Text( + label, + style: textTheme.metadataEmphasis.copyWith( + color: colorScheme.accentPrimary, + fontFamily: 'monospace', + ), + ), + ], + ); + } +} + +// ============================================================================= +// Usage Patterns Section +// ============================================================================= + +class _UsagePatternsSection extends StatelessWidget { + const _UsagePatternsSection(); + + @override + Widget build(BuildContext context) { + final spacing = context.streamSpacing; + + return Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + const _SectionLabel(label: 'USAGE PATTERNS'), + SizedBox(height: spacing.md), + + // Avatar with indicator + const _ExampleCard( + title: 'Avatar with Status', + description: 'Indicator positioned on avatar corner', + child: Row( + spacing: 24, + children: [ + _AvatarWithIndicator( + name: 'Sarah Chen', + isOnline: true, + ), + _AvatarWithIndicator( + name: 'Alex Kim', + isOnline: true, + ), + _AvatarWithIndicator( + name: 'Jordan Lee', + isOnline: false, + ), + _AvatarWithIndicator( + name: 'Taylor Park', + isOnline: true, + ), + ], + ), + ), + SizedBox(height: spacing.sm), + + // Inline status + const _ExampleCard( + title: 'Inline Status', + description: 'Indicator next to user name', + child: _InlineStatusGroup(), + ), + ], + ); + } +} + +class _AvatarWithIndicator extends StatelessWidget { + const _AvatarWithIndicator({ + required this.name, + required this.isOnline, + }); + + final String name; + final bool isOnline; + + @override + Widget build(BuildContext context) { + final textTheme = context.streamTextTheme; + final colorScheme = context.streamColorScheme; + final spacing = context.streamSpacing; + final initials = name.split(' ').map((n) => n[0]).join(); + + return Column( + children: [ + // Using the new child parameter (Badge-like behavior) + StreamOnlineIndicator( + isOnline: isOnline, + size: StreamOnlineIndicatorSize.lg, + child: StreamAvatar( + size: StreamAvatarSize.lg, + placeholder: (context) => Text(initials), + ), + ), + SizedBox(height: spacing.sm), + Text( + name, + style: textTheme.captionDefault.copyWith( + color: colorScheme.textPrimary, + ), + ), + Text( + isOnline ? 'Online' : 'Offline', + style: textTheme.metadataDefault.copyWith( + color: isOnline ? colorScheme.accentSuccess : colorScheme.textTertiary, + ), + ), + ], + ); + } +} + +class _InlineStatusGroup extends StatelessWidget { + const _InlineStatusGroup(); + + @override + Widget build(BuildContext context) { + final spacing = context.streamSpacing; + + return Column( + crossAxisAlignment: CrossAxisAlignment.stretch, + children: [ + const _InlineStatus(name: 'Online User', isOnline: true), + SizedBox(height: spacing.sm), + const _InlineStatus(name: 'Away User', isOnline: false), + ], + ); + } +} + +class _InlineStatus extends StatelessWidget { + const _InlineStatus({ + required this.name, + required this.isOnline, + }); + + final String name; + final bool isOnline; + + @override + Widget build(BuildContext context) { + final textTheme = context.streamTextTheme; + final colorScheme = context.streamColorScheme; + final spacing = context.streamSpacing; + + return Row( + mainAxisSize: MainAxisSize.min, + children: [ + StreamOnlineIndicator( + isOnline: isOnline, + size: StreamOnlineIndicatorSize.sm, + ), + SizedBox(width: spacing.sm), + Text( + name, + style: textTheme.captionDefault.copyWith( + color: colorScheme.textPrimary, + ), + ), + ], + ); + } +} + +class _ExampleCard extends StatelessWidget { + const _ExampleCard({ + required this.title, + required this.description, + required this.child, + }); + + final String title; + final String description; + final Widget child; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final boxShadow = context.streamBoxShadow; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Container( + width: double.infinity, + clipBehavior: Clip.antiAlias, + decoration: BoxDecoration( + color: colorScheme.backgroundSurfaceSubtle, + borderRadius: BorderRadius.all(radius.lg), + boxShadow: boxShadow.elevation1, + ), + foregroundDecoration: BoxDecoration( + borderRadius: BorderRadius.all(radius.lg), + border: Border.all(color: colorScheme.borderSubtle), + ), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + // Header + Padding( + padding: EdgeInsets.fromLTRB(spacing.md, spacing.sm, spacing.md, spacing.sm), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + Text( + title, + style: textTheme.captionEmphasis.copyWith( + color: colorScheme.textPrimary, + ), + ), + Text( + description, + style: textTheme.metadataDefault.copyWith( + color: colorScheme.textTertiary, + ), + ), + ], + ), + ), + Divider( + height: 1, + color: colorScheme.borderSubtle, + ), + // Content + Container( + padding: EdgeInsets.all(spacing.md), + color: colorScheme.backgroundSurface, + child: child, + ), + ], + ), + ); + } +} + +// ============================================================================= +// Shared Widgets +// ============================================================================= + +class _SectionLabel extends StatelessWidget { + const _SectionLabel({required this.label}); + + final String label; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Container( + padding: EdgeInsets.symmetric(horizontal: spacing.sm, vertical: spacing.xs), + decoration: BoxDecoration( + color: colorScheme.accentPrimary, + borderRadius: BorderRadius.all(radius.xs), + ), + child: Text( + label, + style: textTheme.metadataEmphasis.copyWith( + color: colorScheme.textOnAccent, + letterSpacing: 1, + fontSize: 9, + ), + ), + ); + } +} diff --git a/apps/design_system_gallery/lib/components/buttons/button.dart b/apps/design_system_gallery/lib/components/buttons/button.dart new file mode 100644 index 0000000..2e46a09 --- /dev/null +++ b/apps/design_system_gallery/lib/components/buttons/button.dart @@ -0,0 +1,814 @@ +import 'package:flutter/material.dart'; +import 'package:stream_core_flutter/stream_core_flutter.dart'; +import 'package:widgetbook/widgetbook.dart'; +import 'package:widgetbook_annotation/widgetbook_annotation.dart' as widgetbook; + +// ============================================================================= +// Playground +// ============================================================================= + +@widgetbook.UseCase( + name: 'Playground', + type: StreamButton, + path: '[Components]/Buttons', +) +Widget buildStreamButtonPlayground(BuildContext context) { + return const _PlaygroundDemo(); +} + +class _PlaygroundDemo extends StatefulWidget { + const _PlaygroundDemo(); + + @override + State<_PlaygroundDemo> createState() => _PlaygroundDemoState(); +} + +class _PlaygroundDemoState extends State<_PlaygroundDemo> { + var _isSelected = false; + + @override + Widget build(BuildContext context) { + final label = context.knobs.string( + label: 'Label', + initialValue: 'Click me', + description: 'The text displayed on the button.', + ); + + final style = context.knobs.object.dropdown( + label: 'Style', + options: StreamButtonStyle.values, + initialOption: StreamButtonStyle.primary, + labelBuilder: (option) => option.name, + description: 'Button visual style variant.', + ); + + final type = context.knobs.object.dropdown( + label: 'Type', + options: StreamButtonType.values, + initialOption: StreamButtonType.solid, + labelBuilder: (option) => option.name, + description: 'Button type variant.', + ); + + final size = context.knobs.object.dropdown( + label: 'Size', + options: StreamButtonSize.values, + initialOption: StreamButtonSize.large, + labelBuilder: (option) => option.name, + description: 'Button size preset (affects padding and font size).', + ); + + final isIconOnly = context.knobs.boolean( + label: 'Icon Only', + description: 'Render as a circular icon-only button.', + ); + + final isDisabled = context.knobs.boolean( + label: 'Disabled', + description: 'Whether the button is disabled (non-interactive).', + ); + + final isFloating = + isIconOnly && + context.knobs.boolean( + label: 'Floating', + description: 'Whether the button has a floating (elevated) appearance.', + ); + + final isSelectable = context.knobs.boolean( + label: 'Selectable', + description: 'Whether the button toggles its selected state on tap.', + ); + + final showLeadingIcon = + !isIconOnly && + context.knobs.boolean( + label: 'Leading Icon', + description: 'Show an icon before the label.', + ); + + final showTrailingIcon = + !isIconOnly && + context.knobs.boolean( + label: 'Trailing Icon', + description: 'Show an icon after the label.', + ); + + void onTap() { + if (isSelectable) { + setState(() => _isSelected = !_isSelected); + } + ScaffoldMessenger.of(context) + ..hideCurrentSnackBar() + ..showSnackBar( + SnackBar( + content: Text( + isSelectable ? 'Button ${_isSelected ? 'selected' : 'deselected'}' : 'Button tapped!', + ), + duration: const Duration(seconds: 1), + ), + ); + } + + return Center( + child: isIconOnly + ? StreamButton.icon( + icon: Icons.add, + style: style, + type: type, + size: size, + isFloating: isFloating ? true : null, + isSelected: isSelectable ? _isSelected : null, + onTap: isDisabled ? null : onTap, + ) + : StreamButton( + label: label, + style: style, + type: type, + size: size, + isSelected: isSelectable ? _isSelected : null, + onTap: isDisabled ? null : onTap, + iconLeft: showLeadingIcon ? Icons.add : null, + iconRight: showTrailingIcon ? Icons.arrow_forward : null, + ), + ); + } +} + +// ============================================================================= +// Showcase +// ============================================================================= + +@widgetbook.UseCase( + name: 'Showcase', + type: StreamButton, + path: '[Components]/Buttons', +) +Widget buildStreamButtonShowcase(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final spacing = context.streamSpacing; + + return DefaultTextStyle( + style: textTheme.bodyDefault.copyWith(color: colorScheme.textPrimary), + child: SingleChildScrollView( + padding: EdgeInsets.all(spacing.lg), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + spacing: spacing.xl, + children: const [ + _StyleTypeMatrixSection(), + _SizeScaleSection(), + _RealWorldSection(), + ], + ), + ), + ); +} + +// ============================================================================= +// Style × Type Matrix Section +// ============================================================================= + +class _StyleTypeMatrixSection extends StatelessWidget { + const _StyleTypeMatrixSection(); + + @override + Widget build(BuildContext context) { + final spacing = context.streamSpacing; + + return Column( + crossAxisAlignment: CrossAxisAlignment.start, + spacing: spacing.md, + children: [ + const _SectionLabel(label: 'STYLE × TYPE'), + Column( + spacing: spacing.sm, + children: [ + for (final style in StreamButtonStyle.values) _StyleMatrixCard(style: style), + ], + ), + ], + ); + } +} + +/// A card showing one style's full type matrix, mirroring the Figma layout: +/// +/// ```text +/// ┌── Label ──┐ ┌── Icon ──┐ +/// default off default off +/// solid [btn] [btn] [+] [+] +/// outline [btn] [btn] [+] [+] +/// ghost [btn] [btn] [+] [+] +/// ``` +class _StyleMatrixCard extends StatelessWidget { + const _StyleMatrixCard({required this.style}); + + final StreamButtonStyle style; + + static String _description(StreamButtonStyle style) { + return switch (style) { + StreamButtonStyle.primary => 'Brand/accent color scheme', + StreamButtonStyle.secondary => 'Neutral/surface color scheme', + StreamButtonStyle.destructive => 'Error/danger color scheme', + }; + } + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final boxShadow = context.streamBoxShadow; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Container( + clipBehavior: Clip.antiAlias, + padding: EdgeInsets.all(spacing.md), + decoration: BoxDecoration( + color: colorScheme.backgroundSurfaceSubtle, + borderRadius: BorderRadius.all(radius.lg), + boxShadow: boxShadow.elevation1, + ), + foregroundDecoration: BoxDecoration( + borderRadius: BorderRadius.all(radius.lg), + border: Border.all(color: colorScheme.borderSubtle), + ), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + spacing: spacing.md, + children: [ + // Header + Row( + spacing: spacing.sm, + children: [ + Text( + style.name, + style: textTheme.captionEmphasis.copyWith( + color: colorScheme.textPrimary, + fontFamily: 'monospace', + ), + ), + Expanded( + child: Text( + _description(style), + style: textTheme.captionDefault.copyWith( + color: colorScheme.textTertiary, + ), + ), + ), + ], + ), + // Matrix: column headers + type rows + Column( + spacing: spacing.sm, + children: [ + _MatrixHeaderRow(spacing: spacing, textTheme: textTheme, colorScheme: colorScheme), + for (final type in StreamButtonType.values) _MatrixTypeRow(style: style, type: type), + ], + ), + ], + ), + ); + } +} + +class _MatrixHeaderRow extends StatelessWidget { + const _MatrixHeaderRow({ + required this.spacing, + required this.textTheme, + required this.colorScheme, + }); + + final StreamSpacing spacing; + final StreamTextTheme textTheme; + final StreamColorScheme colorScheme; + + @override + Widget build(BuildContext context) { + final headerStyle = textTheme.metadataDefault.copyWith( + color: colorScheme.textTertiary, + fontSize: 10, + ); + + return Row( + children: [ + const SizedBox(width: 56), + Expanded( + child: Center(child: Text('default', style: headerStyle)), + ), + Expanded( + child: Center(child: Text('disabled', style: headerStyle)), + ), + SizedBox(width: spacing.md), + Expanded( + child: Center(child: Text('default', style: headerStyle)), + ), + Expanded( + child: Center(child: Text('disabled', style: headerStyle)), + ), + ], + ); + } +} + +class _MatrixTypeRow extends StatelessWidget { + const _MatrixTypeRow({required this.style, required this.type}); + + final StreamButtonStyle style; + final StreamButtonType type; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final spacing = context.streamSpacing; + + return Row( + children: [ + // Row label + SizedBox( + width: 56, + child: Text( + type.name, + style: textTheme.metadataEmphasis.copyWith( + color: colorScheme.textSecondary, + fontSize: 10, + ), + ), + ), + // Label button — default + Expanded( + child: Center( + child: StreamButton( + label: 'Label', + style: style, + type: type, + size: StreamButtonSize.small, + onTap: () {}, + ), + ), + ), + // Label button — disabled + Expanded( + child: Center( + child: StreamButton( + label: 'Label', + style: style, + type: type, + size: StreamButtonSize.small, + ), + ), + ), + SizedBox(width: spacing.md), + // Icon button — default + Expanded( + child: Center( + child: StreamButton.icon( + icon: Icons.add, + style: style, + type: type, + size: StreamButtonSize.small, + onTap: () {}, + ), + ), + ), + // Icon button — disabled + Expanded( + child: Center( + child: StreamButton.icon( + icon: Icons.add, + style: style, + type: type, + size: StreamButtonSize.small, + ), + ), + ), + ], + ); + } +} + +// ============================================================================= +// Size Scale Section +// ============================================================================= + +class _SizeScaleSection extends StatelessWidget { + const _SizeScaleSection(); + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final boxShadow = context.streamBoxShadow; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Column( + crossAxisAlignment: CrossAxisAlignment.start, + spacing: spacing.md, + children: [ + const _SectionLabel(label: 'SIZE SCALE'), + Container( + width: double.infinity, + clipBehavior: Clip.antiAlias, + padding: EdgeInsets.all(spacing.md), + decoration: BoxDecoration( + color: colorScheme.backgroundSurfaceSubtle, + borderRadius: BorderRadius.all(radius.lg), + boxShadow: boxShadow.elevation1, + ), + foregroundDecoration: BoxDecoration( + borderRadius: BorderRadius.all(radius.lg), + border: Border.all(color: colorScheme.borderSubtle), + ), + child: Column( + spacing: spacing.lg, + children: [ + // Label buttons + Row( + crossAxisAlignment: CrossAxisAlignment.end, + mainAxisAlignment: MainAxisAlignment.spaceEvenly, + children: [ + for (final size in StreamButtonSize.values) _SizeDemo(size: size, isIconOnly: false), + ], + ), + Divider(color: colorScheme.borderSubtle), + // Icon-only buttons + Row( + crossAxisAlignment: CrossAxisAlignment.end, + mainAxisAlignment: MainAxisAlignment.spaceEvenly, + children: [ + for (final size in StreamButtonSize.values) _SizeDemo(size: size, isIconOnly: true), + ], + ), + ], + ), + ), + ], + ); + } +} + +class _SizeDemo extends StatelessWidget { + const _SizeDemo({required this.size, required this.isIconOnly}); + + final StreamButtonSize size; + final bool isIconOnly; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final spacing = context.streamSpacing; + + return Column( + mainAxisSize: MainAxisSize.min, + children: [ + if (isIconOnly) + StreamButton.icon(icon: Icons.add, size: size, onTap: () {}) + else + StreamButton(label: 'Button', size: size, onTap: () {}), + SizedBox(height: spacing.sm), + Text( + size.name, + style: textTheme.metadataEmphasis.copyWith( + color: colorScheme.accentPrimary, + fontFamily: 'monospace', + ), + ), + Text( + '${size.value.toInt()}px', + style: textTheme.metadataDefault.copyWith( + color: colorScheme.textTertiary, + fontFamily: 'monospace', + fontSize: 10, + ), + ), + ], + ); + } +} + +// ============================================================================= +// Real-World Section +// ============================================================================= + +class _RealWorldSection extends StatelessWidget { + const _RealWorldSection(); + + @override + Widget build(BuildContext context) { + final spacing = context.streamSpacing; + + return Column( + crossAxisAlignment: CrossAxisAlignment.start, + spacing: spacing.md, + children: [ + const _SectionLabel(label: 'REAL-WORLD EXAMPLES'), + Column( + spacing: spacing.sm, + children: const [ + _ExampleCard( + title: 'Delete Dialog', + description: 'Destructive confirmation with visual hierarchy', + child: _DeleteDialogExample(), + ), + _ExampleCard( + title: 'Chat Composer', + description: 'Icon actions alongside a text field', + child: _ChatComposerExample(), + ), + _ExampleCard( + title: 'Empty State', + description: 'CTA with leading icon on a blank screen', + child: _EmptyStateExample(), + ), + ], + ), + ], + ); + } +} + +class _DeleteDialogExample extends StatelessWidget { + const _DeleteDialogExample(); + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final spacing = context.streamSpacing; + + return Column( + mainAxisSize: MainAxisSize.min, + children: [ + // Icon badge + Container( + width: 48, + height: 48, + decoration: BoxDecoration( + color: colorScheme.accentError.withValues(alpha: 0.1), + shape: BoxShape.circle, + ), + child: Icon( + Icons.delete_outline, + color: colorScheme.accentError, + size: 24, + ), + ), + SizedBox(height: spacing.md), + Text( + 'Delete this conversation?', + style: textTheme.headingXs.copyWith( + color: colorScheme.textPrimary, + ), + textAlign: TextAlign.center, + ), + SizedBox(height: spacing.xs), + Text( + 'This will permanently remove all messages and attachments. This action cannot be undone.', + style: textTheme.captionDefault.copyWith( + color: colorScheme.textSecondary, + ), + textAlign: TextAlign.center, + ), + SizedBox(height: spacing.lg), + // Buttons — full width, stacked + SizedBox( + width: double.infinity, + child: StreamButton( + label: 'Delete Conversation', + style: StreamButtonStyle.destructive, + size: StreamButtonSize.large, + iconLeft: Icons.delete_outline, + onTap: () {}, + ), + ), + SizedBox(height: spacing.sm), + SizedBox( + width: double.infinity, + child: StreamButton( + label: 'Cancel', + style: StreamButtonStyle.secondary, + type: StreamButtonType.outline, + size: StreamButtonSize.large, + onTap: () {}, + ), + ), + ], + ); + } +} + +class _ChatComposerExample extends StatelessWidget { + const _ChatComposerExample(); + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Container( + padding: EdgeInsets.symmetric( + horizontal: spacing.sm, + vertical: spacing.xs, + ), + decoration: BoxDecoration( + color: colorScheme.backgroundSurfaceSubtle, + borderRadius: BorderRadius.all(radius.lg), + border: Border.all(color: colorScheme.borderDefault), + ), + child: Row( + children: [ + StreamButton.icon( + icon: Icons.add_circle_outline, + style: StreamButtonStyle.secondary, + type: StreamButtonType.ghost, + size: StreamButtonSize.small, + onTap: () {}, + ), + SizedBox(width: spacing.xs), + Expanded( + child: Text( + 'Type a message…', + style: textTheme.bodyDefault.copyWith( + color: colorScheme.textTertiary, + ), + ), + ), + SizedBox(width: spacing.xs), + StreamButton.icon( + icon: Icons.emoji_emotions_outlined, + style: StreamButtonStyle.secondary, + type: StreamButtonType.ghost, + size: StreamButtonSize.small, + onTap: () {}, + ), + SizedBox(width: spacing.xxs), + StreamButton.icon( + icon: Icons.send, + size: StreamButtonSize.small, + onTap: () {}, + ), + ], + ), + ); + } +} + +class _EmptyStateExample extends StatelessWidget { + const _EmptyStateExample(); + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final spacing = context.streamSpacing; + + return Center( + child: Column( + mainAxisSize: MainAxisSize.min, + children: [ + Icon( + Icons.chat_bubble_outline, + size: 48, + color: colorScheme.textTertiary, + ), + SizedBox(height: spacing.md), + Text( + 'No conversations yet', + style: textTheme.headingSm.copyWith( + color: colorScheme.textPrimary, + ), + ), + SizedBox(height: spacing.xs), + Text( + 'Start a new conversation to begin chatting.', + style: textTheme.captionDefault.copyWith( + color: colorScheme.textSecondary, + ), + textAlign: TextAlign.center, + ), + SizedBox(height: spacing.lg), + StreamButton( + label: 'New Conversation', + iconLeft: Icons.add, + onTap: () {}, + ), + ], + ), + ); + } +} + +// ============================================================================= +// Shared Widgets +// ============================================================================= + +class _ExampleCard extends StatelessWidget { + const _ExampleCard({ + required this.title, + required this.description, + required this.child, + }); + + final String title; + final String description; + final Widget child; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final boxShadow = context.streamBoxShadow; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Container( + width: double.infinity, + clipBehavior: Clip.antiAlias, + decoration: BoxDecoration( + color: colorScheme.backgroundSurfaceSubtle, + borderRadius: BorderRadius.all(radius.lg), + boxShadow: boxShadow.elevation1, + ), + foregroundDecoration: BoxDecoration( + borderRadius: BorderRadius.all(radius.lg), + border: Border.all(color: colorScheme.borderSubtle), + ), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + Padding( + padding: EdgeInsets.fromLTRB( + spacing.md, + spacing.sm, + spacing.md, + spacing.sm, + ), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + Text( + title, + style: textTheme.captionEmphasis.copyWith( + color: colorScheme.textPrimary, + ), + ), + Text( + description, + style: textTheme.metadataDefault.copyWith( + color: colorScheme.textTertiary, + ), + ), + ], + ), + ), + Divider(height: 1, color: colorScheme.borderSubtle), + Container( + width: double.infinity, + padding: EdgeInsets.all(spacing.md), + color: colorScheme.backgroundSurfaceSubtle, + child: child, + ), + ], + ), + ); + } +} + +class _SectionLabel extends StatelessWidget { + const _SectionLabel({required this.label}); + + final String label; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Container( + padding: EdgeInsets.symmetric( + horizontal: spacing.sm, + vertical: spacing.xs, + ), + decoration: BoxDecoration( + color: colorScheme.accentPrimary, + borderRadius: BorderRadius.all(radius.xs), + ), + child: Text( + label, + style: textTheme.metadataEmphasis.copyWith( + color: colorScheme.textOnAccent, + letterSpacing: 1, + fontSize: 9, + ), + ), + ); + } +} diff --git a/apps/design_system_gallery/lib/components/buttons/stream_emoji_button.dart b/apps/design_system_gallery/lib/components/buttons/stream_emoji_button.dart new file mode 100644 index 0000000..b6f92be --- /dev/null +++ b/apps/design_system_gallery/lib/components/buttons/stream_emoji_button.dart @@ -0,0 +1,550 @@ +import 'package:flutter/material.dart'; +import 'package:stream_core_flutter/stream_core_flutter.dart'; +import 'package:unicode_emojis/unicode_emojis.dart'; +import 'package:widgetbook/widgetbook.dart'; +import 'package:widgetbook_annotation/widgetbook_annotation.dart' as widgetbook; + +// ============================================================================= +// Playground +// ============================================================================= + +@widgetbook.UseCase( + name: 'Playground', + type: StreamEmojiButton, + path: '[Components]/Buttons', +) +Widget buildStreamEmojiButtonPlayground(BuildContext context) { + return const _PlaygroundDemo(); +} + +class _PlaygroundDemo extends StatefulWidget { + const _PlaygroundDemo(); + + @override + State<_PlaygroundDemo> createState() => _PlaygroundDemoState(); +} + +class _PlaygroundDemoState extends State<_PlaygroundDemo> { + var _isSelected = false; + + @override + Widget build(BuildContext context) { + final size = context.knobs.object.dropdown( + label: 'Size', + options: StreamEmojiButtonSize.values, + initialOption: StreamEmojiButtonSize.lg, + labelBuilder: (option) => '${option.name.toUpperCase()} (${option.value.toInt()}px)', + description: 'Button size preset.', + ); + + final emoji = context.knobs.object.dropdown( + label: 'Emoji', + options: _sampleEmojis, + initialOption: _sampleEmojis.first, + labelBuilder: (option) => '${option.emoji} ${option.name}', + description: 'The emoji to display.', + ); + + final isDisabled = context.knobs.boolean( + label: 'Disabled', + description: 'Whether the button is disabled (non-interactive).', + ); + + return Center( + child: StreamEmojiButton( + size: size, + emoji: Text(emoji.emoji), + isSelected: _isSelected, + onPressed: isDisabled + ? null + : () { + setState(() => _isSelected = !_isSelected); + ScaffoldMessenger.of(context) + ..hideCurrentSnackBar() + ..showSnackBar( + SnackBar( + content: Text('${emoji.emoji} ${emoji.name} ${_isSelected ? 'selected' : 'deselected'}'), + duration: const Duration(seconds: 1), + ), + ); + }, + ), + ); + } +} + +// ============================================================================= +// Showcase +// ============================================================================= + +@widgetbook.UseCase( + name: 'Showcase', + type: StreamEmojiButton, + path: '[Components]/Buttons', +) +Widget buildStreamEmojiButtonShowcase(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final spacing = context.streamSpacing; + + return DefaultTextStyle( + style: textTheme.bodyDefault.copyWith(color: colorScheme.textPrimary), + child: SingleChildScrollView( + padding: EdgeInsets.all(spacing.lg), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + const _SizeVariantsSection(), + SizedBox(height: spacing.xl), + const _StateVariantsSection(), + SizedBox(height: spacing.xl), + const _EmojiGridSection(), + SizedBox(height: spacing.xl), + const _WithIconsSection(), + ], + ), + ), + ); +} + +// ============================================================================= +// Size Variants Section +// ============================================================================= + +class _SizeVariantsSection extends StatelessWidget { + const _SizeVariantsSection(); + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final boxShadow = context.streamBoxShadow; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + const _SectionLabel(label: 'SIZE VARIANTS'), + SizedBox(height: spacing.md), + Container( + width: double.infinity, + clipBehavior: Clip.antiAlias, + padding: EdgeInsets.all(spacing.md), + decoration: BoxDecoration( + color: colorScheme.backgroundSurface, + borderRadius: BorderRadius.all(radius.lg), + boxShadow: boxShadow.elevation1, + ), + foregroundDecoration: BoxDecoration( + borderRadius: BorderRadius.all(radius.lg), + border: Border.all(color: colorScheme.borderSubtle), + ), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + Text( + 'Button sizes with embedded emoji scaling', + style: textTheme.captionDefault.copyWith( + color: colorScheme.textSecondary, + ), + ), + SizedBox(height: spacing.md), + Row( + children: [ + for (final size in StreamEmojiButtonSize.values) ...[ + _SizeDemo(size: size), + if (size != StreamEmojiButtonSize.values.last) SizedBox(width: spacing.xl), + ], + ], + ), + ], + ), + ), + ], + ); + } +} + +class _SizeDemo extends StatelessWidget { + const _SizeDemo({required this.size}); + + final StreamEmojiButtonSize size; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final spacing = context.streamSpacing; + + return Column( + children: [ + StreamEmojiButton( + size: size, + emoji: const Text('👍'), + onPressed: () {}, + ), + SizedBox(height: spacing.sm), + Text( + size.name.toUpperCase(), + style: textTheme.metadataEmphasis.copyWith( + color: colorScheme.accentPrimary, + fontFamily: 'monospace', + ), + ), + Text( + '${size.value.toInt()}px', + style: textTheme.metadataDefault.copyWith( + color: colorScheme.textTertiary, + fontFamily: 'monospace', + fontSize: 10, + ), + ), + ], + ); + } +} + +// ============================================================================= +// State Variants Section +// ============================================================================= + +class _StateVariantsSection extends StatelessWidget { + const _StateVariantsSection(); + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final boxShadow = context.streamBoxShadow; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + const _SectionLabel(label: 'STATE VARIANTS'), + SizedBox(height: spacing.md), + Container( + width: double.infinity, + clipBehavior: Clip.antiAlias, + padding: EdgeInsets.all(spacing.md), + decoration: BoxDecoration( + color: colorScheme.backgroundSurface, + borderRadius: BorderRadius.all(radius.lg), + boxShadow: boxShadow.elevation1, + ), + foregroundDecoration: BoxDecoration( + borderRadius: BorderRadius.all(radius.lg), + border: Border.all(color: colorScheme.borderSubtle), + ), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + Text( + 'Interactive states: default, hover, pressed, disabled, selected', + style: textTheme.captionDefault.copyWith( + color: colorScheme.textSecondary, + ), + ), + SizedBox(height: spacing.xs), + Text( + 'Focused state (blue border) appears during keyboard navigation', + style: textTheme.metadataDefault.copyWith( + color: colorScheme.textTertiary, + ), + ), + SizedBox(height: spacing.md), + Wrap( + spacing: spacing.lg, + runSpacing: spacing.md, + children: const [ + _StateDemo( + label: 'Default', + enabled: true, + initialSelected: false, + ), + _StateDemo( + label: 'Disabled', + enabled: false, + initialSelected: false, + ), + _StateDemo( + label: 'Selected', + enabled: true, + initialSelected: true, + ), + ], + ), + ], + ), + ), + ], + ); + } +} + +class _StateDemo extends StatefulWidget { + const _StateDemo({ + required this.label, + required this.enabled, + required this.initialSelected, + }); + + final String label; + final bool enabled; + final bool initialSelected; + + @override + State<_StateDemo> createState() => _StateDemoState(); +} + +class _StateDemoState extends State<_StateDemo> { + late bool _isSelected; + + @override + void initState() { + super.initState(); + _isSelected = widget.initialSelected; + } + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final spacing = context.streamSpacing; + + return Column( + children: [ + StreamEmojiButton( + size: StreamEmojiButtonSize.lg, + emoji: const Text('👍'), + isSelected: _isSelected, + onPressed: widget.enabled + ? () { + if (widget.label != 'Disabled') { + setState(() => _isSelected = !_isSelected); + } + } + : null, + ), + SizedBox(height: spacing.sm), + Text( + widget.label, + style: textTheme.metadataEmphasis.copyWith( + color: colorScheme.accentPrimary, + fontFamily: 'monospace', + ), + ), + ], + ); + } +} + +// ============================================================================= +// Emoji Grid Section +// ============================================================================= + +class _EmojiGridSection extends StatelessWidget { + const _EmojiGridSection(); + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final boxShadow = context.streamBoxShadow; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + const _SectionLabel(label: 'EMOJI GRID'), + SizedBox(height: spacing.md), + Container( + width: double.infinity, + clipBehavior: Clip.antiAlias, + padding: EdgeInsets.all(spacing.md), + decoration: BoxDecoration( + color: colorScheme.backgroundSurface, + borderRadius: BorderRadius.all(radius.lg), + boxShadow: boxShadow.elevation1, + ), + foregroundDecoration: BoxDecoration( + borderRadius: BorderRadius.all(radius.lg), + border: Border.all(color: colorScheme.borderSubtle), + ), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + Text( + 'Interactive emoji picker pattern', + style: textTheme.captionDefault.copyWith( + color: colorScheme.textSecondary, + ), + ), + SizedBox(height: spacing.md), + Wrap( + spacing: spacing.xs, + runSpacing: spacing.xs, + children: [ + for (final emoji in _sampleEmojis) + StreamEmojiButton( + size: StreamEmojiButtonSize.lg, + emoji: Text(emoji.emoji), + onPressed: () { + ScaffoldMessenger.of(context) + ..hideCurrentSnackBar() + ..showSnackBar( + SnackBar( + content: Text('${emoji.emoji} ${emoji.name}'), + duration: const Duration(seconds: 1), + ), + ); + }, + ), + ], + ), + ], + ), + ), + ], + ); + } +} + +// ============================================================================= +// With Icons Section +// ============================================================================= + +class _WithIconsSection extends StatelessWidget { + const _WithIconsSection(); + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final boxShadow = context.streamBoxShadow; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + const _SectionLabel(label: 'WITH ICONS'), + SizedBox(height: spacing.md), + Container( + width: double.infinity, + clipBehavior: Clip.antiAlias, + padding: EdgeInsets.all(spacing.md), + decoration: BoxDecoration( + color: colorScheme.backgroundSurface, + borderRadius: BorderRadius.all(radius.lg), + boxShadow: boxShadow.elevation1, + ), + foregroundDecoration: BoxDecoration( + borderRadius: BorderRadius.all(radius.lg), + border: Border.all(color: colorScheme.borderSubtle), + ), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + Text( + 'Using Material Icons instead of emoji', + style: textTheme.captionDefault.copyWith( + color: colorScheme.textSecondary, + ), + ), + SizedBox(height: spacing.md), + Wrap( + spacing: spacing.xs, + runSpacing: spacing.xs, + children: [ + for (final iconData in _sampleIcons) + StreamEmojiButton( + size: StreamEmojiButtonSize.lg, + emoji: Icon(iconData, color: colorScheme.textPrimary), + onPressed: () {}, + ), + ], + ), + ], + ), + ), + ], + ); + } +} + +// ============================================================================= +// Shared Widgets +// ============================================================================= + +class _SectionLabel extends StatelessWidget { + const _SectionLabel({required this.label}); + + final String label; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Container( + padding: EdgeInsets.symmetric( + horizontal: spacing.sm, + vertical: spacing.xs, + ), + decoration: BoxDecoration( + color: colorScheme.accentPrimary, + borderRadius: BorderRadius.all(radius.xs), + ), + child: Text( + label, + style: textTheme.metadataEmphasis.copyWith( + color: colorScheme.textOnAccent, + letterSpacing: 1, + fontSize: 9, + ), + ), + ); + } +} + +// ============================================================================= +// Helpers +// ============================================================================= + +Emoji _byName(String name) => UnicodeEmojis.allEmojis.firstWhere((e) => e.name == name); + +final _sampleEmojis = [ + _byName('thumbs up sign'), + _byName('heavy black heart'), + _byName('face with tears of joy'), + _byName('fire'), + _byName('clapping hands sign'), + _byName('thinking face'), + _byName('eyes'), + _byName('rocket'), + _byName('party popper'), + _byName('waving hand sign'), + _byName('white medium star'), + _byName('white heavy check mark'), +]; + +const _sampleIcons = [ + Icons.thumb_up, + Icons.favorite, + Icons.sentiment_very_satisfied, + Icons.local_fire_department, + Icons.celebration, + Icons.lightbulb, + Icons.visibility, + Icons.rocket_launch, + Icons.star, + Icons.check_circle, + Icons.emoji_emotions, + Icons.cake, +]; diff --git a/apps/design_system_gallery/lib/components/common/stream_checkbox.dart b/apps/design_system_gallery/lib/components/common/stream_checkbox.dart new file mode 100644 index 0000000..5833171 --- /dev/null +++ b/apps/design_system_gallery/lib/components/common/stream_checkbox.dart @@ -0,0 +1,810 @@ +import 'package:flutter/material.dart'; +import 'package:stream_core_flutter/stream_core_flutter.dart'; +import 'package:widgetbook/widgetbook.dart'; +import 'package:widgetbook_annotation/widgetbook_annotation.dart' as widgetbook; + +// ============================================================================= +// Playground +// ============================================================================= + +@widgetbook.UseCase( + name: 'Playground', + type: StreamCheckbox, + path: '[Components]/Common', +) +Widget buildStreamCheckboxPlayground(BuildContext context) { + final spacing = context.streamSpacing; + + final value = context.knobs.boolean( + label: 'Checked', + description: 'Whether the checkbox is checked.', + ); + + final enabled = context.knobs.boolean( + label: 'Enabled', + initialValue: true, + description: 'Whether the checkbox responds to input.', + ); + + final size = context.knobs.object.dropdown( + label: 'Size', + initialOption: StreamCheckboxSize.md, + options: StreamCheckboxSize.values, + labelBuilder: (size) => switch (size) { + StreamCheckboxSize.sm => 'Small (20px)', + StreamCheckboxSize.md => 'Medium (24px)', + }, + description: 'The size of the checkbox.', + ); + + final shape = context.knobs.object.dropdown( + label: 'Shape', + initialOption: 'Checkbox', + options: ['Checkbox', 'Radio Check'], + labelBuilder: (s) => s, + description: 'The shape variant of the checkbox.', + ); + + final isRadioCheck = shape == 'Radio Check'; + + return Center( + child: Column( + mainAxisSize: MainAxisSize.min, + spacing: spacing.md, + children: [ + if (isRadioCheck) + StreamCheckbox.circular( + value: value, + size: size, + onChanged: enabled ? (_) {} : null, + ) + else + StreamCheckbox( + value: value, + size: size, + onChanged: enabled ? (_) {} : null, + ), + ], + ), + ); +} + +// ============================================================================= +// Showcase +// ============================================================================= + +@widgetbook.UseCase( + name: 'Showcase', + type: StreamCheckbox, + path: '[Components]/Common', +) +Widget buildStreamCheckboxShowcase(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final spacing = context.streamSpacing; + + return DefaultTextStyle( + style: textTheme.bodyDefault.copyWith(color: colorScheme.textPrimary), + child: SingleChildScrollView( + padding: EdgeInsets.all(spacing.lg), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + const _StatesSection(), + SizedBox(height: spacing.xl), + const _SizesSection(), + SizedBox(height: spacing.xl), + const _CircleVariantSection(), + SizedBox(height: spacing.xl), + const _InteractiveSection(), + SizedBox(height: spacing.xl), + const _ThemeCustomizationSection(), + ], + ), + ), + ); +} + +// ============================================================================= +// States Section +// ============================================================================= + +class _StatesSection extends StatelessWidget { + const _StatesSection(); + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final boxShadow = context.streamBoxShadow; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + const _SectionLabel(label: 'STATES'), + SizedBox(height: spacing.md), + Container( + width: double.infinity, + clipBehavior: Clip.antiAlias, + padding: EdgeInsets.all(spacing.md), + decoration: BoxDecoration( + color: colorScheme.backgroundSurfaceSubtle, + borderRadius: BorderRadius.all(radius.lg), + boxShadow: boxShadow.elevation1, + ), + foregroundDecoration: BoxDecoration( + borderRadius: BorderRadius.all(radius.lg), + border: Border.all(color: colorScheme.borderSubtle), + ), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + spacing: spacing.md, + children: [ + _StateDemo( + label: 'Unchecked', + description: 'Default unselected state', + child: StreamCheckbox(value: false, onChanged: (_) {}), + ), + Divider(height: 1, color: colorScheme.borderSubtle), + _StateDemo( + label: 'Checked', + description: 'Selected with checkmark', + child: StreamCheckbox(value: true, onChanged: (_) {}), + ), + Divider(height: 1, color: colorScheme.borderSubtle), + _StateDemo( + label: 'Disabled Unchecked', + description: 'Non-interactive unselected state', + child: StreamCheckbox(value: false, onChanged: null), + ), + Divider(height: 1, color: colorScheme.borderSubtle), + _StateDemo( + label: 'Disabled Checked', + description: 'Non-interactive selected state', + child: StreamCheckbox(value: true, onChanged: null), + ), + ], + ), + ), + ], + ); + } +} + +class _StateDemo extends StatelessWidget { + const _StateDemo({ + required this.label, + required this.description, + required this.child, + }); + + final String label; + final String description; + final Widget child; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final spacing = context.streamSpacing; + + return Row( + spacing: spacing.md, + children: [ + child, + Expanded( + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + Text( + label, + style: textTheme.captionEmphasis.copyWith( + color: colorScheme.textPrimary, + ), + ), + Text( + description, + style: textTheme.metadataDefault.copyWith( + color: colorScheme.textTertiary, + ), + ), + ], + ), + ), + ], + ); + } +} + +// ============================================================================= +// Sizes Section +// ============================================================================= + +class _SizesSection extends StatelessWidget { + const _SizesSection(); + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final boxShadow = context.streamBoxShadow; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + const _SectionLabel(label: 'SIZES'), + SizedBox(height: spacing.md), + Container( + width: double.infinity, + clipBehavior: Clip.antiAlias, + padding: EdgeInsets.all(spacing.md), + decoration: BoxDecoration( + color: colorScheme.backgroundSurfaceSubtle, + borderRadius: BorderRadius.all(radius.lg), + boxShadow: boxShadow.elevation1, + ), + foregroundDecoration: BoxDecoration( + borderRadius: BorderRadius.all(radius.lg), + border: Border.all(color: colorScheme.borderSubtle), + ), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + Text( + 'Checkbox sizes: small (20px) and medium (24px)', + style: textTheme.captionDefault.copyWith( + color: colorScheme.textSecondary, + ), + ), + SizedBox(height: spacing.md), + for (final size in StreamCheckboxSize.values) ...[ + _SizeDemo(size: size), + if (size != StreamCheckboxSize.values.last) SizedBox(height: spacing.md), + ], + ], + ), + ), + ], + ); + } +} + +class _SizeDemo extends StatelessWidget { + const _SizeDemo({required this.size}); + + final StreamCheckboxSize size; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final spacing = context.streamSpacing; + + return Row( + spacing: spacing.md, + children: [ + SizedBox( + width: 56, + child: Text( + '${size.name} (${size.value.toInt()}px)', + style: textTheme.metadataEmphasis.copyWith( + color: colorScheme.accentPrimary, + fontFamily: 'monospace', + ), + ), + ), + StreamCheckbox(value: false, size: size, onChanged: (_) {}), + StreamCheckbox(value: true, size: size, onChanged: (_) {}), + StreamCheckbox(value: false, size: size, onChanged: null), + StreamCheckbox(value: true, size: size, onChanged: null), + ], + ); + } +} + +// ============================================================================= +// Circular Variant Section +// ============================================================================= + +class _CircleVariantSection extends StatelessWidget { + const _CircleVariantSection(); + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final boxShadow = context.streamBoxShadow; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + const _SectionLabel(label: 'CIRCULAR VARIANT'), + SizedBox(height: spacing.md), + Container( + width: double.infinity, + clipBehavior: Clip.antiAlias, + padding: EdgeInsets.all(spacing.md), + decoration: BoxDecoration( + color: colorScheme.backgroundSurfaceSubtle, + borderRadius: BorderRadius.all(radius.lg), + boxShadow: boxShadow.elevation1, + ), + foregroundDecoration: BoxDecoration( + borderRadius: BorderRadius.all(radius.lg), + border: Border.all(color: colorScheme.borderSubtle), + ), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + spacing: spacing.md, + children: [ + _StateDemo( + label: 'Unselected', + description: 'Circular unselected state', + child: StreamCheckbox.circular( + value: false, + onChanged: (_) {}, + ), + ), + Divider(height: 1, color: colorScheme.borderSubtle), + _StateDemo( + label: 'Selected', + description: 'Circular selected with checkmark', + child: StreamCheckbox.circular( + value: true, + onChanged: (_) {}, + ), + ), + Divider(height: 1, color: colorScheme.borderSubtle), + _StateDemo( + label: 'Disabled Unselected', + description: 'Non-interactive circular state', + child: StreamCheckbox.circular( + value: false, + onChanged: null, + ), + ), + Divider(height: 1, color: colorScheme.borderSubtle), + _StateDemo( + label: 'Disabled Selected', + description: 'Non-interactive circular selected state', + child: StreamCheckbox.circular( + value: true, + onChanged: null, + ), + ), + ], + ), + ), + ], + ); + } +} + +// ============================================================================= +// Interactive Section +// ============================================================================= + +class _InteractiveSection extends StatelessWidget { + const _InteractiveSection(); + + @override + Widget build(BuildContext context) { + final spacing = context.streamSpacing; + + return Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + const _SectionLabel(label: 'INTERACTIVE'), + SizedBox(height: spacing.md), + const _ExampleCard( + title: 'Toggle Demo', + description: 'Tap the checkboxes to toggle them', + child: _ToggleDemo(), + ), + SizedBox(height: spacing.sm), + const _ExampleCard( + title: 'Checklist', + description: 'A common usage pattern for checkboxes', + child: _ChecklistExample(), + ), + SizedBox(height: spacing.sm), + const _ExampleCard( + title: 'Single Selection', + description: 'Circular variant for radio-like selection', + child: _SingleSelectionExample(), + ), + ], + ); + } +} + +class _ToggleDemo extends StatefulWidget { + const _ToggleDemo(); + + @override + State<_ToggleDemo> createState() => _ToggleDemoState(); +} + +class _ToggleDemoState extends State<_ToggleDemo> { + var _value1 = false; + var _value2 = true; + + @override + Widget build(BuildContext context) { + final spacing = context.streamSpacing; + + return Row( + spacing: spacing.lg, + children: [ + StreamCheckbox( + value: _value1, + onChanged: (v) => setState(() => _value1 = v), + ), + StreamCheckbox( + value: _value2, + onChanged: (v) => setState(() => _value2 = v), + ), + StreamCheckbox( + value: _value1, + size: StreamCheckboxSize.sm, + onChanged: (v) => setState(() => _value1 = v), + ), + StreamCheckbox( + value: _value2, + size: StreamCheckboxSize.sm, + onChanged: (v) => setState(() => _value2 = v), + ), + ], + ); + } +} + +class _ChecklistExample extends StatefulWidget { + const _ChecklistExample(); + + @override + State<_ChecklistExample> createState() => _ChecklistExampleState(); +} + +class _ChecklistExampleState extends State<_ChecklistExample> { + final _items = [ + (label: 'Design review', checked: true), + (label: 'Update documentation', checked: false), + (label: 'Write unit tests', checked: false), + (label: 'Deploy to staging', checked: false), + ]; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final spacing = context.streamSpacing; + + return Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + for (var i = 0; i < _items.length; i++) ...[ + Row( + spacing: spacing.sm, + children: [ + StreamCheckbox( + value: _items[i].checked, + onChanged: (v) { + setState(() { + _items[i] = (label: _items[i].label, checked: v); + }); + }, + ), + Expanded( + child: Text( + _items[i].label, + style: textTheme.bodyDefault.copyWith( + color: _items[i].checked ? colorScheme.textTertiary : colorScheme.textPrimary, + decoration: _items[i].checked ? TextDecoration.lineThrough : null, + ), + ), + ), + ], + ), + if (i < _items.length - 1) SizedBox(height: spacing.sm), + ], + ], + ); + } +} + +class _SingleSelectionExample extends StatefulWidget { + const _SingleSelectionExample(); + + @override + State<_SingleSelectionExample> createState() => _SingleSelectionExampleState(); +} + +class _SingleSelectionExampleState extends State<_SingleSelectionExample> { + var _selectedIndex = 0; + + static const _options = [ + 'Light mode', + 'Dark mode', + 'System default', + ]; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final spacing = context.streamSpacing; + + return Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + for (var i = 0; i < _options.length; i++) ...[ + Row( + spacing: spacing.sm, + children: [ + StreamCheckbox.circular( + value: _selectedIndex == i, + onChanged: (_) => setState(() => _selectedIndex = i), + ), + Expanded( + child: Text( + _options[i], + style: textTheme.bodyDefault.copyWith( + color: colorScheme.textPrimary, + ), + ), + ), + ], + ), + if (i < _options.length - 1) SizedBox(height: spacing.sm), + ], + ], + ); + } +} + +// ============================================================================= +// Theme Customization Section +// ============================================================================= + +class _ThemeCustomizationSection extends StatelessWidget { + const _ThemeCustomizationSection(); + + @override + Widget build(BuildContext context) { + final spacing = context.streamSpacing; + + return Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + const _SectionLabel(label: 'THEME CUSTOMIZATION'), + SizedBox(height: spacing.md), + const _ExampleCard( + title: 'Custom Colors', + description: 'Overriding fill and check colors via theme', + child: _CustomColorsDemo(), + ), + SizedBox(height: spacing.sm), + const _ExampleCard( + title: 'Custom Shape', + description: 'Default vs circular variant side by side', + child: _CustomShapeDemo(), + ), + ], + ); + } +} + +class _CustomColorsDemo extends StatefulWidget { + const _CustomColorsDemo(); + + @override + State<_CustomColorsDemo> createState() => _CustomColorsDemoState(); +} + +class _CustomColorsDemoState extends State<_CustomColorsDemo> { + var _value = true; + + @override + Widget build(BuildContext context) { + final spacing = context.streamSpacing; + + return Row( + spacing: spacing.lg, + children: [ + StreamCheckboxTheme( + data: StreamCheckboxThemeData( + style: StreamCheckboxStyle( + fillColor: WidgetStateProperty.resolveWith((states) { + if (states.contains(WidgetState.selected)) { + return Colors.green; + } + return Colors.transparent; + }), + ), + ), + child: StreamCheckbox( + value: _value, + onChanged: (v) => setState(() => _value = v), + ), + ), + StreamCheckboxTheme( + data: StreamCheckboxThemeData( + style: StreamCheckboxStyle( + fillColor: WidgetStateProperty.resolveWith((states) { + if (states.contains(WidgetState.selected)) { + return Colors.deepOrange; + } + return Colors.transparent; + }), + ), + ), + child: StreamCheckbox( + value: _value, + onChanged: (v) => setState(() => _value = v), + ), + ), + StreamCheckboxTheme( + data: StreamCheckboxThemeData( + style: StreamCheckboxStyle( + fillColor: WidgetStateProperty.resolveWith((states) { + if (states.contains(WidgetState.selected)) { + return Colors.purple; + } + return Colors.transparent; + }), + ), + ), + child: StreamCheckbox( + value: _value, + onChanged: (v) => setState(() => _value = v), + ), + ), + ], + ); + } +} + +class _CustomShapeDemo extends StatefulWidget { + const _CustomShapeDemo(); + + @override + State<_CustomShapeDemo> createState() => _CustomShapeDemoState(); +} + +class _CustomShapeDemoState extends State<_CustomShapeDemo> { + var _rounded = true; + var _circle = false; + + @override + Widget build(BuildContext context) { + final spacing = context.streamSpacing; + + return Row( + spacing: spacing.lg, + children: [ + StreamCheckbox( + value: _rounded, + onChanged: (v) => setState(() => _rounded = v), + ), + StreamCheckbox.circular( + value: _circle, + onChanged: (v) => setState(() => _circle = v), + ), + ], + ); + } +} + +// ============================================================================= +// Shared Widgets +// ============================================================================= + +class _ExampleCard extends StatelessWidget { + const _ExampleCard({ + required this.title, + required this.description, + required this.child, + }); + + final String title; + final String description; + final Widget child; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final boxShadow = context.streamBoxShadow; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Container( + width: double.infinity, + clipBehavior: Clip.antiAlias, + decoration: BoxDecoration( + color: colorScheme.backgroundSurfaceSubtle, + borderRadius: BorderRadius.all(radius.lg), + boxShadow: boxShadow.elevation1, + ), + foregroundDecoration: BoxDecoration( + borderRadius: BorderRadius.all(radius.lg), + border: Border.all(color: colorScheme.borderSubtle), + ), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + Padding( + padding: EdgeInsets.fromLTRB( + spacing.md, + spacing.sm, + spacing.md, + spacing.sm, + ), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + Text( + title, + style: textTheme.captionEmphasis.copyWith( + color: colorScheme.textPrimary, + ), + ), + Text( + description, + style: textTheme.metadataDefault.copyWith( + color: colorScheme.textTertiary, + ), + ), + ], + ), + ), + Divider(height: 1, color: colorScheme.borderSubtle), + Container( + width: double.infinity, + padding: EdgeInsets.all(spacing.md), + color: colorScheme.backgroundSurface, + child: child, + ), + ], + ), + ); + } +} + +class _SectionLabel extends StatelessWidget { + const _SectionLabel({required this.label}); + + final String label; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Container( + padding: EdgeInsets.symmetric( + horizontal: spacing.sm, + vertical: spacing.xs, + ), + decoration: BoxDecoration( + color: colorScheme.accentPrimary, + borderRadius: BorderRadius.all(radius.xs), + ), + child: Text( + label, + style: textTheme.metadataEmphasis.copyWith( + color: colorScheme.textOnAccent, + letterSpacing: 1, + fontSize: 9, + ), + ), + ); + } +} diff --git a/apps/design_system_gallery/lib/components/common/stream_flex.dart b/apps/design_system_gallery/lib/components/common/stream_flex.dart new file mode 100644 index 0000000..5ddf82f --- /dev/null +++ b/apps/design_system_gallery/lib/components/common/stream_flex.dart @@ -0,0 +1,685 @@ +import 'package:flutter/material.dart'; +import 'package:stream_core_flutter/stream_core_flutter.dart'; +import 'package:widgetbook/widgetbook.dart'; +import 'package:widgetbook_annotation/widgetbook_annotation.dart' as widgetbook; + +// ============================================================================= +// Playground +// ============================================================================= + +@widgetbook.UseCase( + name: 'Playground', + type: StreamFlex, + path: '[Components]/Common', +) +Widget buildStreamFlexPlayground(BuildContext context) { + final direction = context.knobs.object.dropdown( + label: 'Direction', + options: Axis.values, + labelBuilder: (value) => value.name, + initialOption: Axis.horizontal, + description: 'The main axis direction.', + ); + + final spacing = context.knobs.double.slider( + label: 'Spacing', + initialValue: -8, + min: -24, + max: 32, + description: 'Space between children. Negative values cause overlap.', + ); + + final mainAxisAlignment = context.knobs.object.dropdown( + label: 'Main Axis Alignment', + options: MainAxisAlignment.values, + labelBuilder: (value) => value.name, + initialOption: MainAxisAlignment.start, + description: 'How children are placed along the main axis.', + ); + + final crossAxisAlignment = context.knobs.object.dropdown( + label: 'Cross Axis Alignment', + options: [ + CrossAxisAlignment.start, + CrossAxisAlignment.center, + CrossAxisAlignment.end, + CrossAxisAlignment.stretch, + ], + labelBuilder: (value) => value.name, + initialOption: CrossAxisAlignment.center, + description: 'How children are placed along the cross axis.', + ); + + final mainAxisSize = context.knobs.object.dropdown( + label: 'Main Axis Size', + options: MainAxisSize.values, + labelBuilder: (value) => value.name, + initialOption: MainAxisSize.min, + description: 'Whether to maximize or minimize free space.', + ); + + final clipBehavior = context.knobs.object.dropdown( + label: 'Clip Behavior', + options: Clip.values, + labelBuilder: (value) => value.name, + initialOption: Clip.none, + description: 'How to clip overflowing children.', + ); + + final childCount = context.knobs.int.slider( + label: 'Child Count', + initialValue: 5, + min: 1, + max: 8, + description: 'Number of children.', + ); + + return Center( + child: StreamFlex( + direction: direction, + spacing: spacing, + mainAxisAlignment: mainAxisAlignment, + crossAxisAlignment: crossAxisAlignment, + mainAxisSize: mainAxisSize, + clipBehavior: clipBehavior, + children: [ + for (var i = 0; i < childCount; i++) _PlaygroundChild(index: i, direction: direction), + ], + ), + ); +} + +class _PlaygroundChild extends StatelessWidget { + const _PlaygroundChild({required this.index, required this.direction}); + + final int index; + final Axis direction; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final radius = context.streamRadius; + + final palette = _childPalette[index % _childPalette.length]; + final size = 40.0 + (index % 3) * 12.0; + + return Container( + width: direction == Axis.horizontal ? size : null, + height: direction == Axis.vertical ? size : null, + padding: const EdgeInsets.all(8), + decoration: BoxDecoration( + color: palette.bg, + borderRadius: BorderRadius.all(radius.md), + border: Border.all(color: colorScheme.backgroundSurface, width: 2), + ), + alignment: Alignment.center, + child: Text( + '${index + 1}', + style: textTheme.captionEmphasis.copyWith(color: palette.fg), + ), + ); + } +} + +// ============================================================================= +// Showcase +// ============================================================================= + +@widgetbook.UseCase( + name: 'Showcase', + type: StreamFlex, + path: '[Components]/Common', +) +Widget buildStreamFlexShowcase(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final spacing = context.streamSpacing; + + return DefaultTextStyle( + style: textTheme.bodyDefault.copyWith(color: colorScheme.textPrimary), + child: SingleChildScrollView( + padding: EdgeInsets.all(spacing.lg), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + spacing: spacing.xl, + children: const [ + _SpacingValuesSection(), + _NegativeSpacingSection(), + _RealWorldSection(), + ], + ), + ), + ); +} + +// ============================================================================= +// Spacing Values Section +// ============================================================================= + +class _SpacingValuesSection extends StatelessWidget { + const _SpacingValuesSection(); + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final boxShadow = context.streamBoxShadow; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Column( + crossAxisAlignment: CrossAxisAlignment.start, + spacing: spacing.md, + children: [ + const _SectionLabel(label: 'SPACING VALUES'), + Container( + width: double.infinity, + clipBehavior: Clip.antiAlias, + padding: EdgeInsets.all(spacing.md), + decoration: BoxDecoration( + color: colorScheme.backgroundSurfaceSubtle, + borderRadius: BorderRadius.all(radius.lg), + boxShadow: boxShadow.elevation1, + ), + foregroundDecoration: BoxDecoration( + borderRadius: BorderRadius.all(radius.lg), + border: Border.all(color: colorScheme.borderSubtle), + ), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + spacing: spacing.md, + children: [ + Text( + 'Positive spacing adds gaps, zero makes children flush, ' + 'and negative spacing causes overlap.', + style: textTheme.captionDefault.copyWith( + color: colorScheme.textSecondary, + ), + ), + for (final (label, value) in _spacingValues) _SpacingDemo(label: label, spacing: value), + ], + ), + ), + ], + ); + } +} + +class _SpacingDemo extends StatelessWidget { + const _SpacingDemo({required this.label, required this.spacing}); + + final String label; + final double spacing; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final themeSpacing = context.streamSpacing; + + return Column( + crossAxisAlignment: CrossAxisAlignment.start, + mainAxisSize: MainAxisSize.min, + spacing: themeSpacing.xs, + children: [ + Text( + label, + style: textTheme.metadataEmphasis.copyWith( + color: colorScheme.accentPrimary, + fontFamily: 'monospace', + ), + ), + StreamRow( + spacing: spacing, + children: [ + for (var i = 0; i < 5; i++) _DemoChip(index: i), + ], + ), + ], + ); + } +} + +// ============================================================================= +// Negative Spacing Section +// ============================================================================= + +class _NegativeSpacingSection extends StatelessWidget { + const _NegativeSpacingSection(); + + @override + Widget build(BuildContext context) { + final spacing = context.streamSpacing; + + return Column( + crossAxisAlignment: CrossAxisAlignment.start, + spacing: spacing.md, + children: const [ + _SectionLabel(label: 'NEGATIVE SPACING'), + _ExampleCard( + title: 'Z-Order (Paint Order)', + description: + 'Later children paint on top of earlier ones. ' + 'Child 1 is behind, child 5 is in front.', + child: _ZOrderDemo(), + ), + _ExampleCard( + title: 'Vertical Overlap', + description: 'Negative spacing works on the vertical axis too.', + child: _VerticalOverlapDemo(), + ), + ], + ); + } +} + +class _ZOrderDemo extends StatelessWidget { + const _ZOrderDemo(); + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final radius = context.streamRadius; + + return StreamRow( + spacing: -16, + mainAxisSize: MainAxisSize.min, + children: [ + for (var i = 0; i < 5; i++) + Container( + width: 48, + height: 48, + decoration: BoxDecoration( + color: _childPalette[i].bg, + borderRadius: BorderRadius.all(radius.lg), + border: Border.all( + color: colorScheme.backgroundSurface, + width: 2, + ), + ), + alignment: Alignment.center, + child: Text( + '${i + 1}', + style: textTheme.captionEmphasis.copyWith( + color: _childPalette[i].fg, + ), + ), + ), + ], + ); + } +} + +class _VerticalOverlapDemo extends StatelessWidget { + const _VerticalOverlapDemo(); + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + final boxShadow = context.streamBoxShadow; + + return StreamColumn( + spacing: -12, + mainAxisSize: MainAxisSize.min, + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + for (var i = 0; i < 4; i++) + Container( + width: 200, + padding: EdgeInsets.symmetric( + horizontal: spacing.md, + vertical: spacing.sm, + ), + decoration: BoxDecoration( + color: _childPalette[i].bg, + borderRadius: BorderRadius.all(radius.lg), + border: Border.all( + color: colorScheme.backgroundSurface, + width: 2, + ), + boxShadow: boxShadow.elevation1, + ), + child: Text( + 'Card ${i + 1}', + style: textTheme.captionEmphasis.copyWith( + color: _childPalette[i].fg, + ), + ), + ), + ], + ); + } +} + +// ============================================================================= +// Real-World Section +// ============================================================================= + +class _RealWorldSection extends StatelessWidget { + const _RealWorldSection(); + + @override + Widget build(BuildContext context) { + final spacing = context.streamSpacing; + + return Column( + crossAxisAlignment: CrossAxisAlignment.start, + spacing: spacing.md, + children: const [ + _SectionLabel(label: 'REAL-WORLD EXAMPLES'), + _ExampleCard( + title: 'Avatar Stack', + description: + 'Overlapping circular avatars — a common pattern for ' + 'showing group participants.', + child: _AvatarStackDemo(), + ), + _ExampleCard( + title: 'Notification Badges', + description: + 'Overlapping badges that fan out, useful for showing ' + 'multiple notification types.', + child: _NotificationBadgesDemo(), + ), + ], + ); + } +} + +class _AvatarStackDemo extends StatelessWidget { + const _AvatarStackDemo(); + + static const _initials = ['AL', 'BK', 'CM', 'DP', 'EW']; + + @override + Widget build(BuildContext context) { + final spacing = context.streamSpacing; + + return Column( + crossAxisAlignment: CrossAxisAlignment.start, + spacing: spacing.lg, + children: [ + for (final overlap in [-8.0, -12.0, -16.0]) + _VariantDemo( + label: 'spacing: ${overlap.toInt()}', + child: StreamRow( + spacing: overlap, + mainAxisSize: MainAxisSize.min, + children: [ + for (var i = 0; i < _initials.length; i++) + StreamAvatar( + size: StreamAvatarSize.md, + backgroundColor: _childPalette[i].bg, + foregroundColor: _childPalette[i].fg, + placeholder: (_) => Text(_initials[i]), + ), + ], + ), + ), + ], + ); + } +} + +class _NotificationBadgesDemo extends StatelessWidget { + const _NotificationBadgesDemo(); + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final radius = context.streamRadius; + + final badges = [ + ( + StreamColors.red.shade400.withValues(alpha: 0.85), + StreamColors.red.shade900, + '3', + ), + ( + StreamColors.yellow.shade400.withValues(alpha: 0.85), + StreamColors.yellow.shade900, + '!', + ), + ( + StreamColors.blue.shade400.withValues(alpha: 0.85), + StreamColors.blue.shade900, + '7', + ), + ]; + + return StreamRow( + spacing: -6, + mainAxisSize: MainAxisSize.min, + children: [ + for (final (bg, fg, label) in badges) + Container( + width: 28, + height: 28, + decoration: BoxDecoration( + color: bg, + borderRadius: BorderRadius.all(radius.max), + border: Border.all( + color: colorScheme.backgroundSurface, + width: 2, + ), + ), + alignment: Alignment.center, + child: Text( + label, + style: textTheme.metadataEmphasis.copyWith( + color: fg, + fontSize: 11, + ), + ), + ), + ], + ); + } +} + +// ============================================================================= +// Shared Widgets +// ============================================================================= + +class _DemoChip extends StatelessWidget { + const _DemoChip({required this.index}); + + final int index; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final radius = context.streamRadius; + + final palette = _childPalette[index % _childPalette.length]; + + return Container( + width: 40, + height: 40, + decoration: BoxDecoration( + color: palette.bg, + borderRadius: BorderRadius.all(radius.md), + border: Border.all(color: colorScheme.backgroundSurface, width: 2), + ), + alignment: Alignment.center, + child: Text( + '${index + 1}', + style: textTheme.captionEmphasis.copyWith(color: palette.fg), + ), + ); + } +} + +class _ExampleCard extends StatelessWidget { + const _ExampleCard({ + required this.title, + required this.description, + required this.child, + }); + + final String title; + final String description; + final Widget child; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final boxShadow = context.streamBoxShadow; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Container( + width: double.infinity, + clipBehavior: Clip.antiAlias, + decoration: BoxDecoration( + color: colorScheme.backgroundSurfaceSubtle, + borderRadius: BorderRadius.all(radius.lg), + boxShadow: boxShadow.elevation1, + ), + foregroundDecoration: BoxDecoration( + borderRadius: BorderRadius.all(radius.lg), + border: Border.all(color: colorScheme.borderSubtle), + ), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + Padding( + padding: EdgeInsets.symmetric( + horizontal: spacing.md, + vertical: spacing.sm, + ), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + Text( + title, + style: textTheme.captionEmphasis.copyWith( + color: colorScheme.textPrimary, + ), + ), + Text( + description, + style: textTheme.metadataDefault.copyWith( + color: colorScheme.textTertiary, + ), + ), + ], + ), + ), + Divider(height: 1, color: colorScheme.borderSubtle), + Container( + width: double.infinity, + padding: EdgeInsets.all(spacing.md), + color: colorScheme.backgroundSurfaceSubtle, + child: child, + ), + ], + ), + ); + } +} + +class _SectionLabel extends StatelessWidget { + const _SectionLabel({required this.label}); + + final String label; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Container( + padding: EdgeInsets.symmetric( + horizontal: spacing.sm, + vertical: spacing.xs, + ), + decoration: BoxDecoration( + color: colorScheme.accentPrimary, + borderRadius: BorderRadius.all(radius.xs), + ), + child: Text( + label, + style: textTheme.metadataEmphasis.copyWith( + color: colorScheme.textOnAccent, + letterSpacing: 1, + fontSize: 9, + ), + ), + ); + } +} + +class _VariantDemo extends StatelessWidget { + const _VariantDemo({required this.label, required this.child}); + + final String label; + final Widget child; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final spacing = context.streamSpacing; + + return Column( + crossAxisAlignment: CrossAxisAlignment.start, + mainAxisSize: MainAxisSize.min, + spacing: spacing.xs, + children: [ + Text( + label, + style: textTheme.metadataEmphasis.copyWith( + color: colorScheme.accentPrimary, + fontFamily: 'monospace', + ), + ), + child, + ], + ); + } +} + +// ============================================================================= +// Helpers +// ============================================================================= + +const _spacingValues = [ + ('spacing: 12', 12.0), + ('spacing: 0', 0.0), + ('spacing: -8', -8.0), + ('spacing: -16', -16.0), +]; + +final _childPalette = [ + ( + bg: StreamColors.blue.shade400.withValues(alpha: 0.8), + fg: StreamColors.blue.shade900, + ), + ( + bg: StreamColors.cyan.shade400.withValues(alpha: 0.8), + fg: StreamColors.cyan.shade900, + ), + ( + bg: StreamColors.green.shade400.withValues(alpha: 0.8), + fg: StreamColors.green.shade900, + ), + ( + bg: StreamColors.purple.shade400.withValues(alpha: 0.8), + fg: StreamColors.purple.shade900, + ), + ( + bg: StreamColors.yellow.shade400.withValues(alpha: 0.8), + fg: StreamColors.yellow.shade900, + ), +]; diff --git a/apps/design_system_gallery/lib/components/common/stream_progress_bar.dart b/apps/design_system_gallery/lib/components/common/stream_progress_bar.dart new file mode 100644 index 0000000..8ee3489 --- /dev/null +++ b/apps/design_system_gallery/lib/components/common/stream_progress_bar.dart @@ -0,0 +1,672 @@ +import 'package:flutter/material.dart'; +import 'package:stream_core_flutter/stream_core_flutter.dart'; +import 'package:widgetbook/widgetbook.dart'; +import 'package:widgetbook_annotation/widgetbook_annotation.dart' as widgetbook; + +// ============================================================================= +// Playground +// ============================================================================= + +@widgetbook.UseCase( + name: 'Playground', + type: StreamProgressBar, + path: '[Components]/Common', +) +Widget buildStreamProgressBarPlayground(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final spacing = context.streamSpacing; + + final indeterminate = context.knobs.boolean( + label: 'Indeterminate', + description: 'When enabled, shows a looping animation instead of a fixed fill.', + ); + + final value = context.knobs.double.slider( + label: 'Value', + max: 1, + initialValue: 0.5, + divisions: 20, + description: 'Progress value from 0.0 to 1.0.', + ); + + final minHeight = context.knobs.double.slider( + label: 'Min Height', + min: 2, + max: 24, + initialValue: 8, + divisions: 11, + description: 'The minimum height of the progress bar.', + ); + + final borderRadius = context.knobs.double.slider( + label: 'Border Radius', + max: 16, + initialValue: 8, + divisions: 16, + description: 'The border radius of the progress bar.', + ); + + final effectiveValue = indeterminate ? null : value; + final percentage = (value * 100).round(); + + return Center( + child: ConstrainedBox( + constraints: const BoxConstraints(maxWidth: 264), + child: Column( + mainAxisSize: MainAxisSize.min, + spacing: spacing.sm, + children: [ + StreamProgressBar( + value: effectiveValue, + minHeight: minHeight, + borderRadius: BorderRadius.circular(borderRadius), + ), + Text( + indeterminate ? 'Loading…' : '$percentage%', + style: textTheme.captionEmphasis.copyWith( + color: colorScheme.textSecondary, + ), + ), + ], + ), + ), + ); +} + +// ============================================================================= +// Showcase +// ============================================================================= + +@widgetbook.UseCase( + name: 'Showcase', + type: StreamProgressBar, + path: '[Components]/Common', +) +Widget buildStreamProgressBarShowcase(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final spacing = context.streamSpacing; + + return DefaultTextStyle( + style: textTheme.bodyDefault.copyWith(color: colorScheme.textPrimary), + child: SingleChildScrollView( + padding: EdgeInsets.all(spacing.lg), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + const _StatesSection(), + SizedBox(height: spacing.xl), + const _ValueScaleSection(), + SizedBox(height: spacing.xl), + const _HeightVariantsSection(), + SizedBox(height: spacing.xl), + const _UsagePatternsSection(), + ], + ), + ), + ); +} + +// ============================================================================= +// States Section +// ============================================================================= + +class _StatesSection extends StatelessWidget { + const _StatesSection(); + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final boxShadow = context.streamBoxShadow; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + const _SectionLabel(label: 'STATES'), + SizedBox(height: spacing.md), + Container( + width: double.infinity, + clipBehavior: Clip.antiAlias, + padding: EdgeInsets.all(spacing.md), + decoration: BoxDecoration( + color: colorScheme.backgroundSurface, + borderRadius: BorderRadius.all(radius.lg), + boxShadow: boxShadow.elevation1, + ), + foregroundDecoration: BoxDecoration( + borderRadius: BorderRadius.all(radius.lg), + border: Border.all(color: colorScheme.borderSubtle), + ), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + spacing: spacing.md, + children: [ + _StateDemo( + label: 'Determinate', + description: 'Fixed value showing specific progress', + child: StreamProgressBar(value: 0.6), + ), + Divider(height: 1, color: colorScheme.borderSubtle), + _StateDemo( + label: 'Indeterminate', + description: 'Looping animation for unknown duration', + child: StreamProgressBar(), + ), + Divider(height: 1, color: colorScheme.borderSubtle), + _StateDemo( + label: 'Empty', + description: 'Zero progress', + child: StreamProgressBar(value: 0), + ), + Divider(height: 1, color: colorScheme.borderSubtle), + _StateDemo( + label: 'Complete', + description: 'Full progress', + child: StreamProgressBar(value: 1), + ), + ], + ), + ), + ], + ); + } +} + +class _StateDemo extends StatelessWidget { + const _StateDemo({ + required this.label, + required this.description, + required this.child, + }); + + final String label; + final String description; + final Widget child; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final spacing = context.streamSpacing; + + return Column( + crossAxisAlignment: CrossAxisAlignment.start, + spacing: spacing.sm, + children: [ + Row( + children: [ + Expanded( + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + Text( + label, + style: textTheme.captionEmphasis.copyWith( + color: colorScheme.textPrimary, + ), + ), + Text( + description, + style: textTheme.metadataDefault.copyWith( + color: colorScheme.textTertiary, + ), + ), + ], + ), + ), + ], + ), + child, + ], + ); + } +} + +// ============================================================================= +// Value Scale Section +// ============================================================================= + +class _ValueScaleSection extends StatelessWidget { + const _ValueScaleSection(); + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final boxShadow = context.streamBoxShadow; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + const _SectionLabel(label: 'VALUE SCALE'), + SizedBox(height: spacing.md), + Container( + width: double.infinity, + clipBehavior: Clip.antiAlias, + padding: EdgeInsets.all(spacing.md), + decoration: BoxDecoration( + color: colorScheme.backgroundSurface, + borderRadius: BorderRadius.all(radius.lg), + boxShadow: boxShadow.elevation1, + ), + foregroundDecoration: BoxDecoration( + borderRadius: BorderRadius.all(radius.lg), + border: Border.all(color: colorScheme.borderSubtle), + ), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + Text( + 'Fill width scales linearly with value', + style: textTheme.captionDefault.copyWith( + color: colorScheme.textSecondary, + ), + ), + SizedBox(height: spacing.md), + for (final percent in List.generate(11, (i) => i * 10)) ...[ + _ValueDemo(percentage: percent), + if (percent < 100) SizedBox(height: spacing.sm), + ], + ], + ), + ), + ], + ); + } +} + +class _ValueDemo extends StatelessWidget { + const _ValueDemo({required this.percentage}); + + final int percentage; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final spacing = context.streamSpacing; + + return Row( + children: [ + SizedBox( + width: 40, + child: Text( + '$percentage%', + style: textTheme.metadataEmphasis.copyWith( + color: colorScheme.accentPrimary, + fontFamily: 'monospace', + ), + ), + ), + SizedBox(width: spacing.sm), + Expanded(child: StreamProgressBar(value: percentage / 100)), + ], + ); + } +} + +// ============================================================================= +// Height Variants Section +// ============================================================================= + +class _HeightVariantsSection extends StatelessWidget { + const _HeightVariantsSection(); + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final boxShadow = context.streamBoxShadow; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + const _SectionLabel(label: 'HEIGHT VARIANTS'), + SizedBox(height: spacing.md), + Container( + width: double.infinity, + clipBehavior: Clip.antiAlias, + padding: EdgeInsets.all(spacing.md), + decoration: BoxDecoration( + color: colorScheme.backgroundSurface, + borderRadius: BorderRadius.all(radius.lg), + boxShadow: boxShadow.elevation1, + ), + foregroundDecoration: BoxDecoration( + borderRadius: BorderRadius.all(radius.lg), + border: Border.all(color: colorScheme.borderSubtle), + ), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + Text( + 'Adjustable height via minHeight', + style: textTheme.captionDefault.copyWith( + color: colorScheme.textSecondary, + ), + ), + SizedBox(height: spacing.md), + for (final height in [4.0, 8.0, 12.0, 16.0]) ...[ + _HeightDemo(height: height), + if (height < 16) SizedBox(height: spacing.md), + ], + ], + ), + ), + ], + ); + } +} + +class _HeightDemo extends StatelessWidget { + const _HeightDemo({required this.height}); + + final double height; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final spacing = context.streamSpacing; + + return Row( + children: [ + SizedBox( + width: 40, + child: Text( + '${height.toInt()}px', + style: textTheme.metadataEmphasis.copyWith( + color: colorScheme.accentPrimary, + fontFamily: 'monospace', + ), + ), + ), + SizedBox(width: spacing.sm), + Expanded( + child: StreamProgressBar(value: 0.6, minHeight: height), + ), + ], + ); + } +} + +// ============================================================================= +// Usage Patterns Section +// ============================================================================= + +class _UsagePatternsSection extends StatelessWidget { + const _UsagePatternsSection(); + + @override + Widget build(BuildContext context) { + final spacing = context.streamSpacing; + + return Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + const _SectionLabel(label: 'USAGE PATTERNS'), + SizedBox(height: spacing.md), + const _ExampleCard( + title: 'Poll Results', + description: 'Progress bars showing vote distribution', + child: _PollResultsExample(), + ), + SizedBox(height: spacing.sm), + const _ExampleCard( + title: 'File Upload', + description: 'Progress bar indicating upload status', + child: _FileUploadExample(), + ), + ], + ); + } +} + +class _PollResultsExample extends StatelessWidget { + const _PollResultsExample(); + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final spacing = context.streamSpacing; + + return Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + Text( + 'What should we have for lunch?', + style: textTheme.bodyEmphasis.copyWith( + color: colorScheme.textPrimary, + ), + ), + SizedBox(height: spacing.md), + const _PollOption(label: 'Pizza', percentage: 45, votes: 9), + SizedBox(height: spacing.sm), + const _PollOption(label: 'Sushi', percentage: 30, votes: 6), + SizedBox(height: spacing.sm), + const _PollOption(label: 'Tacos', percentage: 20, votes: 4), + SizedBox(height: spacing.sm), + const _PollOption(label: 'Salad', percentage: 5, votes: 1), + SizedBox(height: spacing.md), + Text( + '20 votes', + style: textTheme.captionDefault.copyWith( + color: colorScheme.textTertiary, + ), + ), + ], + ); + } +} + +class _PollOption extends StatelessWidget { + const _PollOption({ + required this.label, + required this.percentage, + required this.votes, + }); + + final String label; + final int percentage; + final int votes; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final spacing = context.streamSpacing; + + return Column( + crossAxisAlignment: CrossAxisAlignment.start, + spacing: spacing.xs, + children: [ + Row( + children: [ + Expanded( + child: Text( + label, + style: textTheme.captionDefault.copyWith( + color: colorScheme.textPrimary, + ), + ), + ), + Text( + '$percentage%', + style: textTheme.captionEmphasis.copyWith( + color: colorScheme.textSecondary, + ), + ), + ], + ), + StreamProgressBar(value: percentage / 100), + ], + ); + } +} + +class _FileUploadExample extends StatelessWidget { + const _FileUploadExample(); + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final spacing = context.streamSpacing; + + return Column( + crossAxisAlignment: CrossAxisAlignment.start, + spacing: spacing.sm, + children: [ + Row( + children: [ + Icon( + Icons.insert_drive_file_outlined, + size: 20, + color: colorScheme.textSecondary, + ), + SizedBox(width: spacing.sm), + Expanded( + child: Text( + 'presentation.pdf', + style: textTheme.captionDefault.copyWith( + color: colorScheme.textPrimary, + ), + overflow: TextOverflow.ellipsis, + ), + ), + Text( + '73%', + style: textTheme.captionEmphasis.copyWith( + color: colorScheme.textSecondary, + ), + ), + ], + ), + StreamProgressBar(value: 0.73), + Text( + '2.4 MB of 3.3 MB', + style: textTheme.metadataDefault.copyWith( + color: colorScheme.textTertiary, + ), + ), + ], + ); + } +} + +// ============================================================================= +// Shared Widgets +// ============================================================================= + +class _ExampleCard extends StatelessWidget { + const _ExampleCard({ + required this.title, + required this.description, + required this.child, + }); + + final String title; + final String description; + final Widget child; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final boxShadow = context.streamBoxShadow; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Container( + width: double.infinity, + clipBehavior: Clip.antiAlias, + decoration: BoxDecoration( + color: colorScheme.backgroundSurfaceSubtle, + borderRadius: BorderRadius.all(radius.lg), + boxShadow: boxShadow.elevation1, + ), + foregroundDecoration: BoxDecoration( + borderRadius: BorderRadius.all(radius.lg), + border: Border.all(color: colorScheme.borderSubtle), + ), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + Padding( + padding: EdgeInsets.fromLTRB( + spacing.md, + spacing.sm, + spacing.md, + spacing.sm, + ), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + Text( + title, + style: textTheme.captionEmphasis.copyWith( + color: colorScheme.textPrimary, + ), + ), + Text( + description, + style: textTheme.metadataDefault.copyWith( + color: colorScheme.textTertiary, + ), + ), + ], + ), + ), + Divider(height: 1, color: colorScheme.borderSubtle), + Container( + width: double.infinity, + padding: EdgeInsets.all(spacing.md), + color: colorScheme.backgroundSurface, + child: child, + ), + ], + ), + ); + } +} + +class _SectionLabel extends StatelessWidget { + const _SectionLabel({required this.label}); + + final String label; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Container( + padding: EdgeInsets.symmetric( + horizontal: spacing.sm, + vertical: spacing.xs, + ), + decoration: BoxDecoration( + color: colorScheme.accentPrimary, + borderRadius: BorderRadius.all(radius.xs), + ), + child: Text( + label, + style: textTheme.metadataEmphasis.copyWith( + color: colorScheme.textOnAccent, + letterSpacing: 1, + fontSize: 9, + ), + ), + ); + } +} diff --git a/apps/design_system_gallery/lib/components/context_menu/stream_context_menu.dart b/apps/design_system_gallery/lib/components/context_menu/stream_context_menu.dart new file mode 100644 index 0000000..8e66864 --- /dev/null +++ b/apps/design_system_gallery/lib/components/context_menu/stream_context_menu.dart @@ -0,0 +1,1027 @@ +import 'package:flutter/material.dart'; +import 'package:stream_core_flutter/stream_core_flutter.dart'; +import 'package:widgetbook/widgetbook.dart'; +import 'package:widgetbook_annotation/widgetbook_annotation.dart' as widgetbook; + +// ============================================================================= +// Playground +// ============================================================================= + +@widgetbook.UseCase( + name: 'Playground', + type: StreamContextMenu, + path: '[Components]/Context Menu', +) +Widget buildStreamContextMenuPlayground(BuildContext context) { + return const _PlaygroundDemo(); +} + +class _PlaygroundDemo extends StatefulWidget { + const _PlaygroundDemo(); + + @override + State<_PlaygroundDemo> createState() => _PlaygroundDemoState(); +} + +class _PlaygroundDemoState extends State<_PlaygroundDemo> { + String? _inlineTapped; + String? _dialogReturned; + + @override + Widget build(BuildContext context) { + final icons = context.streamIcons; + final spacing = context.streamSpacing; + + final actionCount = context.knobs.int.slider( + label: 'Action Count', + initialValue: 5, + min: 1, + max: 8, + description: 'Number of regular menu actions to display.', + ); + + final showLeadingIcon = context.knobs.boolean( + label: 'Leading Icon', + initialValue: true, + description: 'Show an icon before each action label.', + ); + + final showTrailingIcon = context.knobs.boolean( + label: 'Trailing Icon', + description: 'Show a chevron after each action label.', + ); + + final showSeparator = context.knobs.boolean( + label: 'Separator', + initialValue: true, + description: 'Show a divider before the destructive group.', + ); + + final showDestructiveAction = context.knobs.boolean( + label: 'Destructive Action', + initialValue: true, + description: 'Include a destructive action at the end.', + ); + + final hasDisabledAction = context.knobs.boolean( + label: 'Disabled Action', + description: 'Make the second action disabled.', + ); + + final actionData = <({String label, IconData icon})>[ + (label: 'Reply', icon: icons.arrowShareLeft), + (label: 'Thread Reply', icon: icons.bubbleText6ChatMessage), + (label: 'Pin to Conversation', icon: icons.pin), + (label: 'Copy Message', icon: icons.squareBehindSquare2Copy), + (label: 'Mark Unread', icon: icons.bubbleWideNotificationChatMessage), + (label: 'Remind Me', icon: icons.bellNotification), + (label: 'Save For Later', icon: icons.fileBend), + (label: 'Flag Message', icon: icons.flag2), + ]; + + List buildInlineActions() { + return [ + for (var i = 0; i < actionCount; i++) + StreamContextMenuAction( + value: actionData[i].label, + label: Text(actionData[i].label), + leading: showLeadingIcon ? Icon(actionData[i].icon) : null, + trailing: showTrailingIcon ? Icon(icons.chevronRight) : null, + enabled: !(hasDisabledAction && i == 1), + onTap: () => setState(() => _inlineTapped = actionData[i].label), + ), + if (showSeparator && showDestructiveAction) const StreamContextMenuSeparator(), + if (showDestructiveAction) + StreamContextMenuAction.destructive( + value: 'Delete Message', + label: const Text('Delete Message'), + leading: showLeadingIcon ? Icon(icons.trashBin) : null, + onTap: () => setState(() => _inlineTapped = 'Delete Message'), + ), + ]; + } + + List buildDialogActions() { + return [ + for (var i = 0; i < actionCount; i++) + StreamContextMenuAction( + value: actionData[i].label, + label: Text(actionData[i].label), + leading: showLeadingIcon ? Icon(actionData[i].icon) : null, + trailing: showTrailingIcon ? Icon(icons.chevronRight) : null, + enabled: !(hasDisabledAction && i == 1), + ), + if (showSeparator && showDestructiveAction) const StreamContextMenuSeparator(), + if (showDestructiveAction) + StreamContextMenuAction.destructive( + value: 'Delete Message', + label: const Text('Delete Message'), + leading: showLeadingIcon ? Icon(icons.trashBin) : null, + ), + ]; + } + + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + + return Center( + child: SingleChildScrollView( + padding: EdgeInsets.symmetric(vertical: spacing.lg), + child: Column( + mainAxisSize: MainAxisSize.min, + children: [ + // Inline header. + Text( + 'Inline', + style: textTheme.captionEmphasis.copyWith( + color: colorScheme.textPrimary, + ), + ), + SizedBox(height: spacing.xxs), + Text( + 'Rendered directly — taps fire onTap', + style: textTheme.metadataDefault.copyWith( + color: colorScheme.textTertiary, + ), + ), + SizedBox(height: spacing.sm), + + StreamContextMenu(children: buildInlineActions()), + SizedBox(height: spacing.xs), + _ResultChip( + label: _inlineTapped != null ? 'onTap: "$_inlineTapped"' : 'Tap an action', + isActive: _inlineTapped != null, + ), + + Padding( + padding: EdgeInsets.symmetric(vertical: spacing.xl), + child: Divider(indent: spacing.xl, endIndent: spacing.xl), + ), + + // Dialog header. + Text( + 'Dialog', + style: textTheme.captionEmphasis.copyWith( + color: colorScheme.textPrimary, + ), + ), + SizedBox(height: spacing.xxs), + Text( + 'Opened in a route — taps return value via pop', + style: textTheme.metadataDefault.copyWith( + color: colorScheme.textTertiary, + ), + ), + SizedBox(height: spacing.sm), + + StreamButton( + label: 'Open as Dialog', + type: StreamButtonType.outline, + size: StreamButtonSize.small, + onTap: () async { + final result = await showDialog( + context: context, + useRootNavigator: false, + builder: (_) => Dialog( + backgroundColor: StreamColors.transparent, + child: StreamContextMenu( + children: buildDialogActions(), + ), + ), + ); + if (mounted && result != null) { + setState(() => _dialogReturned = result); + } + }, + ), + SizedBox(height: spacing.xs), + _ResultChip( + label: _dialogReturned != null ? 'value: "$_dialogReturned"' : 'Open and select', + isActive: _dialogReturned != null, + ), + ], + ), + ), + ); + } +} + +// ============================================================================= +// Showcase +// ============================================================================= + +@widgetbook.UseCase( + name: 'Showcase', + type: StreamContextMenu, + path: '[Components]/Context Menu', +) +Widget buildStreamContextMenuShowcase(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final spacing = context.streamSpacing; + + return DefaultTextStyle( + style: textTheme.bodyDefault.copyWith(color: colorScheme.textPrimary), + child: SingleChildScrollView( + padding: EdgeInsets.all(spacing.lg), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + const _ActionStatesSection(), + SizedBox(height: spacing.xl), + const _MenuCompositionsSection(), + SizedBox(height: spacing.xl), + const _DialogIntegrationSection(), + SizedBox(height: spacing.xl), + const _CustomThemingSection(), + SizedBox(height: spacing.xl), + const _RealWorldSection(), + ], + ), + ), + ); +} + +// ============================================================================= +// Action States Section +// ============================================================================= + +class _ActionStatesSection extends StatelessWidget { + const _ActionStatesSection(); + + @override + Widget build(BuildContext context) { + final spacing = context.streamSpacing; + + return Column( + crossAxisAlignment: CrossAxisAlignment.start, + spacing: spacing.md, + children: const [ + _SectionLabel(label: 'ACTION STATES'), + _NormalStatesCard(), + _DestructiveStatesCard(), + ], + ); + } +} + +class _NormalStatesCard extends StatelessWidget { + const _NormalStatesCard(); + + @override + Widget build(BuildContext context) { + final icons = context.streamIcons; + final spacing = context.streamSpacing; + + return _ExampleCard( + title: 'Normal', + description: 'Default styling for standard actions', + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + spacing: spacing.xxs, + children: [ + StreamContextMenuAction( + label: const Text( + 'With Leading & Trailing', + maxLines: 1, + overflow: TextOverflow.ellipsis, + ), + leading: Icon(icons.plusLarge), + trailing: Icon(icons.chevronRight), + ), + StreamContextMenuAction( + label: const Text('With Leading Only'), + leading: Icon(icons.plusLarge), + ), + StreamContextMenuAction( + label: const Text('Label Only'), + ), + StreamContextMenuAction( + label: const Text('Disabled'), + leading: Icon(icons.plusLarge), + trailing: Icon(icons.chevronRight), + enabled: false, + ), + ], + ), + ); + } +} + +class _DestructiveStatesCard extends StatelessWidget { + const _DestructiveStatesCard(); + + @override + Widget build(BuildContext context) { + final icons = context.streamIcons; + final spacing = context.streamSpacing; + + return _ExampleCard( + title: 'Destructive', + description: 'Error styling for dangerous actions', + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + spacing: spacing.xxs, + children: [ + StreamContextMenuAction.destructive( + label: const Text( + 'With Leading & Trailing', + maxLines: 1, + overflow: TextOverflow.ellipsis, + ), + leading: Icon(icons.trashBin), + trailing: Icon(icons.chevronRight), + ), + StreamContextMenuAction.destructive( + label: const Text('With Leading Only'), + leading: Icon(icons.trashBin), + ), + StreamContextMenuAction.destructive( + label: const Text('Label Only'), + ), + StreamContextMenuAction.destructive( + label: const Text('Disabled'), + leading: Icon(icons.trashBin), + trailing: Icon(icons.chevronRight), + enabled: false, + ), + ], + ), + ); + } +} + +// ============================================================================= +// Menu Compositions Section +// ============================================================================= + +class _MenuCompositionsSection extends StatelessWidget { + const _MenuCompositionsSection(); + + @override + Widget build(BuildContext context) { + final icons = context.streamIcons; + final spacing = context.streamSpacing; + + return Column( + crossAxisAlignment: CrossAxisAlignment.start, + spacing: spacing.md, + children: [ + const _SectionLabel(label: 'MENU COMPOSITIONS'), + _ExampleCard( + title: 'Simple Menu', + description: 'Basic actions without icons', + child: Center( + child: StreamContextMenu( + children: [ + StreamContextMenuAction( + label: const Text('Cut'), + ), + StreamContextMenuAction( + label: const Text('Copy'), + ), + StreamContextMenuAction( + label: const Text('Paste'), + ), + ], + ), + ), + ), + _ExampleCard( + title: 'With Icons', + description: 'Actions with leading icons', + child: Center( + child: StreamContextMenu( + children: [ + StreamContextMenuAction( + label: const Text('Reply'), + leading: Icon(icons.arrowShareLeft), + ), + StreamContextMenuAction( + label: const Text('Copy Message'), + leading: Icon(icons.squareBehindSquare2Copy), + ), + StreamContextMenuAction( + label: const Text('Flag Message'), + leading: Icon(icons.flag2), + ), + ], + ), + ), + ), + _ExampleCard( + title: 'With Separator', + description: 'Groups divided by a separator', + child: Center( + child: StreamContextMenu( + children: [ + StreamContextMenuAction( + label: const Text('Reply'), + leading: Icon(icons.arrowShareLeft), + ), + StreamContextMenuAction( + label: const Text('Copy Message'), + leading: Icon(icons.squareBehindSquare2Copy), + ), + const StreamContextMenuSeparator(), + StreamContextMenuAction.destructive( + label: const Text('Delete'), + leading: Icon(icons.trashBin), + ), + ], + ), + ), + ), + _ExampleCard( + title: 'Auto-Separated', + description: 'Using StreamContextMenuAction.separated', + child: Center( + child: StreamContextMenu( + children: StreamContextMenuAction.separated( + items: [ + StreamContextMenuAction( + label: const Text('Reply'), + leading: Icon(icons.arrowShareLeft), + ), + StreamContextMenuAction( + label: const Text('Copy Message'), + leading: Icon(icons.squareBehindSquare2Copy), + ), + StreamContextMenuAction( + label: const Text('Flag Message'), + leading: Icon(icons.flag2), + ), + ], + ), + ), + ), + ), + _ExampleCard( + title: 'Auto-Sectioned', + description: 'Using StreamContextMenuAction.sectioned', + child: Center( + child: StreamContextMenu( + children: StreamContextMenuAction.sectioned( + sections: [ + [ + StreamContextMenuAction( + label: const Text('Reply'), + leading: Icon(icons.arrowShareLeft), + ), + StreamContextMenuAction( + label: const Text('Copy Message'), + leading: Icon(icons.squareBehindSquare2Copy), + ), + StreamContextMenuAction( + label: const Text('Flag Message'), + leading: Icon(icons.flag2), + ), + ], + [ + StreamContextMenuAction.destructive( + label: const Text('Delete Message'), + leading: Icon(icons.trashBin), + ), + ], + ], + ), + ), + ), + ), + _ExampleCard( + title: 'Auto-Partitioned', + description: 'Using StreamContextMenuAction.partitioned', + child: Center( + child: StreamContextMenu( + children: StreamContextMenuAction.partitioned( + items: [ + StreamContextMenuAction( + label: const Text('Reply'), + leading: Icon(icons.arrowShareLeft), + ), + StreamContextMenuAction( + label: const Text('Copy Message'), + leading: Icon(icons.squareBehindSquare2Copy), + ), + StreamContextMenuAction( + label: const Text('Flag Message'), + leading: Icon(icons.flag2), + ), + StreamContextMenuAction.destructive( + label: const Text('Delete Message'), + leading: Icon(icons.trashBin), + ), + ], + ), + ), + ), + ), + ], + ); + } +} + +// ============================================================================= +// Dialog Integration Section +// ============================================================================= + +enum _SampleAction { reply, copy, flag, delete } + +class _DialogIntegrationSection extends StatelessWidget { + const _DialogIntegrationSection(); + + @override + Widget build(BuildContext context) { + final spacing = context.streamSpacing; + + return Column( + crossAxisAlignment: CrossAxisAlignment.start, + spacing: spacing.md, + children: const [ + _SectionLabel(label: 'DIALOG INTEGRATION'), + _TypedValueReturnCard(), + _EnumValueReturnCard(), + ], + ); + } +} + +class _TypedValueReturnCard extends StatefulWidget { + const _TypedValueReturnCard(); + + @override + State<_TypedValueReturnCard> createState() => _TypedValueReturnCardState(); +} + +class _TypedValueReturnCardState extends State<_TypedValueReturnCard> { + String? _result; + + @override + Widget build(BuildContext context) { + final icons = context.streamIcons; + final spacing = context.streamSpacing; + + return _ExampleCard( + title: 'String Value Return', + description: 'Actions carry a String value returned via Navigator.pop', + child: Center( + child: Column( + spacing: spacing.sm, + children: [ + StreamButton( + label: 'Open Menu', + type: StreamButtonType.outline, + size: StreamButtonSize.small, + onTap: () async { + final result = await showDialog( + context: context, + builder: (_) => Dialog( + backgroundColor: StreamColors.transparent, + child: StreamContextMenu( + children: [ + StreamContextMenuAction( + value: 'reply', + label: const Text('Reply'), + leading: Icon(icons.arrowShareLeft), + ), + StreamContextMenuAction( + value: 'copy', + label: const Text('Copy Message'), + leading: Icon(icons.squareBehindSquare2Copy), + ), + StreamContextMenuAction( + value: 'flag', + label: const Text('Flag Message'), + leading: Icon(icons.flag2), + ), + ], + ), + ), + ); + setState(() => _result = result); + }, + ), + _ResultChip( + label: _result != null ? '"$_result"' : 'No selection yet', + isActive: _result != null, + ), + ], + ), + ), + ); + } +} + +class _EnumValueReturnCard extends StatefulWidget { + const _EnumValueReturnCard(); + + @override + State<_EnumValueReturnCard> createState() => _EnumValueReturnCardState(); +} + +class _EnumValueReturnCardState extends State<_EnumValueReturnCard> { + _SampleAction? _result; + + @override + Widget build(BuildContext context) { + final icons = context.streamIcons; + final spacing = context.streamSpacing; + + return _ExampleCard( + title: 'Enum Value Return', + description: 'Type-safe actions using an enum as the value type', + child: Center( + child: Column( + spacing: spacing.sm, + children: [ + StreamButton( + label: 'Open Menu', + type: StreamButtonType.outline, + size: StreamButtonSize.small, + onTap: () async { + final result = await showDialog<_SampleAction>( + context: context, + builder: (_) => Dialog( + backgroundColor: StreamColors.transparent, + child: StreamContextMenu( + children: [ + StreamContextMenuAction<_SampleAction>( + value: _SampleAction.reply, + label: const Text('Reply'), + leading: Icon(icons.arrowShareLeft), + ), + StreamContextMenuAction<_SampleAction>( + value: _SampleAction.copy, + label: const Text('Copy Message'), + leading: Icon(icons.squareBehindSquare2Copy), + ), + StreamContextMenuAction<_SampleAction>( + value: _SampleAction.flag, + label: const Text('Flag Message'), + leading: Icon(icons.flag2), + ), + const StreamContextMenuSeparator(), + StreamContextMenuAction<_SampleAction>.destructive( + value: _SampleAction.delete, + label: const Text('Delete Message'), + leading: Icon(icons.trashBin), + ), + ], + ), + ), + ); + setState(() => _result = result); + }, + ), + _ResultChip( + label: _result != null ? '_SampleAction.${_result!.name}' : 'No selection yet', + isActive: _result != null, + ), + ], + ), + ), + ); + } +} + +// ============================================================================= +// Custom Theming Section +// ============================================================================= + +class _CustomThemingSection extends StatelessWidget { + const _CustomThemingSection(); + + @override + Widget build(BuildContext context) { + final icons = context.streamIcons; + final spacing = context.streamSpacing; + final colorScheme = context.streamColorScheme; + + return Column( + crossAxisAlignment: CrossAxisAlignment.start, + spacing: spacing.md, + children: [ + const _SectionLabel(label: 'CUSTOM THEMING'), + _ExampleCard( + title: 'Compact Style', + description: 'Smaller padding and text for dense layouts', + child: Center( + child: StreamContextMenuActionTheme( + data: const StreamContextMenuActionThemeData( + style: StreamContextMenuActionStyle( + minimumSize: WidgetStatePropertyAll(Size(200, 32)), + iconSize: WidgetStatePropertyAll(16), + padding: WidgetStatePropertyAll( + EdgeInsets.symmetric(horizontal: 8, vertical: 4), + ), + ), + ), + child: StreamContextMenu( + children: [ + StreamContextMenuAction( + label: const Text('Reply'), + leading: Icon(icons.arrowShareLeft), + ), + StreamContextMenuAction( + label: const Text('Copy'), + leading: Icon(icons.squareBehindSquare2Copy), + ), + StreamContextMenuAction( + label: const Text('Flag'), + leading: Icon(icons.flag2), + ), + ], + ), + ), + ), + ), + _ExampleCard( + title: 'Sub-Menu Navigation', + description: 'Back action with tertiary styling via a local theme', + child: Center( + child: StreamContextMenu( + children: [ + StreamContextMenuActionTheme( + data: StreamContextMenuActionThemeData( + style: StreamContextMenuActionStyle( + foregroundColor: WidgetStatePropertyAll( + colorScheme.textTertiary, + ), + iconColor: WidgetStatePropertyAll( + colorScheme.textTertiary, + ), + ), + ), + child: StreamContextMenuAction( + label: const Text('Reactions'), + leading: Icon(icons.chevronLeft), + ), + ), + StreamContextMenuAction( + label: const Text('Love'), + leading: Icon(icons.heart2), + ), + StreamContextMenuAction( + label: const Text('Smile'), + leading: Icon(icons.emojiSmile), + ), + ], + ), + ), + ), + ], + ); + } +} + +// ============================================================================= +// Real-World Examples Section +// ============================================================================= + +class _RealWorldSection extends StatelessWidget { + const _RealWorldSection(); + + @override + Widget build(BuildContext context) { + final icons = context.streamIcons; + final spacing = context.streamSpacing; + + return Column( + crossAxisAlignment: CrossAxisAlignment.start, + spacing: spacing.md, + children: [ + const _SectionLabel(label: 'REAL-WORLD EXAMPLES'), + _ExampleCard( + title: 'Incoming Message Actions', + description: 'Actions for a message from another user', + child: Center( + child: StreamContextMenu( + children: [ + StreamContextMenuAction( + label: const Text('Reply'), + leading: Icon(icons.arrowShareLeft), + ), + StreamContextMenuAction( + label: const Text('Thread Reply'), + leading: Icon(icons.bubbleText6ChatMessage), + ), + StreamContextMenuAction( + label: const Text('Pin to Conversation'), + leading: Icon(icons.pin), + ), + StreamContextMenuAction( + label: const Text('Copy Message'), + leading: Icon(icons.squareBehindSquare2Copy), + ), + StreamContextMenuAction( + label: const Text('Mark Unread'), + leading: Icon(icons.bubbleWideNotificationChatMessage), + ), + StreamContextMenuAction( + label: const Text('Remind Me'), + leading: Icon(icons.bellNotification), + ), + StreamContextMenuAction( + label: const Text('Save For Later'), + leading: Icon(icons.fileBend), + ), + StreamContextMenuAction( + label: const Text('Flag Message'), + leading: Icon(icons.flag2), + ), + StreamContextMenuAction( + label: const Text('Mute User'), + leading: Icon(icons.mute), + ), + const StreamContextMenuSeparator(), + StreamContextMenuAction.destructive( + label: const Text('Block User'), + leading: Icon(icons.circleBanSign), + ), + ], + ), + ), + ), + _ExampleCard( + title: 'Outgoing Message Actions', + description: 'Actions for a message sent by the current user', + child: Center( + child: StreamContextMenu( + children: [ + StreamContextMenuAction( + label: const Text('Reply'), + leading: Icon(icons.arrowShareLeft), + ), + StreamContextMenuAction( + label: const Text('Thread Reply'), + leading: Icon(icons.bubbleText6ChatMessage), + ), + StreamContextMenuAction( + label: const Text('Pin to Conversation'), + leading: Icon(icons.pin), + ), + StreamContextMenuAction( + label: const Text('Copy Message'), + leading: Icon(icons.squareBehindSquare2Copy), + ), + StreamContextMenuAction( + label: const Text('Edit Message'), + leading: Icon(icons.editBig), + ), + const StreamContextMenuSeparator(), + StreamContextMenuAction.destructive( + label: const Text('Delete Message'), + leading: Icon(icons.trashBin), + ), + ], + ), + ), + ), + ], + ); + } +} + +// ============================================================================= +// Shared Widgets +// ============================================================================= + +class _ExampleCard extends StatelessWidget { + const _ExampleCard({ + required this.title, + required this.description, + required this.child, + }); + + final String title; + final String description; + final Widget child; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final boxShadow = context.streamBoxShadow; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Container( + width: double.infinity, + clipBehavior: Clip.antiAlias, + decoration: BoxDecoration( + color: colorScheme.backgroundSurfaceSubtle, + borderRadius: BorderRadius.all(radius.lg), + boxShadow: boxShadow.elevation1, + ), + foregroundDecoration: BoxDecoration( + borderRadius: BorderRadius.all(radius.lg), + border: Border.all(color: colorScheme.borderSubtle), + ), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + Padding( + padding: EdgeInsets.fromLTRB( + spacing.md, + spacing.sm, + spacing.md, + spacing.sm, + ), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + Text( + title, + style: textTheme.captionEmphasis.copyWith( + color: colorScheme.textPrimary, + ), + ), + Text( + description, + style: textTheme.metadataDefault.copyWith( + color: colorScheme.textTertiary, + ), + ), + ], + ), + ), + Divider(height: 1, color: colorScheme.borderSubtle), + Container( + width: double.infinity, + padding: EdgeInsets.all(spacing.md), + color: colorScheme.backgroundSurface, + child: child, + ), + ], + ), + ); + } +} + +class _SectionLabel extends StatelessWidget { + const _SectionLabel({required this.label}); + + final String label; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Container( + padding: EdgeInsets.symmetric( + horizontal: spacing.sm, + vertical: spacing.xs, + ), + decoration: BoxDecoration( + color: colorScheme.accentPrimary, + borderRadius: BorderRadius.all(radius.xs), + ), + child: Text( + label, + style: textTheme.metadataEmphasis.copyWith( + color: colorScheme.textOnAccent, + letterSpacing: 1, + fontSize: 9, + ), + ), + ); + } +} + +class _ResultChip extends StatelessWidget { + const _ResultChip({required this.label, required this.isActive}); + + final String label; + final bool isActive; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final spacing = context.streamSpacing; + + return Container( + padding: EdgeInsets.symmetric( + horizontal: spacing.sm, + vertical: spacing.xs, + ), + decoration: BoxDecoration( + color: isActive ? colorScheme.accentPrimary.withValues(alpha: 0.1) : colorScheme.backgroundSurfaceSubtle, + borderRadius: BorderRadius.circular(6), + border: Border.all( + color: isActive ? colorScheme.accentPrimary : colorScheme.borderDefault, + ), + ), + child: Text( + label, + style: textTheme.metadataEmphasis.copyWith( + fontFamily: isActive ? 'monospace' : null, + color: isActive ? colorScheme.accentPrimary : colorScheme.textTertiary, + ), + ), + ); + } +} diff --git a/apps/design_system_gallery/lib/components/controls/stream_emoji_chip.dart b/apps/design_system_gallery/lib/components/controls/stream_emoji_chip.dart new file mode 100644 index 0000000..78b3d70 --- /dev/null +++ b/apps/design_system_gallery/lib/components/controls/stream_emoji_chip.dart @@ -0,0 +1,1130 @@ +import 'package:flutter/material.dart'; +import 'package:stream_core_flutter/stream_core_flutter.dart'; +import 'package:unicode_emojis/unicode_emojis.dart'; +import 'package:widgetbook/widgetbook.dart'; +import 'package:widgetbook_annotation/widgetbook_annotation.dart' as widgetbook; + +// ============================================================================= +// Playground +// ============================================================================= + +@widgetbook.UseCase( + name: 'Playground', + type: StreamEmojiChip, + path: '[Components]/Controls', +) +Widget buildStreamEmojiChipPlayground(BuildContext context) { + return const _PlaygroundDemo(); +} + +class _PlaygroundDemo extends StatefulWidget { + const _PlaygroundDemo(); + + @override + State<_PlaygroundDemo> createState() => _PlaygroundDemoState(); +} + +class _PlaygroundDemoState extends State<_PlaygroundDemo> { + var _isSelected = false; + + @override + Widget build(BuildContext context) { + final chipType = context.knobs.object.dropdown( + label: 'Chip Type', + options: _ChipType.values, + initialOption: _ChipType.single, + labelBuilder: (t) => t.label, + description: 'Which chip variant to display.', + ); + + final isSingle = chipType == _ChipType.single; + final isCluster = chipType == _ChipType.cluster; + final isOverflow = chipType == _ChipType.overflow; + final isAddEmoji = chipType == _ChipType.addEmoji; + + final emoji = isSingle + ? context.knobs.object.dropdown( + label: 'Emoji', + options: _sampleEmojis, + initialOption: _sampleEmojis.first, + labelBuilder: (e) => '${e.emoji} ${e.name}', + description: 'The emoji to display.', + ) + : null; + + final clusterSize = isCluster + ? context.knobs.int.slider( + label: 'Cluster Size', + initialValue: 3, + min: 1, + max: _sampleEmojis.length, + description: 'Number of emoji icons shown inside the cluster chip.', + ) + : null; + + final overflowCount = isOverflow + ? context.knobs.int.slider( + label: 'Overflow Count', + initialValue: 7, + min: 1, + max: 99, + description: 'The overflow count displayed as +N.', + ) + : null; + + final showCount = + !isAddEmoji && + !isOverflow && + context.knobs.boolean( + label: 'Show Count', + initialValue: true, + description: 'Whether to show the reaction count label.', + ); + + final count = (!isAddEmoji && !isOverflow && showCount) + ? context.knobs.int.slider( + label: 'Count', + initialValue: isCluster ? 12 : 1, + min: 1, + max: 99, + description: 'The reaction count to display.', + ) + : null; + + final isDisabled = context.knobs.boolean( + label: 'Disabled', + description: 'Whether the chip is disabled (non-interactive).', + ); + + final showLongPress = context.knobs.boolean( + label: 'Long Press', + description: 'Whether long-press is handled (e.g. to open a skin-tone picker).', + ); + + void onPressed() { + setState(() => _isSelected = !_isSelected); + ScaffoldMessenger.of(context) + ..hideCurrentSnackBar() + ..showSnackBar( + SnackBar( + content: Text(_isSelected ? 'Reaction added' : 'Reaction removed'), + duration: const Duration(seconds: 1), + ), + ); + } + + void onLongPressed() { + ScaffoldMessenger.of(context) + ..hideCurrentSnackBar() + ..showSnackBar( + const SnackBar( + content: Text('Long pressed — e.g. open skin-tone picker'), + duration: Duration(seconds: 1), + ), + ); + } + + return Center( + child: switch (chipType) { + _ChipType.addEmoji => StreamEmojiChip.addEmoji( + onPressed: isDisabled ? null : onPressed, + onLongPress: (showLongPress && !isDisabled) ? onLongPressed : null, + ), + _ChipType.overflow => StreamEmojiChip.overflow( + count: overflowCount!, + onPressed: isDisabled ? null : onPressed, + ), + _ChipType.cluster => StreamEmojiChip.cluster( + emojis: [ + for (final e in _sampleEmojis.take(clusterSize!)) Text(e.emoji), + ], + count: count, + isSelected: _isSelected, + onPressed: isDisabled ? null : onPressed, + onLongPress: (showLongPress && !isDisabled) ? onLongPressed : null, + ), + _ChipType.single => StreamEmojiChip( + emoji: Text(emoji!.emoji), + count: count, + isSelected: _isSelected, + onPressed: isDisabled ? null : onPressed, + onLongPress: (showLongPress && !isDisabled) ? onLongPressed : null, + ), + }, + ); + } +} + +// ============================================================================= +// Showcase +// ============================================================================= + +@widgetbook.UseCase( + name: 'Showcase', + type: StreamEmojiChip, + path: '[Components]/Controls', +) +Widget buildStreamEmojiChipShowcase(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final spacing = context.streamSpacing; + + return DefaultTextStyle( + style: textTheme.bodyDefault.copyWith(color: colorScheme.textPrimary), + child: SingleChildScrollView( + padding: EdgeInsets.all(spacing.lg), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + spacing: spacing.xl, + children: const [ + _TypeVariantsSection(), + _ClusterVariantsSection(), + _OverflowVariantsSection(), + _CountValuesSection(), + _StateMatrixSection(), + _RealWorldSection(), + ], + ), + ), + ); +} + +// ============================================================================= +// Type Variants Section +// ============================================================================= + +class _TypeVariantsSection extends StatelessWidget { + const _TypeVariantsSection(); + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final boxShadow = context.streamBoxShadow; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Column( + crossAxisAlignment: CrossAxisAlignment.start, + spacing: spacing.md, + children: [ + const _SectionLabel(label: 'TYPE VARIANTS'), + Container( + width: double.infinity, + clipBehavior: Clip.antiAlias, + padding: EdgeInsets.all(spacing.md), + decoration: BoxDecoration( + color: colorScheme.backgroundSurfaceSubtle, + borderRadius: BorderRadius.all(radius.lg), + boxShadow: boxShadow.elevation1, + ), + foregroundDecoration: BoxDecoration( + borderRadius: BorderRadius.all(radius.lg), + border: Border.all(color: colorScheme.borderSubtle), + ), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + spacing: spacing.md, + children: [ + Text( + 'Single-emoji chip (with count, without count, selected), ' + 'cluster chip, overflow chip, and Add Emoji chip.', + style: textTheme.captionDefault.copyWith(color: colorScheme.textSecondary), + ), + Wrap( + spacing: spacing.md, + runSpacing: spacing.md, + children: [ + _TypeDemo( + label: 'With count', + child: StreamEmojiChip( + emoji: const Text('👍'), + count: 3, + onPressed: () {}, + ), + ), + _TypeDemo( + label: 'Without count', + child: StreamEmojiChip( + emoji: const Text('👍'), + onPressed: () {}, + ), + ), + _TypeDemo( + label: 'Selected', + child: StreamEmojiChip( + emoji: const Text('👍'), + count: 3, + isSelected: true, + onPressed: () {}, + ), + ), + _TypeDemo( + label: 'Cluster', + child: StreamEmojiChip.cluster( + emojis: const [Text('👍'), Text('❤️'), Text('😂')], + count: 12, + onPressed: () {}, + ), + ), + _TypeDemo( + label: 'Overflow', + child: StreamEmojiChip.overflow( + count: 7, + onPressed: () {}, + ), + ), + _TypeDemo( + label: 'Add Emoji', + child: StreamEmojiChip.addEmoji(onPressed: () {}), + ), + ], + ), + ], + ), + ), + ], + ); + } +} + +class _TypeDemo extends StatelessWidget { + const _TypeDemo({required this.label, required this.child}); + + final String label; + final Widget child; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final spacing = context.streamSpacing; + + return Column( + mainAxisSize: MainAxisSize.min, + spacing: spacing.xs, + children: [ + child, + Text( + label, + style: textTheme.metadataEmphasis.copyWith( + color: colorScheme.accentPrimary, + fontFamily: 'monospace', + ), + ), + ], + ); + } +} + +// ============================================================================= +// Cluster Variants Section +// ============================================================================= + +class _ClusterVariantsSection extends StatelessWidget { + const _ClusterVariantsSection(); + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final boxShadow = context.streamBoxShadow; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Column( + crossAxisAlignment: CrossAxisAlignment.start, + spacing: spacing.md, + children: [ + const _SectionLabel(label: 'CLUSTER VARIANTS'), + Container( + width: double.infinity, + clipBehavior: Clip.antiAlias, + padding: EdgeInsets.all(spacing.md), + decoration: BoxDecoration( + color: colorScheme.backgroundSurfaceSubtle, + borderRadius: BorderRadius.all(radius.lg), + boxShadow: boxShadow.elevation1, + ), + foregroundDecoration: BoxDecoration( + borderRadius: BorderRadius.all(radius.lg), + border: Border.all(color: colorScheme.borderSubtle), + ), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + spacing: spacing.md, + children: [ + Text( + 'Cluster chips render 1–4 emoji icons side-by-side, each ' + 'individually sized. The total reaction count is shown after the icons.', + style: textTheme.captionDefault.copyWith(color: colorScheme.textSecondary), + ), + Wrap( + spacing: spacing.md, + runSpacing: spacing.md, + children: [ + _TypeDemo( + label: '1 emoji', + child: StreamEmojiChip.cluster( + emojis: const [Text('👍')], + count: 5, + onPressed: () {}, + ), + ), + _TypeDemo( + label: '2 emojis', + child: StreamEmojiChip.cluster( + emojis: const [Text('👍'), Text('❤️')], + count: 9, + onPressed: () {}, + ), + ), + _TypeDemo( + label: '3 emojis', + child: StreamEmojiChip.cluster( + emojis: const [Text('👍'), Text('❤️'), Text('😂')], + count: 17, + onPressed: () {}, + ), + ), + _TypeDemo( + label: '4 emojis', + child: StreamEmojiChip.cluster( + emojis: const [Text('👍'), Text('❤️'), Text('😂'), Text('🔥')], + count: 42, + onPressed: () {}, + ), + ), + _TypeDemo( + label: 'no count', + child: StreamEmojiChip.cluster( + emojis: const [Text('👍'), Text('❤️'), Text('😂')], + onPressed: () {}, + ), + ), + _TypeDemo( + label: 'selected', + child: StreamEmojiChip.cluster( + emojis: const [Text('👍'), Text('❤️'), Text('😂')], + count: 12, + isSelected: true, + onPressed: () {}, + ), + ), + ], + ), + ], + ), + ), + ], + ); + } +} + +// ============================================================================= +// Overflow Variants Section +// ============================================================================= + +class _OverflowVariantsSection extends StatelessWidget { + const _OverflowVariantsSection(); + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final boxShadow = context.streamBoxShadow; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Column( + crossAxisAlignment: CrossAxisAlignment.start, + spacing: spacing.md, + children: [ + const _SectionLabel(label: 'OVERFLOW VARIANTS'), + Container( + width: double.infinity, + clipBehavior: Clip.antiAlias, + padding: EdgeInsets.all(spacing.md), + decoration: BoxDecoration( + color: colorScheme.backgroundSurfaceSubtle, + borderRadius: BorderRadius.all(radius.lg), + boxShadow: boxShadow.elevation1, + ), + foregroundDecoration: BoxDecoration( + borderRadius: BorderRadius.all(radius.lg), + border: Border.all(color: colorScheme.borderSubtle), + ), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + spacing: spacing.md, + children: [ + Text( + 'Overflow chips display a +N label for collapsed items. ' + 'The count uses the numeric text style rather than emoji sizing.', + style: textTheme.captionDefault.copyWith( + color: colorScheme.textSecondary, + ), + ), + Wrap( + spacing: spacing.md, + runSpacing: spacing.md, + children: [ + for (final count in [1, 3, 7, 15, 42, 99]) + _TypeDemo( + label: '+$count', + child: StreamEmojiChip.overflow( + count: count, + onPressed: () {}, + ), + ), + _TypeDemo( + label: 'disabled', + child: StreamEmojiChip.overflow(count: 5), + ), + ], + ), + ], + ), + ), + ], + ); + } +} + +// ============================================================================= +// Count Values Section +// ============================================================================= + +class _CountValuesSection extends StatelessWidget { + const _CountValuesSection(); + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final boxShadow = context.streamBoxShadow; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Column( + crossAxisAlignment: CrossAxisAlignment.start, + spacing: spacing.md, + children: [ + const _SectionLabel(label: 'COUNT VALUES'), + Container( + width: double.infinity, + clipBehavior: Clip.antiAlias, + padding: EdgeInsets.all(spacing.md), + decoration: BoxDecoration( + color: colorScheme.backgroundSurfaceSubtle, + borderRadius: BorderRadius.all(radius.lg), + boxShadow: boxShadow.elevation1, + ), + foregroundDecoration: BoxDecoration( + borderRadius: BorderRadius.all(radius.lg), + border: Border.all(color: colorScheme.borderSubtle), + ), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + spacing: spacing.md, + children: [ + Text( + "Chips respect a minimum width so single-digit counts don't produce " + 'a narrow pill. Large counts expand the chip naturally.', + style: textTheme.captionDefault.copyWith(color: colorScheme.textSecondary), + ), + Wrap( + spacing: spacing.sm, + runSpacing: spacing.sm, + children: [ + for (final count in [1, 9, 42, 99]) + _TypeDemo( + label: 'count: $count', + child: StreamEmojiChip( + emoji: const Text('👍'), + count: count, + onPressed: () {}, + ), + ), + _TypeDemo( + label: 'no count', + child: StreamEmojiChip(emoji: const Text('👍')), + ), + ], + ), + ], + ), + ), + ], + ); + } +} + +// ============================================================================= +// State Matrix Section +// ============================================================================= + +class _StateMatrixSection extends StatelessWidget { + const _StateMatrixSection(); + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final boxShadow = context.streamBoxShadow; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Column( + crossAxisAlignment: CrossAxisAlignment.start, + spacing: spacing.md, + children: [ + const _SectionLabel(label: 'STATE MATRIX'), + Container( + width: double.infinity, + clipBehavior: Clip.antiAlias, + padding: EdgeInsets.all(spacing.md), + decoration: BoxDecoration( + color: colorScheme.backgroundSurfaceSubtle, + borderRadius: BorderRadius.all(radius.lg), + boxShadow: boxShadow.elevation1, + ), + foregroundDecoration: BoxDecoration( + borderRadius: BorderRadius.all(radius.lg), + border: Border.all(color: colorScheme.borderSubtle), + ), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + spacing: spacing.md, + children: [ + Text( + 'Hover and press states are interactive — try them. ' + 'Selected state applies only to single and cluster chips. ' + 'Overflow chips do not support selection.', + style: textTheme.captionDefault.copyWith(color: colorScheme.textSecondary), + ), + SingleChildScrollView( + scrollDirection: Axis.horizontal, + child: ConstrainedBox( + constraints: const BoxConstraints(minWidth: 520), + child: Column( + spacing: spacing.md, + children: [ + _StateRow( + stateLabel: '', + standardChip: Text( + 'Single', + style: textTheme.metadataEmphasis.copyWith( + color: colorScheme.textTertiary, + fontSize: 10, + ), + ), + clusterChip: Text( + 'Cluster', + style: textTheme.metadataEmphasis.copyWith( + color: colorScheme.textTertiary, + fontSize: 10, + ), + ), + overflowChip: Text( + 'Overflow', + style: textTheme.metadataEmphasis.copyWith( + color: colorScheme.textTertiary, + fontSize: 10, + ), + ), + addEmojiChip: Text( + 'Add Emoji', + style: textTheme.metadataEmphasis.copyWith( + color: colorScheme.textTertiary, + fontSize: 10, + ), + ), + ), + _StateRow( + stateLabel: 'default', + standardChip: StreamEmojiChip( + emoji: const Text('👍'), + count: 3, + onPressed: () {}, + ), + clusterChip: StreamEmojiChip.cluster( + emojis: const [Text('👍'), Text('❤️'), Text('😂')], + count: 12, + onPressed: () {}, + ), + overflowChip: StreamEmojiChip.overflow( + count: 7, + onPressed: () {}, + ), + addEmojiChip: StreamEmojiChip.addEmoji(onPressed: () {}), + ), + _StateRow( + stateLabel: 'selected', + standardChip: StreamEmojiChip( + emoji: const Text('👍'), + count: 3, + isSelected: true, + onPressed: () {}, + ), + clusterChip: StreamEmojiChip.cluster( + emojis: const [Text('👍'), Text('❤️'), Text('😂')], + count: 12, + isSelected: true, + onPressed: () {}, + ), + addEmojiChip: null, + ), + _StateRow( + stateLabel: 'disabled', + standardChip: StreamEmojiChip( + emoji: const Text('👍'), + count: 3, + ), + clusterChip: StreamEmojiChip.cluster( + emojis: const [Text('👍'), Text('❤️'), Text('😂')], + count: 12, + ), + overflowChip: StreamEmojiChip.overflow(count: 7), + addEmojiChip: StreamEmojiChip.addEmoji(), + ), + _StateRow( + stateLabel: 'selected\n+ disabled', + standardChip: StreamEmojiChip( + emoji: const Text('👍'), + count: 3, + isSelected: true, + ), + clusterChip: StreamEmojiChip.cluster( + emojis: const [Text('👍'), Text('❤️'), Text('😂')], + count: 12, + isSelected: true, + ), + addEmojiChip: null, + ), + ], + ), + ), + ), + ], + ), + ), + ], + ); + } +} + +class _StateRow extends StatelessWidget { + const _StateRow({ + required this.stateLabel, + required this.standardChip, + required this.clusterChip, + this.overflowChip, + required this.addEmojiChip, + }); + + final String stateLabel; + final Widget standardChip; + final Widget? clusterChip; + final Widget? overflowChip; + final Widget? addEmojiChip; + + static const _cellWidth = 108.0; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + + Widget naText() => Text( + 'n/a', + style: textTheme.metadataDefault.copyWith( + color: colorScheme.textDisabled, + fontSize: 10, + ), + ); + + Widget cell(Widget? child) => SizedBox( + width: _cellWidth, + child: Center(child: child ?? naText()), + ); + + return Row( + children: [ + SizedBox( + width: 88, + child: Text( + stateLabel, + style: textTheme.metadataEmphasis.copyWith( + color: colorScheme.textSecondary, + fontSize: 10, + ), + ), + ), + cell(standardChip), + cell(clusterChip), + cell(overflowChip), + cell(addEmojiChip), + ], + ); + } +} + +// ============================================================================= +// Real-World Section +// ============================================================================= + +class _RealWorldSection extends StatelessWidget { + const _RealWorldSection(); + + @override + Widget build(BuildContext context) { + final spacing = context.streamSpacing; + + return Column( + crossAxisAlignment: CrossAxisAlignment.start, + spacing: spacing.md, + children: const [ + _SectionLabel(label: 'REAL-WORLD EXAMPLES'), + _ExampleCard( + title: 'Message Reactions', + description: + 'Interactive reaction bar below a chat message — tap to toggle, ' + 'long-press would open a skin-tone picker.', + child: _MessageReactionsExample(), + ), + _ExampleCard( + title: 'Clustered Reactions', + description: + 'All reactions grouped into a single cluster chip — tap the chip ' + 'to see the total count; commonly used in compact message threads.', + child: _ClusteredReactionsExample(), + ), + _ExampleCard( + title: 'Busy Reaction Bar', + description: + 'Many reactions with large counts — shows wrap behaviour and ' + 'minimum width enforcement.', + child: _BusyReactionsExample(), + ), + ], + ); + } +} + +class _MessageReactionsExample extends StatefulWidget { + const _MessageReactionsExample(); + + @override + State<_MessageReactionsExample> createState() => _MessageReactionsExampleState(); +} + +class _MessageReactionsExampleState extends State<_MessageReactionsExample> { + final _counts = {'👍': 3, '❤️': 1, '😂': 5}; + final _mine = {'👍'}; + + void _toggle(String emoji) { + setState(() { + if (_mine.contains(emoji)) { + _mine.remove(emoji); + _counts[emoji] = (_counts[emoji] ?? 1) - 1; + if (_counts[emoji]! <= 0) _counts.remove(emoji); + } else { + _mine.add(emoji); + _counts[emoji] = (_counts[emoji] ?? 0) + 1; + } + }); + } + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Column( + crossAxisAlignment: CrossAxisAlignment.start, + mainAxisSize: MainAxisSize.min, + spacing: spacing.xs, + children: [ + Container( + constraints: const BoxConstraints(maxWidth: 280), + padding: EdgeInsets.symmetric(horizontal: spacing.md, vertical: spacing.sm), + decoration: BoxDecoration( + color: colorScheme.backgroundSurface, + borderRadius: BorderRadius.all(radius.lg), + border: Border.all(color: colorScheme.borderSubtle), + ), + child: Text( + 'Looks great! 🎉 Really happy with how this turned out.', + style: textTheme.bodyDefault.copyWith(color: colorScheme.textPrimary), + ), + ), + Wrap( + spacing: spacing.xs, + runSpacing: spacing.xs, + children: [ + for (final entry in _counts.entries) + StreamEmojiChip( + emoji: Text(entry.key), + count: entry.value, + isSelected: _mine.contains(entry.key), + onPressed: () => _toggle(entry.key), + onLongPress: () { + ScaffoldMessenger.of(context) + ..hideCurrentSnackBar() + ..showSnackBar( + const SnackBar( + content: Text('Long pressed — open skin-tone picker'), + duration: Duration(seconds: 1), + ), + ); + }, + ), + StreamEmojiChip.addEmoji( + onPressed: () { + ScaffoldMessenger.of(context) + ..hideCurrentSnackBar() + ..showSnackBar( + const SnackBar( + content: Text('Open reaction picker'), + duration: Duration(seconds: 1), + ), + ); + }, + ), + ], + ), + ], + ); + } +} + +class _ClusteredReactionsExample extends StatefulWidget { + const _ClusteredReactionsExample(); + + @override + State<_ClusteredReactionsExample> createState() => _ClusteredReactionsExampleState(); +} + +class _ClusteredReactionsExampleState extends State<_ClusteredReactionsExample> { + static const _allReactions = [ + ('👍', 4), + ('❤️', 3), + ('😂', 2), + ('🔥', 1), + ]; + + var _isSelected = false; + + int get _totalCount => _allReactions.fold(0, (sum, r) => sum + r.$2); + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Column( + crossAxisAlignment: CrossAxisAlignment.start, + mainAxisSize: MainAxisSize.min, + spacing: spacing.xs, + children: [ + Container( + constraints: const BoxConstraints(maxWidth: 280), + padding: EdgeInsets.symmetric(horizontal: spacing.md, vertical: spacing.sm), + decoration: BoxDecoration( + color: colorScheme.backgroundSurface, + borderRadius: BorderRadius.all(radius.lg), + border: Border.all(color: colorScheme.borderSubtle), + ), + child: Text( + 'Looks great! 🎉 Really happy with how this turned out.', + style: textTheme.bodyDefault.copyWith(color: colorScheme.textPrimary), + ), + ), + StreamEmojiChip.cluster( + emojis: [for (final (emoji, _) in _allReactions) Text(emoji)], + count: _totalCount, + isSelected: _isSelected, + onPressed: () { + setState(() => _isSelected = !_isSelected); + ScaffoldMessenger.of(context) + ..hideCurrentSnackBar() + ..showSnackBar( + const SnackBar( + content: Text('Cluster tapped — show reaction details'), + duration: Duration(seconds: 1), + ), + ); + }, + ), + ], + ); + } +} + +class _BusyReactionsExample extends StatelessWidget { + const _BusyReactionsExample(); + + static const _reactions = [ + ('👍', 42), + ('❤️', 99), + ('😂', 17), + ('🔥', 8), + ('😮', 3), + ('👏', 26), + ('🎉', 1), + ('😢', 5), + ]; + + @override + Widget build(BuildContext context) { + final spacing = context.streamSpacing; + + return Wrap( + spacing: spacing.xs, + runSpacing: spacing.xs, + children: [ + for (final (emoji, count) in _reactions) + StreamEmojiChip( + emoji: Text(emoji), + count: count, + onPressed: () {}, + ), + StreamEmojiChip.addEmoji(onPressed: () {}), + ], + ); + } +} + +// ============================================================================= +// Shared Widgets +// ============================================================================= + +class _ExampleCard extends StatelessWidget { + const _ExampleCard({ + required this.title, + required this.description, + required this.child, + }); + + final String title; + final String description; + final Widget child; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final boxShadow = context.streamBoxShadow; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Container( + width: double.infinity, + clipBehavior: Clip.antiAlias, + decoration: BoxDecoration( + color: colorScheme.backgroundSurfaceSubtle, + borderRadius: BorderRadius.all(radius.lg), + boxShadow: boxShadow.elevation1, + ), + foregroundDecoration: BoxDecoration( + borderRadius: BorderRadius.all(radius.lg), + border: Border.all(color: colorScheme.borderSubtle), + ), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + Padding( + padding: EdgeInsets.symmetric(horizontal: spacing.md, vertical: spacing.sm), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + Text( + title, + style: textTheme.captionEmphasis.copyWith(color: colorScheme.textPrimary), + ), + Text( + description, + style: textTheme.metadataDefault.copyWith(color: colorScheme.textTertiary), + ), + ], + ), + ), + Divider(height: 1, color: colorScheme.borderSubtle), + Container( + width: double.infinity, + padding: EdgeInsets.all(spacing.md), + color: colorScheme.backgroundSurfaceSubtle, + child: child, + ), + ], + ), + ); + } +} + +class _SectionLabel extends StatelessWidget { + const _SectionLabel({required this.label}); + + final String label; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Container( + padding: EdgeInsets.symmetric(horizontal: spacing.sm, vertical: spacing.xs), + decoration: BoxDecoration( + color: colorScheme.accentPrimary, + borderRadius: BorderRadius.all(radius.xs), + ), + child: Text( + label, + style: textTheme.metadataEmphasis.copyWith( + color: colorScheme.textOnAccent, + letterSpacing: 1, + fontSize: 9, + ), + ), + ); + } +} + +// ============================================================================= +// Helpers +// ============================================================================= + +enum _ChipType { + single, + cluster, + overflow, + addEmoji + ; + + String get label => switch (this) { + _ChipType.single => 'Single', + _ChipType.cluster => 'Cluster', + _ChipType.overflow => 'Overflow', + _ChipType.addEmoji => 'Add Emoji', + }; +} + +Emoji _byName(String name) => UnicodeEmojis.allEmojis.firstWhere((e) => e.name == name); + +final _sampleEmojis = [ + _byName('thumbs up sign'), + _byName('heavy black heart'), + _byName('face with tears of joy'), + _byName('fire'), + _byName('clapping hands sign'), + _byName('party popper'), + _byName('white heavy check mark'), + _byName('rocket'), +]; diff --git a/apps/design_system_gallery/lib/components/controls/stream_emoji_chip_bar.dart b/apps/design_system_gallery/lib/components/controls/stream_emoji_chip_bar.dart new file mode 100644 index 0000000..6e517fe --- /dev/null +++ b/apps/design_system_gallery/lib/components/controls/stream_emoji_chip_bar.dart @@ -0,0 +1,681 @@ +import 'package:flutter/material.dart'; +import 'package:stream_core_flutter/stream_core_flutter.dart'; +import 'package:widgetbook/widgetbook.dart'; +import 'package:widgetbook_annotation/widgetbook_annotation.dart' as widgetbook; + +// ============================================================================= +// Playground +// ============================================================================= + +@widgetbook.UseCase( + name: 'Playground', + type: StreamEmojiChipBar, + path: '[Components]/Controls', +) +Widget buildStreamEmojiChipBarPlayground(BuildContext context) { + return const _PlaygroundDemo(); +} + +class _PlaygroundDemo extends StatefulWidget { + const _PlaygroundDemo(); + + @override + State<_PlaygroundDemo> createState() => _PlaygroundDemoState(); +} + +class _PlaygroundDemoState extends State<_PlaygroundDemo> { + late List> _items; + String? _selected; + + @override + void initState() { + super.initState(); + _items = _buildItems(5); + } + + List> _buildItems(int count) { + return [ + for (var i = 0; i < count && i < _reactions.length; i++) + StreamEmojiChipItem( + value: _reactions[i].$1, + emoji: Text(_reactions[i].$1), + count: _reactions[i].$2, + ), + ]; + } + + @override + Widget build(BuildContext context) { + final itemCount = context.knobs.int.slider( + label: 'Item Count', + initialValue: 5, + min: 1, + max: 8, + description: 'Number of emoji filter items.', + ); + + final showLeading = context.knobs.boolean( + label: 'Show Leading (Add Emoji)', + initialValue: true, + description: 'Whether to show the add-emoji chip before items.', + ); + + final isDisabled = context.knobs.boolean( + label: 'Disabled', + description: 'Whether the chip bar is non-interactive.', + ); + + if (itemCount != _items.length) { + _items = _buildItems(itemCount); + final values = _items.map((e) => e.value).toSet(); + if (_selected != null && !values.contains(_selected)) { + _selected = null; + } + } + + return Center( + child: StreamEmojiChipBar( + leading: showLeading + ? StreamEmojiChip.addEmoji( + onPressed: isDisabled + ? null + : () { + ScaffoldMessenger.of(context) + ..hideCurrentSnackBar() + ..showSnackBar( + const SnackBar( + content: Text('Open reaction picker'), + duration: Duration(seconds: 1), + ), + ); + }, + ) + : null, + items: _items, + selected: _selected, + onSelected: isDisabled + ? null + : (value) { + setState(() => _selected = value); + ScaffoldMessenger.of(context) + ..hideCurrentSnackBar() + ..showSnackBar( + SnackBar( + content: Text( + value == null ? 'Filter cleared (All)' : 'Filter: $value', + ), + duration: const Duration(seconds: 1), + ), + ); + }, + ), + ); + } +} + +// ============================================================================= +// Showcase +// ============================================================================= + +@widgetbook.UseCase( + name: 'Showcase', + type: StreamEmojiChipBar, + path: '[Components]/Controls', +) +Widget buildStreamEmojiChipBarShowcase(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final spacing = context.streamSpacing; + + return DefaultTextStyle( + style: textTheme.bodyDefault.copyWith(color: colorScheme.textPrimary), + child: SingleChildScrollView( + padding: EdgeInsets.all(spacing.lg), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + spacing: spacing.xl, + children: const [ + _VariantsSection(), + _SelectionStatesSection(), + _LayoutSection(), + _RealWorldSection(), + ], + ), + ), + ); +} + +// ============================================================================= +// Variants Section +// ============================================================================= + +class _VariantsSection extends StatelessWidget { + const _VariantsSection(); + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final boxShadow = context.streamBoxShadow; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Column( + crossAxisAlignment: CrossAxisAlignment.start, + spacing: spacing.md, + children: [ + const _SectionLabel(label: 'VARIANTS'), + Container( + width: double.infinity, + clipBehavior: Clip.antiAlias, + padding: EdgeInsets.symmetric(vertical: spacing.md), + decoration: BoxDecoration( + color: colorScheme.backgroundSurfaceSubtle, + borderRadius: BorderRadius.all(radius.lg), + boxShadow: boxShadow.elevation1, + ), + foregroundDecoration: BoxDecoration( + borderRadius: BorderRadius.all(radius.lg), + border: Border.all(color: colorScheme.borderSubtle), + ), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + spacing: spacing.md, + children: [ + Padding( + padding: EdgeInsets.symmetric(horizontal: spacing.md), + child: Text( + 'With leading add-emoji chip, without, and disabled states.', + style: textTheme.captionDefault.copyWith( + color: colorScheme.textSecondary, + ), + ), + ), + _VariantDemo( + label: 'With leading', + child: StreamEmojiChipBar( + leading: StreamEmojiChip.addEmoji(onPressed: () {}), + items: _sampleItems, + onSelected: (_) {}, + ), + ), + _VariantDemo( + label: 'Without leading', + child: StreamEmojiChipBar( + items: _sampleItems, + onSelected: (_) {}, + ), + ), + _VariantDemo( + label: 'With selection', + child: StreamEmojiChipBar( + leading: StreamEmojiChip.addEmoji(onPressed: () {}), + items: _sampleItems, + selected: '👍', + onSelected: (_) {}, + ), + ), + _VariantDemo( + label: 'Disabled', + child: StreamEmojiChipBar( + leading: StreamEmojiChip.addEmoji(), + items: _sampleItems, + ), + ), + ], + ), + ), + ], + ); + } +} + +class _VariantDemo extends StatelessWidget { + const _VariantDemo({required this.label, required this.child}); + + final String label; + final Widget child; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final spacing = context.streamSpacing; + + return Column( + crossAxisAlignment: CrossAxisAlignment.start, + mainAxisSize: MainAxisSize.min, + spacing: spacing.xs, + children: [ + Padding( + padding: EdgeInsets.symmetric(horizontal: spacing.md), + child: Text( + label, + style: textTheme.metadataEmphasis.copyWith( + color: colorScheme.accentPrimary, + fontFamily: 'monospace', + ), + ), + ), + child, + ], + ); + } +} + +// ============================================================================= +// Selection States Section +// ============================================================================= + +class _SelectionStatesSection extends StatelessWidget { + const _SelectionStatesSection(); + + @override + Widget build(BuildContext context) { + final spacing = context.streamSpacing; + + return Column( + crossAxisAlignment: CrossAxisAlignment.start, + spacing: spacing.md, + children: const [ + _SectionLabel(label: 'SELECTION STATES'), + _ExampleCard( + title: 'Toggle Selection', + description: + 'Tap a chip to select it. Tap again to deselect. ' + 'Only one chip can be selected at a time.', + child: _ToggleSelectionDemo(), + ), + ], + ); + } +} + +class _ToggleSelectionDemo extends StatefulWidget { + const _ToggleSelectionDemo(); + + @override + State<_ToggleSelectionDemo> createState() => _ToggleSelectionDemoState(); +} + +class _ToggleSelectionDemoState extends State<_ToggleSelectionDemo> { + String? _selected; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final spacing = context.streamSpacing; + + return Column( + crossAxisAlignment: CrossAxisAlignment.start, + spacing: spacing.sm, + children: [ + StreamEmojiChipBar( + leading: StreamEmojiChip.addEmoji(onPressed: () {}), + items: _sampleItems, + selected: _selected, + onSelected: (value) => setState(() => _selected = value), + ), + Padding( + padding: EdgeInsets.symmetric(horizontal: spacing.md), + child: Text( + _selected == null ? 'No filter active — showing all reactions' : 'Filtering by $_selected', + style: textTheme.captionDefault.copyWith( + color: colorScheme.textTertiary, + ), + ), + ), + ], + ); + } +} + +// ============================================================================= +// Layout Section +// ============================================================================= + +class _LayoutSection extends StatelessWidget { + const _LayoutSection(); + + @override + Widget build(BuildContext context) { + final spacing = context.streamSpacing; + + return Column( + crossAxisAlignment: CrossAxisAlignment.start, + spacing: spacing.md, + children: const [ + _SectionLabel(label: 'LAYOUT'), + _ExampleCard( + title: 'Overflow Scrolling', + description: + 'When chips overflow the available width, the bar scrolls ' + 'horizontally. Swipe to reveal more.', + child: _OverflowScrollDemo(), + ), + _ExampleCard( + title: 'Custom Spacing', + description: 'Custom padding and spacing between chips.', + child: _CustomSpacingDemo(), + ), + ], + ); + } +} + +class _OverflowScrollDemo extends StatelessWidget { + const _OverflowScrollDemo(); + + @override + Widget build(BuildContext context) { + return StreamEmojiChipBar( + leading: StreamEmojiChip.addEmoji(onPressed: () {}), + items: _manyItems, + onSelected: (_) {}, + ); + } +} + +class _CustomSpacingDemo extends StatelessWidget { + const _CustomSpacingDemo(); + + @override + Widget build(BuildContext context) { + final spacing = context.streamSpacing; + + return Column( + crossAxisAlignment: CrossAxisAlignment.start, + spacing: spacing.md, + children: [ + _VariantDemo( + label: 'spacing: 16', + child: StreamEmojiChipBar( + items: _sampleItems, + spacing: 16, + onSelected: (_) {}, + ), + ), + _VariantDemo( + label: 'spacing: 2', + child: StreamEmojiChipBar( + items: _sampleItems, + spacing: 2, + onSelected: (_) {}, + ), + ), + ], + ); + } +} + +// ============================================================================= +// Real-World Section +// ============================================================================= + +class _RealWorldSection extends StatelessWidget { + const _RealWorldSection(); + + @override + Widget build(BuildContext context) { + final spacing = context.streamSpacing; + + return Column( + crossAxisAlignment: CrossAxisAlignment.start, + spacing: spacing.md, + children: const [ + _SectionLabel(label: 'REAL-WORLD EXAMPLES'), + _ExampleCard( + title: 'Reaction Detail Sheet', + description: + 'Filter bar above a user list — simulates the reaction detail ' + 'sheet. Tap a chip to filter, tap again to show all.', + child: _ReactionDetailExample(), + ), + ], + ); + } +} + +class _ReactionDetailExample extends StatefulWidget { + const _ReactionDetailExample(); + + @override + State<_ReactionDetailExample> createState() => _ReactionDetailExampleState(); +} + +class _ReactionDetailExampleState extends State<_ReactionDetailExample> { + String? _selected; + + static const _reactionUsers = [ + ('👍', ['Alice', 'Bob', 'Carol', 'Dan', 'Eve', 'Frank', 'Grace']), + ('❤️', ['Alice', 'Carol', 'Eve', 'Grace', 'Ivy']), + ('😂', ['Bob', 'Dan', 'Frank']), + ('🔥', ['Carol', 'Eve']), + ('😮', ['Dan']), + ]; + + late final _items = [ + for (final (emoji, users) in _reactionUsers) + StreamEmojiChipItem( + value: emoji, + emoji: Text(emoji), + count: users.length, + ), + ]; + + List<(String emoji, String user)> get _filteredUsers { + if (_selected == null) { + return [ + for (final (emoji, users) in _reactionUsers) + for (final user in users) (emoji, user), + ]; + } + final (emoji, users) = _reactionUsers.firstWhere((r) => r.$1 == _selected); + return [for (final user in users) (emoji, user)]; + } + + @override + Widget build(BuildContext context) { + final textTheme = context.streamTextTheme; + final spacing = context.streamSpacing; + + final filtered = _filteredUsers; + + return Column( + crossAxisAlignment: CrossAxisAlignment.start, + mainAxisSize: MainAxisSize.min, + children: [ + Padding( + padding: EdgeInsets.symmetric(horizontal: spacing.md), + child: Text( + filtered.length == 1 ? '1 Reaction' : '${filtered.length} Reactions', + style: textTheme.headingSm, + textAlign: TextAlign.center, + ), + ), + SizedBox(height: spacing.sm), + StreamEmojiChipBar( + leading: StreamEmojiChip.addEmoji(onPressed: () {}), + items: _items, + selected: _selected, + onSelected: (value) => setState(() => _selected = value), + ), + SizedBox(height: spacing.xs), + for (final (emoji, user) in filtered) _ReactionUserTile(emoji: emoji, userName: user), + ], + ); + } +} + +class _ReactionUserTile extends StatelessWidget { + const _ReactionUserTile({required this.emoji, required this.userName}); + + final String emoji; + final String userName; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final spacing = context.streamSpacing; + + return Padding( + padding: EdgeInsets.symmetric( + horizontal: spacing.md, + vertical: spacing.xxs, + ), + child: Row( + spacing: spacing.sm, + children: [ + StreamAvatar( + size: StreamAvatarSize.md, + placeholder: (_) => Text(userName[0]), + ), + Expanded( + child: Text( + userName, + style: textTheme.bodyDefault.copyWith( + color: colorScheme.textPrimary, + ), + ), + ), + StreamEmoji( + size: StreamEmojiSize.sm, + emoji: Text(emoji), + ), + ], + ), + ); + } +} + +// ============================================================================= +// Shared Widgets +// ============================================================================= + +class _ExampleCard extends StatelessWidget { + const _ExampleCard({ + required this.title, + required this.description, + required this.child, + }); + + final String title; + final String description; + final Widget child; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final boxShadow = context.streamBoxShadow; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Container( + width: double.infinity, + clipBehavior: Clip.antiAlias, + decoration: BoxDecoration( + color: colorScheme.backgroundSurfaceSubtle, + borderRadius: BorderRadius.all(radius.lg), + boxShadow: boxShadow.elevation1, + ), + foregroundDecoration: BoxDecoration( + borderRadius: BorderRadius.all(radius.lg), + border: Border.all(color: colorScheme.borderSubtle), + ), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + Padding( + padding: EdgeInsets.symmetric( + horizontal: spacing.md, + vertical: spacing.sm, + ), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + Text( + title, + style: textTheme.captionEmphasis.copyWith( + color: colorScheme.textPrimary, + ), + ), + Text( + description, + style: textTheme.metadataDefault.copyWith( + color: colorScheme.textTertiary, + ), + ), + ], + ), + ), + Divider(height: 1, color: colorScheme.borderSubtle), + Container( + width: double.infinity, + padding: EdgeInsets.symmetric(vertical: spacing.md), + color: colorScheme.backgroundSurfaceSubtle, + child: child, + ), + ], + ), + ); + } +} + +class _SectionLabel extends StatelessWidget { + const _SectionLabel({required this.label}); + + final String label; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Container( + padding: EdgeInsets.symmetric( + horizontal: spacing.sm, + vertical: spacing.xs, + ), + decoration: BoxDecoration( + color: colorScheme.accentPrimary, + borderRadius: BorderRadius.all(radius.xs), + ), + child: Text( + label, + style: textTheme.metadataEmphasis.copyWith( + color: colorScheme.textOnAccent, + letterSpacing: 1, + fontSize: 9, + ), + ), + ); + } +} + +// ============================================================================= +// Helpers +// ============================================================================= + +const _reactions = [ + ('👍', 7), + ('❤️', 5), + ('😂', 3), + ('🔥', 2), + ('😮', 1), + ('👏', 12), + ('🎉', 4), + ('😢', 2), +]; + +final _sampleItems = [ + for (final (emoji, count) in _reactions.take(5)) StreamEmojiChipItem(value: emoji, emoji: Text(emoji), count: count), +]; + +final _manyItems = [ + for (final (emoji, count) in _reactions) StreamEmojiChipItem(value: emoji, emoji: Text(emoji), count: count), +]; diff --git a/apps/design_system_gallery/lib/components/emoji/stream_emoji_picker_sheet.dart b/apps/design_system_gallery/lib/components/emoji/stream_emoji_picker_sheet.dart new file mode 100644 index 0000000..50237bf --- /dev/null +++ b/apps/design_system_gallery/lib/components/emoji/stream_emoji_picker_sheet.dart @@ -0,0 +1,90 @@ +import 'package:flutter/material.dart'; +import 'package:stream_core_flutter/stream_core_flutter.dart'; +import 'package:widgetbook/widgetbook.dart'; +import 'package:widgetbook_annotation/widgetbook_annotation.dart' as widgetbook; + +// ============================================================================= +// Playground +// ============================================================================= + +@widgetbook.UseCase( + name: 'Playground', + type: StreamEmojiPickerSheet, + path: '[Components]/Emoji', +) +Widget buildStreamEmojiPickerSheetDefault(BuildContext context) { + final emojiButtonSize = context.knobs.object.dropdown( + label: 'Emoji Button Size', + options: StreamEmojiButtonSize.values, + initialOption: StreamEmojiButtonSize.xl, + labelBuilder: (option) => option.name, + description: 'The size of each emoji button in the grid.', + ); + + return _EmojiPickerPlayground(emojiButtonSize: emojiButtonSize); +} + +class _EmojiPickerPlayground extends StatefulWidget { + const _EmojiPickerPlayground({required this.emojiButtonSize}); + + final StreamEmojiButtonSize emojiButtonSize; + + @override + State<_EmojiPickerPlayground> createState() => _EmojiPickerPlaygroundState(); +} + +class _EmojiPickerPlaygroundState extends State<_EmojiPickerPlayground> { + final _selectedEmojis = {}; + + void _toggle(StreamEmojiData emoji) { + setState(() { + if (_selectedEmojis.containsKey(emoji.shortName)) { + _selectedEmojis.remove(emoji.shortName); + } else { + _selectedEmojis[emoji.shortName] = emoji; + } + }); + } + + @override + Widget build(BuildContext context) { + final spacing = context.streamSpacing; + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + + return Center( + child: Column( + mainAxisSize: MainAxisSize.min, + spacing: spacing.md, + children: [ + StreamButton( + label: 'Show Emoji Picker', + onTap: () async { + final emoji = await StreamEmojiPickerSheet.show( + context: context, + emojiButtonSize: widget.emojiButtonSize, + selectedReactions: _selectedEmojis.keys.toSet(), + ); + if (emoji != null && context.mounted) _toggle(emoji); + }, + ), + if (_selectedEmojis.isNotEmpty) ...[ + Text( + 'Selected Emojis', + style: textTheme.headingXs.copyWith( + color: colorScheme.textSecondary, + ), + ), + Wrap( + spacing: spacing.xs, + runSpacing: spacing.xs, + children: [ + for (final entry in _selectedEmojis.entries) StreamEmoji(emoji: Text(entry.value.emoji)), + ], + ), + ], + ], + ), + ); + } +} diff --git a/apps/design_system_gallery/lib/components/message_composer/message_composer.dart b/apps/design_system_gallery/lib/components/message_composer/message_composer.dart new file mode 100644 index 0000000..07fed36 --- /dev/null +++ b/apps/design_system_gallery/lib/components/message_composer/message_composer.dart @@ -0,0 +1,220 @@ +import 'package:flutter/material.dart'; +import 'package:stream_core_flutter/stream_core_flutter.dart'; +import 'package:widgetbook/widgetbook.dart'; +import 'package:widgetbook_annotation/widgetbook_annotation.dart' as widgetbook; + +// ============================================================================= +// Playground +// ============================================================================= + +final emptyVoiceRecordingCallback = VoiceRecordingCallback( + onLongPressStart: () {}, + onLongPressCancel: () {}, + onLongPressEnd: (_) {}, + onLongPressMoveUpdate: (_) {}, +); + +@widgetbook.UseCase( + name: 'Playground', + type: StreamCoreMessageComposer, + path: '[Components]/Message Composer', +) +Widget buildStreamMessageComposerPlayground(BuildContext context) { + final textEditingController = TextEditingController(); + + return Center( + child: StreamCoreMessageComposer( + controller: textEditingController, + isFloating: false, + inputTrailing: StreamCoreMessageComposerInputTrailing( + controller: textEditingController, + onSendPressed: () {}, + voiceRecordingCallback: emptyVoiceRecordingCallback, + buttonState: StreamMessageComposerInputTrailingState.microphone, + ), + ), + ); +} + +// ============================================================================= +// Real-world Example +// ============================================================================= + +@widgetbook.UseCase( + name: 'Real-world Example', + type: StreamCoreMessageComposer, + path: '[Components]/Message Composer', +) +Widget buildStreamMessageComposerExample(BuildContext context) { + final theme = StreamTheme.of(context); + final colorScheme = theme.colorScheme; + final textTheme = theme.textTheme; + + final isFloating = context.knobs.boolean( + label: 'Floating', + description: 'When true, the composer has no background or border.', + ); + + // Sample messages for scrollable list + const messages = [ + (message: 'Hey! How are you doing today?', isMe: false), + (message: "I'm doing great, thanks for asking!", isMe: true), + (message: 'Did you see the new design updates?', isMe: false), + (message: 'Yes! They look amazing. Great work on the color scheme.', isMe: true), + (message: 'Thanks! We spent a lot of time on the details.', isMe: false), + (message: 'It really shows. The typography is much cleaner now.', isMe: true), + (message: 'Glad you like it! Any feedback?', isMe: false), + (message: 'Maybe we could add more spacing in some areas?', isMe: true), + (message: "Good point, I'll look into that.", isMe: false), + (message: 'Perfect! Let me know if you need any help.', isMe: true), + (message: 'Should be finished by tomorrow.', isMe: false), + (message: 'Great! Thanks for the update.', isMe: true), + (message: "No problem! You're welcome.", isMe: false), + (message: 'I need to go now. See you later!', isMe: false), + (message: 'Bye! Take care.', isMe: true), + (message: 'Thanks! You too!', isMe: false), + (message: 'See you soon!', isMe: true), + (message: 'Bye!', isMe: false), + (message: 'See you soon!', isMe: true), + ]; + + final textEditingController = TextEditingController(); + + return Scaffold( + appBar: AppBar( + title: Row( + children: [ + StreamAvatar( + size: StreamAvatarSize.sm, + placeholder: (context) => const Text('JD'), + ), + const SizedBox(width: 12), + Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + Text( + 'John Doe', + style: textTheme.bodyEmphasis.copyWith( + color: colorScheme.textPrimary, + ), + ), + Text( + 'Online', + style: textTheme.captionDefault.copyWith( + color: colorScheme.accentSuccess, + ), + ), + ], + ), + ], + ), + ), + body: isFloating + ? Stack( + children: [ + // Scrollable messages area (with bottom padding for composer) + ListView.builder( + padding: const EdgeInsets.fromLTRB(16, 16, 16, 250), + itemCount: messages.length, + itemBuilder: (context, index) { + final msg = messages[index]; + return Padding( + padding: EdgeInsets.only( + bottom: index < messages.length - 1 ? 8 : 0, + ), + child: _MessageBubble( + message: msg.message, + isMe: msg.isMe, + ), + ); + }, + ), + // Floating composer at bottom + Positioned( + left: 0, + right: 0, + bottom: 0, + child: StreamCoreMessageComposer( + controller: textEditingController, + isFloating: true, + inputTrailing: StreamCoreMessageComposerInputTrailing( + controller: textEditingController, + onSendPressed: () {}, + voiceRecordingCallback: emptyVoiceRecordingCallback, + buttonState: StreamMessageComposerInputTrailingState.microphone, + ), + ), + ), + ], + ) + : Column( + children: [ + // Scrollable messages area + Expanded( + child: ListView.builder( + padding: const EdgeInsets.all(16), + itemCount: messages.length, + itemBuilder: (context, index) { + final msg = messages[index]; + return Padding( + padding: EdgeInsets.only( + bottom: index < messages.length - 1 ? 8 : 0, + ), + child: _MessageBubble( + message: msg.message, + isMe: msg.isMe, + ), + ); + }, + ), + ), + // Non-floating composer + StreamCoreMessageComposer( + controller: textEditingController, + isFloating: false, + inputTrailing: StreamCoreMessageComposerInputTrailing( + controller: textEditingController, + onSendPressed: () {}, + voiceRecordingCallback: emptyVoiceRecordingCallback, + buttonState: StreamMessageComposerInputTrailingState.microphone, + ), + ), + ], + ), + ); +} + +class _MessageBubble extends StatelessWidget { + const _MessageBubble({ + required this.message, + required this.isMe, + }); + + final String message; + final bool isMe; + + @override + Widget build(BuildContext context) { + final theme = StreamTheme.of(context); + final colorScheme = theme.colorScheme; + final textTheme = theme.textTheme; + + return Align( + alignment: isMe ? Alignment.centerRight : Alignment.centerLeft, + child: Container( + padding: const EdgeInsets.symmetric(horizontal: 12, vertical: 8), + decoration: BoxDecoration( + color: isMe ? colorScheme.accentPrimary : colorScheme.backgroundApp, + borderRadius: BorderRadius.circular(16), + border: isMe ? null : Border.all(color: colorScheme.borderSubtle), + ), + child: Text( + message, + style: textTheme.bodyDefault.copyWith( + color: isMe ? colorScheme.textOnAccent : colorScheme.textPrimary, + ), + ), + ), + ); + } +} diff --git a/apps/design_system_gallery/lib/components/message_composer/message_composer_attachment_link_preview.dart b/apps/design_system_gallery/lib/components/message_composer/message_composer_attachment_link_preview.dart new file mode 100644 index 0000000..25d0f9a --- /dev/null +++ b/apps/design_system_gallery/lib/components/message_composer/message_composer_attachment_link_preview.dart @@ -0,0 +1,54 @@ +import 'package:flutter/material.dart'; +import 'package:stream_core_flutter/stream_core_flutter.dart'; +import 'package:widgetbook/widgetbook.dart'; +import 'package:widgetbook_annotation/widgetbook_annotation.dart' as widgetbook; + +// ============================================================================= +// Playground +// ============================================================================= + +@widgetbook.UseCase( + name: 'Playground', + type: MessageComposerLinkPreviewAttachment, + path: '[Components]/Message Composer', +) +Widget buildMessageComposerAttachmentLinkPreviewPlayground(BuildContext context) { + final title = context.knobs.string( + label: 'Title', + initialValue: 'Getting started with Stream', + description: 'Optional title of the link preview.', + ); + final subtitle = context.knobs.string( + label: 'Subtitle', + initialValue: 'Build in-app messaging with our flexible SDKs and APIs.', + description: 'Optional subtitle or description of the link.', + ); + final url = context.knobs.string( + label: 'URL', + initialValue: 'https://getstream.io/chat/docs/', + description: 'The link URL displayed in the preview.', + ); + final showImage = context.knobs.boolean( + label: 'Show image', + initialValue: true, + description: 'Whether to show the link preview thumbnail image.', + ); + final showRemoveButton = context.knobs.boolean( + label: 'Show remove button', + initialValue: true, + description: 'Whether to show the remove attachment control.', + ); + + return Center( + child: ConstrainedBox( + constraints: const BoxConstraints(maxWidth: 360), + child: MessageComposerLinkPreviewAttachment( + title: title.isEmpty ? null : title, + subtitle: subtitle.isEmpty ? null : subtitle, + url: url.isEmpty ? null : url, + image: showImage ? const AssetImage('assets/attachment_image.png') : null, + onRemovePressed: showRemoveButton ? () {} : null, + ), + ), + ); +} diff --git a/apps/design_system_gallery/lib/components/message_composer/message_composer_attachment_media_file.dart b/apps/design_system_gallery/lib/components/message_composer/message_composer_attachment_media_file.dart new file mode 100644 index 0000000..bb79ecb --- /dev/null +++ b/apps/design_system_gallery/lib/components/message_composer/message_composer_attachment_media_file.dart @@ -0,0 +1,21 @@ +import 'package:flutter/material.dart'; +import 'package:stream_core_flutter/stream_core_flutter.dart'; +import 'package:widgetbook_annotation/widgetbook_annotation.dart' as widgetbook; + +// ============================================================================= +// Playground +// ============================================================================= + +@widgetbook.UseCase( + name: 'Playground', + type: MessageComposerMediaFileAttachment, + path: '[Components]/Message Composer', +) +Widget buildMessageComposerAttachmentMediaFilePlayground(BuildContext context) { + return Center( + child: MessageComposerMediaFileAttachment.image( + image: const AssetImage('assets/attachment_image.png'), + onRemovePressed: () {}, + ), + ); +} diff --git a/apps/design_system_gallery/lib/components/message_composer/message_composer_attachment_reply.dart b/apps/design_system_gallery/lib/components/message_composer/message_composer_attachment_reply.dart new file mode 100644 index 0000000..2ea43b0 --- /dev/null +++ b/apps/design_system_gallery/lib/components/message_composer/message_composer_attachment_reply.dart @@ -0,0 +1,36 @@ +import 'package:flutter/material.dart'; +import 'package:stream_core_flutter/stream_core_flutter.dart'; +import 'package:widgetbook/widgetbook.dart'; +import 'package:widgetbook_annotation/widgetbook_annotation.dart' as widgetbook; + +// ============================================================================= +// Playground +// ============================================================================= + +@widgetbook.UseCase( + name: 'Playground', + type: MessageComposerReplyAttachment, + path: '[Components]/Message Composer', +) +Widget buildMessageComposerAttachmentReplyPlayground(BuildContext context) { + final style = context.knobs.object.dropdown( + label: 'Style', + options: ReplyStyle.values, + initialOption: ReplyStyle.incoming, + labelBuilder: (option) => option.name, + description: 'Incoming uses left-hand bar and incoming colors; outgoing uses right-hand bar and outgoing colors.', + ); + + return Center( + child: ConstrainedBox( + constraints: const BoxConstraints(maxWidth: 360), + child: MessageComposerReplyAttachment( + title: 'Reply to John Doe', + subtitle: 'We had a great time during our holiday.', + image: const AssetImage('assets/attachment_image.png'), + onRemovePressed: () {}, + style: style, + ), + ), + ); +} diff --git a/apps/design_system_gallery/lib/components/reaction/stream_reactions.dart b/apps/design_system_gallery/lib/components/reaction/stream_reactions.dart new file mode 100644 index 0000000..b7d906b --- /dev/null +++ b/apps/design_system_gallery/lib/components/reaction/stream_reactions.dart @@ -0,0 +1,663 @@ +import 'package:flutter/material.dart'; +import 'package:stream_core_flutter/stream_core_flutter.dart'; +import 'package:widgetbook/widgetbook.dart'; +import 'package:widgetbook_annotation/widgetbook_annotation.dart' as widgetbook; + +// ============================================================================= +// Playground +// ============================================================================= + +@widgetbook.UseCase( + name: 'Playground', + type: StreamReactions, + path: '[Components]/Reactions', +) +Widget buildStreamReactionsPlayground(BuildContext context) { + final type = context.knobs.object.dropdown( + label: 'Type', + options: StreamReactionsType.values, + initialOption: StreamReactionsType.segmented, + labelBuilder: (option) => option.name, + description: 'Segmented shows individual pills; clustered groups into one.', + ); + final position = context.knobs.object.dropdown( + label: 'Position', + options: StreamReactionsPosition.values, + initialOption: StreamReactionsPosition.header, + labelBuilder: (option) => option.name, + description: 'Where reactions sit relative to the bubble.', + ); + final alignment = context.knobs.object.dropdown( + label: 'Alignment', + options: StreamReactionsAlignment.values, + initialOption: StreamReactionsAlignment.end, + labelBuilder: (option) => option.name, + description: 'Horizontal alignment of reactions relative to the bubble.', + ); + final overlap = context.knobs.boolean( + label: 'Overlap', + initialValue: true, + description: 'Reactions overlap the bubble edge with negative spacing.', + ); + final indent = context.knobs.double.slider( + label: 'Indent', + initialValue: 8, + min: -8, + max: 8, + divisions: 8, + description: 'Horizontal shift applied to the reaction strip.', + ); + final max = overlap + ? context.knobs.int.slider( + label: 'Max Visible', + initialValue: 4, + min: 1, + max: 6, + divisions: 5, + description: 'Reactions beyond this collapse into a +N chip.', + ) + : null; + final direction = context.knobs.object.dropdown( + label: 'Direction', + options: _MessageDirection.values, + initialOption: _MessageDirection.incoming, + labelBuilder: (option) => option.name, + description: 'Incoming (start-aligned bubble) or outgoing (end-aligned).', + ); + final reactionCount = context.knobs.int.slider( + label: 'Reaction Count', + initialValue: 5, + min: 1, + max: _allReactionItems.length, + description: 'Number of distinct reaction types to display.', + ); + + final items = _allReactionItems.take(reactionCount).toList(); + final spacing = context.streamSpacing; + final isOutgoing = direction.isOutgoing; + final crossAxis = isOutgoing ? CrossAxisAlignment.end : CrossAxisAlignment.start; + + Widget buildReaction({required Widget bubble}) => switch (type) { + StreamReactionsType.segmented => StreamReactions.segmented( + items: items, + position: position, + alignment: alignment, + crossAxisAlignment: crossAxis, + max: max, + overlap: overlap, + indent: indent, + onPressed: () => _showSnack(context, 'Reaction tapped'), + child: bubble, + ), + StreamReactionsType.clustered => StreamReactions.clustered( + items: items, + position: position, + alignment: alignment, + crossAxisAlignment: crossAxis, + max: max, + overlap: overlap, + indent: indent, + onPressed: () => _showSnack(context, 'Reaction tapped'), + child: bubble, + ), + }; + + return Center( + child: ConstrainedBox( + constraints: const BoxConstraints(maxWidth: 400), + child: Padding( + padding: EdgeInsets.all(spacing.lg), + child: Column( + mainAxisSize: MainAxisSize.min, + crossAxisAlignment: .stretch, + spacing: spacing.xl, + children: [ + _ChatBubble( + message: _mediumMessage, + direction: direction, + reactionBuilder: buildReaction, + ), + _ChatBubble( + message: _shortMessage, + direction: direction, + reactionBuilder: buildReaction, + ), + _ChatBubble( + message: _longMessage, + direction: direction, + reactionBuilder: buildReaction, + ), + ], + ), + ), + ), + ); +} + +/// A realistic chat bubble used in playground and showcase. +class _ChatBubble extends StatelessWidget { + const _ChatBubble({ + required this.message, + required this.direction, + required this.reactionBuilder, + }); + + final String message; + final _MessageDirection direction; + final Widget Function({required Widget bubble}) reactionBuilder; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final spacing = context.streamSpacing; + + final isOutgoing = direction.isOutgoing; + final bubbleColor = isOutgoing ? colorScheme.brand.shade100 : colorScheme.backgroundSurface; + + const bubbleRadius = Radius.circular(20); + final bubbleBorderRadius = isOutgoing + ? const BorderRadius.only( + topLeft: bubbleRadius, + topRight: bubbleRadius, + bottomLeft: bubbleRadius, + ) + : const BorderRadius.only( + topLeft: bubbleRadius, + topRight: bubbleRadius, + bottomRight: bubbleRadius, + ); + + final bubble = Container( + constraints: const BoxConstraints(maxWidth: 280), + padding: EdgeInsets.symmetric( + horizontal: spacing.sm, + vertical: spacing.xs, + ), + decoration: BoxDecoration( + color: bubbleColor, + borderRadius: bubbleBorderRadius, + ), + child: Text( + message, + style: textTheme.bodyDefault.copyWith(color: colorScheme.textPrimary), + ), + ); + + return Column( + mainAxisSize: MainAxisSize.min, + crossAxisAlignment: isOutgoing ? CrossAxisAlignment.end : CrossAxisAlignment.start, + children: [ + reactionBuilder(bubble: bubble), + SizedBox(height: spacing.xxs), + Padding( + padding: EdgeInsets.symmetric(horizontal: spacing.xxs), + child: Text( + isOutgoing ? '09:41 · Read' : '09:40', + style: textTheme.metadataDefault.copyWith( + color: colorScheme.textTertiary, + ), + ), + ), + ], + ); + } +} + +// ============================================================================= +// Showcase +// ============================================================================= + +@widgetbook.UseCase( + name: 'Showcase', + type: StreamReactions, + path: '[Components]/Reactions', +) +Widget buildStreamReactionsShowcase(BuildContext context) { + final spacing = context.streamSpacing; + + return SingleChildScrollView( + padding: EdgeInsets.all(spacing.lg), + child: Center( + child: ConstrainedBox( + constraints: const BoxConstraints(maxWidth: 480), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + spacing: spacing.xl, + children: const [ + _ShowcaseSection( + title: 'SEGMENTED — FOOTER', + description: + 'Individual pills per reaction, positioned as a footer ' + 'with overlap. Varying reaction counts across messages.', + threads: [ + _ThreadMessage( + message: _mediumMessage, + direction: _MessageDirection.incoming, + type: StreamReactionsType.segmented, + position: StreamReactionsPosition.footer, + items: _allReactionItems, + max: 4, + ), + _ThreadMessage( + message: _shortMessage, + direction: _MessageDirection.outgoing, + type: StreamReactionsType.segmented, + position: StreamReactionsPosition.footer, + items: [ + StreamReactionsItem(emoji: Text('👍'), count: 2), + StreamReactionsItem(emoji: Text('❤'), count: 1), + ], + ), + _ThreadMessage( + message: _longMessage, + direction: _MessageDirection.incoming, + type: StreamReactionsType.segmented, + position: StreamReactionsPosition.footer, + items: [ + StreamReactionsItem(emoji: Text('😂'), count: 5), + StreamReactionsItem(emoji: Text('🔥'), count: 3), + StreamReactionsItem(emoji: Text('👏'), count: 7), + StreamReactionsItem(emoji: Text('🎉'), count: 2), + ], + ), + ], + ), + _ShowcaseSection( + title: 'SEGMENTED — HEADER', + description: + 'Individual pills as a header. Reactions paint on top ' + 'of the child via z-ordering.', + threads: [ + _ThreadMessage( + message: _shortMessage, + direction: _MessageDirection.incoming, + type: StreamReactionsType.segmented, + position: StreamReactionsPosition.header, + items: [ + StreamReactionsItem(emoji: Text('👍'), count: 3), + StreamReactionsItem(emoji: Text('❤'), count: 8), + StreamReactionsItem(emoji: Text('😂'), count: 2), + ], + ), + _ThreadMessage( + message: _longMessage, + direction: _MessageDirection.outgoing, + type: StreamReactionsType.segmented, + position: StreamReactionsPosition.header, + items: _allReactionItems, + max: 5, + ), + ], + ), + _ShowcaseSection( + title: 'CLUSTERED', + description: + 'All reactions grouped into a single chip. Shown in both ' + 'header and footer positions.', + threads: [ + _ThreadMessage( + message: _longMessage, + direction: _MessageDirection.incoming, + type: StreamReactionsType.clustered, + position: StreamReactionsPosition.footer, + items: _allReactionItems, + ), + _ThreadMessage( + message: _shortMessage, + direction: _MessageDirection.outgoing, + type: StreamReactionsType.clustered, + position: StreamReactionsPosition.header, + items: [ + StreamReactionsItem(emoji: Text('👍'), count: 4), + StreamReactionsItem(emoji: Text('❤'), count: 3), + StreamReactionsItem(emoji: Text('😂'), count: 2), + ], + ), + _ThreadMessage( + message: _mediumMessage, + direction: _MessageDirection.incoming, + type: StreamReactionsType.clustered, + position: StreamReactionsPosition.footer, + items: [ + StreamReactionsItem(emoji: Text('🔥'), count: 6), + StreamReactionsItem(emoji: Text('🙏'), count: 1), + ], + ), + ], + ), + _ShowcaseSection( + title: 'OVERFLOW', + description: + 'When reactions exceed the max visible limit, extras are ' + 'collapsed into a +N overflow chip.', + threads: [ + _ThreadMessage( + message: _mediumMessage, + direction: _MessageDirection.incoming, + type: StreamReactionsType.segmented, + position: StreamReactionsPosition.footer, + items: _allReactionItems, + max: 3, + ), + _ThreadMessage( + message: _longMessage, + direction: _MessageDirection.outgoing, + type: StreamReactionsType.segmented, + position: StreamReactionsPosition.footer, + items: _allReactionItems, + max: 2, + ), + ], + ), + _ShowcaseSection( + title: 'COUNT RULES', + description: + 'If any reaction has count > 1, all chips show counts. ' + 'When all have count 1, no counts are displayed.', + threads: [ + _ThreadMessage( + message: 'Single emoji, count 1 — no count shown.', + direction: _MessageDirection.incoming, + type: StreamReactionsType.segmented, + position: StreamReactionsPosition.footer, + items: [StreamReactionsItem(emoji: Text('👍'))], + ), + _ThreadMessage( + message: 'Single emoji, count 5 — count shown.', + direction: _MessageDirection.outgoing, + type: StreamReactionsType.segmented, + position: StreamReactionsPosition.footer, + items: [StreamReactionsItem(emoji: Text('❤'), count: 5)], + ), + _ThreadMessage( + message: 'Multiple emojis, all count 1 — no counts.', + direction: _MessageDirection.incoming, + type: StreamReactionsType.segmented, + position: StreamReactionsPosition.footer, + items: [ + StreamReactionsItem(emoji: Text('👍')), + StreamReactionsItem(emoji: Text('❤')), + StreamReactionsItem(emoji: Text('😂')), + ], + ), + _ThreadMessage( + message: 'Mixed counts — all show counts.', + direction: _MessageDirection.outgoing, + type: StreamReactionsType.segmented, + position: StreamReactionsPosition.footer, + items: [ + StreamReactionsItem(emoji: Text('👍'), count: 8), + StreamReactionsItem(emoji: Text('❤')), + StreamReactionsItem(emoji: Text('😂'), count: 3), + StreamReactionsItem(emoji: Text('🔥')), + ], + ), + _ThreadMessage( + message: 'Clustered — total count shown when > 1.', + direction: _MessageDirection.incoming, + type: StreamReactionsType.clustered, + position: StreamReactionsPosition.footer, + items: [ + StreamReactionsItem(emoji: Text('👍')), + StreamReactionsItem(emoji: Text('❤')), + StreamReactionsItem(emoji: Text('😂')), + ], + ), + ], + ), + _ShowcaseSection( + title: 'DETACHED', + description: + 'Reactions with overlap disabled — separated from the bubble ' + 'by a fixed gap. Both segmented and clustered.', + threads: [ + _ThreadMessage( + message: _mediumMessage, + direction: _MessageDirection.incoming, + type: StreamReactionsType.segmented, + position: StreamReactionsPosition.footer, + items: [ + StreamReactionsItem(emoji: Text('😂'), count: 5), + StreamReactionsItem(emoji: Text('👍'), count: 2), + StreamReactionsItem(emoji: Text('❤'), count: 8), + ], + overlap: false, + ), + _ThreadMessage( + message: _shortMessage, + direction: _MessageDirection.outgoing, + type: StreamReactionsType.clustered, + position: StreamReactionsPosition.footer, + items: [ + StreamReactionsItem(emoji: Text('🔥'), count: 3), + StreamReactionsItem(emoji: Text('🎉'), count: 1), + ], + overlap: false, + ), + _ThreadMessage( + message: _longMessage, + direction: _MessageDirection.incoming, + type: StreamReactionsType.segmented, + position: StreamReactionsPosition.footer, + items: _allReactionItems, + overlap: false, + ), + ], + ), + ], + ), + ), + ), + ); +} + +// ============================================================================= +// Showcase helpers +// ============================================================================= + +@immutable +class _ThreadMessage { + const _ThreadMessage({ + required this.message, + required this.direction, + required this.type, + required this.position, + required this.items, + this.max, + this.overlap = true, + }); + + final String message; + final _MessageDirection direction; + final StreamReactionsType type; + final StreamReactionsPosition position; + final List items; + final int? max; + final bool overlap; +} + +class _ShowcaseSection extends StatelessWidget { + const _ShowcaseSection({ + required this.title, + required this.description, + required this.threads, + }); + + final String title; + final String description; + final List<_ThreadMessage> threads; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Column( + crossAxisAlignment: CrossAxisAlignment.start, + spacing: spacing.md, + children: [ + _SectionLabel(label: title), + Container( + width: double.infinity, + clipBehavior: Clip.antiAlias, + decoration: BoxDecoration( + color: colorScheme.backgroundApp, + borderRadius: BorderRadius.all(radius.lg), + ), + foregroundDecoration: BoxDecoration( + borderRadius: BorderRadius.all(radius.lg), + border: Border.all(color: colorScheme.borderSubtle), + ), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + Padding( + padding: EdgeInsets.fromLTRB( + spacing.md, + spacing.sm, + spacing.md, + spacing.xs, + ), + child: Text( + description, + style: textTheme.captionDefault.copyWith( + color: colorScheme.textSecondary, + ), + ), + ), + Divider(height: 1, color: colorScheme.borderSubtle), + Padding( + padding: EdgeInsets.all(spacing.md), + child: Column( + spacing: spacing.lg, + crossAxisAlignment: .stretch, + children: [ + for (final t in threads) + _ChatBubble( + message: t.message, + direction: t.direction, + reactionBuilder: ({required bubble}) { + final isOut = t.direction.isOutgoing; + final reactionAlignment = t.overlap + ? (isOut ? StreamReactionsAlignment.start : StreamReactionsAlignment.end) + : (isOut ? StreamReactionsAlignment.end : StreamReactionsAlignment.start); + final crossAxis = isOut ? CrossAxisAlignment.end : CrossAxisAlignment.start; + + return switch (t.type) { + StreamReactionsType.segmented => StreamReactions.segmented( + items: t.items, + position: t.position, + alignment: reactionAlignment, + crossAxisAlignment: crossAxis, + max: t.max, + overlap: t.overlap, + child: bubble, + onPressed: () {}, + ), + StreamReactionsType.clustered => StreamReactions.clustered( + items: t.items, + position: t.position, + alignment: reactionAlignment, + crossAxisAlignment: crossAxis, + max: t.max, + overlap: t.overlap, + child: bubble, + onPressed: () {}, + ), + }; + }, + ), + ], + ), + ), + ], + ), + ), + ], + ); + } +} + +class _SectionLabel extends StatelessWidget { + const _SectionLabel({required this.label}); + + final String label; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Container( + padding: EdgeInsets.symmetric( + horizontal: spacing.sm, + vertical: spacing.xs, + ), + decoration: BoxDecoration( + color: colorScheme.accentPrimary, + borderRadius: BorderRadius.all(radius.xs), + ), + child: Text( + label, + style: textTheme.metadataEmphasis.copyWith( + color: colorScheme.textOnAccent, + letterSpacing: 1, + fontSize: 9, + ), + ), + ); + } +} + +void _showSnack(BuildContext context, String message) { + ScaffoldMessenger.of(context) + ..hideCurrentSnackBar() + ..showSnackBar( + SnackBar( + content: Text(message), + duration: const Duration(seconds: 1), + ), + ); +} + +// ============================================================================= +// Enums +// ============================================================================= + +enum _MessageDirection { + incoming, + outgoing + ; + + bool get isOutgoing => this == outgoing; +} + +// ============================================================================= +// Sample data +// ============================================================================= + +const _allReactionItems = [ + StreamReactionsItem(emoji: Text('👍'), count: 8), + StreamReactionsItem(emoji: Text('❤'), count: 14), + StreamReactionsItem(emoji: Text('😂'), count: 5), + StreamReactionsItem(emoji: Text('🔥'), count: 3), + StreamReactionsItem(emoji: Text('🎉'), count: 2), + StreamReactionsItem(emoji: Text('👏'), count: 7), + StreamReactionsItem(emoji: Text('😮')), + StreamReactionsItem(emoji: Text('🙏'), count: 4), + StreamReactionsItem(emoji: Text('🚀'), count: 6), + StreamReactionsItem(emoji: Text('😢'), count: 2), +]; + +const _shortMessage = 'Sure 👍'; + +const _mediumMessage = 'Hey, did you check the venue options?'; + +const _longMessage = + 'Hey, did you get a chance to look at the venue options for Saturday? ' + 'I found a couple of great places downtown that might work.'; diff --git a/apps/design_system_gallery/lib/components/tiles/stream_list_tile.dart b/apps/design_system_gallery/lib/components/tiles/stream_list_tile.dart new file mode 100644 index 0000000..6432be3 --- /dev/null +++ b/apps/design_system_gallery/lib/components/tiles/stream_list_tile.dart @@ -0,0 +1,539 @@ +import 'package:flutter/material.dart'; +import 'package:stream_core_flutter/stream_core_flutter.dart'; +import 'package:widgetbook/widgetbook.dart'; +import 'package:widgetbook_annotation/widgetbook_annotation.dart' as widgetbook; + +// ============================================================================= +// Playground +// ============================================================================= + +@widgetbook.UseCase( + name: 'Playground', + type: StreamListTile, + path: '[Components]/Tiles', +) +Widget buildStreamListTilePlayground(BuildContext context) { + return const _PlaygroundDemo(); +} + +class _PlaygroundDemo extends StatefulWidget { + const _PlaygroundDemo(); + + @override + State<_PlaygroundDemo> createState() => _PlaygroundDemoState(); +} + +class _PlaygroundDemoState extends State<_PlaygroundDemo> { + @override + Widget build(BuildContext context) { + final title = context.knobs.string( + label: 'Title', + initialValue: 'Alice Johnson', + description: 'Primary label shown in the tile.', + ); + + final subtitleText = context.knobs.stringOrNull( + label: 'Subtitle', + initialValue: 'Online now', + description: 'Optional secondary text shown below title.', + ); + + final descriptionText = context.knobs.stringOrNull( + label: 'Description', + initialValue: '2m', + description: 'Optional right-side metadata text (e.g. timestamp).', + ); + + final enabled = context.knobs.boolean( + label: 'Enabled', + initialValue: true, + description: 'Whether the tile is interactive.', + ); + + final selected = context.knobs.boolean( + label: 'Selected', + description: 'Applies selected colors and selected background.', + ); + + final showLeading = context.knobs.boolean( + label: 'Leading', + initialValue: true, + description: 'Show a leading avatar.', + ); + + final showTrailing = context.knobs.boolean( + label: 'Trailing', + initialValue: true, + description: 'Show a trailing chevron icon.', + ); + + void onTap() { + ScaffoldMessenger.of(context) + ..hideCurrentSnackBar() + ..showSnackBar( + const SnackBar( + content: Text('Tapped'), + duration: Duration(seconds: 1), + ), + ); + } + + return Center( + child: ConstrainedBox( + constraints: const BoxConstraints(maxWidth: 420), + child: Material( + type: MaterialType.transparency, + child: StreamListTile( + leading: showLeading ? _avatar('AJ') : null, + title: Text(title, maxLines: 1, overflow: TextOverflow.ellipsis), + subtitle: (subtitleText?.isNotEmpty ?? false) + ? Text(subtitleText!, maxLines: 1, overflow: TextOverflow.ellipsis) + : null, + description: (descriptionText?.isNotEmpty ?? false) + ? Text(descriptionText!, maxLines: 1, overflow: TextOverflow.ellipsis) + : null, + trailing: showTrailing ? const Icon(Icons.chevron_right_rounded) : null, + selected: selected, + enabled: enabled, + onTap: enabled ? onTap : null, + ), + ), + ), + ); + } +} + +// ============================================================================= +// Showcase +// ============================================================================= + +@widgetbook.UseCase( + name: 'Showcase', + type: StreamListTile, + path: '[Components]/Tiles', +) +Widget buildStreamListTileShowcase(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final spacing = context.streamSpacing; + + return DefaultTextStyle( + style: textTheme.bodyDefault.copyWith(color: colorScheme.textPrimary), + child: SingleChildScrollView( + padding: EdgeInsets.all(spacing.lg), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + spacing: spacing.xl, + children: const [ + _StatesSection(), + _LayoutPatternsSection(), + _RealWorldSection(), + ], + ), + ), + ); +} + +// ============================================================================= +// States Section +// ============================================================================= + +class _StatesSection extends StatelessWidget { + const _StatesSection(); + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final boxShadow = context.streamBoxShadow; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Column( + crossAxisAlignment: CrossAxisAlignment.start, + spacing: spacing.md, + children: [ + const _SectionLabel(label: 'STATES'), + Container( + width: double.infinity, + clipBehavior: Clip.antiAlias, + padding: EdgeInsets.all(spacing.md), + decoration: BoxDecoration( + color: colorScheme.backgroundSurface, + borderRadius: BorderRadius.all(radius.lg), + boxShadow: boxShadow.elevation1, + ), + foregroundDecoration: BoxDecoration( + borderRadius: BorderRadius.all(radius.lg), + border: Border.all(color: colorScheme.borderSubtle), + ), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + spacing: spacing.md, + children: [ + Text( + 'Tap any tile to see the pressed overlay. ' + 'Disabled tiles block all interaction.', + style: textTheme.captionDefault.copyWith( + color: colorScheme.textSecondary, + ), + ), + Column( + spacing: spacing.xs, + children: const [ + _StateRow( + label: 'Default', + subtitle: 'Enabled, not selected', + tile: _DemoTile(), + ), + _StateRow( + label: 'Selected', + subtitle: 'Selected foreground and background', + tile: _DemoTile(selected: true), + ), + _StateRow( + label: 'Disabled', + subtitle: 'Non-interactive, muted colors', + tile: _DemoTile(enabled: false), + ), + _StateRow( + label: 'Disabled + Selected', + subtitle: 'Selected layout with disabled interaction', + tile: _DemoTile(enabled: false, selected: true), + ), + ], + ), + ], + ), + ), + ], + ); + } +} + +// ============================================================================= +// Layout Patterns Section +// ============================================================================= + +class _LayoutPatternsSection extends StatelessWidget { + const _LayoutPatternsSection(); + + @override + Widget build(BuildContext context) { + final spacing = context.streamSpacing; + + return Column( + crossAxisAlignment: CrossAxisAlignment.start, + spacing: spacing.md, + children: const [ + _SectionLabel(label: 'LAYOUT PATTERNS'), + Column( + spacing: 8, + children: [ + _PatternCard( + title: 'Title Only', + tile: _DemoTile(subtitle: null, description: null), + ), + _PatternCard( + title: 'Title + Subtitle', + tile: _DemoTile(description: null), + ), + _PatternCard( + title: 'Title + Description', + tile: _DemoTile(subtitle: null), + ), + _PatternCard( + title: 'Full Composition', + tile: _DemoTile(), + ), + ], + ), + ], + ); + } +} + +// ============================================================================= +// Real-World Section +// ============================================================================= + +class _RealWorldSection extends StatelessWidget { + const _RealWorldSection(); + + @override + Widget build(BuildContext context) { + final spacing = context.streamSpacing; + + return Column( + crossAxisAlignment: CrossAxisAlignment.start, + spacing: spacing.md, + children: const [ + _SectionLabel(label: 'REAL-WORLD EXAMPLE'), + _ExampleCard( + title: 'Conversation List', + description: + 'Tap a row to toggle its selected state, mimicking a real ' + 'conversation list where the active channel is highlighted.', + child: _ConversationListExample(), + ), + ], + ); + } +} + +class _ConversationListExample extends StatefulWidget { + const _ConversationListExample(); + + @override + State<_ConversationListExample> createState() => _ConversationListExampleState(); +} + +class _ConversationListExampleState extends State<_ConversationListExample> { + static const _items = [ + ('Alice Johnson', 'See you in 10?', '2m'), + ('Mobile Team', 'Design review starts in 5m', '5m'), + ('Product Updates', 'Quarterly roadmap posted', '45m'), + ('Support', 'Ticket #8452 has been resolved', '1h'), + ]; + + var _selectedIndex = 0; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + + return Column( + children: [ + for (var i = 0; i < _items.length; i++) ...[ + Material( + type: MaterialType.transparency, + child: StreamListTile( + leading: _avatar(_items[i].$1.substring(0, 2).toUpperCase()), + title: Text(_items[i].$1, maxLines: 1, overflow: TextOverflow.ellipsis), + subtitle: Text(_items[i].$2, maxLines: 1, overflow: TextOverflow.ellipsis), + description: Text(_items[i].$3), + trailing: const Icon(Icons.chevron_right_rounded), + selected: i == _selectedIndex, + onTap: () => setState(() => _selectedIndex = i), + ), + ), + if (i < _items.length - 1) Divider(height: 1, color: colorScheme.borderSubtle), + ], + ], + ); + } +} + +// ============================================================================= +// Shared Widgets +// ============================================================================= + +class _StateRow extends StatelessWidget { + const _StateRow({ + required this.label, + required this.subtitle, + required this.tile, + }); + + final String label; + final String subtitle; + final Widget tile; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final spacing = context.streamSpacing; + + return Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + Text( + label, + style: textTheme.captionEmphasis.copyWith(color: colorScheme.textPrimary), + ), + Text( + subtitle, + style: textTheme.metadataDefault.copyWith(color: colorScheme.textTertiary), + ), + SizedBox(height: spacing.xs), + tile, + ], + ); + } +} + +class _PatternCard extends StatelessWidget { + const _PatternCard({required this.title, required this.tile}); + + final String title; + final Widget tile; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Container( + width: double.infinity, + clipBehavior: Clip.antiAlias, + padding: EdgeInsets.all(spacing.sm), + decoration: BoxDecoration( + color: colorScheme.backgroundSurfaceSubtle, + borderRadius: BorderRadius.all(radius.md), + ), + foregroundDecoration: BoxDecoration( + borderRadius: BorderRadius.all(radius.md), + border: Border.all(color: colorScheme.borderSubtle), + ), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + Text( + title, + style: textTheme.captionEmphasis.copyWith(color: colorScheme.textSecondary), + ), + SizedBox(height: spacing.xs), + tile, + ], + ), + ); + } +} + +class _ExampleCard extends StatelessWidget { + const _ExampleCard({ + required this.title, + required this.description, + required this.child, + }); + + final String title; + final String description; + final Widget child; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final boxShadow = context.streamBoxShadow; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Container( + width: double.infinity, + clipBehavior: Clip.antiAlias, + decoration: BoxDecoration( + color: colorScheme.backgroundSurface, + borderRadius: BorderRadius.all(radius.lg), + boxShadow: boxShadow.elevation1, + ), + foregroundDecoration: BoxDecoration( + borderRadius: BorderRadius.all(radius.lg), + border: Border.all(color: colorScheme.borderSubtle), + ), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + Padding( + padding: EdgeInsets.symmetric( + horizontal: spacing.md, + vertical: spacing.sm, + ), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + Text( + title, + style: textTheme.captionEmphasis.copyWith( + color: colorScheme.textPrimary, + ), + ), + Text( + description, + style: textTheme.metadataDefault.copyWith( + color: colorScheme.textTertiary, + ), + ), + ], + ), + ), + Divider(height: 1, color: colorScheme.borderSubtle), + child, + ], + ), + ); + } +} + +class _DemoTile extends StatelessWidget { + const _DemoTile({ + this.enabled = true, + this.selected = false, + this.subtitle = 'Online now', + this.description = '2m', + }); + + final bool enabled; + final bool selected; + final String? subtitle; + final String? description; + + @override + Widget build(BuildContext context) { + return Material( + type: MaterialType.transparency, + child: StreamListTile( + leading: _avatar('AJ'), + title: const Text('Alice Johnson', maxLines: 1, overflow: TextOverflow.ellipsis), + subtitle: subtitle == null ? null : Text(subtitle!, maxLines: 1, overflow: TextOverflow.ellipsis), + description: description == null ? null : Text(description!, maxLines: 1, overflow: TextOverflow.ellipsis), + trailing: const Icon(Icons.chevron_right_rounded), + enabled: enabled, + selected: selected, + onTap: enabled ? () {} : null, + ), + ); + } +} + +class _SectionLabel extends StatelessWidget { + const _SectionLabel({required this.label}); + + final String label; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Container( + padding: EdgeInsets.symmetric( + horizontal: spacing.sm, + vertical: spacing.xs, + ), + decoration: BoxDecoration( + color: colorScheme.accentPrimary, + borderRadius: BorderRadius.all(radius.xs), + ), + child: Text( + label, + style: textTheme.metadataEmphasis.copyWith( + color: colorScheme.textOnAccent, + letterSpacing: 1, + fontSize: 9, + ), + ), + ); + } +} + +Widget _avatar(String initials) { + return StreamAvatar( + placeholder: (_) => Text(initials), + ); +} diff --git a/apps/design_system_gallery/lib/config/config.dart b/apps/design_system_gallery/lib/config/config.dart new file mode 100644 index 0000000..be5979d --- /dev/null +++ b/apps/design_system_gallery/lib/config/config.dart @@ -0,0 +1,7 @@ +/// Configuration classes for the design system gallery. +/// +/// This barrel file exports all configuration-related classes. +library; + +export 'preview_configuration.dart'; +export 'theme_configuration.dart'; diff --git a/apps/design_system_gallery/lib/config/preview_configuration.dart b/apps/design_system_gallery/lib/config/preview_configuration.dart new file mode 100644 index 0000000..19e15a6 --- /dev/null +++ b/apps/design_system_gallery/lib/config/preview_configuration.dart @@ -0,0 +1,94 @@ +import 'package:device_frame_plus/device_frame_plus.dart'; +import 'package:flutter/widgets.dart'; + +/// Preview configuration for device frame and text scale. +/// +/// Manages the device frame, text scale, text direction, target platform, +/// and device frame visibility for the widget preview area. +class PreviewConfiguration extends ChangeNotifier { + PreviewConfiguration(); + + // ========================================================================= + // State + // ========================================================================= + + DeviceInfo _selectedDevice = Devices.ios.iPhone13ProMax; + var _textScale = 1.0; + var _showDeviceFrame = false; + var _textDirection = TextDirection.ltr; + TargetPlatform? _targetPlatform; + + // ========================================================================= + // Getters + // ========================================================================= + + DeviceInfo get selectedDevice => _selectedDevice; + double get textScale => _textScale; + bool get showDeviceFrame => _showDeviceFrame; + TextDirection get textDirection => _textDirection; + + /// The target platform override, or `null` to use the system default. + TargetPlatform? get targetPlatform => _targetPlatform; + + // ========================================================================= + // Static Options + // ========================================================================= + + static final deviceOptions = [ + Devices.ios.iPhone13ProMax, + Devices.ios.iPhone13Mini, + Devices.ios.iPhoneSE, + Devices.ios.iPad, + Devices.android.samsungGalaxyS20, + Devices.android.samsungGalaxyNote20, + ]; + + static const textScaleOptions = [0.85, 1, 1.15, 1.3, 2]; + + static const textDirectionOptions = TextDirection.values; + + /// Platform options available for override. + /// + /// `null` represents the system default (no override). + static const platformOptions = [ + null, + TargetPlatform.android, + TargetPlatform.iOS, + TargetPlatform.macOS, + TargetPlatform.windows, + TargetPlatform.linux, + ]; + + // ========================================================================= + // Setters + // ========================================================================= + + void setDevice(DeviceInfo device) { + if (_selectedDevice == device) return; + _selectedDevice = device; + notifyListeners(); + } + + void setTextScale(double scale) { + if (_textScale == scale) return; + _textScale = scale; + notifyListeners(); + } + + void toggleDeviceFrame() { + _showDeviceFrame = !_showDeviceFrame; + notifyListeners(); + } + + void setTextDirection(TextDirection direction) { + if (_textDirection == direction) return; + _textDirection = direction; + notifyListeners(); + } + + void setTargetPlatform(TargetPlatform? platform) { + if (_targetPlatform == platform) return; + _targetPlatform = platform; + notifyListeners(); + } +} diff --git a/apps/design_system_gallery/lib/config/theme_configuration.dart b/apps/design_system_gallery/lib/config/theme_configuration.dart new file mode 100644 index 0000000..249fc69 --- /dev/null +++ b/apps/design_system_gallery/lib/config/theme_configuration.dart @@ -0,0 +1,592 @@ +import 'package:flutter/material.dart'; +import 'package:stream_core_flutter/stream_core_flutter.dart'; + +/// A notifier that manages the theme configuration for the design system gallery. +/// +/// Supports full customization of the Stream design system theme using the +/// exact naming conventions from [StreamColorScheme]. +class ThemeConfiguration extends ChangeNotifier { + ThemeConfiguration({ + Brightness brightness = Brightness.light, + }) : _brightness = brightness { + _rebuildTheme(); + } + + factory ThemeConfiguration.light() => ThemeConfiguration(); + factory ThemeConfiguration.dark() => ThemeConfiguration(brightness: Brightness.dark); + + // ========================================================================= + // Core State + // ========================================================================= + var _themeData = StreamTheme.light(); + StreamTheme get themeData => _themeData; + + Brightness _brightness; + Brightness get brightness => _brightness; + + // ========================================================================= + // Accent Colors + // ========================================================================= + Color? _accentPrimary; + Color? _accentSuccess; + Color? _accentWarning; + Color? _accentError; + Color? _accentNeutral; + + // ========================================================================= + // Text Colors + // ========================================================================= + Color? _textPrimary; + Color? _textSecondary; + Color? _textTertiary; + Color? _textDisabled; + Color? _textInverse; + Color? _textLink; + Color? _textOnAccent; + + // ========================================================================= + // Background Colors + // ========================================================================= + Color? _backgroundApp; + Color? _backgroundSurface; + Color? _backgroundSurfaceSubtle; + Color? _backgroundSurfaceStrong; + Color? _backgroundOverlay; + Color? _backgroundDisabled; + + // ========================================================================= + // Border Colors - Core + // ========================================================================= + Color? _borderDefault; + Color? _borderSubtle; + Color? _borderStrong; + Color? _borderOnDark; + Color? _borderOnAccent; + Color? _borderOpacity10; + Color? _borderOpacity25; + + // ========================================================================= + // Border Colors - Utility + // ========================================================================= + Color? _borderFocus; + Color? _borderDisabled; + Color? _borderError; + Color? _borderWarning; + Color? _borderSuccess; + Color? _borderSelected; + + // ========================================================================= + // State Colors + // ========================================================================= + Color? _stateHover; + Color? _statePressed; + Color? _stateSelected; + Color? _stateFocused; + Color? _stateDisabled; + + // ========================================================================= + // System Colors + // ========================================================================= + Color? _systemText; + Color? _systemScrollbar; + + // ========================================================================= + // Avatar Palette + // ========================================================================= + List? _avatarPalette; + + // ========================================================================= + // Brand Color + // ========================================================================= + Color? _brandPrimaryColor; + + // ========================================================================= + // Getters - Accent + // ========================================================================= + Color get accentPrimary => _accentPrimary ?? _themeData.colorScheme.accentPrimary; + Color get accentSuccess => _accentSuccess ?? _themeData.colorScheme.accentSuccess; + Color get accentWarning => _accentWarning ?? _themeData.colorScheme.accentWarning; + Color get accentError => _accentError ?? _themeData.colorScheme.accentError; + Color get accentNeutral => _accentNeutral ?? _themeData.colorScheme.accentNeutral; + + // ========================================================================= + // Getters - Text + // ========================================================================= + Color get textPrimary => _textPrimary ?? _themeData.colorScheme.textPrimary; + Color get textSecondary => _textSecondary ?? _themeData.colorScheme.textSecondary; + Color get textTertiary => _textTertiary ?? _themeData.colorScheme.textTertiary; + Color get textDisabled => _textDisabled ?? _themeData.colorScheme.textDisabled; + Color get textInverse => _textInverse ?? _themeData.colorScheme.textInverse; + Color get textLink => _textLink ?? _themeData.colorScheme.textLink; + Color get textOnAccent => _textOnAccent ?? _themeData.colorScheme.textOnAccent; + + // ========================================================================= + // Getters - Background + // ========================================================================= + Color get backgroundApp => _backgroundApp ?? _themeData.colorScheme.backgroundApp; + Color get backgroundSurface => _backgroundSurface ?? _themeData.colorScheme.backgroundSurface; + Color get backgroundSurfaceSubtle => _backgroundSurfaceSubtle ?? _themeData.colorScheme.backgroundSurfaceSubtle; + Color get backgroundSurfaceStrong => _backgroundSurfaceStrong ?? _themeData.colorScheme.backgroundSurfaceStrong; + Color get backgroundOverlay => _backgroundOverlay ?? _themeData.colorScheme.backgroundOverlay; + Color get backgroundDisabled => _backgroundDisabled ?? _themeData.colorScheme.backgroundDisabled; + + // ========================================================================= + // Getters - Border Core + // ========================================================================= + Color get borderDefault => _borderDefault ?? _themeData.colorScheme.borderDefault; + Color get borderSubtle => _borderSubtle ?? _themeData.colorScheme.borderSubtle; + Color get borderStrong => _borderStrong ?? _themeData.colorScheme.borderStrong; + Color get borderOnDark => _borderOnDark ?? _themeData.colorScheme.borderOnDark; + Color get borderOnAccent => _borderOnAccent ?? _themeData.colorScheme.borderOnAccent; + Color get borderOpacity10 => _borderOpacity10 ?? _themeData.colorScheme.borderOpacity10; + Color get borderOpacity25 => _borderOpacity25 ?? _themeData.colorScheme.borderOpacity25; + + // ========================================================================= + // Getters - Border Utility + // ========================================================================= + Color get borderFocus => _borderFocus ?? _themeData.colorScheme.borderFocus; + Color get borderDisabled => _borderDisabled ?? _themeData.colorScheme.borderDisabled; + Color get borderError => _borderError ?? _themeData.colorScheme.borderError; + Color get borderWarning => _borderWarning ?? _themeData.colorScheme.borderWarning; + Color get borderSuccess => _borderSuccess ?? _themeData.colorScheme.borderSuccess; + Color get borderSelected => _borderSelected ?? _themeData.colorScheme.borderSelected; + + // ========================================================================= + // Getters - State + // ========================================================================= + Color get stateHover => _stateHover ?? _themeData.colorScheme.stateHover; + Color get statePressed => _statePressed ?? _themeData.colorScheme.statePressed; + Color get stateSelected => _stateSelected ?? _themeData.colorScheme.stateSelected; + Color get stateFocused => _stateFocused ?? _themeData.colorScheme.stateFocused; + Color get stateDisabled => _stateDisabled ?? _themeData.colorScheme.stateDisabled; + + // ========================================================================= + // Getters - System + // ========================================================================= + Color get systemText => _systemText ?? _themeData.colorScheme.systemText; + Color get systemScrollbar => _systemScrollbar ?? _themeData.colorScheme.systemScrollbar; + + // ========================================================================= + // Getters - Avatar Palette + // ========================================================================= + List get avatarPalette => _avatarPalette ?? _themeData.colorScheme.avatarPalette; + + // ========================================================================= + // Getters - Brand + // ========================================================================= + Color get brandPrimaryColor => _brandPrimaryColor ?? _themeData.colorScheme.brand.shade500; + + // ========================================================================= + // Setters + // ========================================================================= + + void setBrightness(Brightness brightness) { + if (_brightness == brightness) return; + _brightness = brightness; + _rebuildTheme(); + notifyListeners(); + } + + // Accent + void setAccentPrimary(Color color) => _update(() => _accentPrimary = color); + void setAccentSuccess(Color color) => _update(() => _accentSuccess = color); + void setAccentWarning(Color color) => _update(() => _accentWarning = color); + void setAccentError(Color color) => _update(() => _accentError = color); + void setAccentNeutral(Color color) => _update(() => _accentNeutral = color); + + // Text + void setTextPrimary(Color color) => _update(() => _textPrimary = color); + void setTextSecondary(Color color) => _update(() => _textSecondary = color); + void setTextTertiary(Color color) => _update(() => _textTertiary = color); + void setTextDisabled(Color color) => _update(() => _textDisabled = color); + void setTextInverse(Color color) => _update(() => _textInverse = color); + void setTextLink(Color color) => _update(() => _textLink = color); + void setTextOnAccent(Color color) => _update(() => _textOnAccent = color); + + // Background + void setBackgroundApp(Color color) => _update(() => _backgroundApp = color); + void setBackgroundSurface(Color color) => _update(() => _backgroundSurface = color); + void setBackgroundSurfaceSubtle(Color color) => _update(() => _backgroundSurfaceSubtle = color); + void setBackgroundSurfaceStrong(Color color) => _update(() => _backgroundSurfaceStrong = color); + void setBackgroundOverlay(Color color) => _update(() => _backgroundOverlay = color); + void setBackgroundDisabled(Color color) => _update(() => _backgroundDisabled = color); + + // Border Core + void setBorderDefault(Color color) => _update(() => _borderDefault = color); + void setBorderSubtle(Color color) => _update(() => _borderSubtle = color); + void setBorderStrong(Color color) => _update(() => _borderStrong = color); + void setBorderOnDark(Color color) => _update(() => _borderOnDark = color); + void setBorderOnAccent(Color color) => _update(() => _borderOnAccent = color); + void setBorderOpacity10(Color color) => _update(() => _borderOpacity10 = color); + void setBorderOpacity25(Color color) => _update(() => _borderOpacity25 = color); + + // Border Utility + void setBorderFocus(Color color) => _update(() => _borderFocus = color); + void setBorderDisabled(Color color) => _update(() => _borderDisabled = color); + void setBorderError(Color color) => _update(() => _borderError = color); + void setBorderWarning(Color color) => _update(() => _borderWarning = color); + void setBorderSuccess(Color color) => _update(() => _borderSuccess = color); + void setBorderSelected(Color color) => _update(() => _borderSelected = color); + + // State + void setStateHover(Color color) => _update(() => _stateHover = color); + void setStatePressed(Color color) => _update(() => _statePressed = color); + void setStateSelected(Color color) => _update(() => _stateSelected = color); + void setStateFocused(Color color) => _update(() => _stateFocused = color); + void setStateDisabled(Color color) => _update(() => _stateDisabled = color); + + // System + void setSystemText(Color color) => _update(() => _systemText = color); + void setSystemScrollbar(Color color) => _update(() => _systemScrollbar = color); + + // Avatar Palette + void setAvatarPalette(List palette) => _update(() => _avatarPalette = palette); + + // Brand + void setBrandPrimaryColor(Color color) => _update(() => _brandPrimaryColor = color); + + void updateAvatarPaletteAt(int index, StreamAvatarColorPair pair) { + final current = List.from(avatarPalette); + if (index < current.length) { + current[index] = pair; + _update(() => _avatarPalette = current); + } + } + + void addAvatarPaletteEntry(StreamAvatarColorPair pair) { + final current = List.from(avatarPalette); + current.add(pair); + _update(() => _avatarPalette = current); + } + + void removeAvatarPaletteAt(int index) { + final current = List.from(avatarPalette); + if (index < current.length && current.length > 1) { + current.removeAt(index); + _update(() => _avatarPalette = current); + } + } + + void _update(VoidCallback setter) { + setter(); + _rebuildTheme(); + notifyListeners(); + } + + void resetToDefaults() { + _brandPrimaryColor = null; + // Accent + _accentPrimary = null; + _accentSuccess = null; + _accentWarning = null; + _accentError = null; + _accentNeutral = null; + // Text + _textPrimary = null; + _textSecondary = null; + _textTertiary = null; + _textDisabled = null; + _textInverse = null; + _textLink = null; + _textOnAccent = null; + // Background + _backgroundApp = null; + _backgroundSurface = null; + _backgroundSurfaceSubtle = null; + _backgroundSurfaceStrong = null; + _backgroundOverlay = null; + _backgroundDisabled = null; + // Border Core + _borderDefault = null; + _borderSubtle = null; + _borderStrong = null; + _borderOnDark = null; + _borderOnAccent = null; + _borderOpacity10 = null; + _borderOpacity25 = null; + // Border Utility + _borderFocus = null; + _borderDisabled = null; + _borderError = null; + _borderWarning = null; + _borderSuccess = null; + _borderSelected = null; + // State + _stateHover = null; + _statePressed = null; + _stateSelected = null; + _stateFocused = null; + _stateDisabled = null; + // System + _systemText = null; + _systemScrollbar = null; + // Avatar + _avatarPalette = null; + // Brand + _brandPrimaryColor = null; + + _rebuildTheme(); + notifyListeners(); + } + + void _rebuildTheme() { + final baseColorScheme = _brightness == Brightness.dark ? StreamColorScheme.dark() : StreamColorScheme.light(); + + // Compute effective brand swatch (if brand primary is customized) + final effectiveBrand = _brandPrimaryColor != null + ? StreamColorSwatch.fromColor(_brandPrimaryColor!, brightness: _brightness) + : null; + + // Derived from brand: accentPrimary defaults to brand.shade500 + final effectiveAccentPrimary = _accentPrimary ?? _brandPrimaryColor; + + // Derived from brand: borderFocus defaults to brand.shade300 + final effectiveBorderFocus = _borderFocus ?? effectiveBrand?.shade300; + + // Derived from brand: stateFocused defaults to brand.shade100 + final effectiveStateFocused = _stateFocused ?? effectiveBrand?.shade100; + + // Derived from accentPrimary: textLink and borderSelected + final effectiveTextLink = _textLink ?? effectiveAccentPrimary; + final effectiveBorderSelected = _borderSelected ?? effectiveAccentPrimary; + + // Derived from other accents: border utility colors + final effectiveBorderError = _borderError ?? _accentError; + final effectiveBorderWarning = _borderWarning ?? _accentWarning; + final effectiveBorderSuccess = _borderSuccess ?? _accentSuccess; + + final colorScheme = baseColorScheme.copyWith( + // Brand + brand: effectiveBrand, + // Accent - brand primary affects accentPrimary + accentPrimary: effectiveAccentPrimary, + accentSuccess: _accentSuccess, + accentWarning: _accentWarning, + accentError: _accentError, + accentNeutral: _accentNeutral, + // Text - textLink derived from accentPrimary + textPrimary: _textPrimary, + textSecondary: _textSecondary, + textTertiary: _textTertiary, + textDisabled: _textDisabled, + textInverse: _textInverse, + textLink: effectiveTextLink, + textOnAccent: _textOnAccent, + // Background + backgroundApp: _backgroundApp, + backgroundSurface: _backgroundSurface, + backgroundSurfaceSubtle: _backgroundSurfaceSubtle, + backgroundSurfaceStrong: _backgroundSurfaceStrong, + backgroundOverlay: _backgroundOverlay, + backgroundDisabled: _backgroundDisabled, + // Border Core + borderDefault: _borderDefault, + borderSubtle: _borderSubtle, + borderStrong: _borderStrong, + borderOnDark: _borderOnDark, + borderOnAccent: _borderOnAccent, + borderOpacity10: _borderOpacity10, + borderOpacity25: _borderOpacity25, + // Border Utility - derived from brand and accents + borderFocus: effectiveBorderFocus, + borderDisabled: _borderDisabled, + borderError: effectiveBorderError, + borderWarning: effectiveBorderWarning, + borderSuccess: effectiveBorderSuccess, + borderSelected: effectiveBorderSelected, + // State - stateFocused derived from brand + stateHover: _stateHover, + statePressed: _statePressed, + stateSelected: _stateSelected, + stateFocused: effectiveStateFocused, + stateDisabled: _stateDisabled, + // System + systemText: _systemText, + systemScrollbar: _systemScrollbar, + // Avatar + avatarPalette: _avatarPalette, + ); + + _themeData = StreamTheme( + brightness: _brightness, + colorScheme: colorScheme, + ); + } + + /// Builds a Material ThemeData that uses Stream colors. + /// Use this for applying Stream theming to regular Flutter widgets. + ThemeData buildMaterialTheme() { + final ts = themeData.textTheme; + final radius = themeData.radius; + final isDark = brightness == Brightness.dark; + + // Common radius values (StreamRadius returns Radius, use BorderRadius.all) + final componentRadius = BorderRadius.all(radius.md); + final dialogRadius = BorderRadius.all(radius.lg); + final smallRadius = BorderRadius.all(radius.sm); + + // Shared ColorScheme properties - uses class getters for colors + final materialColorScheme = (isDark ? ColorScheme.dark : ColorScheme.light)( + primary: accentPrimary, + secondary: accentPrimary, + tertiary: accentNeutral, + error: accentError, + surface: backgroundSurface, + surfaceContainerHighest: backgroundSurfaceSubtle, + onPrimary: textOnAccent, + onSecondary: textOnAccent, + onSurface: textPrimary, + onSurfaceVariant: textSecondary, + onError: textOnAccent, + outline: borderDefault, + outlineVariant: borderSubtle, + ); + + return ThemeData( + brightness: brightness, + useMaterial3: true, + colorScheme: materialColorScheme, + // StreamTheme extension - enables StreamTheme.of(context) and context extensions + extensions: [themeData], + // Colors + primaryColor: accentPrimary, + scaffoldBackgroundColor: backgroundApp, + cardColor: backgroundSurface, + dividerColor: borderSubtle, + disabledColor: textDisabled, + hintColor: textTertiary, + // Dialog + dialogTheme: DialogThemeData( + backgroundColor: backgroundSurface, + surfaceTintColor: StreamColors.transparent, + shape: RoundedRectangleBorder( + borderRadius: dialogRadius, + side: BorderSide(color: borderSubtle), + ), + titleTextStyle: ts.bodyEmphasis.copyWith(color: textPrimary), + contentTextStyle: ts.bodyDefault.copyWith(color: textSecondary), + ), + // AppBar + appBarTheme: AppBarTheme( + backgroundColor: backgroundSurface, + foregroundColor: textPrimary, + surfaceTintColor: StreamColors.transparent, + elevation: 0, + ), + // Buttons + filledButtonTheme: FilledButtonThemeData( + style: FilledButton.styleFrom( + backgroundColor: accentPrimary, + foregroundColor: textOnAccent, + disabledBackgroundColor: stateDisabled, + disabledForegroundColor: textDisabled, + shape: RoundedRectangleBorder(borderRadius: componentRadius), + ), + ), + outlinedButtonTheme: OutlinedButtonThemeData( + style: OutlinedButton.styleFrom( + foregroundColor: textPrimary, + side: BorderSide(color: borderDefault), + shape: RoundedRectangleBorder(borderRadius: componentRadius), + ), + ), + textButtonTheme: TextButtonThemeData( + style: TextButton.styleFrom( + foregroundColor: accentPrimary, + shape: RoundedRectangleBorder(borderRadius: componentRadius), + ), + ), + elevatedButtonTheme: ElevatedButtonThemeData( + style: ElevatedButton.styleFrom( + backgroundColor: backgroundSurface, + foregroundColor: textPrimary, + surfaceTintColor: StreamColors.transparent, + shape: RoundedRectangleBorder(borderRadius: componentRadius), + ), + ), + // Input + inputDecorationTheme: InputDecorationTheme( + fillColor: backgroundApp, + filled: true, + border: OutlineInputBorder( + borderRadius: componentRadius, + borderSide: BorderSide(color: borderDefault), + ), + enabledBorder: OutlineInputBorder( + borderRadius: componentRadius, + borderSide: BorderSide(color: borderDefault), + ), + focusedBorder: OutlineInputBorder( + borderRadius: componentRadius, + borderSide: BorderSide(color: accentPrimary, width: 2), + ), + errorBorder: OutlineInputBorder( + borderRadius: componentRadius, + borderSide: BorderSide(color: accentError), + ), + hintStyle: ts.bodyDefault.copyWith(color: textTertiary), + labelStyle: ts.bodyDefault.copyWith(color: textSecondary), + ), + // Dropdown + dropdownMenuTheme: DropdownMenuThemeData( + menuStyle: MenuStyle( + backgroundColor: WidgetStatePropertyAll(backgroundSurface), + surfaceTintColor: const WidgetStatePropertyAll(StreamColors.transparent), + shape: WidgetStatePropertyAll( + RoundedRectangleBorder( + borderRadius: componentRadius, + side: BorderSide(color: borderSubtle), + ), + ), + ), + ), + // PopupMenu + popupMenuTheme: PopupMenuThemeData( + color: backgroundSurface, + surfaceTintColor: StreamColors.transparent, + shape: RoundedRectangleBorder( + borderRadius: componentRadius, + side: BorderSide(color: borderSubtle), + ), + textStyle: ts.bodyDefault.copyWith(color: textPrimary), + ), + // Scrollbar + scrollbarTheme: ScrollbarThemeData( + thumbColor: WidgetStatePropertyAll(systemScrollbar), + trackColor: WidgetStatePropertyAll(backgroundSurfaceSubtle), + radius: radius.max, + thickness: const WidgetStatePropertyAll(6), + ), + // Tooltip + tooltipTheme: TooltipThemeData( + decoration: BoxDecoration( + color: backgroundSurfaceStrong, + borderRadius: smallRadius, + ), + textStyle: ts.captionDefault.copyWith(color: textPrimary), + ), + // Divider + dividerTheme: DividerThemeData( + color: borderSubtle, + thickness: 1, + ), + // Icon + iconTheme: IconThemeData(color: textSecondary), + // Text - mapped to closest Stream styles by size/weight + textTheme: TextTheme( + // Titles - for app bar, dialogs, navigation + titleLarge: ts.headingLg.copyWith(color: textPrimary), + titleMedium: ts.bodyEmphasis.copyWith(color: textPrimary), + titleSmall: ts.captionEmphasis.copyWith(color: textPrimary), + // Body - main content text + bodyLarge: ts.bodyEmphasis.copyWith(color: textPrimary), + bodyMedium: ts.bodyDefault.copyWith(color: textPrimary), + bodySmall: ts.captionDefault.copyWith(color: textSecondary), + // Labels - buttons, chips, navigation items + labelLarge: ts.captionEmphasis.copyWith(color: textPrimary), + labelMedium: ts.metadataEmphasis.copyWith(color: textSecondary), + labelSmall: ts.metadataDefault.copyWith(color: textTertiary), + ), + ); + } +} diff --git a/apps/design_system_gallery/lib/core/core.dart b/apps/design_system_gallery/lib/core/core.dart new file mode 100644 index 0000000..ab152af --- /dev/null +++ b/apps/design_system_gallery/lib/core/core.dart @@ -0,0 +1,6 @@ +/// Core widgets and utilities for the design system gallery. +/// +/// This barrel file exports core functionality like the preview wrapper. +library; + +export 'preview_wrapper.dart'; diff --git a/apps/design_system_gallery/lib/core/preview_wrapper.dart b/apps/design_system_gallery/lib/core/preview_wrapper.dart new file mode 100644 index 0000000..9b9c254 --- /dev/null +++ b/apps/design_system_gallery/lib/core/preview_wrapper.dart @@ -0,0 +1,123 @@ +import 'package:device_frame_plus/device_frame_plus.dart'; +import 'package:flutter/material.dart'; +import 'package:provider/provider.dart'; +import 'package:stream_core_flutter/stream_core_flutter.dart'; + +import '../config/preview_configuration.dart'; + +/// Wrapper widget that applies device frame and text scale to the preview. +/// +/// Uses a nested [Navigator] so that dialogs and bottom sheets open within +/// the preview container rather than covering the entire gallery app. +/// +/// The declarative [Navigator.pages] API is used instead of [onGenerateRoute] +/// so that theme changes propagate into the route content without recreating +/// the navigator (which would reset use-case state). +/// +/// A [GlobalObjectKey] is used on the [Navigator] so that toggling the device +/// frame on/off reparents the navigator without losing state. +class PreviewWrapper extends StatelessWidget { + const PreviewWrapper({super.key, required this.child}); + + final Widget child; + + @override + Widget build(BuildContext context) { + final previewConfig = context.watch(); + + final colorScheme = context.streamColorScheme; + final boxShadow = context.streamBoxShadow; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + Widget content = Builder( + builder: (context) => MediaQuery( + data: MediaQuery.of(context).copyWith( + textScaler: .linear(previewConfig.textScale), + ), + child: Directionality( + textDirection: previewConfig.textDirection, + child: Navigator( + key: const GlobalObjectKey('preview-navigator'), + pages: [ + MaterialPage( + child: ScaffoldMessenger( + child: Scaffold(body: child), + ), + ), + ], + // no-op as the preview page should never be popped + onDidRemovePage: (_) {}, + ), + ), + ), + ); + + // Apply platform override to both Material theme and Stream theme so + // that platform-aware primitives (e.g. StreamRadius, StreamTypography) + // resolve correctly for the selected platform. + if (previewConfig.targetPlatform case final targetPlatform?) { + content = _PlatformOverride(platform: targetPlatform, child: content); + } + + if (previewConfig.showDeviceFrame) { + return Center( + child: Padding( + padding: EdgeInsets.all(spacing.xl), + child: DeviceFrame( + device: previewConfig.selectedDevice, + screen: content, + ), + ), + ); + } + + return Center( + child: Container( + constraints: const BoxConstraints(maxWidth: 540, maxHeight: 900), + margin: EdgeInsets.all(spacing.lg), + clipBehavior: Clip.antiAlias, + decoration: BoxDecoration( + borderRadius: BorderRadius.all(radius.xl), + boxShadow: boxShadow.elevation3, + ), + foregroundDecoration: BoxDecoration( + borderRadius: BorderRadius.all(radius.xl), + border: Border.all(color: colorScheme.borderDefault), + ), + child: content, + ), + ); + } +} + +/// Overrides the target platform for both Material and Stream themes. +/// +/// Uses [StreamTheme.applyPlatform] to recompute platform-dependent +/// primitives while preserving all other theme customizations. +class _PlatformOverride extends StatelessWidget { + const _PlatformOverride({ + required this.platform, + required this.child, + }); + + final TargetPlatform platform; + final Widget child; + + @override + Widget build(BuildContext context) { + final theme = Theme.of(context); + final streamTheme = context.streamTheme; + + return Theme( + data: theme.copyWith( + platform: platform, + extensions: { + ...theme.extensions.values, + streamTheme.applyPlatform(platform), + }, + ), + child: child, + ); + } +} diff --git a/apps/design_system_gallery/lib/core/stream_icons.dart b/apps/design_system_gallery/lib/core/stream_icons.dart new file mode 100644 index 0000000..c97de41 --- /dev/null +++ b/apps/design_system_gallery/lib/core/stream_icons.dart @@ -0,0 +1,10 @@ +import 'package:svg_icon_widget/svg_icon_widget.dart'; + +/// Stream icon assets used throughout the gallery. +abstract final class StreamSvgIcons { + /// The Stream boat logo. + static const logo = SvgIconData( + 'assets/stream_logo.svg', + preserveColors: true, + ); +} diff --git a/apps/design_system_gallery/lib/main.dart b/apps/design_system_gallery/lib/main.dart new file mode 100644 index 0000000..72a4e89 --- /dev/null +++ b/apps/design_system_gallery/lib/main.dart @@ -0,0 +1,11 @@ +import 'package:flutter/foundation.dart'; +import 'package:flutter/material.dart'; +import 'package:marionette_flutter/marionette_flutter.dart'; + +import 'app/gallery_app.dart'; + +void main() { + // Initialize Marionette only in debug mode + if (kDebugMode) MarionetteBinding.ensureInitialized(); + runApp(const StreamDesignSystemGallery()); +} diff --git a/apps/design_system_gallery/lib/primitives/colors.dart b/apps/design_system_gallery/lib/primitives/colors.dart new file mode 100644 index 0000000..c3999b6 --- /dev/null +++ b/apps/design_system_gallery/lib/primitives/colors.dart @@ -0,0 +1,536 @@ +import 'package:flutter/material.dart'; +import 'package:flutter/services.dart'; +import 'package:stream_core_flutter/stream_core_flutter.dart'; +import 'package:widgetbook_annotation/widgetbook_annotation.dart'; + +@UseCase( + name: 'All Colors', + type: StreamColors, + path: '[App Foundation]/Primitives/Colors', +) +Widget buildStreamColorsShowcase(BuildContext context) { + final textTheme = context.streamTextTheme; + final colorScheme = context.streamColorScheme; + final spacing = context.streamSpacing; + + return DefaultTextStyle( + style: textTheme.bodyDefault.copyWith(color: colorScheme.textPrimary), + child: SingleChildScrollView( + padding: EdgeInsets.all(spacing.lg), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + // Color swatches - full width + const _ColorSwatchesList(), + SizedBox(height: spacing.xl), + + // Neutrals section + const _NeutralsSection(), + ], + ), + ), + ); +} + +/// Full-width color swatches +class _ColorSwatchesList extends StatelessWidget { + const _ColorSwatchesList(); + + @override + Widget build(BuildContext context) { + final spacing = context.streamSpacing; + + final swatches = [ + _SwatchData( + name: 'blue', + swatch: StreamColors.blue, + usage: 'Primary actions, links, focus states', + ), + _SwatchData( + name: 'cyan', + swatch: StreamColors.cyan, + usage: 'Info states, secondary highlights', + ), + _SwatchData( + name: 'green', + swatch: StreamColors.green, + usage: 'Success states, positive feedback', + ), + _SwatchData( + name: 'purple', + swatch: StreamColors.purple, + usage: 'Premium features, special content', + ), + _SwatchData( + name: 'yellow', + swatch: StreamColors.yellow, + usage: 'Warnings, attention states', + ), + _SwatchData( + name: 'red', + swatch: StreamColors.red, + usage: 'Errors, destructive actions', + ), + _SwatchData( + name: 'slate', + swatch: StreamColors.slate, + usage: 'Dark backgrounds, text on light', + ), + _SwatchData( + name: 'neutral', + swatch: StreamColors.neutral, + usage: 'Light backgrounds, borders', + ), + ]; + + return Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + const _SectionLabel(label: 'COLOR SWATCHES'), + SizedBox(height: spacing.md), + ...swatches.map((data) => _FullWidthSwatchCard(data: data)), + ], + ); + } +} + +class _FullWidthSwatchCard extends StatelessWidget { + const _FullWidthSwatchCard({required this.data}); + + final _SwatchData data; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final boxShadow = context.streamBoxShadow; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + final shades = [50, 100, 150, 200, 300, 400, 500, 600, 700, 800, 900]; + + return Padding( + padding: EdgeInsets.only(bottom: spacing.md), + child: Container( + clipBehavior: Clip.antiAlias, + decoration: BoxDecoration( + color: colorScheme.backgroundSurface, + borderRadius: BorderRadius.all(radius.lg), + boxShadow: boxShadow.elevation1, + ), + foregroundDecoration: BoxDecoration( + borderRadius: BorderRadius.all(radius.lg), + border: Border.all(color: colorScheme.borderSubtle), + ), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + // Header + Padding( + padding: EdgeInsets.all(spacing.sm), + child: Row( + children: [ + Container( + width: 24, + height: 24, + decoration: BoxDecoration( + color: data.swatch.shade500, + borderRadius: BorderRadius.all(radius.sm), + ), + ), + SizedBox(width: spacing.sm + spacing.xxs), + Text( + 'StreamColors.${data.name}', + style: textTheme.captionEmphasis.copyWith( + color: colorScheme.textPrimary, + fontFamily: 'monospace', + ), + ), + SizedBox(width: spacing.sm), + Expanded( + child: Text( + '— ${data.usage}', + overflow: TextOverflow.ellipsis, + style: textTheme.captionDefault.copyWith( + color: colorScheme.textTertiary, + ), + ), + ), + ], + ), + ), + // Full width shade strip + Row( + children: shades.map((shade) { + final color = data.swatch[shade]!; + final textColor = _getTextColorForShade(data.swatch, shade); + + return Expanded( + child: InkWell( + onTap: () { + Clipboard.setData( + ClipboardData( + text: 'StreamColors.${data.name}.shade$shade', + ), + ); + ScaffoldMessenger.of(context).showSnackBar( + SnackBar( + content: Text( + 'Copied: StreamColors.${data.name}.shade$shade', + ), + duration: const Duration(seconds: 1), + behavior: SnackBarBehavior.floating, + ), + ); + }, + child: Container( + height: 56, + color: color, + child: Center( + child: Text( + '$shade', + style: textTheme.metadataEmphasis.copyWith( + color: textColor, + fontSize: 10, + ), + ), + ), + ), + ), + ); + }).toList(), + ), + ], + ), + ), + ); + } +} + +/// Neutrals section +class _NeutralsSection extends StatelessWidget { + const _NeutralsSection(); + + @override + Widget build(BuildContext context) { + final spacing = context.streamSpacing; + + return Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + const _SectionLabel(label: 'NEUTRALS'), + SizedBox(height: spacing.md), + // White variants + const _NeutralStrip( + title: 'White', + colors: [ + ('white', StreamColors.white, '100%'), + ('white70', StreamColors.white70, '70%'), + ('white50', StreamColors.white50, '50%'), + ('white20', StreamColors.white20, '20%'), + ('white10', StreamColors.white10, '10%'), + ], + ), + SizedBox(height: spacing.sm), + // Black variants + const _NeutralStrip( + title: 'Black', + colors: [ + ('black', StreamColors.black, '100%'), + ('black50', StreamColors.black50, '50%'), + ('black10', StreamColors.black10, '10%'), + ('black5', StreamColors.black5, '5%'), + ], + ), + SizedBox(height: spacing.sm), + // Transparent + const _TransparentTile(), + ], + ); + } +} + +class _NeutralStrip extends StatelessWidget { + const _NeutralStrip({ + required this.title, + required this.colors, + }); + + final String title; + final List<(String, Color, String)> colors; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final boxShadow = context.streamBoxShadow; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Container( + clipBehavior: Clip.antiAlias, + decoration: BoxDecoration( + borderRadius: BorderRadius.all(radius.lg), + boxShadow: boxShadow.elevation1, + ), + foregroundDecoration: BoxDecoration( + borderRadius: BorderRadius.all(radius.lg), + border: Border.all(color: colorScheme.borderSubtle), + ), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + // Header + Container( + width: double.infinity, + padding: EdgeInsets.symmetric(horizontal: spacing.sm, vertical: spacing.sm), + color: colorScheme.backgroundSurfaceSubtle, + child: Text( + title, + style: textTheme.captionEmphasis.copyWith( + color: colorScheme.textSecondary, + ), + ), + ), + // Colors row + Row( + children: colors.map((entry) { + final (name, color, opacity) = entry; + final brightness = ThemeData.estimateBrightnessForColor(color); + final textColor = brightness == Brightness.dark ? StreamColors.white : StreamColors.black; + + return Expanded( + child: InkWell( + onTap: () { + Clipboard.setData( + ClipboardData(text: 'StreamColors.$name'), + ); + ScaffoldMessenger.of(context).showSnackBar( + SnackBar( + content: Text('Copied: StreamColors.$name'), + duration: const Duration(seconds: 1), + behavior: SnackBarBehavior.floating, + ), + ); + }, + child: Container( + height: 64, + color: color, + child: Column( + mainAxisAlignment: MainAxisAlignment.center, + children: [ + Text( + name, + style: textTheme.metadataEmphasis.copyWith( + color: textColor, + fontFamily: 'monospace', + fontSize: 9, + ), + ), + SizedBox(height: spacing.xxs), + Text( + opacity, + style: textTheme.metadataDefault.copyWith( + color: textColor.withValues(alpha: 0.7), + fontSize: 9, + ), + ), + ], + ), + ), + ), + ); + }).toList(), + ), + ], + ), + ); + } +} + +class _TransparentTile extends StatelessWidget { + const _TransparentTile(); + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final boxShadow = context.streamBoxShadow; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return InkWell( + onTap: () { + Clipboard.setData( + const ClipboardData(text: 'StreamColors.transparent'), + ); + ScaffoldMessenger.of(context).showSnackBar( + const SnackBar( + content: Text('Copied: StreamColors.transparent'), + duration: Duration(seconds: 1), + behavior: SnackBarBehavior.floating, + ), + ); + }, + borderRadius: BorderRadius.all(radius.lg), + child: Container( + padding: EdgeInsets.all(spacing.md), + decoration: BoxDecoration( + color: StreamColors.transparent, + borderRadius: BorderRadius.all(radius.lg), + boxShadow: boxShadow.elevation1, + ), + foregroundDecoration: BoxDecoration( + borderRadius: BorderRadius.all(radius.lg), + border: Border.all( + color: colorScheme.borderDefault, + ), + ), + child: Row( + children: [ + // Checkerboard preview + Container( + width: 40, + height: 40, + foregroundDecoration: BoxDecoration( + borderRadius: BorderRadius.all(radius.md), + border: Border.all(color: colorScheme.borderSubtle), + ), + child: ClipRRect( + borderRadius: BorderRadius.all(radius.md), + child: CustomPaint( + painter: _CheckerboardPainter( + color: colorScheme.borderSubtle, + ), + ), + ), + ), + SizedBox(width: spacing.md), + Expanded( + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + Row( + children: [ + Text( + 'StreamColors.transparent', + style: textTheme.captionEmphasis.copyWith( + color: colorScheme.textPrimary, + fontFamily: 'monospace', + ), + ), + SizedBox(width: spacing.xs + spacing.xxs), + Icon( + Icons.copy, + size: 12, + color: colorScheme.textTertiary, + ), + ], + ), + SizedBox(height: spacing.xxs), + Text( + '0% opacity - fully transparent', + style: textTheme.captionDefault.copyWith( + color: colorScheme.textTertiary, + ), + ), + ], + ), + ), + ], + ), + ), + ); + } +} + +class _CheckerboardPainter extends CustomPainter { + const _CheckerboardPainter({required this.color}); + + final Color color; + + @override + void paint(Canvas canvas, Size size) { + final paint = Paint()..color = color; + const squareSize = 8.0; + for (var i = 0; i < size.width / squareSize; i++) { + for (var j = 0; j < size.height / squareSize; j++) { + if ((i + j).isEven) { + canvas.drawRect( + Rect.fromLTWH(i * squareSize, j * squareSize, squareSize, squareSize), + paint, + ); + } + } + } + } + + @override + bool shouldRepaint(covariant CustomPainter oldDelegate) => false; +} + +class _SectionLabel extends StatelessWidget { + const _SectionLabel({required this.label}); + + final String label; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Container( + padding: EdgeInsets.symmetric(horizontal: spacing.sm, vertical: spacing.xs), + decoration: BoxDecoration( + color: colorScheme.accentPrimary, + borderRadius: BorderRadius.all(radius.xs), + ), + child: Text( + label, + style: textTheme.metadataEmphasis.copyWith( + color: colorScheme.textOnAccent, + letterSpacing: 1, + fontSize: 9, + ), + ), + ); + } +} + +class _SwatchData { + const _SwatchData({ + required this.name, + required this.swatch, + required this.usage, + }); + + final String name; + final StreamColorSwatch swatch; + final String usage; +} + +/// Returns the appropriate text color for a given shade background, +/// using the same swatch for visual harmony. +/// +/// This follows the industry-standard "on-color" pattern used by Material +/// Design, Carbon (IBM), and Atlassian design systems. Using colors from +/// the same family (rather than pure black/white) creates better visual +/// cohesion while maintaining WCAG contrast requirements. +/// +/// The graduated contrast approach is based on perceptual depth theory— +/// mimicking how light affects surfaces in real-world environments. +/// +/// Light backgrounds (50-500) use darker shades for text. +/// Dark backgrounds (600+) use the lightest shade for text. +Color _getTextColorForShade(StreamColorSwatch swatch, int shade) { + // Graduated contrast scale: + // - shade 50-100: use shade 700 for text (~5:1 contrast) + // - shade 200-300: use shade 800 for text (~6:1 contrast) + // - shade 400-500: use shade 900 for text (~7:1 contrast) + // - shade 600+: use shade 50 for text (inverted for dark backgrounds) + if (shade <= 100) return swatch.shade700; + if (shade <= 300) return swatch.shade800; + if (shade <= 500) return swatch.shade900; + return swatch.shade50; +} diff --git a/apps/design_system_gallery/lib/primitives/icons.dart b/apps/design_system_gallery/lib/primitives/icons.dart new file mode 100644 index 0000000..1553c4d --- /dev/null +++ b/apps/design_system_gallery/lib/primitives/icons.dart @@ -0,0 +1,459 @@ +import 'package:flutter/material.dart'; +import 'package:flutter/services.dart'; +import 'package:stream_core_flutter/stream_core_flutter.dart'; +import 'package:widgetbook_annotation/widgetbook_annotation.dart'; + +@UseCase( + name: 'All Icons', + type: StreamIcons, + path: '[App Foundation]/Primitives/Icons', +) +Widget buildStreamIconsShowcase(BuildContext context) { + final textTheme = context.streamTextTheme; + final colorScheme = context.streamColorScheme; + + return DefaultTextStyle( + style: textTheme.bodyDefault.copyWith(color: colorScheme.textPrimary), + child: const _IconsPage(), + ); +} + +class _IconsPage extends StatefulWidget { + const _IconsPage(); + + @override + State<_IconsPage> createState() => _IconsPageState(); +} + +class _IconsPageState extends State<_IconsPage> { + final _searchController = TextEditingController(); + var _searchQuery = ''; + + @override + void dispose() { + _searchController.dispose(); + super.dispose(); + } + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final spacing = context.streamSpacing; + + final streamIcons = context.streamIcons; + final allIcons = streamIcons.allIcons.entries.toList(); + final filteredIcons = allIcons.where((MapEntry entry) { + if (_searchQuery.isEmpty) return true; + return entry.key.toLowerCase().contains(_searchQuery.toLowerCase()); + }).toList(); + + return SingleChildScrollView( + padding: EdgeInsets.all(spacing.lg), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + // Search section + const _SectionLabel(label: 'ICON LIBRARY'), + SizedBox(height: spacing.md), + + // Search bar + _SearchBar( + controller: _searchController, + iconCount: allIcons.length, + hasQuery: _searchQuery.isNotEmpty, + onChanged: (value) => setState(() => _searchQuery = value), + onClear: () { + _searchController.clear(); + setState(() => _searchQuery = ''); + }, + ), + + SizedBox(height: spacing.sm), + + // Results count + Text( + '${filteredIcons.length} icons${_searchQuery.isNotEmpty ? ' matching "$_searchQuery"' : ''}', + style: textTheme.captionDefault.copyWith( + color: colorScheme.textTertiary, + ), + ), + + SizedBox(height: spacing.md), + + // Icons grid + _IconsGrid(icons: filteredIcons), + + SizedBox(height: spacing.xl), + + // Quick reference + const _QuickReference(), + ], + ), + ); + } +} + +class _SearchBar extends StatelessWidget { + const _SearchBar({ + required this.controller, + required this.iconCount, + required this.hasQuery, + required this.onChanged, + required this.onClear, + }); + + final TextEditingController controller; + final int iconCount; + final bool hasQuery; + final ValueChanged onChanged; + final VoidCallback onClear; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + final icons = context.streamIcons; + + return Container( + height: 48, + decoration: BoxDecoration( + color: colorScheme.backgroundSurfaceSubtle, + borderRadius: BorderRadius.all(radius.lg), + border: Border.all(color: colorScheme.borderSubtle), + ), + child: TextField( + controller: controller, + style: textTheme.bodyDefault.copyWith(color: colorScheme.textPrimary), + decoration: InputDecoration( + hintText: 'Search $iconCount icons...', + hintStyle: textTheme.bodyDefault.copyWith(color: colorScheme.textTertiary), + prefixIcon: Padding( + padding: EdgeInsets.only(left: spacing.md, right: spacing.sm), + child: Icon( + icons.magnifyingGlassSearch, + size: 20, + color: colorScheme.textTertiary, + ), + ), + prefixIconConstraints: const BoxConstraints(), + suffixIcon: hasQuery + ? IconButton( + onPressed: onClear, + icon: Icon( + icons.crossSmall, + size: 18, + color: colorScheme.textTertiary, + ), + ) + : null, + border: InputBorder.none, + contentPadding: EdgeInsets.symmetric(vertical: spacing.md), + ), + onChanged: onChanged, + ), + ); + } +} + +class _IconsGrid extends StatelessWidget { + const _IconsGrid({required this.icons}); + + final List> icons; + + @override + Widget build(BuildContext context) { + final spacing = context.streamSpacing; + + if (icons.isEmpty) { + return _EmptyState(); + } + + return LayoutBuilder( + builder: (context, constraints) { + // Calculate columns based on available width + const minCardWidth = 140.0; + final gapSize = spacing.sm; + final columns = (constraints.maxWidth / minCardWidth).floor().clamp(2, 6); + final cardWidth = (constraints.maxWidth - (gapSize * (columns - 1))) / columns; + + return Wrap( + spacing: gapSize, + runSpacing: gapSize, + children: icons.map((entry) { + return SizedBox( + width: cardWidth, + child: _IconCard(name: entry.key, icon: entry.value), + ); + }).toList(), + ); + }, + ); + } +} + +class _IconCard extends StatelessWidget { + const _IconCard({ + required this.name, + required this.icon, + }); + + final String name; + final IconData icon; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final boxShadow = context.streamBoxShadow; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return InkWell( + onTap: () { + Clipboard.setData(ClipboardData(text: 'StreamIconData.$name')); + ScaffoldMessenger.of(context).showSnackBar( + SnackBar( + content: Text('Copied: StreamIconData.$name'), + duration: const Duration(seconds: 1), + behavior: SnackBarBehavior.floating, + ), + ); + }, + borderRadius: BorderRadius.all(radius.lg), + child: Container( + clipBehavior: Clip.antiAlias, + padding: EdgeInsets.all(spacing.md), + decoration: BoxDecoration( + color: colorScheme.backgroundSurface, + borderRadius: BorderRadius.all(radius.lg), + boxShadow: boxShadow.elevation1, + ), + foregroundDecoration: BoxDecoration( + borderRadius: BorderRadius.all(radius.lg), + border: Border.all(color: colorScheme.borderSubtle), + ), + child: Column( + mainAxisSize: MainAxisSize.min, + children: [ + // Icon preview + Container( + width: 48, + height: 48, + decoration: BoxDecoration( + color: colorScheme.backgroundSurfaceSubtle, + borderRadius: BorderRadius.all(radius.md), + ), + child: Icon( + icon, + size: 24, + color: colorScheme.textPrimary, + ), + ), + SizedBox(height: spacing.sm), + // Icon name + Row( + mainAxisAlignment: MainAxisAlignment.center, + children: [ + Flexible( + child: Text( + name, + style: textTheme.metadataEmphasis.copyWith( + color: colorScheme.accentPrimary, + fontFamily: 'monospace', + fontSize: 10, + ), + textAlign: TextAlign.center, + maxLines: 2, + overflow: TextOverflow.ellipsis, + ), + ), + SizedBox(width: spacing.xxs), + Icon( + Icons.copy, + size: 10, + color: colorScheme.textTertiary, + ), + ], + ), + ], + ), + ), + ); + } +} + +class _EmptyState extends StatelessWidget { + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final boxShadow = context.streamBoxShadow; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Container( + width: double.infinity, + padding: EdgeInsets.all(spacing.xl), + clipBehavior: Clip.antiAlias, + decoration: BoxDecoration( + color: colorScheme.backgroundSurface, + borderRadius: BorderRadius.all(radius.lg), + boxShadow: boxShadow.elevation1, + ), + foregroundDecoration: BoxDecoration( + borderRadius: BorderRadius.all(radius.lg), + border: Border.all(color: colorScheme.borderSubtle), + ), + child: Column( + children: [ + Icon( + Icons.search_off, + size: 48, + color: colorScheme.textTertiary, + ), + SizedBox(height: spacing.md), + Text( + 'No icons found', + style: textTheme.bodyEmphasis.copyWith( + color: colorScheme.textSecondary, + ), + ), + SizedBox(height: spacing.xs), + Text( + 'Try a different search term', + style: textTheme.captionDefault.copyWith( + color: colorScheme.textTertiary, + ), + ), + ], + ), + ); + } +} + +class _QuickReference extends StatelessWidget { + const _QuickReference(); + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final boxShadow = context.streamBoxShadow; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + const _SectionLabel(label: 'QUICK REFERENCE'), + SizedBox(height: spacing.md), + Container( + width: double.infinity, + padding: EdgeInsets.all(spacing.md), + clipBehavior: Clip.antiAlias, + decoration: BoxDecoration( + color: colorScheme.backgroundSurface, + borderRadius: BorderRadius.all(radius.lg), + boxShadow: boxShadow.elevation1, + ), + foregroundDecoration: BoxDecoration( + borderRadius: BorderRadius.all(radius.lg), + border: Border.all(color: colorScheme.borderSubtle), + ), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + Text( + 'Usage Pattern', + style: textTheme.captionEmphasis.copyWith( + color: colorScheme.textPrimary, + ), + ), + SizedBox(height: spacing.sm), + Container( + width: double.infinity, + padding: EdgeInsets.all(spacing.sm), + decoration: BoxDecoration( + color: colorScheme.backgroundSurfaceSubtle, + borderRadius: BorderRadius.all(radius.md), + ), + child: Text( + 'Icon(StreamIconData.settingsGear2)', + style: textTheme.captionDefault.copyWith( + color: colorScheme.accentPrimary, + fontFamily: 'monospace', + ), + ), + ), + SizedBox(height: spacing.md), + Divider(color: colorScheme.borderSubtle), + SizedBox(height: spacing.md), + Text( + 'Themed Icons', + style: textTheme.captionEmphasis.copyWith( + color: colorScheme.textPrimary, + ), + ), + SizedBox(height: spacing.sm), + Container( + width: double.infinity, + padding: EdgeInsets.all(spacing.sm), + decoration: BoxDecoration( + color: colorScheme.backgroundSurfaceSubtle, + borderRadius: BorderRadius.all(radius.md), + ), + child: Text( + 'Icon(context.streamIcons.settingsGear2)', + style: textTheme.captionDefault.copyWith( + color: colorScheme.accentPrimary, + fontFamily: 'monospace', + ), + ), + ), + SizedBox(height: spacing.md), + Text( + 'Use themed icons when you want to allow icon customization via StreamTheme.', + style: textTheme.captionDefault.copyWith( + color: colorScheme.textTertiary, + ), + ), + ], + ), + ), + ], + ); + } +} + +class _SectionLabel extends StatelessWidget { + const _SectionLabel({required this.label}); + + final String label; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Container( + padding: EdgeInsets.symmetric(horizontal: spacing.sm, vertical: spacing.xs), + decoration: BoxDecoration( + color: colorScheme.accentPrimary, + borderRadius: BorderRadius.all(radius.xs), + ), + child: Text( + label, + style: textTheme.metadataEmphasis.copyWith( + color: colorScheme.textOnAccent, + letterSpacing: 1, + fontSize: 9, + ), + ), + ); + } +} diff --git a/apps/design_system_gallery/lib/primitives/radius.dart b/apps/design_system_gallery/lib/primitives/radius.dart new file mode 100644 index 0000000..35170c0 --- /dev/null +++ b/apps/design_system_gallery/lib/primitives/radius.dart @@ -0,0 +1,370 @@ +import 'package:flutter/material.dart'; +import 'package:flutter/services.dart'; +import 'package:stream_core_flutter/stream_core_flutter.dart'; +import 'package:widgetbook_annotation/widgetbook_annotation.dart'; + +@UseCase( + name: 'All Values', + type: StreamRadius, + path: '[App Foundation]/Primitives/Radius', +) +Widget buildStreamRadiusShowcase(BuildContext context) { + final textTheme = context.streamTextTheme; + final colorScheme = context.streamColorScheme; + final spacing = context.streamSpacing; + + return DefaultTextStyle( + style: textTheme.bodyDefault.copyWith(color: colorScheme.textPrimary), + child: SingleChildScrollView( + padding: EdgeInsets.all(spacing.lg), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + // All radius values + const _RadiusCardsList(), + SizedBox(height: spacing.xl), + + // Quick reference + const _QuickReference(), + ], + ), + ), + ); +} + +/// Full-width radius cards showing all values +class _RadiusCardsList extends StatelessWidget { + const _RadiusCardsList(); + + @override + Widget build(BuildContext context) { + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + final allRadii = [ + _RadiusData(name: 'none', radius: radius.none, usage: 'Sharp corners, dividers'), + _RadiusData(name: 'xxs', radius: radius.xxs, usage: 'Minimal softening'), + _RadiusData(name: 'xs', radius: radius.xs, usage: 'Badges, tags'), + _RadiusData(name: 'sm', radius: radius.sm, usage: 'Small buttons, chips'), + _RadiusData(name: 'md', radius: radius.md, usage: 'Default buttons, inputs'), + _RadiusData(name: 'lg', radius: radius.lg, usage: 'Cards, containers'), + _RadiusData(name: 'xl', radius: radius.xl, usage: 'Modals, large cards'), + _RadiusData(name: 'xxl', radius: radius.xxl, usage: 'Sheets, dialogs'), + _RadiusData(name: 'xxxl', radius: radius.xxxl, usage: 'Large containers'), + _RadiusData(name: 'xxxxl', radius: radius.xxxxl, usage: 'Hero sections'), + _RadiusData(name: 'max', radius: radius.max, usage: 'Pills, avatars, FABs'), + ]; + + return Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + const _SectionLabel(label: 'RADIUS SCALE'), + SizedBox(height: spacing.md), + ...allRadii.map((data) => _RadiusCard(data: data)), + ], + ); + } +} + +class _RadiusCard extends StatelessWidget { + const _RadiusCard({required this.data}); + + final _RadiusData data; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final boxShadow = context.streamBoxShadow; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + final value = data.radius.x; + final displayValue = value == 9999 ? 'max' : '${value.toStringAsFixed(0)}px'; + + return Padding( + padding: EdgeInsets.only(bottom: spacing.sm), + child: InkWell( + onTap: () { + Clipboard.setData(ClipboardData(text: 'radius.${data.name}')); + ScaffoldMessenger.of(context).showSnackBar( + SnackBar( + content: Text('Copied: radius.${data.name}'), + duration: const Duration(seconds: 1), + behavior: SnackBarBehavior.floating, + ), + ); + }, + borderRadius: BorderRadius.all(radius.lg), + child: Container( + clipBehavior: Clip.antiAlias, + padding: EdgeInsets.all(spacing.md), + decoration: BoxDecoration( + color: colorScheme.backgroundSurface, + borderRadius: BorderRadius.all(radius.lg), + boxShadow: boxShadow.elevation1, + ), + foregroundDecoration: BoxDecoration( + borderRadius: BorderRadius.all(radius.lg), + border: Border.all(color: colorScheme.borderSubtle), + ), + child: Row( + children: [ + // Large preview box - rectangle to show radius clearly + Container( + width: 120, + height: 64, + decoration: BoxDecoration( + gradient: LinearGradient( + begin: Alignment.topLeft, + end: Alignment.bottomRight, + colors: [ + colorScheme.accentPrimary, + colorScheme.accentPrimary.withValues(alpha: 0.7), + ], + ), + borderRadius: BorderRadius.all(data.radius), + ), + ), + SizedBox(width: spacing.md + spacing.xs), + // Info + Expanded( + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + Row( + children: [ + Text( + 'radius.${data.name}', + style: textTheme.captionEmphasis.copyWith( + color: colorScheme.accentPrimary, + fontFamily: 'monospace', + ), + ), + SizedBox(width: spacing.sm), + Container( + padding: EdgeInsets.symmetric( + horizontal: spacing.xs + spacing.xxs, + vertical: spacing.xxs, + ), + decoration: BoxDecoration( + color: colorScheme.backgroundSurfaceSubtle, + borderRadius: BorderRadius.all(radius.xs), + ), + child: Text( + displayValue, + style: textTheme.metadataEmphasis.copyWith( + color: colorScheme.textSecondary, + fontFamily: 'monospace', + fontSize: 10, + ), + ), + ), + SizedBox(width: spacing.xs + spacing.xxs), + Icon( + Icons.copy, + size: 12, + color: colorScheme.textTertiary, + ), + ], + ), + SizedBox(height: spacing.xs + spacing.xxs), + Text( + data.usage, + style: textTheme.captionDefault.copyWith( + color: colorScheme.textTertiary, + ), + ), + ], + ), + ), + ], + ), + ), + ), + ); + } +} + +/// Quick reference for radius usage +class _QuickReference extends StatelessWidget { + const _QuickReference(); + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final boxShadow = context.streamBoxShadow; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + const _SectionLabel(label: 'QUICK REFERENCE'), + SizedBox(height: spacing.md), + Container( + width: double.infinity, + padding: EdgeInsets.all(spacing.md), + clipBehavior: Clip.antiAlias, + decoration: BoxDecoration( + color: colorScheme.backgroundSurface, + borderRadius: BorderRadius.all(radius.lg), + boxShadow: boxShadow.elevation1, + ), + foregroundDecoration: BoxDecoration( + borderRadius: BorderRadius.all(radius.lg), + border: Border.all(color: colorScheme.borderSubtle), + ), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + Text( + 'Usage Pattern', + style: textTheme.captionEmphasis.copyWith( + color: colorScheme.textPrimary, + ), + ), + SizedBox(height: spacing.sm), + Container( + width: double.infinity, + padding: EdgeInsets.all(spacing.sm), + decoration: BoxDecoration( + color: colorScheme.backgroundSurfaceSubtle, + borderRadius: BorderRadius.all(radius.md), + ), + child: Text( + 'borderRadius: BorderRadius.all(context.streamRadius.md)', + style: textTheme.captionDefault.copyWith( + color: colorScheme.accentPrimary, + fontFamily: 'monospace', + ), + ), + ), + SizedBox(height: spacing.md), + Divider(color: colorScheme.borderSubtle), + SizedBox(height: spacing.md), + Text( + 'Common Choices', + style: textTheme.captionEmphasis.copyWith( + color: colorScheme.textPrimary, + ), + ), + SizedBox(height: spacing.sm), + const _UsageHint( + token: 'sm', + description: 'Interactive elements (buttons, inputs)', + ), + SizedBox(height: spacing.sm), + const _UsageHint( + token: 'md', + description: 'Medium containers (cards, dropdowns)', + ), + SizedBox(height: spacing.sm), + const _UsageHint( + token: 'lg', + description: 'Large containers (modals, sheets)', + ), + SizedBox(height: spacing.sm), + const _UsageHint( + token: 'max', + description: 'Circular elements (avatars, pills)', + ), + ], + ), + ), + ], + ); + } +} + +class _UsageHint extends StatelessWidget { + const _UsageHint({ + required this.token, + required this.description, + }); + + final String token; + final String description; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Row( + children: [ + Container( + width: 48, + padding: EdgeInsets.symmetric(vertical: spacing.xxs), + decoration: BoxDecoration( + color: colorScheme.backgroundSurfaceSubtle, + borderRadius: BorderRadius.all(radius.xs), + ), + child: Center( + child: Text( + token, + style: textTheme.metadataEmphasis.copyWith( + color: colorScheme.accentPrimary, + fontFamily: 'monospace', + ), + ), + ), + ), + SizedBox(width: spacing.sm), + Expanded( + child: Text( + description, + style: textTheme.captionDefault.copyWith( + color: colorScheme.textSecondary, + ), + ), + ), + ], + ); + } +} + +class _SectionLabel extends StatelessWidget { + const _SectionLabel({required this.label}); + + final String label; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Container( + padding: EdgeInsets.symmetric(horizontal: spacing.sm, vertical: spacing.xs), + decoration: BoxDecoration( + color: colorScheme.accentPrimary, + borderRadius: BorderRadius.all(radius.xs), + ), + child: Text( + label, + style: textTheme.metadataEmphasis.copyWith( + color: colorScheme.textOnAccent, + letterSpacing: 1, + fontSize: 9, + ), + ), + ); + } +} + +class _RadiusData { + const _RadiusData({ + required this.name, + required this.radius, + required this.usage, + }); + + final String name; + final Radius radius; + final String usage; +} diff --git a/apps/design_system_gallery/lib/primitives/spacing.dart b/apps/design_system_gallery/lib/primitives/spacing.dart new file mode 100644 index 0000000..f6b2e25 --- /dev/null +++ b/apps/design_system_gallery/lib/primitives/spacing.dart @@ -0,0 +1,402 @@ +import 'package:flutter/material.dart'; +import 'package:flutter/services.dart'; +import 'package:stream_core_flutter/stream_core_flutter.dart'; +import 'package:widgetbook_annotation/widgetbook_annotation.dart'; + +@UseCase( + name: 'All Values', + type: StreamSpacing, + path: '[App Foundation]/Primitives/Spacing', +) +Widget buildStreamSpacingShowcase(BuildContext context) { + final textTheme = context.streamTextTheme; + final colorScheme = context.streamColorScheme; + final spacing = context.streamSpacing; + + return DefaultTextStyle( + style: textTheme.bodyDefault.copyWith(color: colorScheme.textPrimary), + child: SingleChildScrollView( + padding: EdgeInsets.all(spacing.lg), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + // All spacing values + const _SpacingCardsList(), + SizedBox(height: spacing.xl), + + // Quick reference + const _QuickReference(), + ], + ), + ), + ); +} + +/// Full-width spacing cards showing all values +class _SpacingCardsList extends StatelessWidget { + const _SpacingCardsList(); + + @override + Widget build(BuildContext context) { + final spacing = context.streamSpacing; + + final allSpacing = [ + _SpacingData(name: 'none', value: spacing.none, usage: 'No spacing, tight joins'), + _SpacingData(name: 'xxxs', value: spacing.xxxs, usage: 'Very tight gaps (tab icons)'), + _SpacingData(name: 'xxs', value: spacing.xxs, usage: 'Minimal gaps (icon+text)'), + _SpacingData(name: 'xs', value: spacing.xs, usage: 'Inline elements, small gaps'), + _SpacingData(name: 'sm', value: spacing.sm, usage: 'Button padding, list gaps'), + _SpacingData(name: 'md', value: spacing.md, usage: 'Default padding, sections'), + _SpacingData(name: 'lg', value: spacing.lg, usage: 'Large padding, groups'), + _SpacingData(name: 'xl', value: spacing.xl, usage: 'Section spacing'), + _SpacingData(name: 'xxl', value: spacing.xxl, usage: 'Modal padding, gutters'), + _SpacingData(name: 'xxxl', value: spacing.xxxl, usage: 'Page margins, hero gaps'), + ]; + + return Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + const _SectionLabel(label: 'SPACING SCALE'), + SizedBox(height: spacing.md), + ...allSpacing.map((data) => _SpacingCard(data: data)), + ], + ); + } +} + +class _SpacingCard extends StatelessWidget { + const _SpacingCard({required this.data}); + + final _SpacingData data; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final boxShadow = context.streamBoxShadow; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Padding( + padding: EdgeInsets.only(bottom: spacing.sm), + child: InkWell( + onTap: () { + Clipboard.setData(ClipboardData(text: 'spacing.${data.name}')); + ScaffoldMessenger.of(context).showSnackBar( + SnackBar( + content: Text('Copied: spacing.${data.name}'), + duration: const Duration(seconds: 1), + behavior: SnackBarBehavior.floating, + ), + ); + }, + borderRadius: BorderRadius.all(radius.lg), + child: Container( + clipBehavior: Clip.antiAlias, + padding: EdgeInsets.all(spacing.md), + decoration: BoxDecoration( + color: colorScheme.backgroundSurface, + borderRadius: BorderRadius.all(radius.lg), + boxShadow: boxShadow.elevation1, + ), + foregroundDecoration: BoxDecoration( + borderRadius: BorderRadius.all(radius.lg), + border: Border.all(color: colorScheme.borderSubtle), + ), + child: Row( + children: [ + // Visual spacing demonstration - two boxes with the actual gap + Container( + width: 120, + height: 64, + padding: EdgeInsets.all(spacing.sm), + decoration: BoxDecoration( + color: colorScheme.backgroundSurfaceSubtle, + borderRadius: BorderRadius.all(radius.md), + ), + child: Row( + mainAxisAlignment: MainAxisAlignment.center, + children: [ + Container( + width: 24, + height: 48, + decoration: BoxDecoration( + color: colorScheme.accentPrimary, + borderRadius: BorderRadius.all(radius.xs), + ), + ), + // The actual spacing + SizedBox(width: data.value.clamp(0, 40)), + Container( + width: 24, + height: 48, + decoration: BoxDecoration( + color: colorScheme.accentPrimary, + borderRadius: BorderRadius.all(radius.xs), + ), + ), + ], + ), + ), + SizedBox(width: spacing.md + spacing.xs), + // Info + Expanded( + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + Row( + children: [ + Text( + 'spacing.${data.name}', + style: textTheme.captionEmphasis.copyWith( + color: colorScheme.accentPrimary, + fontFamily: 'monospace', + ), + ), + SizedBox(width: spacing.sm), + Container( + padding: EdgeInsets.symmetric( + horizontal: spacing.xs + spacing.xxs, + vertical: spacing.xxs, + ), + decoration: BoxDecoration( + color: colorScheme.backgroundSurfaceSubtle, + borderRadius: BorderRadius.all(radius.xs), + ), + child: Text( + '${data.value.toInt()}px', + style: textTheme.metadataEmphasis.copyWith( + color: colorScheme.textSecondary, + fontFamily: 'monospace', + fontSize: 10, + ), + ), + ), + SizedBox(width: spacing.xs + spacing.xxs), + Icon( + Icons.copy, + size: 12, + color: colorScheme.textTertiary, + ), + ], + ), + SizedBox(height: spacing.xs + spacing.xxs), + Text( + data.usage, + style: textTheme.captionDefault.copyWith( + color: colorScheme.textTertiary, + ), + ), + ], + ), + ), + ], + ), + ), + ), + ); + } +} + +/// Quick reference for spacing usage +class _QuickReference extends StatelessWidget { + const _QuickReference(); + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final boxShadow = context.streamBoxShadow; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + const _SectionLabel(label: 'QUICK REFERENCE'), + SizedBox(height: spacing.md), + Container( + width: double.infinity, + padding: EdgeInsets.all(spacing.md), + clipBehavior: Clip.antiAlias, + decoration: BoxDecoration( + color: colorScheme.backgroundSurface, + borderRadius: BorderRadius.all(radius.lg), + boxShadow: boxShadow.elevation1, + ), + foregroundDecoration: BoxDecoration( + borderRadius: BorderRadius.all(radius.lg), + border: Border.all(color: colorScheme.borderSubtle), + ), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + Text( + 'Usage Patterns', + style: textTheme.captionEmphasis.copyWith( + color: colorScheme.textPrimary, + ), + ), + SizedBox(height: spacing.sm), + Container( + width: double.infinity, + padding: EdgeInsets.all(spacing.sm), + decoration: BoxDecoration( + color: colorScheme.backgroundSurfaceSubtle, + borderRadius: BorderRadius.all(radius.md), + ), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + Text( + 'padding: EdgeInsets.all(context.streamSpacing.md)', + style: textTheme.metadataDefault.copyWith( + color: colorScheme.accentPrimary, + fontFamily: 'monospace', + ), + ), + SizedBox(height: spacing.xs), + Text( + 'SizedBox(height: context.streamSpacing.lg)', + style: textTheme.metadataDefault.copyWith( + color: colorScheme.accentPrimary, + fontFamily: 'monospace', + ), + ), + ], + ), + ), + SizedBox(height: spacing.md), + Divider(color: colorScheme.borderSubtle), + SizedBox(height: spacing.md), + Text( + 'Spacing Scale', + style: textTheme.captionEmphasis.copyWith( + color: colorScheme.textPrimary, + ), + ), + SizedBox(height: spacing.sm), + Text( + 'Spacing values follow a consistent scale (2, 4, 8, 12, 16...) for visual hierarchy.', + style: textTheme.captionDefault.copyWith( + color: colorScheme.textSecondary, + ), + ), + SizedBox(height: spacing.sm), + const _UsageHint( + token: 'xxxs-xs', + description: 'Fine adjustments (2-8px)', + ), + SizedBox(height: spacing.sm), + const _UsageHint( + token: 'sm-md', + description: 'Component internals (8-16px)', + ), + SizedBox(height: spacing.sm), + const _UsageHint( + token: 'lg-xl', + description: 'Section gaps (24-32px)', + ), + SizedBox(height: spacing.sm), + const _UsageHint( + token: 'xxl-xxxl', + description: 'Page-level spacing (48-64px)', + ), + ], + ), + ), + ], + ); + } +} + +class _UsageHint extends StatelessWidget { + const _UsageHint({ + required this.token, + required this.description, + }); + + final String token; + final String description; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Row( + children: [ + Container( + width: 56, + padding: EdgeInsets.symmetric(vertical: spacing.xxs), + decoration: BoxDecoration( + color: colorScheme.backgroundSurfaceSubtle, + borderRadius: BorderRadius.all(radius.xs), + ), + child: Center( + child: Text( + token, + style: textTheme.metadataEmphasis.copyWith( + color: colorScheme.accentPrimary, + fontFamily: 'monospace', + ), + ), + ), + ), + SizedBox(width: spacing.sm), + Expanded( + child: Text( + description, + style: textTheme.captionDefault.copyWith( + color: colorScheme.textSecondary, + ), + ), + ), + ], + ); + } +} + +class _SectionLabel extends StatelessWidget { + const _SectionLabel({required this.label}); + + final String label; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Container( + padding: EdgeInsets.symmetric(horizontal: spacing.sm, vertical: spacing.xs), + decoration: BoxDecoration( + color: colorScheme.accentPrimary, + borderRadius: BorderRadius.all(radius.xs), + ), + child: Text( + label, + style: textTheme.metadataEmphasis.copyWith( + color: colorScheme.textOnAccent, + letterSpacing: 1, + fontSize: 9, + ), + ), + ); + } +} + +class _SpacingData { + const _SpacingData({ + required this.name, + required this.value, + required this.usage, + }); + + final String name; + final double value; + final String usage; +} diff --git a/apps/design_system_gallery/lib/semantics/elevations.dart b/apps/design_system_gallery/lib/semantics/elevations.dart new file mode 100644 index 0000000..23fe036 --- /dev/null +++ b/apps/design_system_gallery/lib/semantics/elevations.dart @@ -0,0 +1,559 @@ +import 'package:flutter/material.dart'; +import 'package:flutter/services.dart'; +import 'package:stream_core_flutter/stream_core_flutter.dart'; +import 'package:widgetbook_annotation/widgetbook_annotation.dart'; + +@UseCase( + name: 'All Elevations', + type: StreamBoxShadow, + path: '[App Foundation]/Semantics/Elevations', +) +Widget buildStreamBoxShadowShowcase(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final spacing = context.streamSpacing; + + return DefaultTextStyle( + style: textTheme.bodyDefault.copyWith(color: colorScheme.textPrimary), + child: SingleChildScrollView( + padding: EdgeInsets.all(spacing.lg), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + // 3D Stacked visualization + const _StackedElevationDemo(), + SizedBox(height: spacing.xl), + + // Elevation cards + const _ElevationGrid(), + SizedBox(height: spacing.xl), + + // Quick reference + const _QuickReference(), + ], + ), + ), + ); +} + +class _StackedElevationDemo extends StatelessWidget { + const _StackedElevationDemo(); + + @override + Widget build(BuildContext context) { + final boxShadow = context.streamBoxShadow; + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + const _SectionLabel(label: 'DEPTH HIERARCHY'), + SizedBox(height: spacing.md), + Container( + width: double.infinity, + padding: EdgeInsets.all(spacing.lg), + clipBehavior: Clip.antiAlias, + decoration: BoxDecoration( + gradient: LinearGradient( + begin: Alignment.topLeft, + end: Alignment.bottomRight, + colors: [ + colorScheme.backgroundSurface, + colorScheme.backgroundSurfaceSubtle, + ], + ), + borderRadius: BorderRadius.all(radius.lg), + boxShadow: boxShadow.elevation1, + ), + foregroundDecoration: BoxDecoration( + borderRadius: BorderRadius.all(radius.lg), + border: Border.all(color: colorScheme.borderSubtle), + ), + child: Column( + children: [ + SizedBox( + height: 200, + child: Stack( + alignment: Alignment.center, + children: [ + // Base layer + Positioned( + bottom: 0, + child: _buildLayer( + context, + 'elevation1', + boxShadow.elevation1, + 180, + colorScheme.backgroundSurface.withValues(alpha: 0.5), + ), + ), + // elevation2 + Positioned( + bottom: 35, + child: _buildLayer( + context, + 'elevation2', + boxShadow.elevation2, + 155, + colorScheme.backgroundSurface.withValues(alpha: 0.7), + ), + ), + // elevation3 + Positioned( + bottom: 70, + child: _buildLayer( + context, + 'elevation3', + boxShadow.elevation3, + 130, + colorScheme.backgroundSurface.withValues(alpha: 0.85), + ), + ), + // elevation4 + Positioned( + bottom: 105, + child: _buildLayer( + context, + 'elevation4', + boxShadow.elevation4, + 105, + colorScheme.backgroundSurface, + ), + ), + ], + ), + ), + SizedBox(height: spacing.md + spacing.xs), + Row( + mainAxisAlignment: MainAxisAlignment.center, + children: [ + Icon( + Icons.arrow_downward, + size: 14, + color: colorScheme.textTertiary, + ), + SizedBox(width: spacing.sm), + Text( + 'Further from viewer', + style: textTheme.metadataDefault.copyWith( + color: colorScheme.textTertiary, + ), + ), + SizedBox(width: spacing.lg), + Icon( + Icons.arrow_upward, + size: 14, + color: colorScheme.textTertiary, + ), + SizedBox(width: spacing.sm), + Text( + 'Closer to viewer', + style: textTheme.metadataDefault.copyWith( + color: colorScheme.textTertiary, + ), + ), + ], + ), + ], + ), + ), + ], + ); + } + + Widget _buildLayer( + BuildContext context, + String label, + List shadow, + double width, + Color color, + ) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final radius = context.streamRadius; + + return Container( + width: width, + height: 56, + decoration: BoxDecoration( + color: color, + borderRadius: BorderRadius.all(radius.md), + boxShadow: shadow, + border: Border.all( + color: colorScheme.borderSubtle.withValues(alpha: 0.3), + ), + ), + child: Center( + child: Text( + label, + style: textTheme.metadataEmphasis.copyWith( + color: colorScheme.textSecondary, + fontFamily: 'monospace', + ), + ), + ), + ); + } +} + +class _ElevationGrid extends StatelessWidget { + const _ElevationGrid(); + + @override + Widget build(BuildContext context) { + final boxShadow = context.streamBoxShadow; + final spacing = context.streamSpacing; + + final elevations = [ + _ElevationData( + name: 'elevation1', + shadow: boxShadow.elevation1, + level: '1', + description: 'Subtle lift for resting state', + useCases: ['Cards', 'List items', 'Input fields'], + ), + _ElevationData( + name: 'elevation2', + shadow: boxShadow.elevation2, + level: '2', + description: 'Moderate lift for hover/focus', + useCases: ['Dropdowns', 'Menus', 'Popovers'], + ), + _ElevationData( + name: 'elevation3', + shadow: boxShadow.elevation3, + level: '3', + description: 'High lift for prominent UI', + useCases: ['Modals', 'Dialogs', 'Drawers'], + ), + _ElevationData( + name: 'elevation4', + shadow: boxShadow.elevation4, + level: '4', + description: 'Highest lift for alerts', + useCases: ['Toasts', 'Notifications', 'Snackbars'], + ), + ]; + + return Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + const _SectionLabel(label: 'ELEVATION LEVELS'), + SizedBox(height: spacing.md), + ...elevations.map( + (e) => _ElevationCard(data: e), + ), + ], + ); + } +} + +class _ElevationCard extends StatelessWidget { + const _ElevationCard({required this.data}); + + final _ElevationData data; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final boxShadow = context.streamBoxShadow; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Padding( + padding: EdgeInsets.only(bottom: spacing.sm), + child: InkWell( + onTap: () { + Clipboard.setData( + ClipboardData(text: 'boxShadow.${data.name}'), + ); + ScaffoldMessenger.of(context).showSnackBar( + SnackBar( + content: Text('Copied: boxShadow.${data.name}'), + duration: const Duration(seconds: 1), + behavior: SnackBarBehavior.floating, + ), + ); + }, + borderRadius: BorderRadius.all(radius.lg), + child: Container( + clipBehavior: Clip.antiAlias, + decoration: BoxDecoration( + color: colorScheme.backgroundSurface, + borderRadius: BorderRadius.all(radius.lg), + boxShadow: boxShadow.elevation1, + ), + foregroundDecoration: BoxDecoration( + borderRadius: BorderRadius.all(radius.lg), + border: Border.all(color: colorScheme.borderSubtle), + ), + child: Row( + children: [ + // Level indicator + Container( + width: 48, + height: 100, + decoration: BoxDecoration( + color: colorScheme.backgroundSurfaceSubtle, + ), + child: Center( + child: Text( + data.level, + style: textTheme.headingLg.copyWith( + color: colorScheme.textTertiary, + ), + ), + ), + ), + // Preview box with shadow + Padding( + padding: EdgeInsets.all(spacing.md), + child: Container( + width: 64, + height: 64, + decoration: BoxDecoration( + color: colorScheme.backgroundSurface, + borderRadius: BorderRadius.all(radius.lg), + boxShadow: data.shadow, + ), + ), + ), + // Info + Expanded( + child: Padding( + padding: EdgeInsets.symmetric(vertical: spacing.sm), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + Row( + children: [ + Text( + data.name, + style: textTheme.captionEmphasis.copyWith( + color: colorScheme.accentPrimary, + fontFamily: 'monospace', + ), + ), + SizedBox(width: spacing.xs + spacing.xxs), + Icon( + Icons.copy, + size: 11, + color: colorScheme.textTertiary, + ), + ], + ), + SizedBox(height: spacing.xs), + Text( + data.description, + style: textTheme.captionDefault.copyWith( + color: colorScheme.textSecondary, + ), + ), + SizedBox(height: spacing.sm), + Wrap( + spacing: spacing.xs + spacing.xxs, + runSpacing: spacing.xs, + children: data.useCases.map((use) { + return Container( + padding: EdgeInsets.symmetric( + horizontal: spacing.xs + spacing.xxs, + vertical: spacing.xxs, + ), + decoration: BoxDecoration( + color: colorScheme.backgroundSurfaceSubtle, + borderRadius: BorderRadius.all(radius.xs), + ), + child: Text( + use, + style: textTheme.metadataDefault.copyWith( + color: colorScheme.textTertiary, + ), + ), + ); + }).toList(), + ), + ], + ), + ), + ), + SizedBox(width: spacing.sm), + ], + ), + ), + ), + ); + } +} + +/// Quick reference for elevation usage +class _QuickReference extends StatelessWidget { + const _QuickReference(); + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final boxShadow = context.streamBoxShadow; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + const _SectionLabel(label: 'QUICK REFERENCE'), + SizedBox(height: spacing.md), + Container( + width: double.infinity, + padding: EdgeInsets.all(spacing.md), + clipBehavior: Clip.antiAlias, + decoration: BoxDecoration( + color: colorScheme.backgroundSurface, + borderRadius: BorderRadius.all(radius.lg), + boxShadow: boxShadow.elevation1, + ), + foregroundDecoration: BoxDecoration( + borderRadius: BorderRadius.all(radius.lg), + border: Border.all(color: colorScheme.borderSubtle), + ), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + Text( + 'Usage Pattern', + style: textTheme.captionEmphasis.copyWith( + color: colorScheme.textPrimary, + ), + ), + SizedBox(height: spacing.sm), + Container( + width: double.infinity, + padding: EdgeInsets.all(spacing.sm), + decoration: BoxDecoration( + color: colorScheme.backgroundSurfaceSubtle, + borderRadius: BorderRadius.all(radius.md), + ), + child: Text( + 'boxShadow: context.streamBoxShadow.elevation{1-4}', + style: textTheme.captionDefault.copyWith( + color: colorScheme.accentPrimary, + fontFamily: 'monospace', + ), + ), + ), + SizedBox(height: spacing.md), + Divider(color: colorScheme.borderSubtle), + SizedBox(height: spacing.md), + Text( + 'Best Practices', + style: textTheme.captionEmphasis.copyWith( + color: colorScheme.textPrimary, + ), + ), + SizedBox(height: spacing.sm), + const _BestPractice( + icon: Icons.check_circle_outline, + text: 'Use consistent elevation for same-level components', + ), + SizedBox(height: spacing.sm), + const _BestPractice( + icon: Icons.check_circle_outline, + text: 'Increase elevation for overlapping/modal content', + ), + SizedBox(height: spacing.sm), + const _BestPractice( + icon: Icons.check_circle_outline, + text: 'Reserve higher elevations for temporary UI', + ), + ], + ), + ), + ], + ); + } +} + +class _BestPractice extends StatelessWidget { + const _BestPractice({ + required this.icon, + required this.text, + }); + + final IconData icon; + final String text; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final spacing = context.streamSpacing; + + return Row( + children: [ + Icon( + icon, + size: 14, + color: colorScheme.accentSuccess, + ), + SizedBox(width: spacing.sm), + Expanded( + child: Text( + text, + style: textTheme.captionDefault.copyWith( + color: colorScheme.textSecondary, + ), + ), + ), + ], + ); + } +} + +class _SectionLabel extends StatelessWidget { + const _SectionLabel({required this.label}); + + final String label; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Container( + padding: EdgeInsets.symmetric(horizontal: spacing.sm, vertical: spacing.xs), + decoration: BoxDecoration( + color: colorScheme.accentPrimary, + borderRadius: BorderRadius.all(radius.xs), + ), + child: Text( + label, + style: textTheme.metadataEmphasis.copyWith( + color: colorScheme.textOnAccent, + letterSpacing: 1, + fontSize: 9, + ), + ), + ); + } +} + +class _ElevationData { + const _ElevationData({ + required this.name, + required this.shadow, + required this.level, + required this.description, + required this.useCases, + }); + + final String name; + final List shadow; + final String level; + final String description; + final List useCases; +} diff --git a/apps/design_system_gallery/lib/semantics/typography.dart b/apps/design_system_gallery/lib/semantics/typography.dart new file mode 100644 index 0000000..e98f788 --- /dev/null +++ b/apps/design_system_gallery/lib/semantics/typography.dart @@ -0,0 +1,581 @@ +import 'package:flutter/material.dart'; +import 'package:flutter/services.dart'; +import 'package:stream_core_flutter/stream_core_flutter.dart'; +import 'package:widgetbook_annotation/widgetbook_annotation.dart'; + +@UseCase( + name: 'All Styles', + type: StreamTextTheme, + path: '[App Foundation]/Semantics/Typography', +) +Widget buildStreamTextThemeShowcase(BuildContext context) { + final spacing = context.streamSpacing; + + return DefaultTextStyle( + style: context.streamTextTheme.bodyDefault.copyWith( + color: context.streamColorScheme.textPrimary, + ), + child: SingleChildScrollView( + padding: EdgeInsets.all(spacing.lg), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + // Visual Type Scale + const _TypeScale(), + SizedBox(height: spacing.xl), + + // Complete Reference + const _CompleteReference(), + ], + ), + ), + ); +} + +/// Visual type scale showing hierarchy at a glance +class _TypeScale extends StatelessWidget { + const _TypeScale(); + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final boxShadow = context.streamBoxShadow; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + final categories = [ + ( + 'HEADINGS', + 'Page and section titles', + [ + ('headingLg', textTheme.headingLg, 'Page titles, hero text'), + ('headingMd', textTheme.headingMd, 'Section headers'), + ('headingSm', textTheme.headingSm, 'Card titles, dialogs'), + ('headingXs', textTheme.headingXs, 'Small labels, overlines'), + ], + ), + ( + 'BODY', + 'Main content text', + [ + ('bodyDefault', textTheme.bodyDefault, 'Paragraphs, descriptions'), + ('bodyEmphasis', textTheme.bodyEmphasis, 'Important inline text'), + ('bodyLink', textTheme.bodyLink, 'Clickable links'), + ('bodyLinkEmphasis', textTheme.bodyLinkEmphasis, 'Bold links'), + ], + ), + ( + 'CAPTION', + 'Secondary and supporting text', + [ + ('captionDefault', textTheme.captionDefault, 'Labels, hints'), + ('captionEmphasis', textTheme.captionEmphasis, 'Bold labels'), + ('captionLink', textTheme.captionLink, 'Small links'), + ('captionLinkEmphasis', textTheme.captionLinkEmphasis, 'Bold small links'), + ], + ), + ( + 'METADATA', + 'Smallest text for auxiliary info', + [ + ('metadataDefault', textTheme.metadataDefault, 'Timestamps, counts'), + ('metadataEmphasis', textTheme.metadataEmphasis, 'Bold metadata'), + ('metadataLink', textTheme.metadataLink, 'Tiny links'), + ('metadataLinkEmphasis', textTheme.metadataLinkEmphasis, 'Bold tiny links'), + ], + ), + ( + 'NUMERIC', + 'Numbers and counters', + [ + ('numericXl', textTheme.numericXl, 'Extra large counters'), + ('numericLg', textTheme.numericLg, 'Large counters, stats'), + ('numericMd', textTheme.numericMd, 'Badges, indicators'), + ('numericSm', textTheme.numericSm, 'Small counts'), + ], + ), + ]; + + return Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + const _SectionLabel(label: 'TYPE SCALE'), + SizedBox(height: spacing.md), + ...categories.map((category) { + final (title, description, styles) = category; + return Padding( + padding: EdgeInsets.only(bottom: spacing.md), + child: Container( + clipBehavior: Clip.antiAlias, + decoration: BoxDecoration( + color: colorScheme.backgroundSurface, + borderRadius: BorderRadius.all(radius.lg), + boxShadow: boxShadow.elevation1, + ), + foregroundDecoration: BoxDecoration( + borderRadius: BorderRadius.all(radius.lg), + border: Border.all(color: colorScheme.borderSubtle), + ), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + // Category header + Container( + width: double.infinity, + padding: EdgeInsets.symmetric( + horizontal: spacing.md, + vertical: spacing.sm + spacing.xxs, + ), + decoration: BoxDecoration( + color: colorScheme.backgroundSurfaceSubtle, + ), + child: Row( + children: [ + Text( + title, + style: textTheme.metadataEmphasis.copyWith( + color: colorScheme.textPrimary, + letterSpacing: 0.5, + ), + ), + SizedBox(width: spacing.sm), + Text( + '— $description', + style: textTheme.metadataDefault.copyWith( + color: colorScheme.textTertiary, + ), + ), + ], + ), + ), + // Styles list + ...styles.asMap().entries.map((entry) { + final (name, style, usage) = entry.value; + final isLast = entry.key == styles.length - 1; + return _TypeStyleCard( + name: name, + style: style, + usage: usage, + showBorder: !isLast, + ); + }), + ], + ), + ), + ); + }), + ], + ); + } +} + +/// Individual type style card +class _TypeStyleCard extends StatelessWidget { + const _TypeStyleCard({ + required this.name, + required this.style, + required this.usage, + required this.showBorder, + }); + + final String name; + final TextStyle style; + final String usage; + final bool showBorder; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + final size = style.fontSize?.toInt() ?? 0; + final weight = _weightName(style.fontWeight); + final lineHeight = style.height ?? 1.0; + + return InkWell( + onTap: () { + Clipboard.setData(ClipboardData(text: 'textTheme.$name')); + ScaffoldMessenger.of(context).showSnackBar( + SnackBar( + content: Text('Copied: textTheme.$name'), + duration: const Duration(seconds: 1), + behavior: SnackBarBehavior.floating, + ), + ); + }, + child: Container( + padding: EdgeInsets.all(spacing.md), + decoration: BoxDecoration( + border: showBorder + ? Border( + bottom: BorderSide(color: colorScheme.borderSubtle), + ) + : null, + ), + child: Row( + children: [ + // Size indicator bar + Container( + width: 3, + height: size.toDouble().clamp(12, 32), + margin: EdgeInsets.only(right: spacing.sm), + decoration: BoxDecoration( + color: colorScheme.accentPrimary, + borderRadius: BorderRadius.all(radius.xxs), + ), + ), + // Preview text + Expanded( + flex: 3, + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + Text( + name.contains('numeric') ? '1,234,567' : 'The quick brown fox', + style: style.copyWith(color: colorScheme.textPrimary), + maxLines: 1, + overflow: TextOverflow.ellipsis, + ), + SizedBox(height: spacing.xs), + Row( + children: [ + Text( + name, + style: textTheme.metadataDefault.copyWith( + color: colorScheme.accentPrimary, + fontFamily: 'monospace', + ), + ), + SizedBox(width: spacing.xs), + Icon( + Icons.copy, + size: 10, + color: colorScheme.textTertiary, + ), + ], + ), + ], + ), + ), + // Specs + Expanded( + flex: 2, + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + Row( + children: [ + _SpecChip(label: '${size}px'), + SizedBox(width: spacing.xs + spacing.xxs), + _SpecChip(label: weight), + SizedBox(width: spacing.xs + spacing.xxs), + _SpecChip(label: '${lineHeight.toStringAsFixed(1)}×'), + ], + ), + SizedBox(height: spacing.xs), + Text( + usage, + style: textTheme.metadataDefault.copyWith( + color: colorScheme.textTertiary, + ), + ), + ], + ), + ), + ], + ), + ), + ); + } + + String _weightName(FontWeight? weight) { + return switch (weight) { + FontWeight.w100 => 'Thin', + FontWeight.w200 => 'ExtraLight', + FontWeight.w300 => 'Light', + FontWeight.w400 => 'Regular', + FontWeight.w500 => 'Medium', + FontWeight.w600 => 'SemiBold', + FontWeight.w700 => 'Bold', + FontWeight.w800 => 'ExtraBold', + FontWeight.w900 => 'Black', + _ => '${weight?.value ?? "?"}', + }; + } +} + +/// Small spec chip for displaying typography specs +class _SpecChip extends StatelessWidget { + const _SpecChip({required this.label}); + + final String label; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Container( + padding: EdgeInsets.symmetric(horizontal: spacing.xs + spacing.xxs, vertical: spacing.xxs), + decoration: BoxDecoration( + color: colorScheme.backgroundSurfaceSubtle, + borderRadius: BorderRadius.all(radius.xs), + ), + child: Text( + label, + style: textTheme.metadataDefault.copyWith( + color: colorScheme.textSecondary, + fontFamily: 'monospace', + fontSize: 9, + ), + ), + ); + } +} + +/// Quick reference summary +class _CompleteReference extends StatelessWidget { + const _CompleteReference(); + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final boxShadow = context.streamBoxShadow; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + const _SectionLabel(label: 'QUICK REFERENCE'), + SizedBox(height: spacing.md), + Container( + width: double.infinity, + padding: EdgeInsets.all(spacing.md), + clipBehavior: Clip.antiAlias, + decoration: BoxDecoration( + color: colorScheme.backgroundSurface, + borderRadius: BorderRadius.all(radius.lg), + boxShadow: boxShadow.elevation1, + ), + foregroundDecoration: BoxDecoration( + borderRadius: BorderRadius.all(radius.lg), + border: Border.all(color: colorScheme.borderSubtle), + ), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + Text( + 'Style Naming Convention', + style: textTheme.captionEmphasis.copyWith( + color: colorScheme.textPrimary, + ), + ), + SizedBox(height: spacing.sm), + const _ConventionRow( + pattern: '{category}Default', + example: 'bodyDefault', + description: 'Regular weight, base style', + ), + SizedBox(height: spacing.sm), + const _ConventionRow( + pattern: '{category}Emphasis', + example: 'bodyEmphasis', + description: 'SemiBold weight, emphasis', + ), + SizedBox(height: spacing.sm), + const _ConventionRow( + pattern: '{category}Link', + example: 'bodyLink', + description: 'Regular weight, underlined', + ), + SizedBox(height: spacing.sm), + const _ConventionRow( + pattern: '{category}LinkEmphasis', + example: 'bodyLinkEmphasis', + description: 'SemiBold weight, underlined', + ), + SizedBox(height: spacing.md), + Divider(color: colorScheme.borderSubtle), + SizedBox(height: spacing.md), + Text( + 'Size Scale', + style: textTheme.captionEmphasis.copyWith( + color: colorScheme.textPrimary, + ), + ), + SizedBox(height: spacing.sm), + Wrap( + spacing: spacing.sm, + runSpacing: spacing.sm, + children: const [ + _SizeTag( + label: 'heading', + sizes: '20 / 18 / 16 / 12', + ), + _SizeTag( + label: 'body', + sizes: '16', + ), + _SizeTag( + label: 'caption', + sizes: '14', + ), + _SizeTag( + label: 'metadata', + sizes: '12', + ), + _SizeTag( + label: 'numeric', + sizes: '14 / 12 / 10 / 8', + ), + ], + ), + ], + ), + ), + ], + ); + } +} + +class _ConventionRow extends StatelessWidget { + const _ConventionRow({ + required this.pattern, + required this.example, + required this.description, + }); + + final String pattern; + final String example; + final String description; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Row( + children: [ + SizedBox( + width: 160, + child: Text( + pattern, + style: textTheme.metadataDefault.copyWith( + color: colorScheme.accentPrimary, + fontFamily: 'monospace', + ), + ), + ), + Container( + padding: EdgeInsets.symmetric(horizontal: spacing.xs + spacing.xxs, vertical: spacing.xxs), + decoration: BoxDecoration( + color: colorScheme.backgroundSurfaceSubtle, + borderRadius: BorderRadius.all(radius.xs), + ), + child: Text( + example, + style: textTheme.metadataDefault.copyWith( + color: colorScheme.textSecondary, + fontFamily: 'monospace', + fontSize: 10, + ), + ), + ), + SizedBox(width: spacing.sm), + Expanded( + child: Text( + description, + style: textTheme.metadataDefault.copyWith( + color: colorScheme.textTertiary, + ), + ), + ), + ], + ); + } +} + +class _SizeTag extends StatelessWidget { + const _SizeTag({ + required this.label, + required this.sizes, + }); + + final String label; + final String sizes; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Container( + padding: EdgeInsets.symmetric(horizontal: spacing.sm + spacing.xxs, vertical: spacing.xs + spacing.xxs), + decoration: BoxDecoration( + color: colorScheme.backgroundSurfaceSubtle, + borderRadius: BorderRadius.all(radius.sm), + border: Border.all(color: colorScheme.borderSubtle), + ), + child: Row( + mainAxisSize: MainAxisSize.min, + children: [ + Text( + label, + style: textTheme.metadataEmphasis.copyWith( + color: colorScheme.textPrimary, + ), + ), + SizedBox(width: spacing.sm), + Text( + sizes, + style: textTheme.metadataDefault.copyWith( + color: colorScheme.textTertiary, + fontFamily: 'monospace', + ), + ), + ], + ), + ); + } +} + +class _SectionLabel extends StatelessWidget { + const _SectionLabel({required this.label}); + + final String label; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Container( + padding: EdgeInsets.symmetric(horizontal: spacing.sm, vertical: spacing.xs), + decoration: BoxDecoration( + color: colorScheme.accentPrimary, + borderRadius: BorderRadius.all(radius.xs), + ), + child: Text( + label, + style: textTheme.metadataEmphasis.copyWith( + color: colorScheme.textOnAccent, + letterSpacing: 1, + fontSize: 9, + ), + ), + ); + } +} diff --git a/apps/design_system_gallery/lib/widgets/theme_studio/avatar_palette_section.dart b/apps/design_system_gallery/lib/widgets/theme_studio/avatar_palette_section.dart new file mode 100644 index 0000000..b0e0645 --- /dev/null +++ b/apps/design_system_gallery/lib/widgets/theme_studio/avatar_palette_section.dart @@ -0,0 +1,279 @@ +import 'package:flutter/material.dart'; +import 'package:flutter_colorpicker/flutter_colorpicker.dart'; +import 'package:stream_core_flutter/stream_core_flutter.dart'; + +/// A tile for editing a single avatar color pair (background and foreground). +class AvatarColorPairTile extends StatelessWidget { + const AvatarColorPairTile({ + super.key, + required this.index, + required this.pair, + required this.onBackgroundChanged, + required this.onForegroundChanged, + this.onRemove, + }); + + final int index; + final StreamAvatarColorPair pair; + final ValueChanged onBackgroundChanged; + final ValueChanged onForegroundChanged; + final VoidCallback? onRemove; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Padding( + padding: EdgeInsets.only(bottom: spacing.sm), + child: Container( + padding: EdgeInsets.all(spacing.sm + spacing.xxs), + clipBehavior: Clip.antiAlias, + decoration: BoxDecoration( + color: colorScheme.backgroundApp, + borderRadius: BorderRadius.all(radius.md), + ), + foregroundDecoration: BoxDecoration( + borderRadius: BorderRadius.all(radius.md), + border: Border.all(color: colorScheme.borderDefault), + ), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + Row( + children: [ + // Preview avatar + Container( + width: 36, + height: 36, + decoration: BoxDecoration( + color: pair.backgroundColor, + shape: BoxShape.circle, + ), + child: Center( + child: Text( + 'AB', + style: textTheme.captionEmphasis.copyWith( + color: pair.foregroundColor, + ), + ), + ), + ), + SizedBox(width: spacing.sm + spacing.xxs), + Expanded( + child: Text( + 'Palette ${index + 1}', + style: textTheme.captionEmphasis.copyWith( + color: colorScheme.textPrimary, + ), + ), + ), + if (onRemove != null) + IconButton( + onPressed: onRemove, + icon: Icon( + Icons.remove_circle_outline, + color: colorScheme.accentError, + size: 18, + ), + tooltip: 'Remove', + padding: EdgeInsets.zero, + constraints: const BoxConstraints(minWidth: 32, minHeight: 32), + ), + ], + ), + SizedBox(height: spacing.sm), + Row( + children: [ + Expanded( + child: _SmallColorButton( + label: 'backgroundColor', + color: pair.backgroundColor, + onTap: () => _showColorPicker( + context, + 'backgroundColor', + pair.backgroundColor, + onBackgroundChanged, + ), + ), + ), + SizedBox(width: spacing.sm), + Expanded( + child: _SmallColorButton( + label: 'foregroundColor', + color: pair.foregroundColor, + onTap: () => _showColorPicker( + context, + 'foregroundColor', + pair.foregroundColor, + onForegroundChanged, + ), + ), + ), + ], + ), + ], + ), + ), + ); + } + + Future _showColorPicker( + BuildContext context, + String label, + Color initialColor, + ValueChanged onChanged, + ) async { + var pickerColor = initialColor; + final textTheme = context.streamTextTheme; + + await showDialog( + context: context, + builder: (context) => AlertDialog( + title: Text( + label, + style: textTheme.bodyEmphasis.copyWith( + fontFamily: 'monospace', + ), + ), + content: SingleChildScrollView( + child: ColorPicker( + pickerColor: pickerColor, + onColorChanged: (c) => pickerColor = c, + labelTypes: const [], + pickerAreaHeightPercent: 0.8, + ), + ), + actions: [ + TextButton( + onPressed: () => Navigator.of(context).pop(), + child: const Text('Cancel'), + ), + FilledButton( + onPressed: () { + onChanged(pickerColor); + Navigator.of(context).pop(); + }, + child: const Text('Apply'), + ), + ], + ), + ); + } +} + +class _SmallColorButton extends StatelessWidget { + const _SmallColorButton({ + required this.label, + required this.color, + required this.onTap, + }); + + final String label; + final Color color; + final VoidCallback onTap; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return InkWell( + onTap: onTap, + borderRadius: BorderRadius.all(radius.sm), + child: Container( + padding: EdgeInsets.symmetric(horizontal: spacing.sm, vertical: spacing.xs + spacing.xxs), + clipBehavior: Clip.antiAlias, + decoration: BoxDecoration( + color: colorScheme.backgroundSurface, + borderRadius: BorderRadius.all(radius.sm), + ), + foregroundDecoration: BoxDecoration( + borderRadius: BorderRadius.all(radius.sm), + border: Border.all(color: colorScheme.borderDefault), + ), + child: Row( + children: [ + Container( + width: 16, + height: 16, + clipBehavior: Clip.antiAlias, + decoration: BoxDecoration( + color: color, + borderRadius: BorderRadius.all(radius.xxs), + ), + foregroundDecoration: BoxDecoration( + borderRadius: BorderRadius.all(radius.xxs), + border: Border.all( + color: colorScheme.borderDefault.withValues(alpha: 0.3), + ), + ), + ), + SizedBox(width: spacing.xs + spacing.xxs), + Expanded( + child: Text( + label, + style: textTheme.metadataDefault.copyWith( + color: colorScheme.textSecondary, + fontFamily: 'monospace', + ), + overflow: TextOverflow.ellipsis, + ), + ), + ], + ), + ), + ); + } +} + +/// A button to add a new palette entry. +class AddPaletteButton extends StatelessWidget { + const AddPaletteButton({ + super.key, + required this.onTap, + }); + + final VoidCallback onTap; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return InkWell( + onTap: onTap, + borderRadius: BorderRadius.all(radius.md), + child: Container( + padding: EdgeInsets.symmetric(vertical: spacing.sm + spacing.xxs), + clipBehavior: Clip.antiAlias, + decoration: BoxDecoration( + borderRadius: BorderRadius.all(radius.md), + ), + foregroundDecoration: BoxDecoration( + borderRadius: BorderRadius.all(radius.md), + border: Border.all(color: colorScheme.borderDefault), + ), + child: Row( + mainAxisAlignment: MainAxisAlignment.center, + children: [ + Icon(Icons.add, color: colorScheme.accentPrimary, size: 16), + SizedBox(width: spacing.xs + spacing.xxs), + Text( + 'Add Palette Entry', + style: textTheme.captionDefault.copyWith( + color: colorScheme.accentPrimary, + ), + ), + ], + ), + ), + ); + } +} diff --git a/apps/design_system_gallery/lib/widgets/theme_studio/color_picker_tile.dart b/apps/design_system_gallery/lib/widgets/theme_studio/color_picker_tile.dart new file mode 100644 index 0000000..a39d75a --- /dev/null +++ b/apps/design_system_gallery/lib/widgets/theme_studio/color_picker_tile.dart @@ -0,0 +1,128 @@ +import 'package:flutter/material.dart'; +import 'package:flutter_colorpicker/flutter_colorpicker.dart'; +import 'package:stream_core_flutter/stream_core_flutter.dart'; + +/// A tile that displays a color and opens a color picker when tapped. +class ColorPickerTile extends StatelessWidget { + const ColorPickerTile({ + super.key, + required this.label, + required this.color, + required this.onColorChanged, + }); + + final String label; + final Color color; + final ValueChanged onColorChanged; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final boxShadow = context.streamBoxShadow; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Padding( + padding: EdgeInsets.only(bottom: spacing.xs + spacing.xxs), + child: InkWell( + onTap: () => _showColorPicker(context), + borderRadius: BorderRadius.all(radius.sm), + child: Container( + padding: EdgeInsets.symmetric(horizontal: spacing.sm + spacing.xxs, vertical: spacing.sm), + clipBehavior: Clip.antiAlias, + decoration: BoxDecoration( + color: colorScheme.backgroundApp, + borderRadius: BorderRadius.all(radius.sm), + ), + foregroundDecoration: BoxDecoration( + borderRadius: BorderRadius.all(radius.sm), + border: Border.all(color: colorScheme.borderDefault), + ), + child: Row( + children: [ + Container( + width: 24, + height: 24, + clipBehavior: Clip.antiAlias, + decoration: BoxDecoration( + color: color, + borderRadius: BorderRadius.all(radius.xs), + boxShadow: boxShadow.elevation1, + ), + foregroundDecoration: BoxDecoration( + borderRadius: BorderRadius.all(radius.xs), + border: Border.all( + color: colorScheme.borderDefault.withValues(alpha: 0.3), + ), + ), + ), + SizedBox(width: spacing.sm + spacing.xxs), + Expanded( + child: Text( + label, + style: textTheme.captionDefault.copyWith( + color: colorScheme.textPrimary, + fontFamily: 'monospace', + ), + ), + ), + Text( + _colorToHex(color), + style: textTheme.metadataDefault.copyWith( + color: colorScheme.textTertiary, + fontFamily: 'monospace', + ), + ), + SizedBox(width: spacing.xs + spacing.xxs), + Icon(Icons.edit, color: colorScheme.textTertiary, size: 12), + ], + ), + ), + ), + ); + } + + String _colorToHex(Color color) { + final hex = color.toARGB32().toRadixString(16).toUpperCase().padLeft(8, '0'); + return color.a < 1.0 ? '#$hex' : '#${hex.substring(2)}'; + } + + Future _showColorPicker(BuildContext context) async { + var pickerColor = color; + final textTheme = context.streamTextTheme; + + await showDialog( + context: context, + builder: (context) => AlertDialog( + title: Text( + label, + style: textTheme.bodyEmphasis.copyWith( + fontFamily: 'monospace', + ), + ), + content: SingleChildScrollView( + child: ColorPicker( + pickerColor: pickerColor, + onColorChanged: (c) => pickerColor = c, + labelTypes: const [], + pickerAreaHeightPercent: 0.8, + ), + ), + actions: [ + TextButton( + onPressed: () => Navigator.of(context).pop(), + child: const Text('Cancel'), + ), + FilledButton( + onPressed: () { + onColorChanged(pickerColor); + Navigator.of(context).pop(); + }, + child: const Text('Apply'), + ), + ], + ), + ); + } +} diff --git a/apps/design_system_gallery/lib/widgets/theme_studio/mode_button.dart b/apps/design_system_gallery/lib/widgets/theme_studio/mode_button.dart new file mode 100644 index 0000000..f3a2fd5 --- /dev/null +++ b/apps/design_system_gallery/lib/widgets/theme_studio/mode_button.dart @@ -0,0 +1,66 @@ +import 'package:flutter/material.dart'; +import 'package:stream_core_flutter/stream_core_flutter.dart'; + +/// A button for selecting light or dark mode in the theme studio. +class ThemeStudioModeButton extends StatelessWidget { + const ThemeStudioModeButton({ + super.key, + required this.label, + required this.icon, + required this.isSelected, + required this.onTap, + }); + + final String label; + final IconData icon; + final bool isSelected; + final VoidCallback onTap; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Material( + color: isSelected ? colorScheme.accentPrimary.withValues(alpha: 0.1) : colorScheme.backgroundApp, + borderRadius: BorderRadius.all(radius.md), + child: InkWell( + onTap: onTap, + borderRadius: BorderRadius.all(radius.md), + child: Container( + padding: EdgeInsets.symmetric(vertical: spacing.sm + spacing.xxs, horizontal: spacing.sm), + clipBehavior: Clip.antiAlias, + decoration: BoxDecoration( + borderRadius: BorderRadius.all(radius.md), + ), + foregroundDecoration: BoxDecoration( + borderRadius: BorderRadius.all(radius.md), + border: Border.all( + color: isSelected ? colorScheme.accentPrimary : colorScheme.borderDefault, + width: isSelected ? 2 : 1, + ), + ), + child: Column( + children: [ + Icon( + icon, + color: isSelected ? colorScheme.accentPrimary : colorScheme.textTertiary, + size: 20, + ), + SizedBox(height: spacing.xs), + Text( + label, + style: textTheme.captionEmphasis.copyWith( + color: isSelected ? colorScheme.accentPrimary : colorScheme.textTertiary, + fontSize: 11, + ), + ), + ], + ), + ), + ), + ); + } +} diff --git a/apps/design_system_gallery/lib/widgets/theme_studio/section_card.dart b/apps/design_system_gallery/lib/widgets/theme_studio/section_card.dart new file mode 100644 index 0000000..cf30ab9 --- /dev/null +++ b/apps/design_system_gallery/lib/widgets/theme_studio/section_card.dart @@ -0,0 +1,75 @@ +import 'package:flutter/material.dart'; +import 'package:stream_core_flutter/stream_core_flutter.dart'; + +/// A card container for theme customization sections. +/// +/// Provides consistent styling for grouping related theme controls. +class SectionCard extends StatelessWidget { + const SectionCard({ + super.key, + required this.title, + required this.subtitle, + required this.icon, + required this.child, + }); + + final String title; + final String subtitle; + final IconData icon; + final Widget child; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Container( + padding: EdgeInsets.all(spacing.sm), + clipBehavior: Clip.antiAlias, + decoration: BoxDecoration( + color: colorScheme.backgroundSurface, + borderRadius: BorderRadius.all(radius.md), + ), + foregroundDecoration: BoxDecoration( + borderRadius: BorderRadius.all(radius.md), + border: Border.all(color: colorScheme.borderDefault), + ), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + Row( + children: [ + Icon(icon, color: colorScheme.textTertiary, size: 14), + SizedBox(width: spacing.xs + spacing.xxs), + Text( + title, + style: textTheme.captionEmphasis.copyWith( + color: colorScheme.textPrimary, + ), + ), + SizedBox(width: spacing.xs + spacing.xxs), + Container( + padding: EdgeInsets.symmetric(horizontal: spacing.xs, vertical: 1), + decoration: BoxDecoration( + color: colorScheme.backgroundSurfaceSubtle, + borderRadius: BorderRadius.all(radius.xs), + ), + child: Text( + subtitle, + style: textTheme.metadataDefault.copyWith( + color: colorScheme.textTertiary, + fontFamily: 'monospace', + ), + ), + ), + ], + ), + SizedBox(height: spacing.sm + spacing.xxs), + child, + ], + ), + ); + } +} diff --git a/apps/design_system_gallery/lib/widgets/theme_studio/theme_customization_panel.dart b/apps/design_system_gallery/lib/widgets/theme_studio/theme_customization_panel.dart new file mode 100644 index 0000000..942be4a --- /dev/null +++ b/apps/design_system_gallery/lib/widgets/theme_studio/theme_customization_panel.dart @@ -0,0 +1,556 @@ +import 'dart:math' show Random; + +import 'package:flutter/material.dart'; +import 'package:provider/provider.dart'; +import 'package:stream_core_flutter/stream_core_flutter.dart'; + +import '../../config/theme_configuration.dart'; +import 'avatar_palette_section.dart'; +import 'color_picker_tile.dart'; +import 'mode_button.dart'; +import 'section_card.dart'; + +final _random = Random(); + +/// Generates a random avatar color pair matching StreamColors shade patterns. +/// +/// Light mode: background shade100 (~95% lightness), foreground shade800 (~35% lightness) +/// Dark mode: background shade800 (~35% lightness), foreground shade100 (~95% lightness) +StreamAvatarColorPair _generateRandomAvatarPair({required bool isDark}) { + final hue = _random.nextDouble() * 360; + const saturation = 0.7; // Vivid like StreamColors + + // Lightness values approximating StreamColors shade100 and shade800 + const lightShade = 0.92; // ~shade100 + const darkShade = 0.35; // ~shade800 + + final lightColor = HSLColor.fromAHSL(1, hue, saturation, lightShade).toColor(); + final darkColor = HSLColor.fromAHSL(1, hue, saturation, darkShade).toColor(); + + return StreamAvatarColorPair( + backgroundColor: isDark ? darkColor : lightColor, + foregroundColor: isDark ? lightColor : darkColor, + ); +} + +/// A panel widget for customizing the Stream theme. +/// +/// Organized into sections matching [StreamColorScheme] structure. +class ThemeCustomizationPanel extends StatefulWidget { + const ThemeCustomizationPanel({super.key}); + + @override + State createState() => _ThemeCustomizationPanelState(); +} + +class _ThemeCustomizationPanelState extends State { + final _scrollController = ScrollController(); + + @override + void dispose() { + _scrollController.dispose(); + super.dispose(); + } + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final spacing = context.streamSpacing; + + return Container( + decoration: BoxDecoration( + color: colorScheme.backgroundApp, + ), + foregroundDecoration: BoxDecoration( + border: .symmetric( + vertical: .new(color: colorScheme.borderDefault), + ), + ), + child: Column( + children: [ + _buildHeader(context), + Expanded( + child: Scrollbar( + controller: _scrollController, + thumbVisibility: true, + child: SingleChildScrollView( + controller: _scrollController, + padding: EdgeInsets.all(spacing.md), + child: Column( + crossAxisAlignment: CrossAxisAlignment.stretch, + children: [ + _buildAppearanceSection(context), + SizedBox(height: spacing.md), + _buildBrandSection(context), + SizedBox(height: spacing.md), + _buildAccentColorsSection(context), + SizedBox(height: spacing.md), + _buildTextColorsSection(context), + SizedBox(height: spacing.md), + _buildBackgroundColorsSection(context), + SizedBox(height: spacing.md), + _buildBorderCoreSection(context), + SizedBox(height: spacing.md), + _buildBorderUtilitySection(context), + SizedBox(height: spacing.md), + _buildStateColorsSection(context), + SizedBox(height: spacing.md), + _buildSystemColorsSection(context), + SizedBox(height: spacing.md), + _buildAvatarPaletteSection(context), + SizedBox(height: spacing.md), + ], + ), + ), + ), + ), + ], + ), + ); + } + + Widget _buildHeader(BuildContext context) { + final config = context.read(); + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Container( + padding: EdgeInsets.all(spacing.md), + decoration: BoxDecoration( + color: colorScheme.backgroundSurface, + border: Border(bottom: .new(color: colorScheme.borderDefault)), + ), + child: Row( + children: [ + Container( + padding: EdgeInsets.all(spacing.sm), + decoration: BoxDecoration( + color: colorScheme.accentPrimary.withValues(alpha: 0.1), + borderRadius: BorderRadius.all(radius.md), + ), + child: Icon(Icons.tune, color: colorScheme.accentPrimary, size: 20), + ), + SizedBox(width: spacing.sm), + Expanded( + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + Text( + 'Theme Studio', + style: textTheme.bodyEmphasis.copyWith( + color: colorScheme.textPrimary, + ), + ), + Text( + 'StreamColorScheme', + style: textTheme.metadataDefault.copyWith( + color: colorScheme.textTertiary, + fontFamily: 'monospace', + ), + ), + ], + ), + ), + // Reset button + Tooltip( + message: 'Reset to defaults', + child: Material( + color: StreamColors.transparent, + borderRadius: BorderRadius.all(radius.sm), + child: InkWell( + onTap: config.resetToDefaults, + borderRadius: BorderRadius.all(radius.sm), + child: Padding( + padding: EdgeInsets.all(spacing.sm), + child: Icon( + Icons.restart_alt, + color: colorScheme.textTertiary, + size: 20, + ), + ), + ), + ), + ), + ], + ), + ); + } + + Widget _buildAppearanceSection(BuildContext context) { + final config = context.read(); + final spacing = context.streamSpacing; + + return SectionCard( + title: 'Appearance', + subtitle: 'brightness', + icon: Icons.brightness_6, + child: Row( + children: [ + Expanded( + child: ThemeStudioModeButton( + label: 'Light', + icon: Icons.light_mode, + isSelected: config.brightness == Brightness.light, + onTap: () => config.setBrightness(Brightness.light), + ), + ), + SizedBox(width: spacing.sm), + Expanded( + child: ThemeStudioModeButton( + label: 'Dark', + icon: Icons.dark_mode, + isSelected: config.brightness == Brightness.dark, + onTap: () => config.setBrightness(Brightness.dark), + ), + ), + ], + ), + ); + } + + Widget _buildBrandSection(BuildContext context) { + final config = context.read(); + return SectionCard( + title: 'Brand Color', + subtitle: 'brand', + icon: Icons.branding_watermark, + child: ColorPickerTile( + label: 'brandPrimary', + color: config.brandPrimaryColor, + onColorChanged: config.setBrandPrimaryColor, + ), + ); + } + + Widget _buildAccentColorsSection(BuildContext context) { + final config = context.read(); + return SectionCard( + title: 'Accent Colors', + subtitle: 'accent*', + icon: Icons.color_lens, + child: Column( + children: [ + ColorPickerTile( + label: 'accentPrimary', + color: config.accentPrimary, + onColorChanged: config.setAccentPrimary, + ), + ColorPickerTile( + label: 'accentSuccess', + color: config.accentSuccess, + onColorChanged: config.setAccentSuccess, + ), + ColorPickerTile( + label: 'accentWarning', + color: config.accentWarning, + onColorChanged: config.setAccentWarning, + ), + ColorPickerTile( + label: 'accentError', + color: config.accentError, + onColorChanged: config.setAccentError, + ), + ColorPickerTile( + label: 'accentNeutral', + color: config.accentNeutral, + onColorChanged: config.setAccentNeutral, + ), + ], + ), + ); + } + + Widget _buildTextColorsSection(BuildContext context) { + final config = context.read(); + return SectionCard( + title: 'Text Colors', + subtitle: 'text*', + icon: Icons.format_color_text, + child: Column( + children: [ + ColorPickerTile( + label: 'textPrimary', + color: config.textPrimary, + onColorChanged: config.setTextPrimary, + ), + ColorPickerTile( + label: 'textSecondary', + color: config.textSecondary, + onColorChanged: config.setTextSecondary, + ), + ColorPickerTile( + label: 'textTertiary', + color: config.textTertiary, + onColorChanged: config.setTextTertiary, + ), + ColorPickerTile( + label: 'textDisabled', + color: config.textDisabled, + onColorChanged: config.setTextDisabled, + ), + ColorPickerTile( + label: 'textInverse', + color: config.textInverse, + onColorChanged: config.setTextInverse, + ), + ColorPickerTile( + label: 'textLink', + color: config.textLink, + onColorChanged: config.setTextLink, + ), + ColorPickerTile( + label: 'textOnAccent', + color: config.textOnAccent, + onColorChanged: config.setTextOnAccent, + ), + ], + ), + ); + } + + Widget _buildBackgroundColorsSection(BuildContext context) { + final config = context.read(); + return SectionCard( + title: 'Background Colors', + subtitle: 'background*', + icon: Icons.format_paint, + child: Column( + children: [ + ColorPickerTile( + label: 'backgroundApp', + color: config.backgroundApp, + onColorChanged: config.setBackgroundApp, + ), + ColorPickerTile( + label: 'backgroundSurface', + color: config.backgroundSurface, + onColorChanged: config.setBackgroundSurface, + ), + ColorPickerTile( + label: 'backgroundSurfaceSubtle', + color: config.backgroundSurfaceSubtle, + onColorChanged: config.setBackgroundSurfaceSubtle, + ), + ColorPickerTile( + label: 'backgroundSurfaceStrong', + color: config.backgroundSurfaceStrong, + onColorChanged: config.setBackgroundSurfaceStrong, + ), + ColorPickerTile( + label: 'backgroundOverlay', + color: config.backgroundOverlay, + onColorChanged: config.setBackgroundOverlay, + ), + ColorPickerTile( + label: 'backgroundDisabled', + color: config.backgroundDisabled, + onColorChanged: config.setBackgroundDisabled, + ), + ], + ), + ); + } + + Widget _buildBorderCoreSection(BuildContext context) { + final config = context.read(); + return SectionCard( + title: 'Border Colors - Core', + subtitle: 'border*', + icon: Icons.border_all, + child: Column( + children: [ + ColorPickerTile( + label: 'borderDefault', + color: config.borderDefault, + onColorChanged: config.setBorderDefault, + ), + ColorPickerTile( + label: 'borderSubtle', + color: config.borderSubtle, + onColorChanged: config.setBorderSubtle, + ), + ColorPickerTile( + label: 'borderStrong', + color: config.borderStrong, + onColorChanged: config.setBorderStrong, + ), + ColorPickerTile( + label: 'borderOnDark', + color: config.borderOnDark, + onColorChanged: config.setBorderOnDark, + ), + ColorPickerTile( + label: 'borderOnAccent', + color: config.borderOnAccent, + onColorChanged: config.setBorderOnAccent, + ), + ColorPickerTile( + label: 'borderOpacity10', + color: config.borderOpacity10, + onColorChanged: config.setBorderOpacity10, + ), + ColorPickerTile( + label: 'borderOpacity25', + color: config.borderOpacity25, + onColorChanged: config.setBorderOpacity25, + ), + ], + ), + ); + } + + Widget _buildBorderUtilitySection(BuildContext context) { + final config = context.read(); + return SectionCard( + title: 'Border Colors - Utility', + subtitle: 'border*', + icon: Icons.border_style, + child: Column( + children: [ + ColorPickerTile( + label: 'borderFocus', + color: config.borderFocus, + onColorChanged: config.setBorderFocus, + ), + ColorPickerTile( + label: 'borderDisabled', + color: config.borderDisabled, + onColorChanged: config.setBorderDisabled, + ), + ColorPickerTile( + label: 'borderError', + color: config.borderError, + onColorChanged: config.setBorderError, + ), + ColorPickerTile( + label: 'borderWarning', + color: config.borderWarning, + onColorChanged: config.setBorderWarning, + ), + ColorPickerTile( + label: 'borderSuccess', + color: config.borderSuccess, + onColorChanged: config.setBorderSuccess, + ), + ColorPickerTile( + label: 'borderSelected', + color: config.borderSelected, + onColorChanged: config.setBorderSelected, + ), + ], + ), + ); + } + + Widget _buildStateColorsSection(BuildContext context) { + final config = context.read(); + return SectionCard( + title: 'State Colors', + subtitle: 'state*', + icon: Icons.touch_app, + child: Column( + children: [ + ColorPickerTile( + label: 'stateHover', + color: config.stateHover, + onColorChanged: config.setStateHover, + ), + ColorPickerTile( + label: 'statePressed', + color: config.statePressed, + onColorChanged: config.setStatePressed, + ), + ColorPickerTile( + label: 'stateSelected', + color: config.stateSelected, + onColorChanged: config.setStateSelected, + ), + ColorPickerTile( + label: 'stateFocused', + color: config.stateFocused, + onColorChanged: config.setStateFocused, + ), + ColorPickerTile( + label: 'stateDisabled', + color: config.stateDisabled, + onColorChanged: config.setStateDisabled, + ), + ], + ), + ); + } + + Widget _buildSystemColorsSection(BuildContext context) { + final config = context.read(); + return SectionCard( + title: 'System Colors', + subtitle: 'system*', + icon: Icons.settings_system_daydream, + child: Column( + children: [ + ColorPickerTile( + label: 'systemText', + color: config.systemText, + onColorChanged: config.setSystemText, + ), + ColorPickerTile( + label: 'systemScrollbar', + color: config.systemScrollbar, + onColorChanged: config.setSystemScrollbar, + ), + ], + ), + ); + } + + Widget _buildAvatarPaletteSection(BuildContext context) { + final config = context.read(); + final palette = config.avatarPalette; + final spacing = context.streamSpacing; + + return SectionCard( + title: 'Avatar Palette', + subtitle: 'avatarPalette', + icon: Icons.palette, + child: Column( + children: [ + ...List.generate(palette.length, (index) { + final pair = palette[index]; + return AvatarColorPairTile( + index: index, + pair: pair, + onBackgroundChanged: (color) { + config.updateAvatarPaletteAt( + index, + StreamAvatarColorPair( + backgroundColor: color, + foregroundColor: pair.foregroundColor, + ), + ); + }, + onForegroundChanged: (color) { + config.updateAvatarPaletteAt( + index, + StreamAvatarColorPair( + backgroundColor: pair.backgroundColor, + foregroundColor: color, + ), + ); + }, + onRemove: palette.length > 1 ? () => config.removeAvatarPaletteAt(index) : null, + ); + }), + SizedBox(height: spacing.sm), + AddPaletteButton( + onTap: () { + final isDark = config.brightness == Brightness.dark; + config.addAvatarPaletteEntry(_generateRandomAvatarPair(isDark: isDark)); + }, + ), + ], + ), + ); + } +} diff --git a/apps/design_system_gallery/lib/widgets/theme_studio/theme_studio_widgets.dart b/apps/design_system_gallery/lib/widgets/theme_studio/theme_studio_widgets.dart new file mode 100644 index 0000000..8adef0e --- /dev/null +++ b/apps/design_system_gallery/lib/widgets/theme_studio/theme_studio_widgets.dart @@ -0,0 +1,10 @@ +/// Theme Studio widgets for the design system gallery. +/// +/// This barrel file exports all theme customization-related widgets. +library; + +export 'avatar_palette_section.dart'; +export 'color_picker_tile.dart'; +export 'mode_button.dart'; +export 'section_card.dart'; +export 'theme_customization_panel.dart'; diff --git a/apps/design_system_gallery/lib/widgets/toolbar/baselines_toggle.dart b/apps/design_system_gallery/lib/widgets/toolbar/baselines_toggle.dart new file mode 100644 index 0000000..d544abc --- /dev/null +++ b/apps/design_system_gallery/lib/widgets/toolbar/baselines_toggle.dart @@ -0,0 +1,29 @@ +import 'package:flutter/material.dart'; +import 'package:flutter/rendering.dart'; + +import 'toolbar_button.dart'; + +/// Debug baselines toggle button for visualizing text baselines. +class BaselinesToggle extends StatefulWidget { + const BaselinesToggle({super.key}); + + @override + State createState() => _BaselinesToggleState(); +} + +class _BaselinesToggleState extends State { + void _toggle() { + setState(() => debugPaintBaselinesEnabled = !debugPaintBaselinesEnabled); + WidgetsBinding.instance.performReassemble(); + } + + @override + Widget build(BuildContext context) { + return ToolbarButton( + icon: Icons.format_line_spacing, + tooltip: 'Text Baselines', + isActive: debugPaintBaselinesEnabled, + onTap: _toggle, + ); + } +} diff --git a/apps/design_system_gallery/lib/widgets/toolbar/debug_paint_toggle.dart b/apps/design_system_gallery/lib/widgets/toolbar/debug_paint_toggle.dart new file mode 100644 index 0000000..e915777 --- /dev/null +++ b/apps/design_system_gallery/lib/widgets/toolbar/debug_paint_toggle.dart @@ -0,0 +1,29 @@ +import 'package:flutter/material.dart'; +import 'package:flutter/rendering.dart'; + +import 'toolbar_button.dart'; + +/// Debug paint toggle button for visualizing layout bounds. +class DebugPaintToggle extends StatefulWidget { + const DebugPaintToggle({super.key}); + + @override + State createState() => _DebugPaintToggleState(); +} + +class _DebugPaintToggleState extends State { + void _toggle() { + setState(() => debugPaintSizeEnabled = !debugPaintSizeEnabled); + WidgetsBinding.instance.performReassemble(); + } + + @override + Widget build(BuildContext context) { + return ToolbarButton( + icon: debugPaintSizeEnabled ? Icons.grid_on : Icons.grid_off, + tooltip: 'Layout Bounds', + isActive: debugPaintSizeEnabled, + onTap: _toggle, + ); + } +} diff --git a/apps/design_system_gallery/lib/widgets/toolbar/device_selector.dart b/apps/design_system_gallery/lib/widgets/toolbar/device_selector.dart new file mode 100644 index 0000000..75df3ef --- /dev/null +++ b/apps/design_system_gallery/lib/widgets/toolbar/device_selector.dart @@ -0,0 +1,76 @@ +import 'package:device_frame_plus/device_frame_plus.dart'; +import 'package:flutter/material.dart'; +import 'package:stream_core_flutter/stream_core_flutter.dart'; + +/// A dropdown selector for choosing the preview device. +class DeviceSelector extends StatelessWidget { + const DeviceSelector({ + super.key, + required this.selectedDevice, + required this.devices, + required this.onDeviceChanged, + }); + + final DeviceInfo selectedDevice; + final List devices; + final ValueChanged onDeviceChanged; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Container( + padding: EdgeInsets.symmetric(horizontal: spacing.sm), + clipBehavior: Clip.antiAlias, + decoration: BoxDecoration( + color: colorScheme.backgroundApp, + borderRadius: BorderRadius.all(radius.md), + ), + foregroundDecoration: BoxDecoration( + borderRadius: BorderRadius.all(radius.md), + border: Border.all(color: colorScheme.borderDefault), + ), + child: DropdownButtonHideUnderline( + child: DropdownButton( + value: selectedDevice, + icon: Icon( + Icons.unfold_more, + color: colorScheme.textTertiary, + size: 16, + ), + style: textTheme.captionDefault.copyWith( + color: colorScheme.textPrimary, + ), + dropdownColor: colorScheme.backgroundSurface, + items: devices.map((device) { + final isPhone = + device.name.toLowerCase().contains('iphone') || + device.name.toLowerCase().contains('phone') || + device.name.toLowerCase().contains('galaxy'); + return DropdownMenuItem( + value: device, + child: Row( + mainAxisSize: MainAxisSize.min, + children: [ + Icon( + isPhone ? Icons.phone_iphone : Icons.tablet_mac, + size: 14, + color: colorScheme.textTertiary, + ), + SizedBox(width: spacing.sm), + Text(device.name, style: textTheme.captionDefault), + ], + ), + ); + }).toList(), + onChanged: (device) { + if (device != null) onDeviceChanged(device); + }, + ), + ), + ); + } +} diff --git a/apps/design_system_gallery/lib/widgets/toolbar/platform_selector.dart b/apps/design_system_gallery/lib/widgets/toolbar/platform_selector.dart new file mode 100644 index 0000000..c7f8bc9 --- /dev/null +++ b/apps/design_system_gallery/lib/widgets/toolbar/platform_selector.dart @@ -0,0 +1,95 @@ +import 'package:flutter/material.dart'; +import 'package:stream_core_flutter/stream_core_flutter.dart'; + +/// A dropdown selector for choosing the target platform override. +/// +/// Displays the current platform with an icon and allows the user to switch +/// between system default, Android, iOS, macOS, Windows, and Linux. +class PlatformSelector extends StatelessWidget { + const PlatformSelector({ + super.key, + required this.value, + required this.options, + required this.onChanged, + }); + + final TargetPlatform? value; + final List options; + final ValueChanged onChanged; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Container( + padding: EdgeInsets.symmetric(horizontal: spacing.sm), + clipBehavior: Clip.antiAlias, + decoration: BoxDecoration( + color: colorScheme.backgroundApp, + borderRadius: BorderRadius.all(radius.md), + ), + foregroundDecoration: BoxDecoration( + borderRadius: BorderRadius.all(radius.md), + border: Border.all(color: colorScheme.borderDefault), + ), + child: DropdownButtonHideUnderline( + child: DropdownButton( + value: value, + icon: Icon( + Icons.unfold_more, + color: colorScheme.textTertiary, + size: 16, + ), + style: textTheme.captionDefault.copyWith( + color: colorScheme.textPrimary, + ), + dropdownColor: colorScheme.backgroundSurface, + items: options.map((platform) { + return DropdownMenuItem( + value: platform, + child: Row( + mainAxisSize: MainAxisSize.min, + children: [ + Icon( + _iconFor(platform), + size: 14, + color: colorScheme.textTertiary, + ), + SizedBox(width: spacing.sm), + Text( + _labelFor(platform), + style: textTheme.captionDefault, + ), + ], + ), + ); + }).toList(), + onChanged: onChanged, + ), + ), + ); + } + + static String _labelFor(TargetPlatform? platform) => switch (platform) { + null => 'System', + TargetPlatform.android => 'Android', + TargetPlatform.iOS => 'iOS', + TargetPlatform.macOS => 'macOS', + TargetPlatform.windows => 'Windows', + TargetPlatform.linux => 'Linux', + TargetPlatform.fuchsia => 'Fuchsia', + }; + + static IconData _iconFor(TargetPlatform? platform) => switch (platform) { + null => Icons.settings_suggest, + TargetPlatform.android => Icons.android, + TargetPlatform.iOS => Icons.phone_iphone, + TargetPlatform.macOS => Icons.laptop_mac, + TargetPlatform.windows => Icons.desktop_windows, + TargetPlatform.linux => Icons.terminal, + TargetPlatform.fuchsia => Icons.all_inclusive, + }; +} diff --git a/apps/design_system_gallery/lib/widgets/toolbar/text_direction_selector.dart b/apps/design_system_gallery/lib/widgets/toolbar/text_direction_selector.dart new file mode 100644 index 0000000..5dc8b41 --- /dev/null +++ b/apps/design_system_gallery/lib/widgets/toolbar/text_direction_selector.dart @@ -0,0 +1,75 @@ +import 'package:flutter/material.dart'; +import 'package:stream_core_flutter/stream_core_flutter.dart'; + +/// A dropdown selector for choosing the text direction (LTR/RTL). +class TextDirectionSelector extends StatelessWidget { + const TextDirectionSelector({ + super.key, + required this.value, + required this.options, + required this.onChanged, + }); + + final TextDirection value; + final List options; + final ValueChanged onChanged; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Container( + padding: EdgeInsets.symmetric(horizontal: spacing.sm), + clipBehavior: Clip.antiAlias, + decoration: BoxDecoration( + color: colorScheme.backgroundApp, + borderRadius: BorderRadius.all(radius.md), + ), + foregroundDecoration: BoxDecoration( + borderRadius: BorderRadius.all(radius.md), + border: Border.all(color: colorScheme.borderDefault), + ), + child: DropdownButtonHideUnderline( + child: DropdownButton( + value: value, + icon: Icon( + Icons.unfold_more, + color: colorScheme.textTertiary, + size: 16, + ), + style: textTheme.captionDefault.copyWith( + color: colorScheme.textPrimary, + ), + dropdownColor: colorScheme.backgroundSurface, + items: options.map((direction) { + final isLtr = direction == TextDirection.ltr; + return DropdownMenuItem( + value: direction, + child: Row( + mainAxisSize: MainAxisSize.min, + children: [ + Icon( + isLtr ? Icons.format_textdirection_l_to_r : Icons.format_textdirection_r_to_l, + size: 14, + color: colorScheme.textTertiary, + ), + SizedBox(width: spacing.sm), + Text( + isLtr ? 'LTR' : 'RTL', + style: textTheme.captionDefault, + ), + ], + ), + ); + }).toList(), + onChanged: (direction) { + if (direction != null) onChanged(direction); + }, + ), + ), + ); + } +} diff --git a/apps/design_system_gallery/lib/widgets/toolbar/text_scale_selector.dart b/apps/design_system_gallery/lib/widgets/toolbar/text_scale_selector.dart new file mode 100644 index 0000000..0aece50 --- /dev/null +++ b/apps/design_system_gallery/lib/widgets/toolbar/text_scale_selector.dart @@ -0,0 +1,74 @@ +import 'package:flutter/material.dart'; +import 'package:stream_core_flutter/stream_core_flutter.dart'; + +/// A dropdown selector for choosing the text scale factor. +class TextScaleSelector extends StatelessWidget { + const TextScaleSelector({ + super.key, + required this.value, + required this.options, + required this.onChanged, + }); + + final double value; + final List options; + final ValueChanged onChanged; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Container( + padding: EdgeInsets.symmetric(horizontal: spacing.sm), + clipBehavior: Clip.antiAlias, + decoration: BoxDecoration( + color: colorScheme.backgroundApp, + borderRadius: BorderRadius.all(radius.md), + ), + foregroundDecoration: BoxDecoration( + borderRadius: BorderRadius.all(radius.md), + border: Border.all(color: colorScheme.borderDefault), + ), + child: DropdownButtonHideUnderline( + child: DropdownButton( + value: value, + icon: Icon( + Icons.unfold_more, + color: colorScheme.textTertiary, + size: 16, + ), + style: textTheme.captionDefault.copyWith( + color: colorScheme.textPrimary, + ), + dropdownColor: colorScheme.backgroundSurface, + items: options.map((scale) { + return DropdownMenuItem( + value: scale, + child: Row( + mainAxisSize: MainAxisSize.min, + children: [ + Icon( + Icons.text_fields, + size: 14, + color: colorScheme.textTertiary, + ), + SizedBox(width: spacing.sm), + Text( + '${(scale * 100).toInt()}%', + style: textTheme.captionDefault, + ), + ], + ), + ); + }).toList(), + onChanged: (scale) { + if (scale != null) onChanged(scale); + }, + ), + ), + ); + } +} diff --git a/apps/design_system_gallery/lib/widgets/toolbar/theme_mode_toggle.dart b/apps/design_system_gallery/lib/widgets/toolbar/theme_mode_toggle.dart new file mode 100644 index 0000000..084386d --- /dev/null +++ b/apps/design_system_gallery/lib/widgets/toolbar/theme_mode_toggle.dart @@ -0,0 +1,92 @@ +import 'package:flutter/material.dart'; +import 'package:stream_core_flutter/stream_core_flutter.dart'; + +/// A toggle button for switching between light and dark theme modes. +class ThemeModeToggle extends StatelessWidget { + const ThemeModeToggle({ + super.key, + required this.isDark, + required this.onLightTap, + required this.onDarkTap, + }); + + final bool isDark; + final VoidCallback onLightTap; + final VoidCallback onDarkTap; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final radius = context.streamRadius; + + return Container( + clipBehavior: Clip.antiAlias, + decoration: BoxDecoration( + color: colorScheme.backgroundApp, + borderRadius: BorderRadius.all(radius.md), + ), + foregroundDecoration: BoxDecoration( + borderRadius: BorderRadius.all(radius.md), + border: Border.all(color: colorScheme.borderDefault), + ), + child: Row( + mainAxisSize: MainAxisSize.min, + children: [ + _ModeButton( + icon: Icons.light_mode, + isSelected: !isDark, + onTap: onLightTap, + borderRadius: BorderRadius.horizontal(left: Radius.circular(radius.md.x - 1)), + ), + ColoredBox( + color: colorScheme.borderDefault, + child: const SizedBox(width: 1, height: 28), + ), + _ModeButton( + icon: Icons.dark_mode, + isSelected: isDark, + onTap: onDarkTap, + borderRadius: BorderRadius.horizontal(right: Radius.circular(radius.md.x - 1)), + ), + ], + ), + ); + } +} + +class _ModeButton extends StatelessWidget { + const _ModeButton({ + required this.icon, + required this.isSelected, + required this.onTap, + required this.borderRadius, + }); + + final IconData icon; + final bool isSelected; + final VoidCallback onTap; + final BorderRadius borderRadius; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final spacing = context.streamSpacing; + + return Material( + color: isSelected ? colorScheme.accentPrimary.withValues(alpha: 0.1) : StreamColors.transparent, + borderRadius: borderRadius, + child: InkWell( + onTap: onTap, + borderRadius: borderRadius, + child: Padding( + padding: EdgeInsets.all(spacing.sm + spacing.xxs), + child: Icon( + icon, + size: 18, + color: isSelected ? colorScheme.accentPrimary : colorScheme.textTertiary, + ), + ), + ), + ); + } +} diff --git a/apps/design_system_gallery/lib/widgets/toolbar/toolbar.dart b/apps/design_system_gallery/lib/widgets/toolbar/toolbar.dart new file mode 100644 index 0000000..564f660 --- /dev/null +++ b/apps/design_system_gallery/lib/widgets/toolbar/toolbar.dart @@ -0,0 +1,174 @@ +import 'package:flutter/foundation.dart'; +import 'package:flutter/material.dart'; +import 'package:provider/provider.dart'; +import 'package:stream_core_flutter/stream_core_flutter.dart'; +import 'package:svg_icon_widget/svg_icon_widget.dart'; + +import '../../config/preview_configuration.dart'; +import '../../config/theme_configuration.dart'; +import '../../core/stream_icons.dart'; +import 'baselines_toggle.dart'; +import 'debug_paint_toggle.dart'; +import 'device_selector.dart'; +import 'platform_selector.dart'; +import 'text_direction_selector.dart'; +import 'text_scale_selector.dart'; +import 'theme_mode_toggle.dart'; +import 'toolbar_button.dart'; +import 'widget_select_toggle.dart'; + +/// The main toolbar for the design system gallery. +/// +/// Contains branding, device controls, and theme controls. +class GalleryToolbar extends StatelessWidget { + const GalleryToolbar({ + super.key, + required this.showThemePanel, + required this.onToggleThemePanel, + }); + + final bool showThemePanel; + final VoidCallback onToggleThemePanel; + + @override + Widget build(BuildContext context) { + // Use read (not watch) - rebuilds come from Consumer in gallery_app.dart + final themeConfig = context.read(); + final previewConfig = context.watch(); + final colorScheme = context.streamColorScheme; + final spacing = context.streamSpacing; + final isDark = Theme.of(context).brightness == Brightness.dark; + + return Container( + height: 64, + padding: EdgeInsets.symmetric(horizontal: spacing.md), + decoration: BoxDecoration( + color: colorScheme.backgroundSurface, + border: Border( + bottom: BorderSide(color: colorScheme.borderDefault), + ), + ), + child: Row( + children: [ + // Stream Logo and title + const _StreamBranding(), + SizedBox(width: spacing.lg), + + // Toolbar controls - wrapped in Expanded to prevent overflow + Expanded( + child: SingleChildScrollView( + scrollDirection: Axis.horizontal, + child: Row( + spacing: spacing.sm, + mainAxisSize: MainAxisSize.min, + children: [ + // Device frame toggle + ToolbarButton( + icon: previewConfig.showDeviceFrame ? Icons.devices : Icons.phone_android, + tooltip: 'Device Frame', + isActive: previewConfig.showDeviceFrame, + onTap: previewConfig.toggleDeviceFrame, + ), + + // Device frame options + if (previewConfig.showDeviceFrame) + DeviceSelector( + selectedDevice: previewConfig.selectedDevice, + devices: PreviewConfiguration.deviceOptions, + onDeviceChanged: previewConfig.setDevice, + ), + + // Text scale selector + TextScaleSelector( + value: previewConfig.textScale, + options: PreviewConfiguration.textScaleOptions, + onChanged: previewConfig.setTextScale, + ), + + // Text direction selector (LTR/RTL) + TextDirectionSelector( + value: previewConfig.textDirection, + options: PreviewConfiguration.textDirectionOptions, + onChanged: previewConfig.setTextDirection, + ), + + // Platform override selector + PlatformSelector( + value: previewConfig.targetPlatform, + options: PreviewConfiguration.platformOptions, + onChanged: previewConfig.setTargetPlatform, + ), + + // Debug tools (debug mode only) + if (kDebugMode) ...[ + const DebugPaintToggle(), + const BaselinesToggle(), + const WidgetSelectToggle(), + ], + ], + ), + ), + ), + + SizedBox(width: spacing.md), + + // Theme mode toggle + ThemeModeToggle( + isDark: isDark, + onLightTap: () => themeConfig.setBrightness(Brightness.light), + onDarkTap: () => themeConfig.setBrightness(Brightness.dark), + ), + SizedBox(width: spacing.sm), + + // Theme panel toggle + ToolbarButton( + icon: showThemePanel ? Icons.palette : Icons.palette_outlined, + tooltip: 'Theme Studio', + isActive: showThemePanel, + onTap: onToggleThemePanel, + ), + ], + ), + ); + } +} + +// Stream branding logo and title. +class _StreamBranding extends StatelessWidget { + const _StreamBranding(); + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final textTheme = context.streamTextTheme; + final spacing = context.streamSpacing; + + return Row( + mainAxisSize: MainAxisSize.min, + children: [ + // Stream Logo + const SvgIcon(StreamSvgIcons.logo, size: 40), + SizedBox(width: spacing.sm + spacing.xxs), + Column( + mainAxisAlignment: MainAxisAlignment.center, + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + Text( + 'Stream', + style: textTheme.headingSm.copyWith( + color: colorScheme.textPrimary, + letterSpacing: -0.5, + ), + ), + Text( + 'Design System', + style: textTheme.captionDefault.copyWith( + color: colorScheme.textTertiary, + ), + ), + ], + ), + ], + ); + } +} diff --git a/apps/design_system_gallery/lib/widgets/toolbar/toolbar_button.dart b/apps/design_system_gallery/lib/widgets/toolbar/toolbar_button.dart new file mode 100644 index 0000000..da8947d --- /dev/null +++ b/apps/design_system_gallery/lib/widgets/toolbar/toolbar_button.dart @@ -0,0 +1,55 @@ +import 'package:flutter/material.dart'; +import 'package:stream_core_flutter/stream_core_flutter.dart'; + +/// A reusable toolbar button with icon and tooltip. +class ToolbarButton extends StatelessWidget { + const ToolbarButton({ + super.key, + required this.icon, + required this.tooltip, + required this.isActive, + required this.onTap, + }); + + final IconData icon; + final String tooltip; + final bool isActive; + final VoidCallback onTap; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + final radius = context.streamRadius; + final spacing = context.streamSpacing; + + return Tooltip( + message: tooltip, + child: Material( + color: isActive ? colorScheme.accentPrimary.withValues(alpha: 0.1) : colorScheme.backgroundApp, + borderRadius: BorderRadius.all(radius.md), + child: InkWell( + onTap: onTap, + borderRadius: BorderRadius.all(radius.md), + child: Container( + padding: EdgeInsets.all(spacing.sm + spacing.xxs), + clipBehavior: Clip.antiAlias, + decoration: BoxDecoration( + borderRadius: BorderRadius.all(radius.md), + ), + foregroundDecoration: BoxDecoration( + borderRadius: BorderRadius.all(radius.md), + border: Border.all( + color: isActive ? colorScheme.accentPrimary : colorScheme.borderDefault, + ), + ), + child: Icon( + icon, + size: 20, + color: isActive ? colorScheme.accentPrimary : colorScheme.textSecondary, + ), + ), + ), + ), + ); + } +} diff --git a/apps/design_system_gallery/lib/widgets/toolbar/widget_select_toggle.dart b/apps/design_system_gallery/lib/widgets/toolbar/widget_select_toggle.dart new file mode 100644 index 0000000..ffda5b5 --- /dev/null +++ b/apps/design_system_gallery/lib/widgets/toolbar/widget_select_toggle.dart @@ -0,0 +1,25 @@ +import 'package:flutter/material.dart'; + +import 'toolbar_button.dart'; + +/// Widget select mode toggle for inspecting widgets in the preview. +class WidgetSelectToggle extends StatelessWidget { + const WidgetSelectToggle({super.key}); + + @override + Widget build(BuildContext context) { + final notifier = WidgetsBinding.instance.debugShowWidgetInspectorOverrideNotifier; + + return ValueListenableBuilder( + valueListenable: notifier, + builder: (context, isActive, _) { + return ToolbarButton( + icon: Icons.ads_click, + tooltip: 'Select Widget', + isActive: isActive, + onTap: () => notifier.value = !isActive, + ); + }, + ); + } +} diff --git a/apps/design_system_gallery/macos/Flutter/Flutter-Debug.xcconfig b/apps/design_system_gallery/macos/Flutter/Flutter-Debug.xcconfig new file mode 100644 index 0000000..4b81f9b --- /dev/null +++ b/apps/design_system_gallery/macos/Flutter/Flutter-Debug.xcconfig @@ -0,0 +1,2 @@ +#include? "Pods/Target Support Files/Pods-Runner/Pods-Runner.debug.xcconfig" +#include "ephemeral/Flutter-Generated.xcconfig" diff --git a/apps/design_system_gallery/macos/Flutter/Flutter-Release.xcconfig b/apps/design_system_gallery/macos/Flutter/Flutter-Release.xcconfig new file mode 100644 index 0000000..5caa9d1 --- /dev/null +++ b/apps/design_system_gallery/macos/Flutter/Flutter-Release.xcconfig @@ -0,0 +1,2 @@ +#include? "Pods/Target Support Files/Pods-Runner/Pods-Runner.release.xcconfig" +#include "ephemeral/Flutter-Generated.xcconfig" diff --git a/apps/design_system_gallery/macos/Podfile b/apps/design_system_gallery/macos/Podfile new file mode 100644 index 0000000..ff5ddb3 --- /dev/null +++ b/apps/design_system_gallery/macos/Podfile @@ -0,0 +1,42 @@ +platform :osx, '10.15' + +# CocoaPods analytics sends network stats synchronously affecting flutter build latency. +ENV['COCOAPODS_DISABLE_STATS'] = 'true' + +project 'Runner', { + 'Debug' => :debug, + 'Profile' => :release, + 'Release' => :release, +} + +def flutter_root + generated_xcode_build_settings_path = File.expand_path(File.join('..', 'Flutter', 'ephemeral', 'Flutter-Generated.xcconfig'), __FILE__) + unless File.exist?(generated_xcode_build_settings_path) + raise "#{generated_xcode_build_settings_path} must exist. If you're running pod install manually, make sure \"flutter pub get\" is executed first" + end + + File.foreach(generated_xcode_build_settings_path) do |line| + matches = line.match(/FLUTTER_ROOT\=(.*)/) + return matches[1].strip if matches + end + raise "FLUTTER_ROOT not found in #{generated_xcode_build_settings_path}. Try deleting Flutter-Generated.xcconfig, then run \"flutter pub get\"" +end + +require File.expand_path(File.join('packages', 'flutter_tools', 'bin', 'podhelper'), flutter_root) + +flutter_macos_podfile_setup + +target 'Runner' do + use_frameworks! + + flutter_install_all_macos_pods File.dirname(File.realpath(__FILE__)) + target 'RunnerTests' do + inherit! :search_paths + end +end + +post_install do |installer| + installer.pods_project.targets.each do |target| + flutter_additional_macos_build_settings(target) + end +end diff --git a/apps/design_system_gallery/macos/Runner.xcodeproj/project.pbxproj b/apps/design_system_gallery/macos/Runner.xcodeproj/project.pbxproj new file mode 100644 index 0000000..e484232 --- /dev/null +++ b/apps/design_system_gallery/macos/Runner.xcodeproj/project.pbxproj @@ -0,0 +1,801 @@ +// !$*UTF8*$! +{ + archiveVersion = 1; + classes = { + }; + objectVersion = 54; + objects = { + +/* Begin PBXAggregateTarget section */ + 33CC111A2044C6BA0003C045 /* Flutter Assemble */ = { + isa = PBXAggregateTarget; + buildConfigurationList = 33CC111B2044C6BA0003C045 /* Build configuration list for PBXAggregateTarget "Flutter Assemble" */; + buildPhases = ( + 33CC111E2044C6BF0003C045 /* ShellScript */, + ); + dependencies = ( + ); + name = "Flutter Assemble"; + productName = FLX; + }; +/* End PBXAggregateTarget section */ + +/* Begin PBXBuildFile section */ + 331C80D8294CF71000263BE5 /* RunnerTests.swift in Sources */ = {isa = PBXBuildFile; fileRef = 331C80D7294CF71000263BE5 /* RunnerTests.swift */; }; + 335BBD1B22A9A15E00E9071D /* GeneratedPluginRegistrant.swift in Sources */ = {isa = PBXBuildFile; fileRef = 335BBD1A22A9A15E00E9071D /* GeneratedPluginRegistrant.swift */; }; + 33CC10F12044A3C60003C045 /* AppDelegate.swift in Sources */ = {isa = PBXBuildFile; fileRef = 33CC10F02044A3C60003C045 /* AppDelegate.swift */; }; + 33CC10F32044A3C60003C045 /* Assets.xcassets in Resources */ = {isa = PBXBuildFile; fileRef = 33CC10F22044A3C60003C045 /* Assets.xcassets */; }; + 33CC10F62044A3C60003C045 /* MainMenu.xib in Resources */ = {isa = PBXBuildFile; fileRef = 33CC10F42044A3C60003C045 /* MainMenu.xib */; }; + 33CC11132044BFA00003C045 /* MainFlutterWindow.swift in Sources */ = {isa = PBXBuildFile; fileRef = 33CC11122044BFA00003C045 /* MainFlutterWindow.swift */; }; + 46DD458174C7774D5517212F /* Pods_RunnerTests.framework in Frameworks */ = {isa = PBXBuildFile; fileRef = 59B1E00FA3B30213D4C20AB2 /* Pods_RunnerTests.framework */; }; + 7E0E203C66EAF59B6A8F8BC4 /* Pods_Runner.framework in Frameworks */ = {isa = PBXBuildFile; fileRef = 1E0ABC705860251A4E5A52A9 /* Pods_Runner.framework */; }; +/* End PBXBuildFile section */ + +/* Begin PBXContainerItemProxy section */ + 331C80D9294CF71000263BE5 /* PBXContainerItemProxy */ = { + isa = PBXContainerItemProxy; + containerPortal = 33CC10E52044A3C60003C045 /* Project object */; + proxyType = 1; + remoteGlobalIDString = 33CC10EC2044A3C60003C045; + remoteInfo = Runner; + }; + 33CC111F2044C79F0003C045 /* PBXContainerItemProxy */ = { + isa = PBXContainerItemProxy; + containerPortal = 33CC10E52044A3C60003C045 /* Project object */; + proxyType = 1; + remoteGlobalIDString = 33CC111A2044C6BA0003C045; + remoteInfo = FLX; + }; +/* End PBXContainerItemProxy section */ + +/* Begin PBXCopyFilesBuildPhase section */ + 33CC110E2044A8840003C045 /* Bundle Framework */ = { + isa = PBXCopyFilesBuildPhase; + buildActionMask = 2147483647; + dstPath = ""; + dstSubfolderSpec = 10; + files = ( + ); + name = "Bundle Framework"; + runOnlyForDeploymentPostprocessing = 0; + }; +/* End PBXCopyFilesBuildPhase section */ + +/* Begin PBXFileReference section */ + 11C6122197A6C5AB84DBB6CD /* Pods-RunnerTests.release.xcconfig */ = {isa = PBXFileReference; includeInIndex = 1; lastKnownFileType = text.xcconfig; name = "Pods-RunnerTests.release.xcconfig"; path = "Target Support Files/Pods-RunnerTests/Pods-RunnerTests.release.xcconfig"; sourceTree = ""; }; + 1E0ABC705860251A4E5A52A9 /* Pods_Runner.framework */ = {isa = PBXFileReference; explicitFileType = wrapper.framework; includeInIndex = 0; path = Pods_Runner.framework; sourceTree = BUILT_PRODUCTS_DIR; }; + 331C80D5294CF71000263BE5 /* RunnerTests.xctest */ = {isa = PBXFileReference; explicitFileType = wrapper.cfbundle; includeInIndex = 0; path = RunnerTests.xctest; sourceTree = BUILT_PRODUCTS_DIR; }; + 331C80D7294CF71000263BE5 /* RunnerTests.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = RunnerTests.swift; sourceTree = ""; }; + 333000ED22D3DE5D00554162 /* Warnings.xcconfig */ = {isa = PBXFileReference; lastKnownFileType = text.xcconfig; path = Warnings.xcconfig; sourceTree = ""; }; + 335BBD1A22A9A15E00E9071D /* GeneratedPluginRegistrant.swift */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.swift; path = GeneratedPluginRegistrant.swift; sourceTree = ""; }; + 33CC10ED2044A3C60003C045 /* design_system_gallery.app */ = {isa = PBXFileReference; explicitFileType = wrapper.application; includeInIndex = 0; path = design_system_gallery.app; sourceTree = BUILT_PRODUCTS_DIR; }; + 33CC10F02044A3C60003C045 /* AppDelegate.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = AppDelegate.swift; sourceTree = ""; }; + 33CC10F22044A3C60003C045 /* Assets.xcassets */ = {isa = PBXFileReference; lastKnownFileType = folder.assetcatalog; name = Assets.xcassets; path = Runner/Assets.xcassets; sourceTree = ""; }; + 33CC10F52044A3C60003C045 /* Base */ = {isa = PBXFileReference; lastKnownFileType = file.xib; name = Base; path = Base.lproj/MainMenu.xib; sourceTree = ""; }; + 33CC10F72044A3C60003C045 /* Info.plist */ = {isa = PBXFileReference; lastKnownFileType = text.plist.xml; name = Info.plist; path = Runner/Info.plist; sourceTree = ""; }; + 33CC11122044BFA00003C045 /* MainFlutterWindow.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = MainFlutterWindow.swift; sourceTree = ""; }; + 33CEB47222A05771004F2AC0 /* Flutter-Debug.xcconfig */ = {isa = PBXFileReference; lastKnownFileType = text.xcconfig; path = "Flutter-Debug.xcconfig"; sourceTree = ""; }; + 33CEB47422A05771004F2AC0 /* Flutter-Release.xcconfig */ = {isa = PBXFileReference; lastKnownFileType = text.xcconfig; path = "Flutter-Release.xcconfig"; sourceTree = ""; }; + 33CEB47722A0578A004F2AC0 /* Flutter-Generated.xcconfig */ = {isa = PBXFileReference; lastKnownFileType = text.xcconfig; name = "Flutter-Generated.xcconfig"; path = "ephemeral/Flutter-Generated.xcconfig"; sourceTree = ""; }; + 33E51913231747F40026EE4D /* DebugProfile.entitlements */ = {isa = PBXFileReference; lastKnownFileType = text.plist.entitlements; path = DebugProfile.entitlements; sourceTree = ""; }; + 33E51914231749380026EE4D /* Release.entitlements */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = text.plist.entitlements; path = Release.entitlements; sourceTree = ""; }; + 33E5194F232828860026EE4D /* AppInfo.xcconfig */ = {isa = PBXFileReference; lastKnownFileType = text.xcconfig; path = AppInfo.xcconfig; sourceTree = ""; }; + 59B1E00FA3B30213D4C20AB2 /* Pods_RunnerTests.framework */ = {isa = PBXFileReference; explicitFileType = wrapper.framework; includeInIndex = 0; path = Pods_RunnerTests.framework; sourceTree = BUILT_PRODUCTS_DIR; }; + 710C45C47279046866A6B261 /* Pods-RunnerTests.debug.xcconfig */ = {isa = PBXFileReference; includeInIndex = 1; lastKnownFileType = text.xcconfig; name = "Pods-RunnerTests.debug.xcconfig"; path = "Target Support Files/Pods-RunnerTests/Pods-RunnerTests.debug.xcconfig"; sourceTree = ""; }; + 7AFA3C8E1D35360C0083082E /* Release.xcconfig */ = {isa = PBXFileReference; lastKnownFileType = text.xcconfig; path = Release.xcconfig; sourceTree = ""; }; + 7DE4CA34EE522ACFD8C08F0E /* Pods-Runner.debug.xcconfig */ = {isa = PBXFileReference; includeInIndex = 1; lastKnownFileType = text.xcconfig; name = "Pods-Runner.debug.xcconfig"; path = "Target Support Files/Pods-Runner/Pods-Runner.debug.xcconfig"; sourceTree = ""; }; + 9426CBEF606781FF2C6BFDF7 /* Pods-RunnerTests.profile.xcconfig */ = {isa = PBXFileReference; includeInIndex = 1; lastKnownFileType = text.xcconfig; name = "Pods-RunnerTests.profile.xcconfig"; path = "Target Support Files/Pods-RunnerTests/Pods-RunnerTests.profile.xcconfig"; sourceTree = ""; }; + 9740EEB21CF90195004384FC /* Debug.xcconfig */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = text.xcconfig; path = Debug.xcconfig; sourceTree = ""; }; + D958C82C1C411C825EEE4E32 /* Pods-Runner.profile.xcconfig */ = {isa = PBXFileReference; includeInIndex = 1; lastKnownFileType = text.xcconfig; name = "Pods-Runner.profile.xcconfig"; path = "Target Support Files/Pods-Runner/Pods-Runner.profile.xcconfig"; sourceTree = ""; }; + FBB6BFFBC99F201AD6E7FD7E /* Pods-Runner.release.xcconfig */ = {isa = PBXFileReference; includeInIndex = 1; lastKnownFileType = text.xcconfig; name = "Pods-Runner.release.xcconfig"; path = "Target Support Files/Pods-Runner/Pods-Runner.release.xcconfig"; sourceTree = ""; }; +/* End PBXFileReference section */ + +/* Begin PBXFrameworksBuildPhase section */ + 331C80D2294CF70F00263BE5 /* Frameworks */ = { + isa = PBXFrameworksBuildPhase; + buildActionMask = 2147483647; + files = ( + 46DD458174C7774D5517212F /* Pods_RunnerTests.framework in Frameworks */, + ); + runOnlyForDeploymentPostprocessing = 0; + }; + 33CC10EA2044A3C60003C045 /* Frameworks */ = { + isa = PBXFrameworksBuildPhase; + buildActionMask = 2147483647; + files = ( + 7E0E203C66EAF59B6A8F8BC4 /* Pods_Runner.framework in Frameworks */, + ); + runOnlyForDeploymentPostprocessing = 0; + }; +/* End PBXFrameworksBuildPhase section */ + +/* Begin PBXGroup section */ + 331C80D6294CF71000263BE5 /* RunnerTests */ = { + isa = PBXGroup; + children = ( + 331C80D7294CF71000263BE5 /* RunnerTests.swift */, + ); + path = RunnerTests; + sourceTree = ""; + }; + 33BA886A226E78AF003329D5 /* Configs */ = { + isa = PBXGroup; + children = ( + 33E5194F232828860026EE4D /* AppInfo.xcconfig */, + 9740EEB21CF90195004384FC /* Debug.xcconfig */, + 7AFA3C8E1D35360C0083082E /* Release.xcconfig */, + 333000ED22D3DE5D00554162 /* Warnings.xcconfig */, + ); + path = Configs; + sourceTree = ""; + }; + 33CC10E42044A3C60003C045 = { + isa = PBXGroup; + children = ( + 33FAB671232836740065AC1E /* Runner */, + 33CEB47122A05771004F2AC0 /* Flutter */, + 331C80D6294CF71000263BE5 /* RunnerTests */, + 33CC10EE2044A3C60003C045 /* Products */, + D73912EC22F37F3D000D13A0 /* Frameworks */, + CA5982254CCF8D36549E21CF /* Pods */, + ); + sourceTree = ""; + }; + 33CC10EE2044A3C60003C045 /* Products */ = { + isa = PBXGroup; + children = ( + 33CC10ED2044A3C60003C045 /* design_system_gallery.app */, + 331C80D5294CF71000263BE5 /* RunnerTests.xctest */, + ); + name = Products; + sourceTree = ""; + }; + 33CC11242044D66E0003C045 /* Resources */ = { + isa = PBXGroup; + children = ( + 33CC10F22044A3C60003C045 /* Assets.xcassets */, + 33CC10F42044A3C60003C045 /* MainMenu.xib */, + 33CC10F72044A3C60003C045 /* Info.plist */, + ); + name = Resources; + path = ..; + sourceTree = ""; + }; + 33CEB47122A05771004F2AC0 /* Flutter */ = { + isa = PBXGroup; + children = ( + 335BBD1A22A9A15E00E9071D /* GeneratedPluginRegistrant.swift */, + 33CEB47222A05771004F2AC0 /* Flutter-Debug.xcconfig */, + 33CEB47422A05771004F2AC0 /* Flutter-Release.xcconfig */, + 33CEB47722A0578A004F2AC0 /* Flutter-Generated.xcconfig */, + ); + path = Flutter; + sourceTree = ""; + }; + 33FAB671232836740065AC1E /* Runner */ = { + isa = PBXGroup; + children = ( + 33CC10F02044A3C60003C045 /* AppDelegate.swift */, + 33CC11122044BFA00003C045 /* MainFlutterWindow.swift */, + 33E51913231747F40026EE4D /* DebugProfile.entitlements */, + 33E51914231749380026EE4D /* Release.entitlements */, + 33CC11242044D66E0003C045 /* Resources */, + 33BA886A226E78AF003329D5 /* Configs */, + ); + path = Runner; + sourceTree = ""; + }; + CA5982254CCF8D36549E21CF /* Pods */ = { + isa = PBXGroup; + children = ( + 7DE4CA34EE522ACFD8C08F0E /* Pods-Runner.debug.xcconfig */, + FBB6BFFBC99F201AD6E7FD7E /* Pods-Runner.release.xcconfig */, + D958C82C1C411C825EEE4E32 /* Pods-Runner.profile.xcconfig */, + 710C45C47279046866A6B261 /* Pods-RunnerTests.debug.xcconfig */, + 11C6122197A6C5AB84DBB6CD /* Pods-RunnerTests.release.xcconfig */, + 9426CBEF606781FF2C6BFDF7 /* Pods-RunnerTests.profile.xcconfig */, + ); + name = Pods; + path = Pods; + sourceTree = ""; + }; + D73912EC22F37F3D000D13A0 /* Frameworks */ = { + isa = PBXGroup; + children = ( + 1E0ABC705860251A4E5A52A9 /* Pods_Runner.framework */, + 59B1E00FA3B30213D4C20AB2 /* Pods_RunnerTests.framework */, + ); + name = Frameworks; + sourceTree = ""; + }; +/* End PBXGroup section */ + +/* Begin PBXNativeTarget section */ + 331C80D4294CF70F00263BE5 /* RunnerTests */ = { + isa = PBXNativeTarget; + buildConfigurationList = 331C80DE294CF71000263BE5 /* Build configuration list for PBXNativeTarget "RunnerTests" */; + buildPhases = ( + 5B905A75D4B2F813B57C0902 /* [CP] Check Pods Manifest.lock */, + 331C80D1294CF70F00263BE5 /* Sources */, + 331C80D2294CF70F00263BE5 /* Frameworks */, + 331C80D3294CF70F00263BE5 /* Resources */, + ); + buildRules = ( + ); + dependencies = ( + 331C80DA294CF71000263BE5 /* PBXTargetDependency */, + ); + name = RunnerTests; + productName = RunnerTests; + productReference = 331C80D5294CF71000263BE5 /* RunnerTests.xctest */; + productType = "com.apple.product-type.bundle.unit-test"; + }; + 33CC10EC2044A3C60003C045 /* Runner */ = { + isa = PBXNativeTarget; + buildConfigurationList = 33CC10FB2044A3C60003C045 /* Build configuration list for PBXNativeTarget "Runner" */; + buildPhases = ( + 1EDB2D5DDC187E3C9DEBE26A /* [CP] Check Pods Manifest.lock */, + 33CC10E92044A3C60003C045 /* Sources */, + 33CC10EA2044A3C60003C045 /* Frameworks */, + 33CC10EB2044A3C60003C045 /* Resources */, + 33CC110E2044A8840003C045 /* Bundle Framework */, + 3399D490228B24CF009A79C7 /* ShellScript */, + 12F31F9AA969464C3B9CAF4E /* [CP] Embed Pods Frameworks */, + ); + buildRules = ( + ); + dependencies = ( + 33CC11202044C79F0003C045 /* PBXTargetDependency */, + ); + name = Runner; + productName = Runner; + productReference = 33CC10ED2044A3C60003C045 /* design_system_gallery.app */; + productType = "com.apple.product-type.application"; + }; +/* End PBXNativeTarget section */ + +/* Begin PBXProject section */ + 33CC10E52044A3C60003C045 /* Project object */ = { + isa = PBXProject; + attributes = { + BuildIndependentTargetsInParallel = YES; + LastSwiftUpdateCheck = 0920; + LastUpgradeCheck = 1510; + ORGANIZATIONNAME = ""; + TargetAttributes = { + 331C80D4294CF70F00263BE5 = { + CreatedOnToolsVersion = 14.0; + TestTargetID = 33CC10EC2044A3C60003C045; + }; + 33CC10EC2044A3C60003C045 = { + CreatedOnToolsVersion = 9.2; + LastSwiftMigration = 1100; + ProvisioningStyle = Automatic; + SystemCapabilities = { + com.apple.Sandbox = { + enabled = 1; + }; + }; + }; + 33CC111A2044C6BA0003C045 = { + CreatedOnToolsVersion = 9.2; + ProvisioningStyle = Manual; + }; + }; + }; + buildConfigurationList = 33CC10E82044A3C60003C045 /* Build configuration list for PBXProject "Runner" */; + compatibilityVersion = "Xcode 9.3"; + developmentRegion = en; + hasScannedForEncodings = 0; + knownRegions = ( + en, + Base, + ); + mainGroup = 33CC10E42044A3C60003C045; + productRefGroup = 33CC10EE2044A3C60003C045 /* Products */; + projectDirPath = ""; + projectRoot = ""; + targets = ( + 33CC10EC2044A3C60003C045 /* Runner */, + 331C80D4294CF70F00263BE5 /* RunnerTests */, + 33CC111A2044C6BA0003C045 /* Flutter Assemble */, + ); + }; +/* End PBXProject section */ + +/* Begin PBXResourcesBuildPhase section */ + 331C80D3294CF70F00263BE5 /* Resources */ = { + isa = PBXResourcesBuildPhase; + buildActionMask = 2147483647; + files = ( + ); + runOnlyForDeploymentPostprocessing = 0; + }; + 33CC10EB2044A3C60003C045 /* Resources */ = { + isa = PBXResourcesBuildPhase; + buildActionMask = 2147483647; + files = ( + 33CC10F32044A3C60003C045 /* Assets.xcassets in Resources */, + 33CC10F62044A3C60003C045 /* MainMenu.xib in Resources */, + ); + runOnlyForDeploymentPostprocessing = 0; + }; +/* End PBXResourcesBuildPhase section */ + +/* Begin PBXShellScriptBuildPhase section */ + 12F31F9AA969464C3B9CAF4E /* [CP] Embed Pods Frameworks */ = { + isa = PBXShellScriptBuildPhase; + buildActionMask = 2147483647; + files = ( + ); + inputFileListPaths = ( + "${PODS_ROOT}/Target Support Files/Pods-Runner/Pods-Runner-frameworks-${CONFIGURATION}-input-files.xcfilelist", + ); + name = "[CP] Embed Pods Frameworks"; + outputFileListPaths = ( + "${PODS_ROOT}/Target Support Files/Pods-Runner/Pods-Runner-frameworks-${CONFIGURATION}-output-files.xcfilelist", + ); + runOnlyForDeploymentPostprocessing = 0; + shellPath = /bin/sh; + shellScript = "\"${PODS_ROOT}/Target Support Files/Pods-Runner/Pods-Runner-frameworks.sh\"\n"; + showEnvVarsInLog = 0; + }; + 1EDB2D5DDC187E3C9DEBE26A /* [CP] Check Pods Manifest.lock */ = { + isa = PBXShellScriptBuildPhase; + buildActionMask = 2147483647; + files = ( + ); + inputFileListPaths = ( + ); + inputPaths = ( + "${PODS_PODFILE_DIR_PATH}/Podfile.lock", + "${PODS_ROOT}/Manifest.lock", + ); + name = "[CP] Check Pods Manifest.lock"; + outputFileListPaths = ( + ); + outputPaths = ( + "$(DERIVED_FILE_DIR)/Pods-Runner-checkManifestLockResult.txt", + ); + runOnlyForDeploymentPostprocessing = 0; + shellPath = /bin/sh; + shellScript = "diff \"${PODS_PODFILE_DIR_PATH}/Podfile.lock\" \"${PODS_ROOT}/Manifest.lock\" > /dev/null\nif [ $? != 0 ] ; then\n # print error to STDERR\n echo \"error: The sandbox is not in sync with the Podfile.lock. Run 'pod install' or update your CocoaPods installation.\" >&2\n exit 1\nfi\n# This output is used by Xcode 'outputs' to avoid re-running this script phase.\necho \"SUCCESS\" > \"${SCRIPT_OUTPUT_FILE_0}\"\n"; + showEnvVarsInLog = 0; + }; + 3399D490228B24CF009A79C7 /* ShellScript */ = { + isa = PBXShellScriptBuildPhase; + alwaysOutOfDate = 1; + buildActionMask = 2147483647; + files = ( + ); + inputFileListPaths = ( + ); + inputPaths = ( + ); + outputFileListPaths = ( + ); + outputPaths = ( + ); + runOnlyForDeploymentPostprocessing = 0; + shellPath = /bin/sh; + shellScript = "echo \"$PRODUCT_NAME.app\" > \"$PROJECT_DIR\"/Flutter/ephemeral/.app_filename && \"$FLUTTER_ROOT\"/packages/flutter_tools/bin/macos_assemble.sh embed\n"; + }; + 33CC111E2044C6BF0003C045 /* ShellScript */ = { + isa = PBXShellScriptBuildPhase; + buildActionMask = 2147483647; + files = ( + ); + inputFileListPaths = ( + Flutter/ephemeral/FlutterInputs.xcfilelist, + ); + inputPaths = ( + Flutter/ephemeral/tripwire, + ); + outputFileListPaths = ( + Flutter/ephemeral/FlutterOutputs.xcfilelist, + ); + outputPaths = ( + ); + runOnlyForDeploymentPostprocessing = 0; + shellPath = /bin/sh; + shellScript = "\"$FLUTTER_ROOT\"/packages/flutter_tools/bin/macos_assemble.sh && touch Flutter/ephemeral/tripwire"; + }; + 5B905A75D4B2F813B57C0902 /* [CP] Check Pods Manifest.lock */ = { + isa = PBXShellScriptBuildPhase; + buildActionMask = 2147483647; + files = ( + ); + inputFileListPaths = ( + ); + inputPaths = ( + "${PODS_PODFILE_DIR_PATH}/Podfile.lock", + "${PODS_ROOT}/Manifest.lock", + ); + name = "[CP] Check Pods Manifest.lock"; + outputFileListPaths = ( + ); + outputPaths = ( + "$(DERIVED_FILE_DIR)/Pods-RunnerTests-checkManifestLockResult.txt", + ); + runOnlyForDeploymentPostprocessing = 0; + shellPath = /bin/sh; + shellScript = "diff \"${PODS_PODFILE_DIR_PATH}/Podfile.lock\" \"${PODS_ROOT}/Manifest.lock\" > /dev/null\nif [ $? != 0 ] ; then\n # print error to STDERR\n echo \"error: The sandbox is not in sync with the Podfile.lock. Run 'pod install' or update your CocoaPods installation.\" >&2\n exit 1\nfi\n# This output is used by Xcode 'outputs' to avoid re-running this script phase.\necho \"SUCCESS\" > \"${SCRIPT_OUTPUT_FILE_0}\"\n"; + showEnvVarsInLog = 0; + }; +/* End PBXShellScriptBuildPhase section */ + +/* Begin PBXSourcesBuildPhase section */ + 331C80D1294CF70F00263BE5 /* Sources */ = { + isa = PBXSourcesBuildPhase; + buildActionMask = 2147483647; + files = ( + 331C80D8294CF71000263BE5 /* RunnerTests.swift in Sources */, + ); + runOnlyForDeploymentPostprocessing = 0; + }; + 33CC10E92044A3C60003C045 /* Sources */ = { + isa = PBXSourcesBuildPhase; + buildActionMask = 2147483647; + files = ( + 33CC11132044BFA00003C045 /* MainFlutterWindow.swift in Sources */, + 33CC10F12044A3C60003C045 /* AppDelegate.swift in Sources */, + 335BBD1B22A9A15E00E9071D /* GeneratedPluginRegistrant.swift in Sources */, + ); + runOnlyForDeploymentPostprocessing = 0; + }; +/* End PBXSourcesBuildPhase section */ + +/* Begin PBXTargetDependency section */ + 331C80DA294CF71000263BE5 /* PBXTargetDependency */ = { + isa = PBXTargetDependency; + target = 33CC10EC2044A3C60003C045 /* Runner */; + targetProxy = 331C80D9294CF71000263BE5 /* PBXContainerItemProxy */; + }; + 33CC11202044C79F0003C045 /* PBXTargetDependency */ = { + isa = PBXTargetDependency; + target = 33CC111A2044C6BA0003C045 /* Flutter Assemble */; + targetProxy = 33CC111F2044C79F0003C045 /* PBXContainerItemProxy */; + }; +/* End PBXTargetDependency section */ + +/* Begin PBXVariantGroup section */ + 33CC10F42044A3C60003C045 /* MainMenu.xib */ = { + isa = PBXVariantGroup; + children = ( + 33CC10F52044A3C60003C045 /* Base */, + ); + name = MainMenu.xib; + path = Runner; + sourceTree = ""; + }; +/* End PBXVariantGroup section */ + +/* Begin XCBuildConfiguration section */ + 331C80DB294CF71000263BE5 /* Debug */ = { + isa = XCBuildConfiguration; + baseConfigurationReference = 710C45C47279046866A6B261 /* Pods-RunnerTests.debug.xcconfig */; + buildSettings = { + BUNDLE_LOADER = "$(TEST_HOST)"; + CURRENT_PROJECT_VERSION = 1; + GENERATE_INFOPLIST_FILE = YES; + MARKETING_VERSION = 1.0; + PRODUCT_BUNDLE_IDENTIFIER = com.example.designSystemGallery.RunnerTests; + PRODUCT_NAME = "$(TARGET_NAME)"; + SWIFT_VERSION = 5.0; + TEST_HOST = "$(BUILT_PRODUCTS_DIR)/design_system_gallery.app/$(BUNDLE_EXECUTABLE_FOLDER_PATH)/design_system_gallery"; + }; + name = Debug; + }; + 331C80DC294CF71000263BE5 /* Release */ = { + isa = XCBuildConfiguration; + baseConfigurationReference = 11C6122197A6C5AB84DBB6CD /* Pods-RunnerTests.release.xcconfig */; + buildSettings = { + BUNDLE_LOADER = "$(TEST_HOST)"; + CURRENT_PROJECT_VERSION = 1; + GENERATE_INFOPLIST_FILE = YES; + MARKETING_VERSION = 1.0; + PRODUCT_BUNDLE_IDENTIFIER = com.example.designSystemGallery.RunnerTests; + PRODUCT_NAME = "$(TARGET_NAME)"; + SWIFT_VERSION = 5.0; + TEST_HOST = "$(BUILT_PRODUCTS_DIR)/design_system_gallery.app/$(BUNDLE_EXECUTABLE_FOLDER_PATH)/design_system_gallery"; + }; + name = Release; + }; + 331C80DD294CF71000263BE5 /* Profile */ = { + isa = XCBuildConfiguration; + baseConfigurationReference = 9426CBEF606781FF2C6BFDF7 /* Pods-RunnerTests.profile.xcconfig */; + buildSettings = { + BUNDLE_LOADER = "$(TEST_HOST)"; + CURRENT_PROJECT_VERSION = 1; + GENERATE_INFOPLIST_FILE = YES; + MARKETING_VERSION = 1.0; + PRODUCT_BUNDLE_IDENTIFIER = com.example.designSystemGallery.RunnerTests; + PRODUCT_NAME = "$(TARGET_NAME)"; + SWIFT_VERSION = 5.0; + TEST_HOST = "$(BUILT_PRODUCTS_DIR)/design_system_gallery.app/$(BUNDLE_EXECUTABLE_FOLDER_PATH)/design_system_gallery"; + }; + name = Profile; + }; + 338D0CE9231458BD00FA5F75 /* Profile */ = { + isa = XCBuildConfiguration; + baseConfigurationReference = 7AFA3C8E1D35360C0083082E /* Release.xcconfig */; + buildSettings = { + ALWAYS_SEARCH_USER_PATHS = NO; + ASSETCATALOG_COMPILER_GENERATE_SWIFT_ASSET_SYMBOL_EXTENSIONS = YES; + CLANG_ANALYZER_NONNULL = YES; + CLANG_ANALYZER_NUMBER_OBJECT_CONVERSION = YES_AGGRESSIVE; + CLANG_CXX_LANGUAGE_STANDARD = "gnu++14"; + CLANG_CXX_LIBRARY = "libc++"; + CLANG_ENABLE_MODULES = YES; + CLANG_ENABLE_OBJC_ARC = YES; + CLANG_WARN_BLOCK_CAPTURE_AUTORELEASING = YES; + CLANG_WARN_BOOL_CONVERSION = YES; + CLANG_WARN_CONSTANT_CONVERSION = YES; + CLANG_WARN_DEPRECATED_OBJC_IMPLEMENTATIONS = YES; + CLANG_WARN_DIRECT_OBJC_ISA_USAGE = YES_ERROR; + CLANG_WARN_DOCUMENTATION_COMMENTS = YES; + CLANG_WARN_EMPTY_BODY = YES; + CLANG_WARN_ENUM_CONVERSION = YES; + CLANG_WARN_INFINITE_RECURSION = YES; + CLANG_WARN_INT_CONVERSION = YES; + CLANG_WARN_NON_LITERAL_NULL_CONVERSION = YES; + CLANG_WARN_OBJC_LITERAL_CONVERSION = YES; + CLANG_WARN_OBJC_ROOT_CLASS = YES_ERROR; + CLANG_WARN_RANGE_LOOP_ANALYSIS = YES; + CLANG_WARN_SUSPICIOUS_MOVE = YES; + CODE_SIGN_IDENTITY = "-"; + COPY_PHASE_STRIP = NO; + DEAD_CODE_STRIPPING = YES; + DEBUG_INFORMATION_FORMAT = "dwarf-with-dsym"; + ENABLE_NS_ASSERTIONS = NO; + ENABLE_STRICT_OBJC_MSGSEND = YES; + ENABLE_USER_SCRIPT_SANDBOXING = NO; + GCC_C_LANGUAGE_STANDARD = gnu11; + GCC_NO_COMMON_BLOCKS = YES; + GCC_WARN_64_TO_32_BIT_CONVERSION = YES; + GCC_WARN_ABOUT_RETURN_TYPE = YES_ERROR; + GCC_WARN_UNINITIALIZED_AUTOS = YES_AGGRESSIVE; + GCC_WARN_UNUSED_FUNCTION = YES; + GCC_WARN_UNUSED_VARIABLE = YES; + MACOSX_DEPLOYMENT_TARGET = 10.15; + MTL_ENABLE_DEBUG_INFO = NO; + SDKROOT = macosx; + SWIFT_COMPILATION_MODE = wholemodule; + SWIFT_OPTIMIZATION_LEVEL = "-O"; + }; + name = Profile; + }; + 338D0CEA231458BD00FA5F75 /* Profile */ = { + isa = XCBuildConfiguration; + baseConfigurationReference = 33E5194F232828860026EE4D /* AppInfo.xcconfig */; + buildSettings = { + ASSETCATALOG_COMPILER_APPICON_NAME = AppIcon; + CLANG_ENABLE_MODULES = YES; + CODE_SIGN_ENTITLEMENTS = Runner/DebugProfile.entitlements; + CODE_SIGN_STYLE = Automatic; + COMBINE_HIDPI_IMAGES = YES; + INFOPLIST_FILE = Runner/Info.plist; + LD_RUNPATH_SEARCH_PATHS = ( + "$(inherited)", + "@executable_path/../Frameworks", + ); + PROVISIONING_PROFILE_SPECIFIER = ""; + SWIFT_VERSION = 5.0; + }; + name = Profile; + }; + 338D0CEB231458BD00FA5F75 /* Profile */ = { + isa = XCBuildConfiguration; + buildSettings = { + CODE_SIGN_STYLE = Manual; + PRODUCT_NAME = "$(TARGET_NAME)"; + }; + name = Profile; + }; + 33CC10F92044A3C60003C045 /* Debug */ = { + isa = XCBuildConfiguration; + baseConfigurationReference = 9740EEB21CF90195004384FC /* Debug.xcconfig */; + buildSettings = { + ALWAYS_SEARCH_USER_PATHS = NO; + ASSETCATALOG_COMPILER_GENERATE_SWIFT_ASSET_SYMBOL_EXTENSIONS = YES; + CLANG_ANALYZER_NONNULL = YES; + CLANG_ANALYZER_NUMBER_OBJECT_CONVERSION = YES_AGGRESSIVE; + CLANG_CXX_LANGUAGE_STANDARD = "gnu++14"; + CLANG_CXX_LIBRARY = "libc++"; + CLANG_ENABLE_MODULES = YES; + CLANG_ENABLE_OBJC_ARC = YES; + CLANG_WARN_BLOCK_CAPTURE_AUTORELEASING = YES; + CLANG_WARN_BOOL_CONVERSION = YES; + CLANG_WARN_CONSTANT_CONVERSION = YES; + CLANG_WARN_DEPRECATED_OBJC_IMPLEMENTATIONS = YES; + CLANG_WARN_DIRECT_OBJC_ISA_USAGE = YES_ERROR; + CLANG_WARN_DOCUMENTATION_COMMENTS = YES; + CLANG_WARN_EMPTY_BODY = YES; + CLANG_WARN_ENUM_CONVERSION = YES; + CLANG_WARN_INFINITE_RECURSION = YES; + CLANG_WARN_INT_CONVERSION = YES; + CLANG_WARN_NON_LITERAL_NULL_CONVERSION = YES; + CLANG_WARN_OBJC_LITERAL_CONVERSION = YES; + CLANG_WARN_OBJC_ROOT_CLASS = YES_ERROR; + CLANG_WARN_RANGE_LOOP_ANALYSIS = YES; + CLANG_WARN_SUSPICIOUS_MOVE = YES; + CODE_SIGN_IDENTITY = "-"; + COPY_PHASE_STRIP = NO; + DEAD_CODE_STRIPPING = YES; + DEBUG_INFORMATION_FORMAT = dwarf; + ENABLE_STRICT_OBJC_MSGSEND = YES; + ENABLE_TESTABILITY = YES; + ENABLE_USER_SCRIPT_SANDBOXING = NO; + GCC_C_LANGUAGE_STANDARD = gnu11; + GCC_DYNAMIC_NO_PIC = NO; + GCC_NO_COMMON_BLOCKS = YES; + GCC_OPTIMIZATION_LEVEL = 0; + GCC_PREPROCESSOR_DEFINITIONS = ( + "DEBUG=1", + "$(inherited)", + ); + GCC_WARN_64_TO_32_BIT_CONVERSION = YES; + GCC_WARN_ABOUT_RETURN_TYPE = YES_ERROR; + GCC_WARN_UNINITIALIZED_AUTOS = YES_AGGRESSIVE; + GCC_WARN_UNUSED_FUNCTION = YES; + GCC_WARN_UNUSED_VARIABLE = YES; + MACOSX_DEPLOYMENT_TARGET = 10.15; + MTL_ENABLE_DEBUG_INFO = YES; + ONLY_ACTIVE_ARCH = YES; + SDKROOT = macosx; + SWIFT_ACTIVE_COMPILATION_CONDITIONS = DEBUG; + SWIFT_OPTIMIZATION_LEVEL = "-Onone"; + }; + name = Debug; + }; + 33CC10FA2044A3C60003C045 /* Release */ = { + isa = XCBuildConfiguration; + baseConfigurationReference = 7AFA3C8E1D35360C0083082E /* Release.xcconfig */; + buildSettings = { + ALWAYS_SEARCH_USER_PATHS = NO; + ASSETCATALOG_COMPILER_GENERATE_SWIFT_ASSET_SYMBOL_EXTENSIONS = YES; + CLANG_ANALYZER_NONNULL = YES; + CLANG_ANALYZER_NUMBER_OBJECT_CONVERSION = YES_AGGRESSIVE; + CLANG_CXX_LANGUAGE_STANDARD = "gnu++14"; + CLANG_CXX_LIBRARY = "libc++"; + CLANG_ENABLE_MODULES = YES; + CLANG_ENABLE_OBJC_ARC = YES; + CLANG_WARN_BLOCK_CAPTURE_AUTORELEASING = YES; + CLANG_WARN_BOOL_CONVERSION = YES; + CLANG_WARN_CONSTANT_CONVERSION = YES; + CLANG_WARN_DEPRECATED_OBJC_IMPLEMENTATIONS = YES; + CLANG_WARN_DIRECT_OBJC_ISA_USAGE = YES_ERROR; + CLANG_WARN_DOCUMENTATION_COMMENTS = YES; + CLANG_WARN_EMPTY_BODY = YES; + CLANG_WARN_ENUM_CONVERSION = YES; + CLANG_WARN_INFINITE_RECURSION = YES; + CLANG_WARN_INT_CONVERSION = YES; + CLANG_WARN_NON_LITERAL_NULL_CONVERSION = YES; + CLANG_WARN_OBJC_LITERAL_CONVERSION = YES; + CLANG_WARN_OBJC_ROOT_CLASS = YES_ERROR; + CLANG_WARN_RANGE_LOOP_ANALYSIS = YES; + CLANG_WARN_SUSPICIOUS_MOVE = YES; + CODE_SIGN_IDENTITY = "-"; + COPY_PHASE_STRIP = NO; + DEAD_CODE_STRIPPING = YES; + DEBUG_INFORMATION_FORMAT = "dwarf-with-dsym"; + ENABLE_NS_ASSERTIONS = NO; + ENABLE_STRICT_OBJC_MSGSEND = YES; + ENABLE_USER_SCRIPT_SANDBOXING = NO; + GCC_C_LANGUAGE_STANDARD = gnu11; + GCC_NO_COMMON_BLOCKS = YES; + GCC_WARN_64_TO_32_BIT_CONVERSION = YES; + GCC_WARN_ABOUT_RETURN_TYPE = YES_ERROR; + GCC_WARN_UNINITIALIZED_AUTOS = YES_AGGRESSIVE; + GCC_WARN_UNUSED_FUNCTION = YES; + GCC_WARN_UNUSED_VARIABLE = YES; + MACOSX_DEPLOYMENT_TARGET = 10.15; + MTL_ENABLE_DEBUG_INFO = NO; + SDKROOT = macosx; + SWIFT_COMPILATION_MODE = wholemodule; + SWIFT_OPTIMIZATION_LEVEL = "-O"; + }; + name = Release; + }; + 33CC10FC2044A3C60003C045 /* Debug */ = { + isa = XCBuildConfiguration; + baseConfigurationReference = 33E5194F232828860026EE4D /* AppInfo.xcconfig */; + buildSettings = { + ASSETCATALOG_COMPILER_APPICON_NAME = AppIcon; + CLANG_ENABLE_MODULES = YES; + CODE_SIGN_ENTITLEMENTS = Runner/DebugProfile.entitlements; + CODE_SIGN_STYLE = Automatic; + COMBINE_HIDPI_IMAGES = YES; + INFOPLIST_FILE = Runner/Info.plist; + LD_RUNPATH_SEARCH_PATHS = ( + "$(inherited)", + "@executable_path/../Frameworks", + ); + PROVISIONING_PROFILE_SPECIFIER = ""; + SWIFT_OPTIMIZATION_LEVEL = "-Onone"; + SWIFT_VERSION = 5.0; + }; + name = Debug; + }; + 33CC10FD2044A3C60003C045 /* Release */ = { + isa = XCBuildConfiguration; + baseConfigurationReference = 33E5194F232828860026EE4D /* AppInfo.xcconfig */; + buildSettings = { + ASSETCATALOG_COMPILER_APPICON_NAME = AppIcon; + CLANG_ENABLE_MODULES = YES; + CODE_SIGN_ENTITLEMENTS = Runner/Release.entitlements; + CODE_SIGN_STYLE = Automatic; + COMBINE_HIDPI_IMAGES = YES; + INFOPLIST_FILE = Runner/Info.plist; + LD_RUNPATH_SEARCH_PATHS = ( + "$(inherited)", + "@executable_path/../Frameworks", + ); + PROVISIONING_PROFILE_SPECIFIER = ""; + SWIFT_VERSION = 5.0; + }; + name = Release; + }; + 33CC111C2044C6BA0003C045 /* Debug */ = { + isa = XCBuildConfiguration; + buildSettings = { + CODE_SIGN_STYLE = Manual; + PRODUCT_NAME = "$(TARGET_NAME)"; + }; + name = Debug; + }; + 33CC111D2044C6BA0003C045 /* Release */ = { + isa = XCBuildConfiguration; + buildSettings = { + CODE_SIGN_STYLE = Automatic; + PRODUCT_NAME = "$(TARGET_NAME)"; + }; + name = Release; + }; +/* End XCBuildConfiguration section */ + +/* Begin XCConfigurationList section */ + 331C80DE294CF71000263BE5 /* Build configuration list for PBXNativeTarget "RunnerTests" */ = { + isa = XCConfigurationList; + buildConfigurations = ( + 331C80DB294CF71000263BE5 /* Debug */, + 331C80DC294CF71000263BE5 /* Release */, + 331C80DD294CF71000263BE5 /* Profile */, + ); + defaultConfigurationIsVisible = 0; + defaultConfigurationName = Release; + }; + 33CC10E82044A3C60003C045 /* Build configuration list for PBXProject "Runner" */ = { + isa = XCConfigurationList; + buildConfigurations = ( + 33CC10F92044A3C60003C045 /* Debug */, + 33CC10FA2044A3C60003C045 /* Release */, + 338D0CE9231458BD00FA5F75 /* Profile */, + ); + defaultConfigurationIsVisible = 0; + defaultConfigurationName = Release; + }; + 33CC10FB2044A3C60003C045 /* Build configuration list for PBXNativeTarget "Runner" */ = { + isa = XCConfigurationList; + buildConfigurations = ( + 33CC10FC2044A3C60003C045 /* Debug */, + 33CC10FD2044A3C60003C045 /* Release */, + 338D0CEA231458BD00FA5F75 /* Profile */, + ); + defaultConfigurationIsVisible = 0; + defaultConfigurationName = Release; + }; + 33CC111B2044C6BA0003C045 /* Build configuration list for PBXAggregateTarget "Flutter Assemble" */ = { + isa = XCConfigurationList; + buildConfigurations = ( + 33CC111C2044C6BA0003C045 /* Debug */, + 33CC111D2044C6BA0003C045 /* Release */, + 338D0CEB231458BD00FA5F75 /* Profile */, + ); + defaultConfigurationIsVisible = 0; + defaultConfigurationName = Release; + }; +/* End XCConfigurationList section */ + }; + rootObject = 33CC10E52044A3C60003C045 /* Project object */; +} diff --git a/apps/design_system_gallery/macos/Runner.xcodeproj/project.xcworkspace/xcshareddata/IDEWorkspaceChecks.plist b/apps/design_system_gallery/macos/Runner.xcodeproj/project.xcworkspace/xcshareddata/IDEWorkspaceChecks.plist new file mode 100644 index 0000000..18d9810 --- /dev/null +++ b/apps/design_system_gallery/macos/Runner.xcodeproj/project.xcworkspace/xcshareddata/IDEWorkspaceChecks.plist @@ -0,0 +1,8 @@ + + + + + IDEDidComputeMac32BitWarning + + + diff --git a/apps/design_system_gallery/macos/Runner.xcodeproj/xcshareddata/xcschemes/Runner.xcscheme b/apps/design_system_gallery/macos/Runner.xcodeproj/xcshareddata/xcschemes/Runner.xcscheme new file mode 100644 index 0000000..ff5c608 --- /dev/null +++ b/apps/design_system_gallery/macos/Runner.xcodeproj/xcshareddata/xcschemes/Runner.xcscheme @@ -0,0 +1,99 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/apps/design_system_gallery/macos/Runner.xcworkspace/contents.xcworkspacedata b/apps/design_system_gallery/macos/Runner.xcworkspace/contents.xcworkspacedata new file mode 100644 index 0000000..21a3cc1 --- /dev/null +++ b/apps/design_system_gallery/macos/Runner.xcworkspace/contents.xcworkspacedata @@ -0,0 +1,10 @@ + + + + + + + diff --git a/apps/design_system_gallery/macos/Runner.xcworkspace/xcshareddata/IDEWorkspaceChecks.plist b/apps/design_system_gallery/macos/Runner.xcworkspace/xcshareddata/IDEWorkspaceChecks.plist new file mode 100644 index 0000000..18d9810 --- /dev/null +++ b/apps/design_system_gallery/macos/Runner.xcworkspace/xcshareddata/IDEWorkspaceChecks.plist @@ -0,0 +1,8 @@ + + + + + IDEDidComputeMac32BitWarning + + + diff --git a/apps/design_system_gallery/macos/Runner/AppDelegate.swift b/apps/design_system_gallery/macos/Runner/AppDelegate.swift new file mode 100644 index 0000000..b3c1761 --- /dev/null +++ b/apps/design_system_gallery/macos/Runner/AppDelegate.swift @@ -0,0 +1,13 @@ +import Cocoa +import FlutterMacOS + +@main +class AppDelegate: FlutterAppDelegate { + override func applicationShouldTerminateAfterLastWindowClosed(_ sender: NSApplication) -> Bool { + return true + } + + override func applicationSupportsSecureRestorableState(_ app: NSApplication) -> Bool { + return true + } +} diff --git a/apps/design_system_gallery/macos/Runner/Assets.xcassets/AppIcon.appiconset/Contents.json b/apps/design_system_gallery/macos/Runner/Assets.xcassets/AppIcon.appiconset/Contents.json new file mode 100644 index 0000000..a2ec33f --- /dev/null +++ b/apps/design_system_gallery/macos/Runner/Assets.xcassets/AppIcon.appiconset/Contents.json @@ -0,0 +1,68 @@ +{ + "images" : [ + { + "size" : "16x16", + "idiom" : "mac", + "filename" : "app_icon_16.png", + "scale" : "1x" + }, + { + "size" : "16x16", + "idiom" : "mac", + "filename" : "app_icon_32.png", + "scale" : "2x" + }, + { + "size" : "32x32", + "idiom" : "mac", + "filename" : "app_icon_32.png", + "scale" : "1x" + }, + { + "size" : "32x32", + "idiom" : "mac", + "filename" : "app_icon_64.png", + "scale" : "2x" + }, + { + "size" : "128x128", + "idiom" : "mac", + "filename" : "app_icon_128.png", + "scale" : "1x" + }, + { + "size" : "128x128", + "idiom" : "mac", + "filename" : "app_icon_256.png", + "scale" : "2x" + }, + { + "size" : "256x256", + "idiom" : "mac", + "filename" : "app_icon_256.png", + "scale" : "1x" + }, + { + "size" : "256x256", + "idiom" : "mac", + "filename" : "app_icon_512.png", + "scale" : "2x" + }, + { + "size" : "512x512", + "idiom" : "mac", + "filename" : "app_icon_512.png", + "scale" : "1x" + }, + { + "size" : "512x512", + "idiom" : "mac", + "filename" : "app_icon_1024.png", + "scale" : "2x" + } + ], + "info" : { + "version" : 1, + "author" : "xcode" + } +} diff --git a/apps/design_system_gallery/macos/Runner/Assets.xcassets/AppIcon.appiconset/app_icon_1024.png b/apps/design_system_gallery/macos/Runner/Assets.xcassets/AppIcon.appiconset/app_icon_1024.png new file mode 100644 index 0000000..82b6f9d Binary files /dev/null and b/apps/design_system_gallery/macos/Runner/Assets.xcassets/AppIcon.appiconset/app_icon_1024.png differ diff --git a/apps/design_system_gallery/macos/Runner/Assets.xcassets/AppIcon.appiconset/app_icon_128.png b/apps/design_system_gallery/macos/Runner/Assets.xcassets/AppIcon.appiconset/app_icon_128.png new file mode 100644 index 0000000..13b35eb Binary files /dev/null and b/apps/design_system_gallery/macos/Runner/Assets.xcassets/AppIcon.appiconset/app_icon_128.png differ diff --git a/apps/design_system_gallery/macos/Runner/Assets.xcassets/AppIcon.appiconset/app_icon_16.png b/apps/design_system_gallery/macos/Runner/Assets.xcassets/AppIcon.appiconset/app_icon_16.png new file mode 100644 index 0000000..0a3f5fa Binary files /dev/null and b/apps/design_system_gallery/macos/Runner/Assets.xcassets/AppIcon.appiconset/app_icon_16.png differ diff --git a/apps/design_system_gallery/macos/Runner/Assets.xcassets/AppIcon.appiconset/app_icon_256.png b/apps/design_system_gallery/macos/Runner/Assets.xcassets/AppIcon.appiconset/app_icon_256.png new file mode 100644 index 0000000..bdb5722 Binary files /dev/null and b/apps/design_system_gallery/macos/Runner/Assets.xcassets/AppIcon.appiconset/app_icon_256.png differ diff --git a/apps/design_system_gallery/macos/Runner/Assets.xcassets/AppIcon.appiconset/app_icon_32.png b/apps/design_system_gallery/macos/Runner/Assets.xcassets/AppIcon.appiconset/app_icon_32.png new file mode 100644 index 0000000..f083318 Binary files /dev/null and b/apps/design_system_gallery/macos/Runner/Assets.xcassets/AppIcon.appiconset/app_icon_32.png differ diff --git a/apps/design_system_gallery/macos/Runner/Assets.xcassets/AppIcon.appiconset/app_icon_512.png b/apps/design_system_gallery/macos/Runner/Assets.xcassets/AppIcon.appiconset/app_icon_512.png new file mode 100644 index 0000000..326c0e7 Binary files /dev/null and b/apps/design_system_gallery/macos/Runner/Assets.xcassets/AppIcon.appiconset/app_icon_512.png differ diff --git a/apps/design_system_gallery/macos/Runner/Assets.xcassets/AppIcon.appiconset/app_icon_64.png b/apps/design_system_gallery/macos/Runner/Assets.xcassets/AppIcon.appiconset/app_icon_64.png new file mode 100644 index 0000000..2f1632c Binary files /dev/null and b/apps/design_system_gallery/macos/Runner/Assets.xcassets/AppIcon.appiconset/app_icon_64.png differ diff --git a/apps/design_system_gallery/macos/Runner/Base.lproj/MainMenu.xib b/apps/design_system_gallery/macos/Runner/Base.lproj/MainMenu.xib new file mode 100644 index 0000000..80e867a --- /dev/null +++ b/apps/design_system_gallery/macos/Runner/Base.lproj/MainMenu.xib @@ -0,0 +1,343 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/apps/design_system_gallery/macos/Runner/Configs/AppInfo.xcconfig b/apps/design_system_gallery/macos/Runner/Configs/AppInfo.xcconfig new file mode 100644 index 0000000..1583ef9 --- /dev/null +++ b/apps/design_system_gallery/macos/Runner/Configs/AppInfo.xcconfig @@ -0,0 +1,14 @@ +// Application-level settings for the Runner target. +// +// This may be replaced with something auto-generated from metadata (e.g., pubspec.yaml) in the +// future. If not, the values below would default to using the project name when this becomes a +// 'flutter create' template. + +// The application's name. By default this is also the title of the Flutter window. +PRODUCT_NAME = design_system_gallery + +// The application's bundle identifier +PRODUCT_BUNDLE_IDENTIFIER = com.example.designSystemGallery + +// The copyright displayed in application information +PRODUCT_COPYRIGHT = Copyright © 2026 com.example. All rights reserved. diff --git a/apps/design_system_gallery/macos/Runner/Configs/Debug.xcconfig b/apps/design_system_gallery/macos/Runner/Configs/Debug.xcconfig new file mode 100644 index 0000000..36b0fd9 --- /dev/null +++ b/apps/design_system_gallery/macos/Runner/Configs/Debug.xcconfig @@ -0,0 +1,2 @@ +#include "../../Flutter/Flutter-Debug.xcconfig" +#include "Warnings.xcconfig" diff --git a/apps/design_system_gallery/macos/Runner/Configs/Release.xcconfig b/apps/design_system_gallery/macos/Runner/Configs/Release.xcconfig new file mode 100644 index 0000000..dff4f49 --- /dev/null +++ b/apps/design_system_gallery/macos/Runner/Configs/Release.xcconfig @@ -0,0 +1,2 @@ +#include "../../Flutter/Flutter-Release.xcconfig" +#include "Warnings.xcconfig" diff --git a/apps/design_system_gallery/macos/Runner/Configs/Warnings.xcconfig b/apps/design_system_gallery/macos/Runner/Configs/Warnings.xcconfig new file mode 100644 index 0000000..42bcbf4 --- /dev/null +++ b/apps/design_system_gallery/macos/Runner/Configs/Warnings.xcconfig @@ -0,0 +1,13 @@ +WARNING_CFLAGS = -Wall -Wconditional-uninitialized -Wnullable-to-nonnull-conversion -Wmissing-method-return-type -Woverlength-strings +GCC_WARN_UNDECLARED_SELECTOR = YES +CLANG_UNDEFINED_BEHAVIOR_SANITIZER_NULLABILITY = YES +CLANG_WARN_UNGUARDED_AVAILABILITY = YES_AGGRESSIVE +CLANG_WARN__DUPLICATE_METHOD_MATCH = YES +CLANG_WARN_PRAGMA_PACK = YES +CLANG_WARN_STRICT_PROTOTYPES = YES +CLANG_WARN_COMMA = YES +GCC_WARN_STRICT_SELECTOR_MATCH = YES +CLANG_WARN_OBJC_REPEATED_USE_OF_WEAK = YES +CLANG_WARN_OBJC_IMPLICIT_RETAIN_SELF = YES +GCC_WARN_SHADOW = YES +CLANG_WARN_UNREACHABLE_CODE = YES diff --git a/apps/design_system_gallery/macos/Runner/DebugProfile.entitlements b/apps/design_system_gallery/macos/Runner/DebugProfile.entitlements new file mode 100644 index 0000000..3ba6c12 --- /dev/null +++ b/apps/design_system_gallery/macos/Runner/DebugProfile.entitlements @@ -0,0 +1,14 @@ + + + + + com.apple.security.app-sandbox + + com.apple.security.cs.allow-jit + + com.apple.security.network.client + + com.apple.security.network.server + + + diff --git a/apps/design_system_gallery/macos/Runner/Info.plist b/apps/design_system_gallery/macos/Runner/Info.plist new file mode 100644 index 0000000..4789daa --- /dev/null +++ b/apps/design_system_gallery/macos/Runner/Info.plist @@ -0,0 +1,32 @@ + + + + + CFBundleDevelopmentRegion + $(DEVELOPMENT_LANGUAGE) + CFBundleExecutable + $(EXECUTABLE_NAME) + CFBundleIconFile + + CFBundleIdentifier + $(PRODUCT_BUNDLE_IDENTIFIER) + CFBundleInfoDictionaryVersion + 6.0 + CFBundleName + $(PRODUCT_NAME) + CFBundlePackageType + APPL + CFBundleShortVersionString + $(FLUTTER_BUILD_NAME) + CFBundleVersion + $(FLUTTER_BUILD_NUMBER) + LSMinimumSystemVersion + $(MACOSX_DEPLOYMENT_TARGET) + NSHumanReadableCopyright + $(PRODUCT_COPYRIGHT) + NSMainNibFile + MainMenu + NSPrincipalClass + NSApplication + + diff --git a/apps/design_system_gallery/macos/Runner/MainFlutterWindow.swift b/apps/design_system_gallery/macos/Runner/MainFlutterWindow.swift new file mode 100644 index 0000000..9792888 --- /dev/null +++ b/apps/design_system_gallery/macos/Runner/MainFlutterWindow.swift @@ -0,0 +1,18 @@ +import Cocoa +import FlutterMacOS + +class MainFlutterWindow: NSWindow { + override func awakeFromNib() { + let flutterViewController = FlutterViewController() + let windowFrame = self.frame + self.contentViewController = flutterViewController + self.setFrame(windowFrame, display: true) + + // Set minimum window size to prevent layout issues + self.minSize = NSSize(width: 400, height: 700) + + RegisterGeneratedPlugins(registry: flutterViewController) + + super.awakeFromNib() + } +} diff --git a/apps/design_system_gallery/macos/Runner/Release.entitlements b/apps/design_system_gallery/macos/Runner/Release.entitlements new file mode 100644 index 0000000..ee95ab7 --- /dev/null +++ b/apps/design_system_gallery/macos/Runner/Release.entitlements @@ -0,0 +1,10 @@ + + + + + com.apple.security.app-sandbox + + com.apple.security.network.client + + + diff --git a/apps/design_system_gallery/macos/RunnerTests/RunnerTests.swift b/apps/design_system_gallery/macos/RunnerTests/RunnerTests.swift new file mode 100644 index 0000000..61f3bd1 --- /dev/null +++ b/apps/design_system_gallery/macos/RunnerTests/RunnerTests.swift @@ -0,0 +1,12 @@ +import Cocoa +import FlutterMacOS +import XCTest + +class RunnerTests: XCTestCase { + + func testExample() { + // If you add code to the Runner application, consider adding tests here. + // See https://developer.apple.com/documentation/xctest for more information about using XCTest. + } + +} diff --git a/apps/design_system_gallery/pubspec.yaml b/apps/design_system_gallery/pubspec.yaml new file mode 100644 index 0000000..f816ad5 --- /dev/null +++ b/apps/design_system_gallery/pubspec.yaml @@ -0,0 +1,34 @@ +name: design_system_gallery +description: "Stream Design System Gallery - A comprehensive widgetbook for exploring and customizing Stream components." +publish_to: 'none' +version: 1.0.0+1 + +environment: + sdk: ^3.10.0 + flutter: ">=3.38.1" + +dependencies: + device_frame_plus: ^1.0.0 + flutter: + sdk: flutter + flutter_colorpicker: ^1.1.0 + marionette_flutter: ^0.3.0 + provider: ^6.1.5+1 + stream_core_flutter: + path: ../../packages/stream_core_flutter + svg_icon_widget: ^0.0.1+1 + unicode_emojis: ^0.5.1 + widgetbook: ^3.20.2 + widgetbook_annotation: ^3.9.0 + +dev_dependencies: + build_runner: ^2.10.5 + flutter_test: + sdk: flutter + marionette_mcp: ^0.3.0 + widgetbook_generator: ^3.20.1 + +flutter: + uses-material-design: true + assets: + - assets/ \ No newline at end of file diff --git a/apps/design_system_gallery/web/favicon.png b/apps/design_system_gallery/web/favicon.png new file mode 100644 index 0000000..8aaa46a Binary files /dev/null and b/apps/design_system_gallery/web/favicon.png differ diff --git a/apps/design_system_gallery/web/icons/Icon-192.png b/apps/design_system_gallery/web/icons/Icon-192.png new file mode 100644 index 0000000..b749bfe Binary files /dev/null and b/apps/design_system_gallery/web/icons/Icon-192.png differ diff --git a/apps/design_system_gallery/web/icons/Icon-512.png b/apps/design_system_gallery/web/icons/Icon-512.png new file mode 100644 index 0000000..88cfd48 Binary files /dev/null and b/apps/design_system_gallery/web/icons/Icon-512.png differ diff --git a/apps/design_system_gallery/web/icons/Icon-maskable-192.png b/apps/design_system_gallery/web/icons/Icon-maskable-192.png new file mode 100644 index 0000000..eb9b4d7 Binary files /dev/null and b/apps/design_system_gallery/web/icons/Icon-maskable-192.png differ diff --git a/apps/design_system_gallery/web/icons/Icon-maskable-512.png b/apps/design_system_gallery/web/icons/Icon-maskable-512.png new file mode 100644 index 0000000..d69c566 Binary files /dev/null and b/apps/design_system_gallery/web/icons/Icon-maskable-512.png differ diff --git a/apps/design_system_gallery/web/index.html b/apps/design_system_gallery/web/index.html new file mode 100644 index 0000000..945205d --- /dev/null +++ b/apps/design_system_gallery/web/index.html @@ -0,0 +1,38 @@ + + + + + + + + + + + + + + + + + + + + design_system_gallery + + + + + + diff --git a/apps/design_system_gallery/web/manifest.json b/apps/design_system_gallery/web/manifest.json new file mode 100644 index 0000000..0c9ff26 --- /dev/null +++ b/apps/design_system_gallery/web/manifest.json @@ -0,0 +1,35 @@ +{ + "name": "design_system_gallery", + "short_name": "design_system_gallery", + "start_url": ".", + "display": "standalone", + "background_color": "#0175C2", + "theme_color": "#0175C2", + "description": "A new Flutter project.", + "orientation": "portrait-primary", + "prefer_related_applications": false, + "icons": [ + { + "src": "icons/Icon-192.png", + "sizes": "192x192", + "type": "image/png" + }, + { + "src": "icons/Icon-512.png", + "sizes": "512x512", + "type": "image/png" + }, + { + "src": "icons/Icon-maskable-192.png", + "sizes": "192x192", + "type": "image/png", + "purpose": "maskable" + }, + { + "src": "icons/Icon-maskable-512.png", + "sizes": "512x512", + "type": "image/png", + "purpose": "maskable" + } + ] +} diff --git a/melos.yaml b/melos.yaml index 0be9381..1ba8437 100644 --- a/melos.yaml +++ b/melos.yaml @@ -5,22 +5,25 @@ versioning: mode: independent packages: + - apps/** - packages/** command: bootstrap: # Dart and Flutter environment used in the project. environment: - sdk: ^3.6.2 + sdk: ^3.10.0 # We are not using carat '^' syntax here because flutter don't follow semantic versioning. - flutter: ">=3.27.4" + flutter: ">=3.38.1" # List of all the dependencies used in the project. dependencies: + cached_network_image: ^3.4.1 collection: ^1.19.0 cross_file: ^0.3.4+2 dio: ^5.8.0+1 equatable: ^2.0.7 + flutter_svg: ^2.2.3 http_parser: ^4.1.2 intl: ">=0.19.0 <=0.21.0" jose: ^0.3.4 @@ -28,18 +31,23 @@ command: meta: ^1.15.0 mime: ^2.0.0 rxdart: ^0.28.0 + stream_core: ^0.4.0 + svg_icon_widget: ^0.0.1+1 synchronized: ^3.3.0 + theme_extensions_builder_annotation: ^7.1.0 + unicode_emojis: ^0.5.1 uuid: ^4.5.1 web: ^1.1.1 web_socket_channel: ^3.0.1 # List of all the dev_dependencies used in the project. dev_dependencies: - build_runner: ^2.4.15 + build_runner: ^2.10.5 json_serializable: ^6.9.5 melos: ^6.2.0 mocktail: ^1.0.4 test: ^1.26.2 + theme_extensions_builder: ^7.2.0 scripts: postclean: @@ -108,6 +116,10 @@ scripts: run: melos run generate:dart && melos run generate:flutter description: Build all generated files for Dart & Flutter packages in this project. + generate:icons: + run: melos exec -c 1 --file-exists="stream_icons.yaml" -- "dart run \$MELOS_ROOT_PATH/scripts/generate_icons.dart" + description: Generate icon font and Dart classes from SVG files. + generate:dart: run: melos exec -c 1 --depends-on="build_runner" --no-flutter -- "dart run build_runner build --delete-conflicting-outputs" description: Build all generated files for Dart packages in this project. diff --git a/packages/stream_core/lib/src/api/interceptors/logging_interceptor.dart b/packages/stream_core/lib/src/api/interceptors/logging_interceptor.dart index 61694bd..f74b784 100644 --- a/packages/stream_core/lib/src/api/interceptors/logging_interceptor.dart +++ b/packages/stream_core/lib/src/api/interceptors/logging_interceptor.dart @@ -1,4 +1,3 @@ -// ignore_for_file: lines_longer_than_80_chars // coverage:ignore-file import 'dart:math' as math; @@ -56,10 +55,10 @@ class LoggingInterceptor extends Interceptor { final bool error; /// InitialTab count to logPrint json response - static const int initialTab = 1; + static const initialTab = 1; /// 1 tab length - static const String tabStep = ' '; + static const tabStep = ' '; /// Print compact json response final bool compact; @@ -125,8 +124,7 @@ class LoggingInterceptor extends Interceptor { final uri = err.response?.requestOptions.uri; _printBoxed( _logPrintError, - header: - 'DioException ║ Status: ${err.response?.statusCode} ${err.response?.statusMessage}', + header: 'DioException ║ Status: ${err.response?.statusCode} ${err.response?.statusMessage}', text: uri.toString(), ); if (err.response != null && err.response?.data != null) { @@ -155,8 +153,7 @@ class LoggingInterceptor extends Interceptor { _printResponseHeader(_logPrintResponse, response); if (responseHeader) { final responseHeaders = {}; - response.headers - .forEach((k, list) => responseHeaders[k] = list.toString()); + response.headers.forEach((k, list) => responseHeaders[k] = list.toString()); _printMapAsTable(_logPrintResponse, responseHeaders, header: 'Headers'); } @@ -206,8 +203,7 @@ class LoggingInterceptor extends Interceptor { final method = response.requestOptions.method; _printBoxed( logPrint, - header: - 'Response ║ $method ║ Status: ${response.statusCode} ${response.statusMessage}', + header: 'Response ║ $method ║ Status: ${response.statusCode} ${response.statusMessage}', text: uri.toString(), ); } @@ -225,8 +221,7 @@ class LoggingInterceptor extends Interceptor { void Function(Object) logPrint, [ String pre = '', String suf = '╝', - ]) => - logPrint('$pre${'═' * maxWidth}$suf'); + ]) => logPrint('$pre${'═' * maxWidth}$suf'); void _printKV(void Function(Object) logPrint, String? key, Object? v) { final pre = '╟ $key: '; @@ -299,10 +294,12 @@ class LoggingInterceptor extends Interceptor { if (msg.length + indent.length > linWidth) { final lines = (msg.length / linWidth).ceil(); for (var i = 0; i < lines; ++i) { - logPrint('║${_indent(indentedTabs)} ${msg.substring( - i * linWidth, - math.min(i * linWidth + linWidth, msg.length), - )}'); + logPrint( + '║${_indent(indentedTabs)} ${msg.substring( + i * linWidth, + math.min(i * linWidth + linWidth, msg.length), + )}', + ); } } else { logPrint('║${_indent(indentedTabs)} $key: $msg${!isLast ? ',' : ''}'); @@ -351,11 +348,9 @@ class LoggingInterceptor extends Interceptor { _printLine(logPrint, '╚'); } - void _logPrintRequest(Object object) => - logPrint(InterceptStep.request, object); + void _logPrintRequest(Object object) => logPrint(InterceptStep.request, object); - void _logPrintResponse(Object object) => - logPrint(InterceptStep.response, object); + void _logPrintResponse(Object object) => logPrint(InterceptStep.response, object); void _logPrintError(Object object) => logPrint(InterceptStep.error, object); } diff --git a/packages/stream_core/lib/src/api/stream_core_dio_error.dart b/packages/stream_core/lib/src/api/stream_core_dio_error.dart index 33cf78b..fb0d345 100644 --- a/packages/stream_core/lib/src/api/stream_core_dio_error.dart +++ b/packages/stream_core/lib/src/api/stream_core_dio_error.dart @@ -13,9 +13,9 @@ class StreamDioException extends DioException { StackTrace? stackTrace, super.message, }) : super( - error: exception, - stackTrace: stackTrace ?? StackTrace.current, - ); + error: exception, + stackTrace: stackTrace ?? StackTrace.current, + ); final ClientException exception; } diff --git a/packages/stream_core/lib/src/attachment/uploader/attachment_uploader.dart b/packages/stream_core/lib/src/attachment/uploader/attachment_uploader.dart index 73eeaf9..a660306 100644 --- a/packages/stream_core/lib/src/attachment/uploader/attachment_uploader.dart +++ b/packages/stream_core/lib/src/attachment/uploader/attachment_uploader.dart @@ -112,10 +112,7 @@ class StreamAttachmentUploader { /// /// Receives the [attachmentId] and upload [progress] as a value between 0.0 and 1.0 /// for individual attachments during batch upload. -typedef OnBatchUploadProgress = void Function( - String attachmentId, - double progress, -); +typedef OnBatchUploadProgress = void Function(String attachmentId, double progress); /// Extension providing batch upload functionality for [StreamAttachmentUploader]. /// @@ -150,7 +147,8 @@ extension StreamAttachmentUploaderBatch on StreamAttachmentUploader { upload( attachment, onProgress: onProgress?.let( - (f) => (progress) => f(attachment.id, progress), + (f) => + (progress) => f(attachment.id, progress), ), ), ), diff --git a/packages/stream_core/lib/src/errors/stream_api_error.dart b/packages/stream_core/lib/src/errors/stream_api_error.dart index 4d33bcb..19c2fe0 100644 --- a/packages/stream_core/lib/src/errors/stream_api_error.dart +++ b/packages/stream_core/lib/src/errors/stream_api_error.dart @@ -54,20 +54,19 @@ class StreamApiError extends Equatable { Map toJson() => _$StreamApiErrorToJson(this); /// Creates a [StreamApiError] from a JSON map. - static StreamApiError fromJson(Map json) => - _$StreamApiErrorFromJson(json); + static StreamApiError fromJson(Map json) => _$StreamApiErrorFromJson(json); @override List get props => [ - code, - details, - duration, - exceptionFields, - message, - moreInfo, - statusCode, - unrecoverable, - ]; + code, + details, + duration, + exceptionFields, + message, + moreInfo, + statusCode, + unrecoverable, + ]; } final _tokenInvalidErrorCodes = _range(40, 42); diff --git a/packages/stream_core/lib/src/errors/stream_api_error.g.dart b/packages/stream_core/lib/src/errors/stream_api_error.g.dart index 15ba50e..e3fd613 100644 --- a/packages/stream_core/lib/src/errors/stream_api_error.g.dart +++ b/packages/stream_core/lib/src/errors/stream_api_error.g.dart @@ -6,30 +6,26 @@ part of 'stream_api_error.dart'; // JsonSerializableGenerator // ************************************************************************** -StreamApiError _$StreamApiErrorFromJson(Map json) => - StreamApiError( - code: (json['code'] as num).toInt(), - details: (json['details'] as List) - .map((e) => (e as num).toInt()) - .toList(), - duration: json['duration'] as String, - exceptionFields: (json['exception_fields'] as Map?)?.map( - (k, e) => MapEntry(k, e as String), - ), - message: json['message'] as String, - moreInfo: json['more_info'] as String, - statusCode: (json['StatusCode'] as num).toInt(), - unrecoverable: json['unrecoverable'] as bool?, - ); +StreamApiError _$StreamApiErrorFromJson(Map json) => StreamApiError( + code: (json['code'] as num).toInt(), + details: (json['details'] as List).map((e) => (e as num).toInt()).toList(), + duration: json['duration'] as String, + exceptionFields: (json['exception_fields'] as Map?)?.map( + (k, e) => MapEntry(k, e as String), + ), + message: json['message'] as String, + moreInfo: json['more_info'] as String, + statusCode: (json['StatusCode'] as num).toInt(), + unrecoverable: json['unrecoverable'] as bool?, +); -Map _$StreamApiErrorToJson(StreamApiError instance) => - { - 'code': instance.code, - 'details': instance.details, - 'duration': instance.duration, - 'exception_fields': instance.exceptionFields, - 'message': instance.message, - 'more_info': instance.moreInfo, - 'StatusCode': instance.statusCode, - 'unrecoverable': instance.unrecoverable, - }; +Map _$StreamApiErrorToJson(StreamApiError instance) => { + 'code': instance.code, + 'details': instance.details, + 'duration': instance.duration, + 'exception_fields': instance.exceptionFields, + 'message': instance.message, + 'more_info': instance.moreInfo, + 'StatusCode': instance.statusCode, + 'unrecoverable': instance.unrecoverable, +}; diff --git a/packages/stream_core/lib/src/logger/impl/external_logger.dart b/packages/stream_core/lib/src/logger/impl/external_logger.dart index 5552e76..56a749f 100644 --- a/packages/stream_core/lib/src/logger/impl/external_logger.dart +++ b/packages/stream_core/lib/src/logger/impl/external_logger.dart @@ -1,12 +1,13 @@ import '../stream_logger.dart'; -typedef ExternalFunction = void Function( - Priority priority, - String tag, - MessageBuilder message, [ - Object? error, - StackTrace? stk, -]); +typedef ExternalFunction = + void Function( + Priority priority, + String tag, + MessageBuilder message, [ + Object? error, + StackTrace? stk, + ]); class ExternalStreamLogger extends StreamLogger { const ExternalStreamLogger(this.external); diff --git a/packages/stream_core/lib/src/logger/impl/file_logger.dart b/packages/stream_core/lib/src/logger/impl/file_logger.dart index 634deb7..880142e 100644 --- a/packages/stream_core/lib/src/logger/impl/file_logger.dart +++ b/packages/stream_core/lib/src/logger/impl/file_logger.dart @@ -7,12 +7,12 @@ import 'package:intl/intl.dart'; import '../../utils/standard.dart'; import '../stream_logger.dart'; -const String _tag = 'SV:FileLogger'; +const _tag = 'SV:FileLogger'; const int _defaultSize = 12 * 1024 * 1024; -const String _shareableFilePrefix = 'stream_log_'; -const String _internalFile0 = 'internal_0.txt'; -const String _internalFile1 = 'internal_1.txt'; +const _shareableFilePrefix = 'stream_log_'; +const _internalFile0 = 'internal_0.txt'; +const _internalFile1 = 'internal_1.txt'; typedef FileLogSender = Future Function(File); @@ -26,8 +26,7 @@ class FileStreamLogger extends StreamLogger { this.console, }); - static final Finalizer _finalizer = - Finalizer((ioSink) async => ioSink.close()); + static final Finalizer _finalizer = Finalizer((ioSink) => ioSink.close()); final FileLogConfig config; final FileLogSender? sender; @@ -66,16 +65,12 @@ class FileStreamLogger extends StreamLogger { _logD(() => '[initIfNeeded] no args'); _filesDir = await config.filesDir; _tempsDir = await config.tempsDir; - _file0 = File('${_filesDir.path}$pathSeparator$_internalFile0') - ..createSync(recursive: true); - _file1 = File('${_filesDir.path}$pathSeparator$_internalFile1') - ..createSync(recursive: true); + _file0 = File('${_filesDir.path}$pathSeparator$_internalFile0')..createSync(recursive: true); + _file1 = File('${_filesDir.path}$pathSeparator$_internalFile1')..createSync(recursive: true); final File currentFile; if (!_file0.existsSync() || !_file1.existsSync()) { currentFile = _file0; - } else if (_file0 - .lastModifiedSync() - .isAfter(_file1.lastModifiedSync())) { + } else if (_file0.lastModifiedSync().isAfter(_file1.lastModifiedSync())) { currentFile = _file0; } else { currentFile = _file1; @@ -120,7 +115,8 @@ class FileStreamLogger extends StreamLogger { Future clear() async { try { _logD( - () => '[clear] before; file0: ${_file0.lengthSync()}, ' + () => + '[clear] before; file0: ${_file0.lengthSync()}, ' 'file1: ${_file1.lengthSync()}', ); final currentIO = _currentIO; @@ -139,7 +135,8 @@ class FileStreamLogger extends StreamLogger { _finalizer.attach(this, it, detach: this); }); _logV( - () => '[clear] after; file0: ${_file0.lengthSync()}, ' + () => + '[clear] after; file0: ${_file0.lengthSync()}, ' 'file1: ${_file1.lengthSync()}', ); } catch (e, stk) { @@ -166,19 +163,20 @@ class FileStreamLogger extends StreamLogger { } Future prepareShareable() async { - final filename = '$_shareableFilePrefix' + final filename = + '$_shareableFilePrefix' '${_dateFormat.format(DateTime.now())}.txt'; - final out = File('${_tempsDir.path}$pathSeparator$filename') - ..createSync(recursive: true); + final out = File('${_tempsDir.path}$pathSeparator$filename')..createSync(recursive: true); _logD(() => '[prepareShareable] out: $out'); IOSink? writer; try { writer = out.openWrite(mode: FileMode.append); writer.writeln(await _buildHeader()); - final filtered = [_file0, _file1] - .where((file) => file.existsSync()) - .sortedBy((file) => file.lastModifiedSync()); + final filtered = [ + _file0, + _file1, + ].where((file) => file.existsSync()).sortedBy((file) => file.lastModifiedSync()); for (final file in filtered) { if (file.existsSync()) { await writer.addStream(file.openRead()); diff --git a/packages/stream_core/lib/src/logger/stream_log.dart b/packages/stream_core/lib/src/logger/stream_log.dart index 9862603..f4709d1 100644 --- a/packages/stream_core/lib/src/logger/stream_log.dart +++ b/packages/stream_core/lib/src/logger/stream_log.dart @@ -1,3 +1,5 @@ +// ignore_for_file: omit_obvious_property_types + import 'stream_logger.dart'; StreamLog get streamLog => StreamLog(); @@ -9,7 +11,7 @@ class StreamLog { StreamLog._(); - static final StreamLog _instance = StreamLog._(); + static final _instance = StreamLog._(); StreamLogger _logger = const SilentStreamLogger(); IsLoggableValidator _validator = (Priority priority, Tag tag) => false; diff --git a/packages/stream_core/lib/src/logger/stream_logger.dart b/packages/stream_core/lib/src/logger/stream_logger.dart index e0c9f4f..730f578 100644 --- a/packages/stream_core/lib/src/logger/stream_logger.dart +++ b/packages/stream_core/lib/src/logger/stream_logger.dart @@ -41,7 +41,8 @@ enum Priority implements Comparable { info(level: 4), warning(level: 5), error(level: 6), - none(level: 7); + none(level: 7) + ; const Priority({required this.level}); diff --git a/packages/stream_core/lib/src/platform/current_platform.dart b/packages/stream_core/lib/src/platform/current_platform.dart index 7e0d133..8cb934a 100644 --- a/packages/stream_core/lib/src/platform/current_platform.dart +++ b/packages/stream_core/lib/src/platform/current_platform.dart @@ -1,5 +1,4 @@ -import 'detector/platform_detector.dart' - if (dart.library.io) 'detector/platform_detector_io.dart'; +import 'detector/platform_detector.dart' if (dart.library.io) 'detector/platform_detector_io.dart'; /// Platform detection utility for identifying the current runtime environment. /// @@ -87,7 +86,8 @@ enum PlatformType { linux('linux'), /// Fuchsia: - fuchsia('fuchsia'); + fuchsia('fuchsia') + ; /// Creates a [PlatformType] with the specified [operatingSystem] identifier. const PlatformType(this.operatingSystem); diff --git a/packages/stream_core/lib/src/query/filter/filter.dart b/packages/stream_core/lib/src/query/filter/filter.dart index af7d10d..2c6ee41 100644 --- a/packages/stream_core/lib/src/query/filter/filter.dart +++ b/packages/stream_core/lib/src/query/filter/filter.dart @@ -1,3 +1,5 @@ +// ignore_for_file: matching_super_parameters + import '../../utils.dart'; import 'filter_operation_utils.dart'; import 'filter_operator.dart'; @@ -241,8 +243,7 @@ sealed class ComparisonOperator extends Filter { /// **Supported with**: `.equal` factory method final class EqualOperator extends ComparisonOperator { /// Creates an equality filter for the specified [field] and [value]. - const EqualOperator(super.field, super.value) - : super._(operator: FilterOperator.equal); + const EqualOperator(super.field, super.value) : super._(operator: FilterOperator.equal); @override bool matches(T other) { @@ -273,8 +274,7 @@ final class EqualOperator extends ComparisonOperator { /// **Supported with**: `.greater` factory method final class GreaterOperator extends ComparisonOperator { /// Creates a greater-than filter for the specified [field] and [value]. - const GreaterOperator(super.field, super.value) - : super._(operator: FilterOperator.greater); + const GreaterOperator(super.field, super.value) : super._(operator: FilterOperator.greater); @override bool matches(T other) { @@ -293,11 +293,9 @@ final class GreaterOperator extends ComparisonOperator { /// Greater-than-or-equal comparison filter. /// /// Primarily used with numeric values and dates. -final class GreaterOrEqualOperator - extends ComparisonOperator { +final class GreaterOrEqualOperator extends ComparisonOperator { /// Creates a greater-than-or-equal filter for the specified [field] and [value]. - const GreaterOrEqualOperator(super.field, super.value) - : super._(operator: FilterOperator.greaterOrEqual); + const GreaterOrEqualOperator(super.field, super.value) : super._(operator: FilterOperator.greaterOrEqual); @override bool matches(T other) { @@ -318,8 +316,7 @@ final class GreaterOrEqualOperator /// Primarily used with numeric values and dates. final class LessOperator extends ComparisonOperator { /// Creates a less-than filter for the specified [field] and [value]. - const LessOperator(super.field, super.value) - : super._(operator: FilterOperator.less); + const LessOperator(super.field, super.value) : super._(operator: FilterOperator.less); @override bool matches(T other) { @@ -338,11 +335,9 @@ final class LessOperator extends ComparisonOperator { /// Less-than-or-equal comparison filter. /// /// Primarily used with numeric values and dates. -final class LessOrEqualOperator - extends ComparisonOperator { +final class LessOrEqualOperator extends ComparisonOperator { /// Creates a less-than-or-equal filter for the specified [field] and [value]. - const LessOrEqualOperator(super.field, super.value) - : super._(operator: FilterOperator.lessOrEqual); + const LessOrEqualOperator(super.field, super.value) : super._(operator: FilterOperator.lessOrEqual); @override bool matches(T other) { @@ -397,8 +392,7 @@ sealed class ListOperator extends Filter { /// **Supported with**: `.in_` factory method final class InOperator extends ListOperator { /// Creates an 'in' filter for the specified [field] and [values] iterable. - const InOperator(super.field, Iterable super.values) - : super._(operator: FilterOperator.in_); + const InOperator(super.field, Iterable super.values) : super._(operator: FilterOperator.in_); @override bool matches(T other) { @@ -422,8 +416,7 @@ final class InOperator extends ListOperator { /// **Supported with**: `.contains` factory method final class ContainsOperator extends ListOperator { /// Creates a contains filter for the specified [field] and [value]. - const ContainsOperator(super.field, super.value) - : super._(operator: FilterOperator.contains_); + const ContainsOperator(super.field, super.value) : super._(operator: FilterOperator.contains_); @override bool matches(T other) { @@ -511,8 +504,7 @@ sealed class EvaluationOperator extends Filter { /// **Supported with**: `.query` factory method final class QueryOperator extends EvaluationOperator { /// Creates a text search filter for the specified [field] and search [query]. - const QueryOperator(super.field, super.query) - : super._(operator: FilterOperator.query); + const QueryOperator(super.field, super.query) : super._(operator: FilterOperator.query); @override bool matches(T other) { @@ -529,11 +521,9 @@ final class QueryOperator extends EvaluationOperator { /// Word prefix matching filter for autocomplete. /// /// Matches field values where any word starts with the provided prefix. -final class AutoCompleteOperator - extends EvaluationOperator { +final class AutoCompleteOperator extends EvaluationOperator { /// Creates an autocomplete filter for the specified [field] and prefix [query]. - const AutoCompleteOperator(super.field, super.query) - : super._(operator: FilterOperator.autoComplete); + const AutoCompleteOperator(super.field, super.query) : super._(operator: FilterOperator.autoComplete); @override bool matches(T other) { diff --git a/packages/stream_core/lib/src/query/filter/location/bounding_box.g.dart b/packages/stream_core/lib/src/query/filter/location/bounding_box.g.dart index 90bb530..ecb84e5 100644 --- a/packages/stream_core/lib/src/query/filter/location/bounding_box.g.dart +++ b/packages/stream_core/lib/src/query/filter/location/bounding_box.g.dart @@ -6,10 +6,9 @@ part of 'bounding_box.dart'; // JsonSerializableGenerator // ************************************************************************** -Map _$BoundingBoxToJson(BoundingBox instance) => - { - 'ne_lat': instance.neLat, - 'ne_lng': instance.neLng, - 'sw_lat': instance.swLat, - 'sw_lng': instance.swLng, - }; +Map _$BoundingBoxToJson(BoundingBox instance) => { + 'ne_lat': instance.neLat, + 'ne_lng': instance.neLng, + 'sw_lat': instance.swLat, + 'sw_lng': instance.swLng, +}; diff --git a/packages/stream_core/lib/src/query/filter/location/circular_region.g.dart b/packages/stream_core/lib/src/query/filter/location/circular_region.g.dart index 66a08e0..2690c73 100644 --- a/packages/stream_core/lib/src/query/filter/location/circular_region.g.dart +++ b/packages/stream_core/lib/src/query/filter/location/circular_region.g.dart @@ -6,9 +6,8 @@ part of 'circular_region.dart'; // JsonSerializableGenerator // ************************************************************************** -Map _$CircularRegionToJson(CircularRegion instance) => - { - 'lat': instance.lat, - 'lng': instance.lng, - 'distance': instance.distance, - }; +Map _$CircularRegionToJson(CircularRegion instance) => { + 'lat': instance.lat, + 'lng': instance.lng, + 'distance': instance.distance, +}; diff --git a/packages/stream_core/lib/src/query/filter/location/location_coordinate.dart b/packages/stream_core/lib/src/query/filter/location/location_coordinate.dart index 2164904..fd46f16 100644 --- a/packages/stream_core/lib/src/query/filter/location/location_coordinate.dart +++ b/packages/stream_core/lib/src/query/filter/location/location_coordinate.dart @@ -79,9 +79,7 @@ class LocationCoordinate { final latComponent = _square(sinDLat); // Calculate longitude component: sin²(Δlon/2) * cos(lat1) * cos(lat2) - final lonComponent = _square(sinDLon) * - math.cos(_degToRad(latitude)) * - math.cos(_degToRad(other.latitude)); + final lonComponent = _square(sinDLon) * math.cos(_degToRad(latitude)) * math.cos(_degToRad(other.latitude)); // Combine components final a = latComponent + lonComponent; diff --git a/packages/stream_core/lib/src/query/sort.dart b/packages/stream_core/lib/src/query/sort.dart index 164fbc4..67afa67 100644 --- a/packages/stream_core/lib/src/query/sort.dart +++ b/packages/stream_core/lib/src/query/sort.dart @@ -15,7 +15,8 @@ enum SortDirection { /// Sort in descending order (Z to A, 9 to 1, etc.). @JsonValue(-1) - desc(-1); + desc(-1) + ; /// Creates a new [SortDirection] instance with the specified direction. const SortDirection(this.value); @@ -32,7 +33,7 @@ enum NullOrdering { /// Null values appear at the end of the sorted list, /// regardless of sort direction (ASC or DESC). - nullsLast; + nullsLast, } /// Signature for a function that retrieves a sortable field value of type [V] from @@ -44,12 +45,13 @@ typedef SortFieldValueGetter = V? Function(T); /// A comparator function that compares two instances of type [T] based on /// a specified field, sort direction, and null ordering. -typedef SortFieldComparator = int Function( - T? a, - T? b, - SortDirection direction, - NullOrdering nullOrdering, -); +typedef SortFieldComparator = + int Function( + T? a, + T? b, + SortDirection direction, + NullOrdering nullOrdering, + ); /// A sort specification that defines how to order a collection of objects. /// diff --git a/packages/stream_core/lib/src/query/sort.g.dart b/packages/stream_core/lib/src/query/sort.g.dart index 3036cd4..2d8de5f 100644 --- a/packages/stream_core/lib/src/query/sort.g.dart +++ b/packages/stream_core/lib/src/query/sort.g.dart @@ -6,13 +6,9 @@ part of 'sort.dart'; // JsonSerializableGenerator // ************************************************************************** -Map _$SortToJson(Sort instance) => - { - 'field': Sort._fieldToJson(instance.field), - 'direction': _$SortDirectionEnumMap[instance.direction]!, - }; - -const _$SortDirectionEnumMap = { - SortDirection.asc: 1, - SortDirection.desc: -1, +Map _$SortToJson(Sort instance) => { + 'field': Sort._fieldToJson(instance.field), + 'direction': _$SortDirectionEnumMap[instance.direction]!, }; + +const _$SortDirectionEnumMap = {SortDirection.asc: 1, SortDirection.desc: -1}; diff --git a/packages/stream_core/lib/src/user/connect_user_details_request.g.dart b/packages/stream_core/lib/src/user/connect_user_details_request.g.dart index 3b4fe26..1d97036 100644 --- a/packages/stream_core/lib/src/user/connect_user_details_request.g.dart +++ b/packages/stream_core/lib/src/user/connect_user_details_request.g.dart @@ -7,12 +7,12 @@ part of 'connect_user_details_request.dart'; // ************************************************************************** Map _$ConnectUserDetailsRequestToJson( - ConnectUserDetailsRequest instance) => - { - 'id': instance.id, - 'image': instance.image, - 'invisible': instance.invisible, - 'language': instance.language, - 'name': instance.name, - 'custom': instance.custom, - }; + ConnectUserDetailsRequest instance, +) => { + 'id': instance.id, + 'image': instance.image, + 'invisible': instance.invisible, + 'language': instance.language, + 'name': instance.name, + 'custom': instance.custom, +}; diff --git a/packages/stream_core/lib/src/user/token_manager.dart b/packages/stream_core/lib/src/user/token_manager.dart index aa9c6dc..288f0d4 100644 --- a/packages/stream_core/lib/src/user/token_manager.dart +++ b/packages/stream_core/lib/src/user/token_manager.dart @@ -68,7 +68,7 @@ class TokenManager { /// at a time. /// /// Returns a [Future] that resolves to a [UserToken] for the user. - Future getToken() async { + Future getToken() { final snapshot = _cachedToken; return synchronized(() async { // If the snapshot is no longer equal to the cached token, it means diff --git a/packages/stream_core/lib/src/user/user.dart b/packages/stream_core/lib/src/user/user.dart index 9b0fcd5..606ea46 100644 --- a/packages/stream_core/lib/src/user/user.dart +++ b/packages/stream_core/lib/src/user/user.dart @@ -16,14 +16,13 @@ class User extends Equatable { this.role = 'user', this.type = UserType.regular, Map? custom, - }) : originalName = name, - custom = custom ?? const {}; + }) : originalName = name, + custom = custom ?? const {}; /// Creates a guest user with the provided id. /// - Parameter userId: the id of the user. /// - Returns: a guest `User`. - const User.guest(String userId) - : this(id: userId, name: userId, type: UserType.guest); + const User.guest(String userId) : this(id: userId, name: userId, type: UserType.guest); /// Creates an anonymous user. /// - Returns: an anonymous `User`. @@ -54,14 +53,7 @@ class User extends Equatable { String get name => originalName ?? id; @override - List get props => [ - id, - image, - role, - type, - originalName, - custom, - ]; + List get props => [id, image, role, type, originalName, custom]; } /// The user authorization type. diff --git a/packages/stream_core/lib/src/user/user_token.dart b/packages/stream_core/lib/src/user/user_token.dart index 63fe1c6..bdb7cd3 100644 --- a/packages/stream_core/lib/src/user/user_token.dart +++ b/packages/stream_core/lib/src/user/user_token.dart @@ -112,7 +112,8 @@ enum AuthType { /// /// Allows unauthenticated access with limited permissions. /// Used for public content access or guest user scenarios. - anonymous('anonymous'); + anonymous('anonymous') + ; /// Constructs an [AuthType] with the associated header value. const AuthType(this.headerValue); diff --git a/packages/stream_core/lib/src/user/ws_auth_message_request.g.dart b/packages/stream_core/lib/src/user/ws_auth_message_request.g.dart index 9e4f2ae..b32bada 100644 --- a/packages/stream_core/lib/src/user/ws_auth_message_request.g.dart +++ b/packages/stream_core/lib/src/user/ws_auth_message_request.g.dart @@ -7,12 +7,12 @@ part of 'ws_auth_message_request.dart'; // ************************************************************************** Map _$WsAuthMessageRequestToJson( - WsAuthMessageRequest instance) => - { - 'stringify': instance.stringify, - 'hash_code': instance.hashCode, - 'products': instance.products, - 'token': instance.token, - 'user_details': instance.userDetails?.toJson(), - 'props': instance.props, - }; + WsAuthMessageRequest instance, +) => { + 'stringify': instance.stringify, + 'hash_code': instance.hashCode, + 'products': instance.products, + 'token': instance.token, + 'user_details': instance.userDetails?.toJson(), + 'props': instance.props, +}; diff --git a/packages/stream_core/lib/src/utils/comparable_field.dart b/packages/stream_core/lib/src/utils/comparable_field.dart index 00c1310..692ad7c 100644 --- a/packages/stream_core/lib/src/utils/comparable_field.dart +++ b/packages/stream_core/lib/src/utils/comparable_field.dart @@ -41,8 +41,7 @@ import 'package:meta/meta.dart'; /// print(intField?.compareTo(doubleField!)); // 0 (equal) /// ``` @immutable -class ComparableField - implements Comparable> { +class ComparableField implements Comparable> { const ComparableField._(this.value); /// Creates a [ComparableField] from [value]. @@ -84,8 +83,8 @@ class ComparableField (final bool a, final bool b) when a == b => 0, (final bool a, final bool b) => a && !b ? 1 : -1, _ => throw ArgumentError( - 'Incompatible types: ${value.runtimeType} vs ${other.value.runtimeType}', - ), + 'Incompatible types: ${value.runtimeType} vs ${other.value.runtimeType}', + ), }; } } diff --git a/packages/stream_core/lib/src/utils/disposable.dart b/packages/stream_core/lib/src/utils/disposable.dart index 1ef2462..be10176 100644 --- a/packages/stream_core/lib/src/utils/disposable.dart +++ b/packages/stream_core/lib/src/utils/disposable.dart @@ -1,3 +1,5 @@ +// ignore_for_file: avoid_futureor_void, unnecessary_async + import 'dart:async'; import 'package:meta/meta.dart'; @@ -6,7 +8,7 @@ import 'package:meta/meta.dart'; mixin class Disposable { /// Returns `true` if this object has been disposed. bool get isDisposed => _disposed; - bool _disposed = false; + var _disposed = false; /// Disposes of this object. @mustCallSuper diff --git a/packages/stream_core/lib/src/utils/event_emitter.dart b/packages/stream_core/lib/src/utils/event_emitter.dart index 0bda35c..2e1e0e0 100644 --- a/packages/stream_core/lib/src/utils/event_emitter.dart +++ b/packages/stream_core/lib/src/utils/event_emitter.dart @@ -57,8 +57,7 @@ typedef EventEmitter = SharedEmitter; /// See also: /// - [EventEmitter] for the read-only interface. /// - [EventResolver] for the resolver function signature. -final class MutableEventEmitter - extends SharedEmitterImpl implements MutableSharedEmitter { +final class MutableEventEmitter extends SharedEmitterImpl implements MutableSharedEmitter { /// Creates a [MutableEventEmitter] with optional event [resolvers]. /// /// Resolvers are applied in order to each emitted event until one returns diff --git a/packages/stream_core/lib/src/utils/result.dart b/packages/stream_core/lib/src/utils/result.dart index 034f809..07c66ca 100644 --- a/packages/stream_core/lib/src/utils/result.dart +++ b/packages/stream_core/lib/src/utils/result.dart @@ -94,8 +94,10 @@ extension PatternMatching on Result { T getOrThrow() { return switch (this) { Success(:final data) => data, - Failure(:final error, :final stackTrace) => - Error.throwWithStackTrace(error, stackTrace ?? StackTrace.current), + Failure(:final error, :final stackTrace) => Error.throwWithStackTrace( + error, + stackTrace ?? StackTrace.current, + ), }; } @@ -184,8 +186,8 @@ extension PatternMatching on Result { return switch (this) { Success(:final data) => Result.success(data as R), Failure(:final error, :final stackTrace) => Result.success( - transform(error, stackTrace), - ), + transform(error, stackTrace), + ), }; } @@ -200,8 +202,8 @@ extension PatternMatching on Result { return switch (this) { Success(:final data) => Result.success(data as R), Failure(:final error, :final stackTrace) => runSafelySync( - () => transform(error, stackTrace), - ), + () => transform(error, stackTrace), + ), }; } diff --git a/packages/stream_core/lib/src/utils/shared_emitter.dart b/packages/stream_core/lib/src/utils/shared_emitter.dart index 0c52b06..c3005c9 100644 --- a/packages/stream_core/lib/src/utils/shared_emitter.dart +++ b/packages/stream_core/lib/src/utils/shared_emitter.dart @@ -98,8 +98,7 @@ abstract interface class MutableSharedEmitter extends SharedEmitter { /// /// See also: /// - [MutableSharedEmitter] for the interface. -class SharedEmitterImpl extends StreamView - implements MutableSharedEmitter { +class SharedEmitterImpl extends StreamView implements MutableSharedEmitter { /// Creates a [SharedEmitterImpl]. /// /// Supports synchronous or asynchronous event emission via [sync], and diff --git a/packages/stream_core/lib/src/utils/state_emitter.dart b/packages/stream_core/lib/src/utils/state_emitter.dart index 5bb0799..3d570a3 100644 --- a/packages/stream_core/lib/src/utils/state_emitter.dart +++ b/packages/stream_core/lib/src/utils/state_emitter.dart @@ -37,8 +37,7 @@ abstract interface class StateEmitter implements SharedEmitter { /// See also: /// - [StateEmitter] for the read-only interface. /// - [MutableStateEmitterExtension] for convenience methods. -abstract interface class MutableStateEmitter extends StateEmitter - implements MutableSharedEmitter { +abstract interface class MutableStateEmitter extends StateEmitter implements MutableSharedEmitter { /// Creates a [MutableStateEmitter] with the given [initialValue]. /// /// Supports synchronous or asynchronous state emission via [sync]. @@ -71,8 +70,7 @@ abstract interface class MutableStateEmitter extends StateEmitter /// /// See also: /// - [MutableStateEmitter] for the interface. -class StateEmitterImpl extends StreamView - implements MutableStateEmitter { +class StateEmitterImpl extends StreamView implements MutableStateEmitter { /// Creates a [StateEmitterImpl] with the given [initialValue]. /// /// Supports synchronous or asynchronous state emission via [sync]. diff --git a/packages/stream_core/lib/src/ws/client/engine/stream_web_socket_engine.dart b/packages/stream_core/lib/src/ws/client/engine/stream_web_socket_engine.dart index 5f5194c..7a70596 100644 --- a/packages/stream_core/lib/src/ws/client/engine/stream_web_socket_engine.dart +++ b/packages/stream_core/lib/src/ws/client/engine/stream_web_socket_engine.dart @@ -36,9 +36,9 @@ class StreamWebSocketEngine implements WebSocketEngine { WebSocketProvider? wsProvider, WebSocketEngineListener? listener, required WebSocketMessageCodec messageCodec, - }) : _wsProvider = wsProvider ?? _createWebSocket, - _messageCodec = messageCodec, - _listener = listener; + }) : _wsProvider = wsProvider ?? _createWebSocket, + _messageCodec = messageCodec, + _listener = listener; final WebSocketProvider _wsProvider; final WebSocketMessageCodec _messageCodec; diff --git a/packages/stream_core/lib/src/ws/client/engine/web_socket_engine.dart b/packages/stream_core/lib/src/ws/client/engine/web_socket_engine.dart index 9553267..29acf58 100644 --- a/packages/stream_core/lib/src/ws/client/engine/web_socket_engine.dart +++ b/packages/stream_core/lib/src/ws/client/engine/web_socket_engine.dart @@ -181,8 +181,8 @@ class WebSocketEngineException with EquatableMixin implements Exception { String? reason, int? code = 0, this.error, - }) : reason = reason ?? 'Unknown', - code = code ?? 0; + }) : reason = reason ?? 'Unknown', + code = code ?? 0; final String reason; final int code; diff --git a/packages/stream_core/lib/src/ws/client/reconnect/automatic_reconnection_policy.dart b/packages/stream_core/lib/src/ws/client/reconnect/automatic_reconnection_policy.dart index 6481c3a..e26ee52 100644 --- a/packages/stream_core/lib/src/ws/client/reconnect/automatic_reconnection_policy.dart +++ b/packages/stream_core/lib/src/ws/client/reconnect/automatic_reconnection_policy.dart @@ -12,8 +12,7 @@ abstract interface class AutomaticReconnectionPolicy { /// A reconnection policy that checks if automatic reconnection is enabled /// based on the current state of the WebSocket connection. -class WebSocketAutomaticReconnectionPolicy - implements AutomaticReconnectionPolicy { +class WebSocketAutomaticReconnectionPolicy implements AutomaticReconnectionPolicy { /// Creates a [WebSocketAutomaticReconnectionPolicy]. WebSocketAutomaticReconnectionPolicy({required this.connectionState}); @@ -30,8 +29,7 @@ class WebSocketAutomaticReconnectionPolicy /// A reconnection policy that checks for internet connectivity before allowing /// reconnection. This prevents unnecessary reconnection attempts when there's no /// network available. -class InternetAvailabilityReconnectionPolicy - implements AutomaticReconnectionPolicy { +class InternetAvailabilityReconnectionPolicy implements AutomaticReconnectionPolicy { /// Creates an [InternetAvailabilityReconnectionPolicy]. InternetAvailabilityReconnectionPolicy({required this.networkState}); @@ -69,7 +67,7 @@ enum Operator { /// Requires ANY policy to return `true` for reconnection to be allowed. /// If at least one policy returns `true`, reconnection will be attempted. - or; + or, } /// A composite reconnection policy that combines multiple [policies] using a diff --git a/packages/stream_core/lib/src/ws/client/reconnect/connection_recovery_handler.dart b/packages/stream_core/lib/src/ws/client/reconnect/connection_recovery_handler.dart index 3dc70c1..3cbfcd3 100644 --- a/packages/stream_core/lib/src/ws/client/reconnect/connection_recovery_handler.dart +++ b/packages/stream_core/lib/src/ws/client/reconnect/connection_recovery_handler.dart @@ -42,23 +42,23 @@ class ConnectionRecoveryHandler extends Disposable { bool keepConnectionAliveInBackground = false, List? policies, RetryStrategy? retryStrategy, - }) : _client = client, - _reconnectStrategy = retryStrategy ?? RetryStrategy(), - _keepConnectionAliveInBackground = keepConnectionAliveInBackground, - _policies = [ - if (policies != null) ...policies, - WebSocketAutomaticReconnectionPolicy( - connectionState: client.connectionState, - ), - if (networkStateProvider case final provider?) - InternetAvailabilityReconnectionPolicy( - networkState: provider.state, - ), - if (lifecycleStateProvider case final provider?) - BackgroundStateReconnectionPolicy( - appLifecycleState: provider.state, - ), - ] { + }) : _client = client, + _reconnectStrategy = retryStrategy ?? RetryStrategy(), + _keepConnectionAliveInBackground = keepConnectionAliveInBackground, + _policies = [ + if (policies != null) ...policies, + WebSocketAutomaticReconnectionPolicy( + connectionState: client.connectionState, + ), + if (networkStateProvider case final provider?) + InternetAvailabilityReconnectionPolicy( + networkState: provider.state, + ), + if (lifecycleStateProvider case final provider?) + BackgroundStateReconnectionPolicy( + appLifecycleState: provider.state, + ), + ] { // Listen to connection state changes. _client.connectionState.on(_onConnectionStateChanged).addTo(_subscriptions); diff --git a/packages/stream_core/lib/src/ws/client/reconnect/retry_strategy.dart b/packages/stream_core/lib/src/ws/client/reconnect/retry_strategy.dart index 43e6256..84278d0 100644 --- a/packages/stream_core/lib/src/ws/client/reconnect/retry_strategy.dart +++ b/packages/stream_core/lib/src/ws/client/reconnect/retry_strategy.dart @@ -65,13 +65,14 @@ class DefaultRetryStrategy implements RetryStrategy { static const maximumReconnectionDelayInSeconds = 25; @override - int consecutiveFailuresCount = 0; + int get consecutiveFailuresCount => _consecutiveFailuresCount; + var _consecutiveFailuresCount = 0; @override - void incrementConsecutiveFailures() => consecutiveFailuresCount++; + void incrementConsecutiveFailures() => _consecutiveFailuresCount++; @override - void resetConsecutiveFailures() => consecutiveFailuresCount = 0; + void resetConsecutiveFailures() => _consecutiveFailuresCount = 0; @override Duration getNextRetryDelay() { diff --git a/packages/stream_core/lib/src/ws/client/stream_web_socket_client.dart b/packages/stream_core/lib/src/ws/client/stream_web_socket_client.dart index 5022433..3e6c4ec 100644 --- a/packages/stream_core/lib/src/ws/client/stream_web_socket_client.dart +++ b/packages/stream_core/lib/src/ws/client/stream_web_socket_client.dart @@ -40,8 +40,7 @@ WsRequest _defaultPingRequestBuilder([HealthCheckInfo? info]) { /// /// await client.connect(); /// ``` -class StreamWebSocketClient - implements WebSocketHealthListener, WebSocketEngineListener { +class StreamWebSocketClient implements WebSocketHealthListener, WebSocketEngineListener { /// Creates a new instance of [StreamWebSocketClient]. StreamWebSocketClient({ required this.options, @@ -121,7 +120,7 @@ class StreamWebSocketClient final result = await _engine.open(options); // If some failure occurs, disconnect and rethrow the error. - return result.recover((_, __) => onClose()).getOrThrow(); + return result.recover((_, _) => onClose()).getOrThrow(); } /// Closes the WebSocket connection. @@ -162,11 +161,11 @@ class StreamWebSocketClient // Any active state that wasn’t user/system initiated becomes server initiated. Connecting() || Authenticating() || Connected() => ServerInitiated( - error: WebSocketEngineException( - code: closeCode, - reason: closeReason, - ), + error: WebSocketEngineException( + code: closeCode, + reason: closeReason, ), + ), // Not meaningful to transition from these; just log and bail. Initialized() || Disconnected() => null, diff --git a/packages/stream_core/lib/src/ws/client/web_socket_connection_state.dart b/packages/stream_core/lib/src/ws/client/web_socket_connection_state.dart index 4eff935..87a6cac 100644 --- a/packages/stream_core/lib/src/ws/client/web_socket_connection_state.dart +++ b/packages/stream_core/lib/src/ws/client/web_socket_connection_state.dart @@ -16,8 +16,7 @@ typedef ConnectionStateEmitter = StateEmitter; /// /// Extends [ConnectionStateEmitter] with the ability to update the current state. /// Used internally by WebSocket client implementations to manage state transitions. -typedef MutableConnectionStateEmitter - = MutableStateEmitter; +typedef MutableConnectionStateEmitter = MutableStateEmitter; /// Represents the current state of a WebSocket connection. /// @@ -107,16 +106,16 @@ sealed class WebSocketConnectionState extends Equatable { bool get isAutomaticReconnectionEnabled { return switch (this) { Disconnected(:final source) => switch (source) { - ServerInitiated() => switch (source.error?.apiError) { - final error? when error.code == 1000 => false, - final error? when error.isTokenExpiredError => false, - final error? when error.isClientError => false, - _ => true, // Reconnect on other server initiated disconnections - }, - UnHealthyConnection() => true, - SystemInitiated() => true, - UserInitiated() => false, + ServerInitiated() => switch (source.error?.apiError) { + final error? when error.code == 1000 => false, + final error? when error.isTokenExpiredError => false, + final error? when error.isClientError => false, + _ => true, // Reconnect on other server initiated disconnections }, + UnHealthyConnection() => true, + SystemInitiated() => true, + UserInitiated() => false, + }, _ => false, // No automatic reconnection for other states }; } diff --git a/packages/stream_core/lib/src/ws/events/ws_request.dart b/packages/stream_core/lib/src/ws/events/ws_request.dart index 2feb688..3fdc65e 100644 --- a/packages/stream_core/lib/src/ws/events/ws_request.dart +++ b/packages/stream_core/lib/src/ws/events/ws_request.dart @@ -18,7 +18,7 @@ final class HealthCheckPingEvent extends WsRequest { Map toJson() { return { 'type': 'health.check', - if (connectionId case final id?) 'client_id': id, + 'client_id': ?connectionId, }; } } diff --git a/packages/stream_core/pubspec.yaml b/packages/stream_core/pubspec.yaml index f9d556f..aaf6294 100644 --- a/packages/stream_core/pubspec.yaml +++ b/packages/stream_core/pubspec.yaml @@ -16,7 +16,7 @@ repository: https://github.com/GetStream/stream-core-flutter # 2. Add it to the melos.yaml file for future updates. environment: - sdk: ^3.6.2 + sdk: ^3.10.0 dependencies: collection: ^1.19.0 @@ -36,7 +36,7 @@ dependencies: web_socket_channel: ^3.0.1 dev_dependencies: - build_runner: ^2.4.15 + build_runner: ^2.10.5 json_serializable: ^6.9.5 mocktail: ^1.0.4 test: ^1.26.2 diff --git a/packages/stream_core/test/query/filter_test.dart b/packages/stream_core/test/query/filter_test.dart index 86c3f3e..a949ca3 100644 --- a/packages/stream_core/test/query/filter_test.dart +++ b/packages/stream_core/test/query/filter_test.dart @@ -743,8 +743,7 @@ void main() { final model = TestModel(metadata: {'a': 1, 'b': 2}); expect( - Filter.equal(TestFilterField.metadata, {'b': 2, 'a': 1}) - .matches(model), + Filter.equal(TestFilterField.metadata, {'b': 2, 'a': 1}).matches(model), isTrue, ); }); @@ -796,23 +795,19 @@ void main() { final modelWithoutDiacritic = TestModel(name: 'Jose'); expect( - Filter.equal(TestFilterField.name, 'José') - .matches(modelWithDiacritic), + Filter.equal(TestFilterField.name, 'José').matches(modelWithDiacritic), isTrue, ); expect( - Filter.equal(TestFilterField.name, 'José') - .matches(modelWithoutDiacritic), + Filter.equal(TestFilterField.name, 'José').matches(modelWithoutDiacritic), isFalse, ); expect( - Filter.equal(TestFilterField.name, 'Jose') - .matches(modelWithDiacritic), + Filter.equal(TestFilterField.name, 'Jose').matches(modelWithDiacritic), isFalse, ); expect( - Filter.equal(TestFilterField.name, 'jose') - .matches(modelWithDiacritic), + Filter.equal(TestFilterField.name, 'jose').matches(modelWithDiacritic), isFalse, ); }); @@ -873,18 +868,15 @@ void main() { final model = TestModel(name: 'John'); expect( - Filter.in_(TestFilterField.name, ['John', 'Jane', 'Bob']) - .matches(model), + Filter.in_(TestFilterField.name, ['John', 'Jane', 'Bob']).matches(model), isTrue, ); expect( - Filter.in_(TestFilterField.name, ['john', 'Jane', 'Bob']) - .matches(model), + Filter.in_(TestFilterField.name, ['john', 'Jane', 'Bob']).matches(model), isFalse, ); expect( - Filter.in_(TestFilterField.name, ['JOHN', 'Jane', 'Bob']) - .matches(model), + Filter.in_(TestFilterField.name, ['JOHN', 'Jane', 'Bob']).matches(model), isFalse, ); }); @@ -894,23 +886,27 @@ void main() { final modelWithoutDiacritic = TestModel(name: 'Jose'); expect( - Filter.in_(TestFilterField.name, ['José', 'François', 'Müller']) - .matches(modelWithDiacritic), + Filter.in_(TestFilterField.name, [ + 'José', + 'François', + 'Müller', + ]).matches(modelWithDiacritic), isTrue, ); expect( - Filter.in_(TestFilterField.name, ['José', 'François', 'Müller']) - .matches(modelWithoutDiacritic), + Filter.in_(TestFilterField.name, [ + 'José', + 'François', + 'Müller', + ]).matches(modelWithoutDiacritic), isFalse, ); expect( - Filter.in_(TestFilterField.name, ['Jose', 'Francois']) - .matches(modelWithDiacritic), + Filter.in_(TestFilterField.name, ['Jose', 'Francois']).matches(modelWithDiacritic), isFalse, ); expect( - Filter.in_(TestFilterField.name, ['jose', 'françois']) - .matches(modelWithDiacritic), + Filter.in_(TestFilterField.name, ['jose', 'françois']).matches(modelWithDiacritic), isFalse, ); }); @@ -921,8 +917,7 @@ void main() { final model = TestModel(metadata: {'a': 1, 'b': 2, 'c': 3}); expect( - Filter.contains(TestFilterField.metadata, {'a': 1, 'b': 2}) - .matches(model), + Filter.contains(TestFilterField.metadata, {'a': 1, 'b': 2}).matches(model), isTrue, ); expect( @@ -935,8 +930,7 @@ void main() { final modelWithNull = TestModel(metadata: {'status': null}); final modelWithoutKey = TestModel(metadata: {'name': 'John'}); - final filter = - Filter.contains(TestFilterField.metadata, {'status': null}); + final filter = Filter.contains(TestFilterField.metadata, {'status': null}); expect(filter.matches(modelWithNull), isTrue); expect(filter.matches(modelWithoutKey), isFalse); @@ -1008,14 +1002,12 @@ void main() { // Filter with duplicates should match (duplicates ignored) expect( - Filter.contains(TestFilterField.tags, ['a', 'a', 'a']) - .matches(model), + Filter.contains(TestFilterField.tags, ['a', 'a', 'a']).matches(model), isTrue, // Should be TRUE, not FALSE ); expect( - Filter.contains(TestFilterField.tags, ['a', 'b', 'a']) - .matches(model), + Filter.contains(TestFilterField.tags, ['a', 'b', 'a']).matches(model), isTrue, ); }, @@ -1067,18 +1059,15 @@ void main() { final model = TestModel(createdAt: DateTime(2023, 6, 15)); expect( - Filter.greater(TestFilterField.createdAt, DateTime(2023, 1, 1)) - .matches(model), + Filter.greater(TestFilterField.createdAt, DateTime(2023, 1, 1)).matches(model), isTrue, ); expect( - Filter.greater(TestFilterField.createdAt, DateTime(2023, 6, 15)) - .matches(model), + Filter.greater(TestFilterField.createdAt, DateTime(2023, 6, 15)).matches(model), isFalse, ); expect( - Filter.greater(TestFilterField.createdAt, DateTime(2024, 1, 1)) - .matches(model), + Filter.greater(TestFilterField.createdAt, DateTime(2024, 1, 1)).matches(model), isFalse, ); }); @@ -1086,67 +1075,55 @@ void main() { test('Greater should use lexicographic comparison for strings', () { // Lexicographic: uppercase < lowercase expect( - Filter.greater(TestFilterField.name, 'John') - .matches(TestModel(name: 'Johnny')), + Filter.greater(TestFilterField.name, 'John').matches(TestModel(name: 'Johnny')), isTrue, ); expect( - Filter.greater(TestFilterField.name, 'John') - .matches(TestModel(name: 'Mike')), + Filter.greater(TestFilterField.name, 'John').matches(TestModel(name: 'Mike')), isTrue, ); expect( - Filter.greater(TestFilterField.name, 'John') - .matches(TestModel(name: 'john')), + Filter.greater(TestFilterField.name, 'John').matches(TestModel(name: 'john')), isTrue, ); expect( - Filter.greater(TestFilterField.name, 'John') - .matches(TestModel(name: 'John')), + Filter.greater(TestFilterField.name, 'John').matches(TestModel(name: 'John')), isFalse, ); expect( - Filter.greater(TestFilterField.name, 'John') - .matches(TestModel(name: 'JOHN')), + Filter.greater(TestFilterField.name, 'John').matches(TestModel(name: 'JOHN')), isFalse, ); expect( - Filter.greater(TestFilterField.name, 'John') - .matches(TestModel(name: 'Alice')), + Filter.greater(TestFilterField.name, 'John').matches(TestModel(name: 'Alice')), isFalse, ); }); test('Greater should handle diacritics lexicographically', () { expect( - Filter.greater(TestFilterField.name, 'José') - .matches(TestModel(name: 'Joséa')), + Filter.greater(TestFilterField.name, 'José').matches(TestModel(name: 'Joséa')), isTrue, ); expect( - Filter.greater(TestFilterField.name, 'José') - .matches(TestModel(name: 'joséa')), + Filter.greater(TestFilterField.name, 'José').matches(TestModel(name: 'joséa')), isTrue, ); expect( - Filter.greater(TestFilterField.name, 'José') - .matches(TestModel(name: 'José')), + Filter.greater(TestFilterField.name, 'José').matches(TestModel(name: 'José')), isFalse, ); expect( - Filter.greater(TestFilterField.name, 'José') - .matches(TestModel(name: 'Jose')), + Filter.greater(TestFilterField.name, 'José').matches(TestModel(name: 'Jose')), isFalse, ); expect( - Filter.greater(TestFilterField.name, 'José') - .matches(TestModel(name: 'jose')), + Filter.greater(TestFilterField.name, 'José').matches(TestModel(name: 'jose')), isTrue, ); }); - test('GreaterOrEqual should match when field value is greater or equal', - () { + test('GreaterOrEqual should match when field value is greater or equal', () { final model = TestModel(id: '50'); expect( @@ -1163,36 +1140,29 @@ void main() { ); }); - test('GreaterOrEqual should use lexicographic comparison for strings', - () { + test('GreaterOrEqual should use lexicographic comparison for strings', () { expect( - Filter.greaterOrEqual(TestFilterField.name, 'John') - .matches(TestModel(name: 'Johnny')), + Filter.greaterOrEqual(TestFilterField.name, 'John').matches(TestModel(name: 'Johnny')), isTrue, ); expect( - Filter.greaterOrEqual(TestFilterField.name, 'John') - .matches(TestModel(name: 'Mike')), + Filter.greaterOrEqual(TestFilterField.name, 'John').matches(TestModel(name: 'Mike')), isTrue, ); expect( - Filter.greaterOrEqual(TestFilterField.name, 'John') - .matches(TestModel(name: 'john')), + Filter.greaterOrEqual(TestFilterField.name, 'John').matches(TestModel(name: 'john')), isTrue, ); expect( - Filter.greaterOrEqual(TestFilterField.name, 'John') - .matches(TestModel(name: 'John')), + Filter.greaterOrEqual(TestFilterField.name, 'John').matches(TestModel(name: 'John')), isTrue, ); expect( - Filter.greaterOrEqual(TestFilterField.name, 'John') - .matches(TestModel(name: 'JOHN')), + Filter.greaterOrEqual(TestFilterField.name, 'John').matches(TestModel(name: 'JOHN')), isFalse, ); expect( - Filter.greaterOrEqual(TestFilterField.name, 'John') - .matches(TestModel(name: 'Alice')), + Filter.greaterOrEqual(TestFilterField.name, 'John').matches(TestModel(name: 'Alice')), isFalse, ); }); @@ -1201,51 +1171,42 @@ void main() { final model = TestModel(createdAt: DateTime(2023, 6, 15)); expect( - Filter.less(TestFilterField.createdAt, DateTime(2024, 1, 1)) - .matches(model), + Filter.less(TestFilterField.createdAt, DateTime(2024, 1, 1)).matches(model), isTrue, ); expect( - Filter.less(TestFilterField.createdAt, DateTime(2023, 6, 15)) - .matches(model), + Filter.less(TestFilterField.createdAt, DateTime(2023, 6, 15)).matches(model), isFalse, ); expect( - Filter.less(TestFilterField.createdAt, DateTime(2023, 1, 1)) - .matches(model), + Filter.less(TestFilterField.createdAt, DateTime(2023, 1, 1)).matches(model), isFalse, ); }); test('Less should use lexicographic comparison for strings', () { expect( - Filter.less(TestFilterField.name, 'John') - .matches(TestModel(name: 'Johnny')), + Filter.less(TestFilterField.name, 'John').matches(TestModel(name: 'Johnny')), isFalse, ); expect( - Filter.less(TestFilterField.name, 'John') - .matches(TestModel(name: 'Mike')), + Filter.less(TestFilterField.name, 'John').matches(TestModel(name: 'Mike')), isFalse, ); expect( - Filter.less(TestFilterField.name, 'John') - .matches(TestModel(name: 'john')), + Filter.less(TestFilterField.name, 'John').matches(TestModel(name: 'john')), isFalse, ); expect( - Filter.less(TestFilterField.name, 'John') - .matches(TestModel(name: 'John')), + Filter.less(TestFilterField.name, 'John').matches(TestModel(name: 'John')), isFalse, ); expect( - Filter.less(TestFilterField.name, 'John') - .matches(TestModel(name: 'JOHN')), + Filter.less(TestFilterField.name, 'John').matches(TestModel(name: 'JOHN')), isTrue, ); expect( - Filter.less(TestFilterField.name, 'John') - .matches(TestModel(name: 'Alice')), + Filter.less(TestFilterField.name, 'John').matches(TestModel(name: 'Alice')), isTrue, ); }); @@ -1269,33 +1230,27 @@ void main() { test('LessOrEqual should use lexicographic comparison for strings', () { expect( - Filter.lessOrEqual(TestFilterField.name, 'John') - .matches(TestModel(name: 'Johnny')), + Filter.lessOrEqual(TestFilterField.name, 'John').matches(TestModel(name: 'Johnny')), isFalse, ); expect( - Filter.lessOrEqual(TestFilterField.name, 'John') - .matches(TestModel(name: 'Mike')), + Filter.lessOrEqual(TestFilterField.name, 'John').matches(TestModel(name: 'Mike')), isFalse, ); expect( - Filter.lessOrEqual(TestFilterField.name, 'John') - .matches(TestModel(name: 'john')), + Filter.lessOrEqual(TestFilterField.name, 'John').matches(TestModel(name: 'john')), isFalse, ); expect( - Filter.lessOrEqual(TestFilterField.name, 'John') - .matches(TestModel(name: 'John')), + Filter.lessOrEqual(TestFilterField.name, 'John').matches(TestModel(name: 'John')), isTrue, ); expect( - Filter.lessOrEqual(TestFilterField.name, 'John') - .matches(TestModel(name: 'JOHN')), + Filter.lessOrEqual(TestFilterField.name, 'John').matches(TestModel(name: 'JOHN')), isTrue, ); expect( - Filter.lessOrEqual(TestFilterField.name, 'John') - .matches(TestModel(name: 'Alice')), + Filter.lessOrEqual(TestFilterField.name, 'John').matches(TestModel(name: 'Alice')), isTrue, ); }); @@ -1321,8 +1276,7 @@ void main() { ); }); - test('should return false for NULL comparisons (PostgreSQL semantics)', - () { + test('should return false for NULL comparisons (PostgreSQL semantics)', () { final modelWithNull = TestModel(id: null); final modelWithValue = TestModel(id: '50'); @@ -1344,20 +1298,17 @@ void main() { // GreaterOrEqual: NULL >= value → false expect( - Filter.greaterOrEqual(TestFilterField.id, '30') - .matches(modelWithNull), + Filter.greaterOrEqual(TestFilterField.id, '30').matches(modelWithNull), isFalse, ); // GreaterOrEqual: value >= NULL → false expect( - Filter.greaterOrEqual(TestFilterField.id, null) - .matches(modelWithValue), + Filter.greaterOrEqual(TestFilterField.id, null).matches(modelWithValue), isFalse, ); // GreaterOrEqual: NULL >= NULL → false expect( - Filter.greaterOrEqual(TestFilterField.id, null) - .matches(modelWithNull), + Filter.greaterOrEqual(TestFilterField.id, null).matches(modelWithNull), isFalse, ); @@ -1473,8 +1424,7 @@ void main() { final filter = Filter.query(TestFilterField.name, 'PROD'); final itemWithLowercase = TestModel(name: 'production server'); - final itemWithMixedCase = - TestModel(name: 'Development Production Environment'); + final itemWithMixedCase = TestModel(name: 'Development Production Environment'); final itemWithPartialMatch = TestModel(name: 'reproduced issue'); final itemWithoutMatch = TestModel(name: 'staging server'); @@ -1495,46 +1445,38 @@ void main() { test('should handle diacritics case-insensitively', () { expect( - Filter.query(TestFilterField.name, 'josé') - .matches(TestModel(name: 'José')), + Filter.query(TestFilterField.name, 'josé').matches(TestModel(name: 'José')), isTrue, ); expect( - Filter.query(TestFilterField.name, 'josé') - .matches(TestModel(name: 'JOSÉ')), + Filter.query(TestFilterField.name, 'josé').matches(TestModel(name: 'JOSÉ')), isTrue, ); expect( - Filter.query(TestFilterField.name, 'josé') - .matches(TestModel(name: 'josé')), + Filter.query(TestFilterField.name, 'josé').matches(TestModel(name: 'josé')), isTrue, ); expect( - Filter.query(TestFilterField.name, 'josé') - .matches(TestModel(name: 'Jose')), + Filter.query(TestFilterField.name, 'josé').matches(TestModel(name: 'Jose')), isFalse, ); expect( - Filter.query(TestFilterField.name, 'josé') - .matches(TestModel(name: 'jose')), + Filter.query(TestFilterField.name, 'josé').matches(TestModel(name: 'jose')), isFalse, ); }); test('should match middle and end substrings', () { expect( - Filter.query(TestFilterField.name, 'hn') - .matches(TestModel(name: 'John')), + Filter.query(TestFilterField.name, 'hn').matches(TestModel(name: 'John')), isTrue, ); expect( - Filter.query(TestFilterField.name, 'hn') - .matches(TestModel(name: 'JOHN')), + Filter.query(TestFilterField.name, 'hn').matches(TestModel(name: 'JOHN')), isTrue, ); expect( - Filter.query(TestFilterField.name, 'hn') - .matches(TestModel(name: 'Jane')), + Filter.query(TestFilterField.name, 'hn').matches(TestModel(name: 'Jane')), isFalse, ); }); @@ -1563,13 +1505,11 @@ void main() { final modelWithEmptyName = TestModel(name: ''); expect( - Filter.autoComplete(TestFilterField.name, '') - .matches(modelWithContent), + Filter.autoComplete(TestFilterField.name, '').matches(modelWithContent), isFalse, ); expect( - Filter.autoComplete(TestFilterField.name, '') - .matches(modelWithEmptyName), + Filter.autoComplete(TestFilterField.name, '').matches(modelWithEmptyName), isFalse, ); }); @@ -1578,10 +1518,8 @@ void main() { final filter = Filter.autoComplete(TestFilterField.name, 'con'); final itemWithDotSeparation = TestModel(name: 'app.config.json'); - final itemWithDashSeparation = - TestModel(name: 'user-configuration-file'); - final itemWithMixedPunctuation = - TestModel(name: 'system/container,settings.xml'); + final itemWithDashSeparation = TestModel(name: 'user-configuration-file'); + final itemWithMixedPunctuation = TestModel(name: 'system/container,settings.xml'); final itemWithoutWordPrefix = TestModel(name: 'application'); final itemWithInWordMatch = TestModel(name: 'reconstruction'); @@ -1603,88 +1541,77 @@ void main() { test('should handle diacritics case-insensitively', () { expect( - Filter.autoComplete(TestFilterField.name, 'jos') - .matches(TestModel(name: 'José')), + Filter.autoComplete(TestFilterField.name, 'jos').matches(TestModel(name: 'José')), isTrue, ); expect( - Filter.autoComplete(TestFilterField.name, 'jos') - .matches(TestModel(name: 'JOSÉ')), + Filter.autoComplete(TestFilterField.name, 'jos').matches(TestModel(name: 'JOSÉ')), isTrue, ); expect( - Filter.autoComplete(TestFilterField.name, 'jos') - .matches(TestModel(name: 'josé')), + Filter.autoComplete(TestFilterField.name, 'jos').matches(TestModel(name: 'josé')), isTrue, ); }); test('should match word boundaries in multi-word text', () { expect( - Filter.autoComplete(TestFilterField.name, 'john') - .matches(TestModel(name: 'John Smith')), + Filter.autoComplete(TestFilterField.name, 'john').matches(TestModel(name: 'John Smith')), isTrue, ); expect( - Filter.autoComplete(TestFilterField.name, 'john') - .matches(TestModel(name: 'JOHN DOE')), + Filter.autoComplete(TestFilterField.name, 'john').matches(TestModel(name: 'JOHN DOE')), isTrue, ); expect( - Filter.autoComplete(TestFilterField.name, 'john') - .matches(TestModel(name: 'Smith John')), + Filter.autoComplete(TestFilterField.name, 'john').matches(TestModel(name: 'Smith John')), isTrue, ); expect( - Filter.autoComplete(TestFilterField.name, 'smi') - .matches(TestModel(name: 'John Smith')), + Filter.autoComplete(TestFilterField.name, 'smi').matches(TestModel(name: 'John Smith')), isTrue, ); expect( - Filter.autoComplete(TestFilterField.name, 'smi') - .matches(TestModel(name: 'Johnson')), + Filter.autoComplete(TestFilterField.name, 'smi').matches(TestModel(name: 'Johnson')), isFalse, ); }); test('should handle punctuation as word boundaries', () { expect( - Filter.autoComplete(TestFilterField.name, 'john') - .matches(TestModel(name: 'john-doe')), + Filter.autoComplete(TestFilterField.name, 'john').matches(TestModel(name: 'john-doe')), isTrue, ); expect( - Filter.autoComplete(TestFilterField.name, 'john') - .matches(TestModel(name: 'john.doe')), + Filter.autoComplete(TestFilterField.name, 'john').matches(TestModel(name: 'john.doe')), isTrue, ); expect( - Filter.autoComplete(TestFilterField.name, 'john') - .matches(TestModel(name: 'Johnson')), + Filter.autoComplete(TestFilterField.name, 'john').matches(TestModel(name: 'Johnson')), isTrue, ); }); test('should not match when query is longer than word', () { expect( - Filter.autoComplete(TestFilterField.name, 'johnathan') - .matches(TestModel(name: 'John')), + Filter.autoComplete(TestFilterField.name, 'johnathan').matches(TestModel(name: 'John')), isFalse, ); }); test('should return false for non-string fields', () { expect( - Filter.autoComplete(TestFilterField.metadata, 'test') - .matches(TestModel(metadata: {'key': 'value'})), + Filter.autoComplete( + TestFilterField.metadata, + 'test', + ).matches(TestModel(metadata: {'key': 'value'})), isFalse, ); }); test('should return false for fields with only punctuation', () { expect( - Filter.autoComplete(TestFilterField.name, 'test') - .matches(TestModel(name: '...')), + Filter.autoComplete(TestFilterField.name, 'test').matches(TestModel(name: '...')), isFalse, ); }); @@ -1701,13 +1628,11 @@ void main() { ); expect( - Filter.pathExists(TestFilterField.metadata, 'user.profile.name') - .matches(model), + Filter.pathExists(TestFilterField.metadata, 'user.profile.name').matches(model), isTrue, ); expect( - Filter.pathExists(TestFilterField.metadata, 'user.profile.age') - .matches(model), + Filter.pathExists(TestFilterField.metadata, 'user.profile.age').matches(model), isFalse, ); }); @@ -1738,8 +1663,7 @@ void main() { final model = TestModel(metadata: null); expect( - Filter.pathExists(TestFilterField.metadata, 'user.name') - .matches(model), + Filter.pathExists(TestFilterField.metadata, 'user.name').matches(model), isFalse, ); }); @@ -1761,8 +1685,7 @@ void main() { ); expect( - Filter.pathExists(TestFilterField.metadata, 'user.name') - .matches(model), + Filter.pathExists(TestFilterField.metadata, 'user.name').matches(model), isFalse, ); }); @@ -1773,15 +1696,13 @@ void main() { // Path exists but value is null - should match (key exists) expect( - Filter.pathExists(TestFilterField.metadata, 'user') - .matches(modelWithNull), + Filter.pathExists(TestFilterField.metadata, 'user').matches(modelWithNull), isTrue, ); // Path doesn't exist - should not match expect( - Filter.pathExists(TestFilterField.metadata, 'user') - .matches(modelWithoutKey), + Filter.pathExists(TestFilterField.metadata, 'user').matches(modelWithoutKey), isFalse, ); }); @@ -1876,9 +1797,7 @@ void main() { ); }); - test( - 'should handle null values in optional fields (PostgreSQL semantics)', - () { + test('should handle null values in optional fields (PostgreSQL semantics)', () { final modelWithNull = TestModel(name: null); final modelWithValue = TestModel(name: 'John'); @@ -1935,8 +1854,7 @@ void main() { isTrue, ); expect( - Filter.contains(TestFilterField.metadata, {}) - .matches(modelWithValues), + Filter.contains(TestFilterField.metadata, {}).matches(modelWithValues), isTrue, ); }); diff --git a/packages/stream_core/test/query/list_extensions_test.dart b/packages/stream_core/test/query/list_extensions_test.dart index 4bd5da4..0e261a5 100644 --- a/packages/stream_core/test/query/list_extensions_test.dart +++ b/packages/stream_core/test/query/list_extensions_test.dart @@ -265,8 +265,7 @@ void main() { final result = users.updateWhere( (user) => user.id == '2', - update: (user) => - _TestUser(id: user.id, name: '${user.name} Updated'), + update: (user) => _TestUser(id: user.id, name: '${user.name} Updated'), ); expect(result.length, 3); @@ -287,8 +286,7 @@ void main() { final result = scores.updateWhere( (score) => score.points < 100, - update: (score) => - _TestScore(userId: score.userId, points: score.points * 2), + update: (score) => _TestScore(userId: score.userId, points: score.points * 2), ); expect(result.length, 4); @@ -322,8 +320,7 @@ void main() { final result = users.updateWhere( (user) => true, - update: (user) => - _TestUser(id: user.id, name: '${user.name} Updated'), + update: (user) => _TestUser(id: user.id, name: '${user.name} Updated'), ); expect(result.length, 2); @@ -374,8 +371,7 @@ void main() { final result = scores.updateWhere( (score) => score.points >= 150 && score.points <= 200, - update: (score) => - _TestScore(userId: score.userId, points: score.points + 50), + update: (score) => _TestScore(userId: score.userId, points: score.points + 50), ); expect(result[0].points, 100); // Unchanged @@ -403,8 +399,7 @@ void main() { expect(result[2].points, 150); }); - test('should sort multiple updated elements when compare is provided', - () { + test('should sort multiple updated elements when compare is provided', () { final users = [ const _TestUser(id: '1', name: 'Alice'), const _TestUser(id: '2', name: 'Bob'), @@ -414,8 +409,7 @@ void main() { final result = users.updateWhere( (user) => user.id == '2' || user.id == '4', - update: (user) => - _TestUser(id: user.id, name: 'Z${user.name}'), // Prefix with Z + update: (user) => _TestUser(id: user.id, name: 'Z${user.name}'), // Prefix with Z compare: (a, b) => a.name.compareTo(b.name), // Ascending by name ); @@ -701,8 +695,7 @@ void main() { test('should insert element at correct position in sorted list', () { final numbers = [1, 3, 5, 7]; - final result = - numbers.sortedInsert(4, compare: (a, b) => a.compareTo(b)); + final result = numbers.sortedInsert(4, compare: (a, b) => a.compareTo(b)); expect(result, [1, 3, 4, 5, 7]); // Original list should be unchanged @@ -712,8 +705,7 @@ void main() { test('should insert at beginning when element is smallest', () { final numbers = [3, 5, 7]; - final result = - numbers.sortedInsert(1, compare: (a, b) => a.compareTo(b)); + final result = numbers.sortedInsert(1, compare: (a, b) => a.compareTo(b)); expect(result, [1, 3, 5, 7]); }); @@ -721,8 +713,7 @@ void main() { test('should insert at end when element is largest', () { final numbers = [1, 3, 5]; - final result = - numbers.sortedInsert(7, compare: (a, b) => a.compareTo(b)); + final result = numbers.sortedInsert(7, compare: (a, b) => a.compareTo(b)); expect(result, [1, 3, 5, 7]); }); @@ -730,10 +721,8 @@ void main() { test('should work with single element list', () { final numbers = [5]; - final smaller = - numbers.sortedInsert(3, compare: (a, b) => a.compareTo(b)); - final larger = - numbers.sortedInsert(7, compare: (a, b) => a.compareTo(b)); + final smaller = numbers.sortedInsert(3, compare: (a, b) => a.compareTo(b)); + final larger = numbers.sortedInsert(7, compare: (a, b) => a.compareTo(b)); expect(smaller, [3, 5]); expect(larger, [5, 7]); @@ -742,8 +731,7 @@ void main() { test('should work with empty list', () { final numbers = []; - final result = - numbers.sortedInsert(5, compare: (a, b) => a.compareTo(b)); + final result = numbers.sortedInsert(5, compare: (a, b) => a.compareTo(b)); expect(result, [5]); }); @@ -751,8 +739,7 @@ void main() { test('should work with reverse order comparator', () { final numbers = [7, 5, 3, 1]; // Descending order - final result = - numbers.sortedInsert(4, compare: (a, b) => b.compareTo(a)); + final result = numbers.sortedInsert(4, compare: (a, b) => b.compareTo(a)); expect(result, [7, 5, 4, 3, 1]); }); @@ -760,8 +747,7 @@ void main() { test('should work with string sorting', () { final names = ['Alice', 'Charlie', 'David']; - final result = - names.sortedInsert('Bob', compare: (a, b) => a.compareTo(b)); + final result = names.sortedInsert('Bob', compare: (a, b) => a.compareTo(b)); expect(result, ['Alice', 'Bob', 'Charlie', 'David']); }); @@ -785,8 +771,7 @@ void main() { test('should handle duplicate values', () { final numbers = [1, 3, 5, 7]; - final result = - numbers.sortedInsert(3, compare: (a, b) => a.compareTo(b)); + final result = numbers.sortedInsert(3, compare: (a, b) => a.compareTo(b)); expect(result, [1, 3, 3, 5, 7]); }); @@ -838,8 +823,7 @@ void main() { final result = scores.insertUnique( const _TestScore(userId: 4, points: 175), key: (score) => score.userId, - compare: (a, b) => - b.points.compareTo(a.points), // Descending by points + compare: (a, b) => b.points.compareTo(a.points), // Descending by points ); expect(result.length, 4); @@ -847,8 +831,7 @@ void main() { expect(result.map((s) => s.userId), [2, 4, 3, 1]); }); - test('should replace and sort when key exists and compare is provided', - () { + test('should replace and sort when key exists and compare is provided', () { final scores = [ const _TestScore(userId: 1, points: 100), const _TestScore(userId: 2, points: 200), @@ -858,8 +841,7 @@ void main() { final result = scores.insertUnique( const _TestScore(userId: 2, points: 250), // Update existing key: (score) => score.userId, - compare: (a, b) => - b.points.compareTo(a.points), // Descending by points + compare: (a, b) => b.points.compareTo(a.points), // Descending by points ); expect(result.length, 3); @@ -967,8 +949,7 @@ void main() { final result = users.sortedUpsert( const _TestScore(userId: 1, points: 150), key: (score) => score.userId, - compare: (a, b) => - b.points.compareTo(a.points), // Descending by points + compare: (a, b) => b.points.compareTo(a.points), // Descending by points ); expect(result.length, 3); @@ -985,8 +966,7 @@ void main() { final result = users.sortedUpsert( const _TestScore(userId: 2, points: 80), key: (score) => score.userId, - compare: (a, b) => - b.points.compareTo(a.points), // Descending by points + compare: (a, b) => b.points.compareTo(a.points), // Descending by points ); expect(result.length, 3); @@ -1063,8 +1043,7 @@ void main() { final result = scores.sortedUpsert( const _TestScore(userId: 2, points: 50), key: (score) => score.userId, - compare: (a, b) => - b.points.compareTo(a.points), // Descending by points + compare: (a, b) => b.points.compareTo(a.points), // Descending by points update: (original, updated) => _TestScore( userId: original.userId, points: original.points + updated.points, // Add points together @@ -1077,9 +1056,7 @@ void main() { expect(result.map((s) => s.userId), [2, 3, 1]); }); - test( - 'should use default update behavior when update function is not provided', - () { + test('should use default update behavior when update function is not provided', () { final scores = [ const _TestScore(userId: 1, points: 100), const _TestScore(userId: 2, points: 200), @@ -1413,8 +1390,7 @@ void main() { ); // Should return same instance }); - test('should handle multiple matching elements (removes first found)', - () { + test('should handle multiple matching elements (removes first found)', () { final comments = [ const _TestComment(id: '1', text: 'duplicate', replies: []), const _TestComment(id: '2', text: 'duplicate', replies: []), @@ -1471,8 +1447,9 @@ void main() { final mainComment = result.first; expect(mainComment.replies.length, 2); - final controversialComment = mainComment.replies - .firstWhere((c) => c.text == 'Controversial opinion'); + final controversialComment = mainComment.replies.firstWhere( + (c) => c.text == 'Controversial opinion', + ); expect(controversialComment.replies.length, 1); expect(controversialComment.replies.first.text, 'Valid response'); expect(mainComment.modifiedAt, isNotNull); // Root was updated @@ -1506,10 +1483,8 @@ void main() { final result = comments.updateNested( (comment) => comment.id == updatedComment.id, children: (comment) => comment.replies, - update: (comment) => - updatedComment.copyWith(modifiedAt: DateTime.now()), - updateChildren: (parent, newReplies) => - parent.copyWith(replies: newReplies), + update: (comment) => updatedComment.copyWith(modifiedAt: DateTime.now()), + updateChildren: (parent, newReplies) => parent.copyWith(replies: newReplies), ); expect(result.length, 2); @@ -1552,10 +1527,8 @@ void main() { final result = comments.updateNested( (comment) => comment.id == updatedComment.id, children: (comment) => comment.replies, - update: (comment) => - updatedComment.copyWith(modifiedAt: DateTime.now()), - updateChildren: (parent, newReplies) => - parent.copyWith(replies: newReplies), + update: (comment) => updatedComment.copyWith(modifiedAt: DateTime.now()), + updateChildren: (parent, newReplies) => parent.copyWith(replies: newReplies), ); expect(result.length, 1); @@ -1593,12 +1566,9 @@ void main() { final result = comments.updateNested( (comment) => comment.id == updatedComment.id, children: (comment) => comment.replies, - update: (comment) => - updatedComment.copyWith(modifiedAt: DateTime.now()), - updateChildren: (parent, newReplies) => - parent.copyWith(replies: newReplies), - compare: (a, b) => - b.upvotes.compareTo(a.upvotes), // Sort by upvotes desc + update: (comment) => updatedComment.copyWith(modifiedAt: DateTime.now()), + updateChildren: (parent, newReplies) => parent.copyWith(replies: newReplies), + compare: (a, b) => b.upvotes.compareTo(a.upvotes), // Sort by upvotes desc ); expect(result.length, 1); @@ -1649,15 +1619,12 @@ void main() { final result = comments.updateNested( (comment) => comment.id == updatedComment.id, children: (comment) => comment.replies, - update: (comment) => - updatedComment.copyWith(modifiedAt: DateTime.now()), - updateChildren: (parent, newReplies) => - parent.copyWith(replies: newReplies), + update: (comment) => updatedComment.copyWith(modifiedAt: DateTime.now()), + updateChildren: (parent, newReplies) => parent.copyWith(replies: newReplies), ); expect(result.length, 1); - final deepComment = - result.first.replies.first.replies.first.replies.first; + final deepComment = result.first.replies.first.replies.first.replies.first; expect(deepComment.text, 'Updated Level 3'); expect(deepComment.upvotes, 10); expect(deepComment.modifiedAt, isNotNull); @@ -1670,8 +1637,7 @@ void main() { (comment) => comment.id == '1', children: (comment) => comment.replies, update: (comment) => comment.copyWith(modifiedAt: DateTime.now()), - updateChildren: (parent, newReplies) => - parent.copyWith(replies: newReplies), + updateChildren: (parent, newReplies) => parent.copyWith(replies: newReplies), ); expect(result, isEmpty); @@ -1686,8 +1652,7 @@ void main() { (comment) => comment.id == 'nonexistent', children: (comment) => comment.replies, update: (comment) => comment.copyWith(modifiedAt: DateTime.now()), - updateChildren: (parent, newReplies) => - parent.copyWith(replies: newReplies), + updateChildren: (parent, newReplies) => parent.copyWith(replies: newReplies), ); expect( @@ -1737,10 +1702,8 @@ void main() { final result = forumThread.updateNested( (comment) => comment.id == upvotedComment.id, children: (comment) => comment.replies, - update: (comment) => - upvotedComment.copyWith(modifiedAt: DateTime.now()), - updateChildren: (parent, newReplies) => - parent.copyWith(replies: newReplies), + update: (comment) => upvotedComment.copyWith(modifiedAt: DateTime.now()), + updateChildren: (parent, newReplies) => parent.copyWith(replies: newReplies), compare: (a, b) => b.upvotes.compareTo(a.upvotes), // Sort by upvotes ); @@ -1860,11 +1823,11 @@ void main() { final result = deepComments.updateNested( (comment) => comment.id == 'thread1_0', children: (comment) => comment.replies, - update: (comment) => - const _TestComment(id: 'thread1_0', text: 'Updated leaf') - .copyWith(modifiedAt: DateTime.now()), - updateChildren: (parent, newReplies) => - parent.copyWith(replies: newReplies), + update: (comment) => const _TestComment( + id: 'thread1_0', + text: 'Updated leaf', + ).copyWith(modifiedAt: DateTime.now()), + updateChildren: (parent, newReplies) => parent.copyWith(replies: newReplies), ); stopwatch.stop(); @@ -1945,8 +1908,7 @@ void main() { }); group('Concurrent Usage Simulation', () { - test('should maintain immutability under simulated concurrent access', - () { + test('should maintain immutability under simulated concurrent access', () { final baseList = [ const _TestUser(id: '1', name: 'Alice'), const _TestUser(id: '2', name: 'Bob'), @@ -1989,11 +1951,12 @@ void main() { currentState = currentState.updateNested( (comment) => comment.id == '2', children: (comment) => comment.replies, - update: (comment) => - _TestComment(id: '2', text: 'Reply 1', upvotes: 5 + i) - .copyWith(modifiedAt: DateTime.now()), - updateChildren: (parent, newReplies) => - parent.copyWith(replies: newReplies), + update: (comment) => _TestComment( + id: '2', + text: 'Reply 1', + upvotes: 5 + i, + ).copyWith(modifiedAt: DateTime.now()), + updateChildren: (parent, newReplies) => parent.copyWith(replies: newReplies), ); } @@ -2031,8 +1994,7 @@ void main() { authorId: 'user1', content: 'Hello Updated', ), - key: (activity) => - '${activity.authorId}_${activity.content.split(' ').first}', + key: (activity) => '${activity.authorId}_${activity.content.split(' ').first}', ); expect(result.length, 2); // Should replace 'Hello' activity diff --git a/packages/stream_core/test/query/sort_test.dart b/packages/stream_core/test/query/sort_test.dart index 2aeec57..2747b2d 100644 --- a/packages/stream_core/test/query/sort_test.dart +++ b/packages/stream_core/test/query/sort_test.dart @@ -120,10 +120,8 @@ void main() { final field = SortField('birthDate', (p) => p.birthDate); final sort = Sort.asc(field); - final person1990 = - Person(name: 'Person1990', age: 34, birthDate: DateTime(1990)); - final person2000 = - Person(name: 'Person2000', age: 24, birthDate: DateTime(2000)); + final person1990 = Person(name: 'Person1990', age: 34, birthDate: DateTime(1990)); + final person2000 = Person(name: 'Person2000', age: 24, birthDate: DateTime(2000)); expect(sort.compare(person1990, person2000), lessThan(0)); // 1990 < 2000 }); @@ -156,8 +154,7 @@ void main() { final field = SortField('birthDate', (p) => p.birthDate); final sort = Sort.asc(field); - final withDate = - Person(name: 'WithDate', age: 30, birthDate: DateTime(1990)); + final withDate = Person(name: 'WithDate', age: 30, birthDate: DateTime(1990)); const withoutDate = Person(name: 'WithoutDate', age: 25); expect( @@ -174,8 +171,7 @@ void main() { final field = SortField('birthDate', (p) => p.birthDate); final sort = Sort.asc(field, nullOrdering: NullOrdering.nullsFirst); - final withDate = - Person(name: 'WithDate', age: 30, birthDate: DateTime(1990)); + final withDate = Person(name: 'WithDate', age: 30, birthDate: DateTime(1990)); const withoutDate = Person(name: 'WithoutDate', age: 25); expect( @@ -443,9 +439,7 @@ void main() { people.sort(sorts.compare); - final result = people - .map((p) => '${p.name}-${p.score?.toString() ?? 'null'}') - .toList(); + final result = people.map((p) => '${p.name}-${p.score?.toString() ?? 'null'}').toList(); expect( result, equals([ diff --git a/packages/stream_core/test/utils/event_emitter_test.dart b/packages/stream_core/test/utils/event_emitter_test.dart index d304a0b..7947791 100644 --- a/packages/stream_core/test/utils/event_emitter_test.dart +++ b/packages/stream_core/test/utils/event_emitter_test.dart @@ -126,8 +126,7 @@ void main() { expect((values.first as AnotherEvent).value, 5); }); - test('resolver can conditionally transform based on event properties', - () async { + test('resolver can conditionally transform based on event properties', () async { final emitter = MutableEventEmitter( resolvers: [ (event) => event.data.startsWith('transform:') diff --git a/packages/stream_core/test/utils/shared_emitter_test.dart b/packages/stream_core/test/utils/shared_emitter_test.dart index c0013dc..aa97293 100644 --- a/packages/stream_core/test/utils/shared_emitter_test.dart +++ b/packages/stream_core/test/utils/shared_emitter_test.dart @@ -84,8 +84,7 @@ void main() { expect(() => emitter.emit(1), throwsStateError); }); - test('tryEmit catches errors and returns false instead of throwing', - () async { + test('tryEmit catches errors and returns false instead of throwing', () async { final emitter = MutableSharedEmitter(); addTearDown(emitter.close); @@ -409,8 +408,7 @@ void main() { }); group('SharedEmitter vs StateEmitter behavior', () { - test('SharedEmitter does not emit to late subscribers by default', - () async { + test('SharedEmitter does not emit to late subscribers by default', () async { final emitter = MutableSharedEmitter(); addTearDown(emitter.close); @@ -428,8 +426,7 @@ void main() { expect(values, [3]); }); - test('StateEmitter always emits current value to new subscribers', - () async { + test('StateEmitter always emits current value to new subscribers', () async { final emitter = MutableStateEmitter(0); addTearDown(emitter.close); diff --git a/packages/stream_core/test/utils/state_emitter_test.dart b/packages/stream_core/test/utils/state_emitter_test.dart index c5803f5..2805f19 100644 --- a/packages/stream_core/test/utils/state_emitter_test.dart +++ b/packages/stream_core/test/utils/state_emitter_test.dart @@ -25,7 +25,7 @@ void main() { expect(values, [42]); }); - test('updates value on emit', () async { + test('updates value on emit', () { final emitter = MutableStateEmitter(0); addTearDown(emitter.close); @@ -34,7 +34,7 @@ void main() { expect(emitter.value, 42); }); - test('value setter works like emit', () async { + test('value setter works like emit', () { final emitter = MutableStateEmitter(0); addTearDown(emitter.close); @@ -115,7 +115,7 @@ void main() { }); group('atomic update methods', () { - test('update applies function to current value', () async { + test('update applies function to current value', () { final emitter = MutableStateEmitter(10); addTearDown(emitter.close); @@ -124,7 +124,7 @@ void main() { expect(emitter.value, 20); }); - test('getAndUpdate returns previous value and updates', () async { + test('getAndUpdate returns previous value and updates', () { final emitter = MutableStateEmitter(10); addTearDown(emitter.close); @@ -134,7 +134,7 @@ void main() { expect(emitter.value, 15); }); - test('updateAndGet returns new value after update', () async { + test('updateAndGet returns new value after update', () { final emitter = MutableStateEmitter(10); addTearDown(emitter.close); diff --git a/packages/stream_core_flutter/.metadata b/packages/stream_core_flutter/.metadata new file mode 100644 index 0000000..db5194b --- /dev/null +++ b/packages/stream_core_flutter/.metadata @@ -0,0 +1,10 @@ +# This file tracks properties of this Flutter project. +# Used by Flutter tool to assess capabilities and perform upgrades etc. +# +# This file should be version controlled and should not be manually edited. + +version: + revision: "05db9689081f091050f01aed79f04dce0c750154" + channel: "stable" + +project_type: package diff --git a/packages/stream_core_flutter/.pubignore b/packages/stream_core_flutter/.pubignore new file mode 100644 index 0000000..4789f36 --- /dev/null +++ b/packages/stream_core_flutter/.pubignore @@ -0,0 +1,2 @@ +# Exclude assets source from published package +assets_source/ \ No newline at end of file diff --git a/packages/stream_core_flutter/CHANGELOG.md b/packages/stream_core_flutter/CHANGELOG.md new file mode 100644 index 0000000..41cc7d8 --- /dev/null +++ b/packages/stream_core_flutter/CHANGELOG.md @@ -0,0 +1,3 @@ +## 0.0.1 + +* TODO: Describe initial release. diff --git a/packages/stream_core_flutter/LICENSE b/packages/stream_core_flutter/LICENSE new file mode 100644 index 0000000..ba75c69 --- /dev/null +++ b/packages/stream_core_flutter/LICENSE @@ -0,0 +1 @@ +TODO: Add your license here. diff --git a/packages/stream_core_flutter/README.md b/packages/stream_core_flutter/README.md new file mode 100644 index 0000000..4a260d8 --- /dev/null +++ b/packages/stream_core_flutter/README.md @@ -0,0 +1,39 @@ + + +TODO: Put a short description of the package here that helps potential users +know whether this package might be useful for them. + +## Features + +TODO: List what your package can do. Maybe include images, gifs, or videos. + +## Getting started + +TODO: List prerequisites and provide or point to information on how to +start using the package. + +## Usage + +TODO: Include short and useful examples for package users. Add longer examples +to `/example` folder. + +```dart +const like = 'sample'; +``` + +## Additional information + +TODO: Tell users more about the package: where to find more information, how to +contribute to the package, how to file issues, what response they can expect +from the package authors, and more. diff --git a/packages/stream_core_flutter/assets/file_type/filetype-audio-40.svg b/packages/stream_core_flutter/assets/file_type/filetype-audio-40.svg new file mode 100644 index 0000000..44f6a3b --- /dev/null +++ b/packages/stream_core_flutter/assets/file_type/filetype-audio-40.svg @@ -0,0 +1,5 @@ + + + + + diff --git a/packages/stream_core_flutter/assets/file_type/filetype-audio-48.svg b/packages/stream_core_flutter/assets/file_type/filetype-audio-48.svg new file mode 100644 index 0000000..82fbb0d --- /dev/null +++ b/packages/stream_core_flutter/assets/file_type/filetype-audio-48.svg @@ -0,0 +1,5 @@ + + + + + diff --git a/packages/stream_core_flutter/assets/file_type/filetype-code-40.svg b/packages/stream_core_flutter/assets/file_type/filetype-code-40.svg new file mode 100644 index 0000000..c1fe0bb --- /dev/null +++ b/packages/stream_core_flutter/assets/file_type/filetype-code-40.svg @@ -0,0 +1,5 @@ + + + + + diff --git a/packages/stream_core_flutter/assets/file_type/filetype-code-48.svg b/packages/stream_core_flutter/assets/file_type/filetype-code-48.svg new file mode 100644 index 0000000..33c13c9 --- /dev/null +++ b/packages/stream_core_flutter/assets/file_type/filetype-code-48.svg @@ -0,0 +1,5 @@ + + + + + diff --git a/packages/stream_core_flutter/assets/file_type/filetype-compression-40.svg b/packages/stream_core_flutter/assets/file_type/filetype-compression-40.svg new file mode 100644 index 0000000..369eeae --- /dev/null +++ b/packages/stream_core_flutter/assets/file_type/filetype-compression-40.svg @@ -0,0 +1,5 @@ + + + + + diff --git a/packages/stream_core_flutter/assets/file_type/filetype-compression-48.svg b/packages/stream_core_flutter/assets/file_type/filetype-compression-48.svg new file mode 100644 index 0000000..6030e19 --- /dev/null +++ b/packages/stream_core_flutter/assets/file_type/filetype-compression-48.svg @@ -0,0 +1,5 @@ + + + + + diff --git a/packages/stream_core_flutter/assets/file_type/filetype-other-40.svg b/packages/stream_core_flutter/assets/file_type/filetype-other-40.svg new file mode 100644 index 0000000..cc58bbf --- /dev/null +++ b/packages/stream_core_flutter/assets/file_type/filetype-other-40.svg @@ -0,0 +1,7 @@ + + + + + + + diff --git a/packages/stream_core_flutter/assets/file_type/filetype-other-48.svg b/packages/stream_core_flutter/assets/file_type/filetype-other-48.svg new file mode 100644 index 0000000..416ec79 --- /dev/null +++ b/packages/stream_core_flutter/assets/file_type/filetype-other-48.svg @@ -0,0 +1,7 @@ + + + + + + + diff --git a/packages/stream_core_flutter/assets/file_type/filetype-pdf-40.svg b/packages/stream_core_flutter/assets/file_type/filetype-pdf-40.svg new file mode 100644 index 0000000..eef31b0 --- /dev/null +++ b/packages/stream_core_flutter/assets/file_type/filetype-pdf-40.svg @@ -0,0 +1,12 @@ + + + + + + + + + + + + diff --git a/packages/stream_core_flutter/assets/file_type/filetype-pdf-48.svg b/packages/stream_core_flutter/assets/file_type/filetype-pdf-48.svg new file mode 100644 index 0000000..1098eda --- /dev/null +++ b/packages/stream_core_flutter/assets/file_type/filetype-pdf-48.svg @@ -0,0 +1,12 @@ + + + + + + + + + + + + diff --git a/packages/stream_core_flutter/assets/file_type/filetype-presentation-40.svg b/packages/stream_core_flutter/assets/file_type/filetype-presentation-40.svg new file mode 100644 index 0000000..c7f04a6 --- /dev/null +++ b/packages/stream_core_flutter/assets/file_type/filetype-presentation-40.svg @@ -0,0 +1,5 @@ + + + + + diff --git a/packages/stream_core_flutter/assets/file_type/filetype-presentation-48.svg b/packages/stream_core_flutter/assets/file_type/filetype-presentation-48.svg new file mode 100644 index 0000000..7cce8c7 --- /dev/null +++ b/packages/stream_core_flutter/assets/file_type/filetype-presentation-48.svg @@ -0,0 +1,5 @@ + + + + + diff --git a/packages/stream_core_flutter/assets/file_type/filetype-spreadsheet-40.svg b/packages/stream_core_flutter/assets/file_type/filetype-spreadsheet-40.svg new file mode 100644 index 0000000..022e9b0 --- /dev/null +++ b/packages/stream_core_flutter/assets/file_type/filetype-spreadsheet-40.svg @@ -0,0 +1,5 @@ + + + + + diff --git a/packages/stream_core_flutter/assets/file_type/filetype-spreadsheet-48.svg b/packages/stream_core_flutter/assets/file_type/filetype-spreadsheet-48.svg new file mode 100644 index 0000000..320397e --- /dev/null +++ b/packages/stream_core_flutter/assets/file_type/filetype-spreadsheet-48.svg @@ -0,0 +1,5 @@ + + + + + diff --git a/packages/stream_core_flutter/assets/file_type/filetype-text-40.svg b/packages/stream_core_flutter/assets/file_type/filetype-text-40.svg new file mode 100644 index 0000000..8727804 --- /dev/null +++ b/packages/stream_core_flutter/assets/file_type/filetype-text-40.svg @@ -0,0 +1,7 @@ + + + + + + + diff --git a/packages/stream_core_flutter/assets/file_type/filetype-text-48.svg b/packages/stream_core_flutter/assets/file_type/filetype-text-48.svg new file mode 100644 index 0000000..40e70ad --- /dev/null +++ b/packages/stream_core_flutter/assets/file_type/filetype-text-48.svg @@ -0,0 +1,7 @@ + + + + + + + diff --git a/packages/stream_core_flutter/assets/file_type/filetype-video-40.svg b/packages/stream_core_flutter/assets/file_type/filetype-video-40.svg new file mode 100644 index 0000000..9d70cde --- /dev/null +++ b/packages/stream_core_flutter/assets/file_type/filetype-video-40.svg @@ -0,0 +1,6 @@ + + + + + + diff --git a/packages/stream_core_flutter/assets/file_type/filetype-video-48.svg b/packages/stream_core_flutter/assets/file_type/filetype-video-48.svg new file mode 100644 index 0000000..045f325 --- /dev/null +++ b/packages/stream_core_flutter/assets/file_type/filetype-video-48.svg @@ -0,0 +1,6 @@ + + + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconApiAggregate.svg b/packages/stream_core_flutter/assets_source/icons/IconApiAggregate.svg new file mode 100644 index 0000000..a4071bc --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconApiAggregate.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconApples.svg b/packages/stream_core_flutter/assets_source/icons/IconApples.svg new file mode 100644 index 0000000..4307252 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconApples.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconArchive1.svg b/packages/stream_core_flutter/assets_source/icons/IconArchive1.svg new file mode 100644 index 0000000..c1db35a --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconArchive1.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconArrowBoxLeft.svg b/packages/stream_core_flutter/assets_source/icons/IconArrowBoxLeft.svg new file mode 100644 index 0000000..7464978 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconArrowBoxLeft.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconArrowDown.svg b/packages/stream_core_flutter/assets_source/icons/IconArrowDown.svg new file mode 100644 index 0000000..c7cdb95 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconArrowDown.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconArrowLeft.svg b/packages/stream_core_flutter/assets_source/icons/IconArrowLeft.svg new file mode 100644 index 0000000..e93e6fc --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconArrowLeft.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconArrowRight.svg b/packages/stream_core_flutter/assets_source/icons/IconArrowRight.svg new file mode 100644 index 0000000..c404975 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconArrowRight.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconArrowRotateClockwise.svg b/packages/stream_core_flutter/assets_source/icons/IconArrowRotateClockwise.svg new file mode 100644 index 0000000..37b25cc --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconArrowRotateClockwise.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconArrowRotateRightLeftRepeatRefresh.svg b/packages/stream_core_flutter/assets_source/icons/IconArrowRotateRightLeftRepeatRefresh.svg new file mode 100644 index 0000000..11cd1ee --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconArrowRotateRightLeftRepeatRefresh.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconArrowShareLeft.svg b/packages/stream_core_flutter/assets_source/icons/IconArrowShareLeft.svg new file mode 100644 index 0000000..adf1763 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconArrowShareLeft.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconArrowUp.svg b/packages/stream_core_flutter/assets_source/icons/IconArrowUp.svg new file mode 100644 index 0000000..ad258d4 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconArrowUp.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconArrowsRepeatLeftRight.svg b/packages/stream_core_flutter/assets_source/icons/IconArrowsRepeatLeftRight.svg new file mode 100644 index 0000000..6a7d826 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconArrowsRepeatLeftRight.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconAt.svg b/packages/stream_core_flutter/assets_source/icons/IconAt.svg new file mode 100644 index 0000000..1c72f84 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconAt.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconAtSolid.svg b/packages/stream_core_flutter/assets_source/icons/IconAtSolid.svg new file mode 100644 index 0000000..1659a76 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconAtSolid.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconBellNotification.svg b/packages/stream_core_flutter/assets_source/icons/IconBellNotification.svg new file mode 100644 index 0000000..c8ff4b2 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconBellNotification.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconBellOff.svg b/packages/stream_core_flutter/assets_source/icons/IconBellOff.svg new file mode 100644 index 0000000..4517ff0 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconBellOff.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconBookmark.svg b/packages/stream_core_flutter/assets_source/icons/IconBookmark.svg new file mode 100644 index 0000000..1fdb30e --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconBookmark.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconBookmarkRemove.svg b/packages/stream_core_flutter/assets_source/icons/IconBookmarkRemove.svg new file mode 100644 index 0000000..e7238c3 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconBookmarkRemove.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconBrowserAISparkle.svg b/packages/stream_core_flutter/assets_source/icons/IconBrowserAISparkle.svg new file mode 100644 index 0000000..6023d0c --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconBrowserAISparkle.svg @@ -0,0 +1,6 @@ + + + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconBubble3ChatMessage.svg b/packages/stream_core_flutter/assets_source/icons/IconBubble3ChatMessage.svg new file mode 100644 index 0000000..d20a3d1 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconBubble3ChatMessage.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconBubble3Solid.svg b/packages/stream_core_flutter/assets_source/icons/IconBubble3Solid.svg new file mode 100644 index 0000000..8878bcb --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconBubble3Solid.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconBubbleAnnotation2ChatMessage.svg b/packages/stream_core_flutter/assets_source/icons/IconBubbleAnnotation2ChatMessage.svg new file mode 100644 index 0000000..e61361d --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconBubbleAnnotation2ChatMessage.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconBubbleText6ChatMessage.svg b/packages/stream_core_flutter/assets_source/icons/IconBubbleText6ChatMessage.svg new file mode 100644 index 0000000..7c50101 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconBubbleText6ChatMessage.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconBubbleText6Solid.svg b/packages/stream_core_flutter/assets_source/icons/IconBubbleText6Solid.svg new file mode 100644 index 0000000..b6a3b01 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconBubbleText6Solid.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconBubbleWideNotificationChatMessage.svg b/packages/stream_core_flutter/assets_source/icons/IconBubbleWideNotificationChatMessage.svg new file mode 100644 index 0000000..6560ae3 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconBubbleWideNotificationChatMessage.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconBubbleWideSparkleChatMessage.svg b/packages/stream_core_flutter/assets_source/icons/IconBubbleWideSparkleChatMessage.svg new file mode 100644 index 0000000..c2a55f5 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconBubbleWideSparkleChatMessage.svg @@ -0,0 +1,4 @@ + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconCalendar1.svg b/packages/stream_core_flutter/assets_source/icons/IconCalendar1.svg new file mode 100644 index 0000000..942727c --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconCalendar1.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconCallCancel.svg b/packages/stream_core_flutter/assets_source/icons/IconCallCancel.svg new file mode 100644 index 0000000..f482067 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconCallCancel.svg @@ -0,0 +1,4 @@ + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconCamera1.svg b/packages/stream_core_flutter/assets_source/icons/IconCamera1.svg new file mode 100644 index 0000000..a032b33 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconCamera1.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconCar1.svg b/packages/stream_core_flutter/assets_source/icons/IconCar1.svg new file mode 100644 index 0000000..21cd033 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconCar1.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconCat.svg b/packages/stream_core_flutter/assets_source/icons/IconCat.svg new file mode 100644 index 0000000..01380a0 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconCat.svg @@ -0,0 +1,6 @@ + + + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconChainLink3.svg b/packages/stream_core_flutter/assets_source/icons/IconChainLink3.svg new file mode 100644 index 0000000..f76c455 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconChainLink3.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconChart5.svg b/packages/stream_core_flutter/assets_source/icons/IconChart5.svg new file mode 100644 index 0000000..b34ab60 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconChart5.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconCheckmark1Small.svg b/packages/stream_core_flutter/assets_source/icons/IconCheckmark1Small.svg new file mode 100644 index 0000000..82e46d8 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconCheckmark1Small.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconCheckmark2.svg b/packages/stream_core_flutter/assets_source/icons/IconCheckmark2.svg new file mode 100644 index 0000000..4eacbe5 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconCheckmark2.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconCheckmark2Small.svg b/packages/stream_core_flutter/assets_source/icons/IconCheckmark2Small.svg new file mode 100644 index 0000000..7391a36 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconCheckmark2Small.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconChevronDown.svg b/packages/stream_core_flutter/assets_source/icons/IconChevronDown.svg new file mode 100644 index 0000000..9139e06 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconChevronDown.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconChevronGrabberVerticalSelector.svg b/packages/stream_core_flutter/assets_source/icons/IconChevronGrabberVerticalSelector.svg new file mode 100644 index 0000000..d520270 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconChevronGrabberVerticalSelector.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconChevronLeft.svg b/packages/stream_core_flutter/assets_source/icons/IconChevronLeft.svg new file mode 100644 index 0000000..efd0513 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconChevronLeft.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconChevronRight.svg b/packages/stream_core_flutter/assets_source/icons/IconChevronRight.svg new file mode 100644 index 0000000..41444f4 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconChevronRight.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconChevronTop.svg b/packages/stream_core_flutter/assets_source/icons/IconChevronTop.svg new file mode 100644 index 0000000..cfb943e --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconChevronTop.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconCircleBanSign.svg b/packages/stream_core_flutter/assets_source/icons/IconCircleBanSign.svg new file mode 100644 index 0000000..90d8319 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconCircleBanSign.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconCircleCheck.svg b/packages/stream_core_flutter/assets_source/icons/IconCircleCheck.svg new file mode 100644 index 0000000..ad1d204 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconCircleCheck.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconCircleInfoTooltip.svg b/packages/stream_core_flutter/assets_source/icons/IconCircleInfoTooltip.svg new file mode 100644 index 0000000..b174ee5 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconCircleInfoTooltip.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconCircleMinus.svg b/packages/stream_core_flutter/assets_source/icons/IconCircleMinus.svg new file mode 100644 index 0000000..6910434 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconCircleMinus.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconCircleQuestionmark.svg b/packages/stream_core_flutter/assets_source/icons/IconCircleQuestionmark.svg new file mode 100644 index 0000000..1a5baae --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconCircleQuestionmark.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconCircleQuestionmarkFilled.svg b/packages/stream_core_flutter/assets_source/icons/IconCircleQuestionmarkFilled.svg new file mode 100644 index 0000000..d8fd6c9 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconCircleQuestionmarkFilled.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconCircleX.svg b/packages/stream_core_flutter/assets_source/icons/IconCircleX.svg new file mode 100644 index 0000000..da8414d --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconCircleX.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconClock.svg b/packages/stream_core_flutter/assets_source/icons/IconClock.svg new file mode 100644 index 0000000..d0f9412 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconClock.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconClockSolid.svg b/packages/stream_core_flutter/assets_source/icons/IconClockSolid.svg new file mode 100644 index 0000000..aff9a08 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconClockSolid.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconCloseQuote2.svg b/packages/stream_core_flutter/assets_source/icons/IconCloseQuote2.svg new file mode 100644 index 0000000..be23ec9 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconCloseQuote2.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconCode.svg b/packages/stream_core_flutter/assets_source/icons/IconCode.svg new file mode 100644 index 0000000..125a0a3 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconCode.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconCodeBrackets.svg b/packages/stream_core_flutter/assets_source/icons/IconCodeBrackets.svg new file mode 100644 index 0000000..9a38a49 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconCodeBrackets.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconCodeEditorInsert.svg b/packages/stream_core_flutter/assets_source/icons/IconCodeEditorInsert.svg new file mode 100644 index 0000000..ef8c7e8 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconCodeEditorInsert.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconCompass.svg b/packages/stream_core_flutter/assets_source/icons/IconCompass.svg new file mode 100644 index 0000000..0e3af35 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconCompass.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconCreditCard2Billing.svg b/packages/stream_core_flutter/assets_source/icons/IconCreditCard2Billing.svg new file mode 100644 index 0000000..906472e --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconCreditCard2Billing.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconCrossMedium.svg b/packages/stream_core_flutter/assets_source/icons/IconCrossMedium.svg new file mode 100644 index 0000000..3ef6d95 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconCrossMedium.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconCrossSmall.svg b/packages/stream_core_flutter/assets_source/icons/IconCrossSmall.svg new file mode 100644 index 0000000..adbc8e3 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconCrossSmall.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconDotGrid1x3Horizontal.svg b/packages/stream_core_flutter/assets_source/icons/IconDotGrid1x3Horizontal.svg new file mode 100644 index 0000000..e2d5e68 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconDotGrid1x3Horizontal.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconDotGrid2x3.svg b/packages/stream_core_flutter/assets_source/icons/IconDotGrid2x3.svg new file mode 100644 index 0000000..412b10e --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconDotGrid2x3.svg @@ -0,0 +1,8 @@ + + + + + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconDotsGrid1x3Vertical.svg b/packages/stream_core_flutter/assets_source/icons/IconDotsGrid1x3Vertical.svg new file mode 100644 index 0000000..4f8368d --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconDotsGrid1x3Vertical.svg @@ -0,0 +1,6 @@ + + + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconDoupleCheckmark1Small.svg b/packages/stream_core_flutter/assets_source/icons/IconDoupleCheckmark1Small.svg new file mode 100644 index 0000000..f9a13f1 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconDoupleCheckmark1Small.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconEditBig.svg b/packages/stream_core_flutter/assets_source/icons/IconEditBig.svg new file mode 100644 index 0000000..72e381e --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconEditBig.svg @@ -0,0 +1,4 @@ + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconEditBigSolid.svg b/packages/stream_core_flutter/assets_source/icons/IconEditBigSolid.svg new file mode 100644 index 0000000..c5fe8b9 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconEditBigSolid.svg @@ -0,0 +1,4 @@ + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconEmojiAddReaction.svg b/packages/stream_core_flutter/assets_source/icons/IconEmojiAddReaction.svg new file mode 100644 index 0000000..87b2369 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconEmojiAddReaction.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconEmojiSad.svg b/packages/stream_core_flutter/assets_source/icons/IconEmojiSad.svg new file mode 100644 index 0000000..6940d7e --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconEmojiSad.svg @@ -0,0 +1,6 @@ + + + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconEmojiSmile.svg b/packages/stream_core_flutter/assets_source/icons/IconEmojiSmile.svg new file mode 100644 index 0000000..a6179dd --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconEmojiSmile.svg @@ -0,0 +1,6 @@ + + + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconExclamationCircle-1.svg b/packages/stream_core_flutter/assets_source/icons/IconExclamationCircle-1.svg new file mode 100644 index 0000000..39370b7 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconExclamationCircle-1.svg @@ -0,0 +1,5 @@ + + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconExclamationCircle.svg b/packages/stream_core_flutter/assets_source/icons/IconExclamationCircle.svg new file mode 100644 index 0000000..f5bad00 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconExclamationCircle.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconExclamationTriangle-1.svg b/packages/stream_core_flutter/assets_source/icons/IconExclamationTriangle-1.svg new file mode 100644 index 0000000..2ce1db7 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconExclamationTriangle-1.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconExclamationTriangle.svg b/packages/stream_core_flutter/assets_source/icons/IconExclamationTriangle.svg new file mode 100644 index 0000000..2bfd4ea --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconExclamationTriangle.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconEyeOpen.svg b/packages/stream_core_flutter/assets_source/icons/IconEyeOpen.svg new file mode 100644 index 0000000..eaefa15 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconEyeOpen.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconFileArrowLeftIn.svg b/packages/stream_core_flutter/assets_source/icons/IconFileArrowLeftIn.svg new file mode 100644 index 0000000..371f4a9 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconFileArrowLeftIn.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconFileBend.svg b/packages/stream_core_flutter/assets_source/icons/IconFileBend.svg new file mode 100644 index 0000000..5bc579c --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconFileBend.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconFilledCircleInfoTooltip.svg b/packages/stream_core_flutter/assets_source/icons/IconFilledCircleInfoTooltip.svg new file mode 100644 index 0000000..c8e6c3a --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconFilledCircleInfoTooltip.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconFilter1.svg b/packages/stream_core_flutter/assets_source/icons/IconFilter1.svg new file mode 100644 index 0000000..627c10a --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconFilter1.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconFlag2.svg b/packages/stream_core_flutter/assets_source/icons/IconFlag2.svg new file mode 100644 index 0000000..1f88282 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconFlag2.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconGauge.svg b/packages/stream_core_flutter/assets_source/icons/IconGauge.svg new file mode 100644 index 0000000..e38e4e4 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconGauge.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconGoogle.svg b/packages/stream_core_flutter/assets_source/icons/IconGoogle.svg new file mode 100644 index 0000000..f9d2550 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconGoogle.svg @@ -0,0 +1,6 @@ + + + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconHashtagChannel.svg b/packages/stream_core_flutter/assets_source/icons/IconHashtagChannel.svg new file mode 100644 index 0000000..ea4c323 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconHashtagChannel.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconHeart2.svg b/packages/stream_core_flutter/assets_source/icons/IconHeart2.svg new file mode 100644 index 0000000..cb40f13 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconHeart2.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconHistory.svg b/packages/stream_core_flutter/assets_source/icons/IconHistory.svg new file mode 100644 index 0000000..df92a38 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconHistory.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconImages1Alt.svg b/packages/stream_core_flutter/assets_source/icons/IconImages1Alt.svg new file mode 100644 index 0000000..0bf9277 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconImages1Alt.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconInvite.svg b/packages/stream_core_flutter/assets_source/icons/IconInvite.svg new file mode 100644 index 0000000..708ea4f --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconInvite.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconLayersBehind.svg b/packages/stream_core_flutter/assets_source/icons/IconLayersBehind.svg new file mode 100644 index 0000000..aea5ebe --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconLayersBehind.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconLayoutAlignLeft.svg b/packages/stream_core_flutter/assets_source/icons/IconLayoutAlignLeft.svg new file mode 100644 index 0000000..ffb95ae --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconLayoutAlignLeft.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconLayoutGrid1.svg b/packages/stream_core_flutter/assets_source/icons/IconLayoutGrid1.svg new file mode 100644 index 0000000..fcda5b2 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconLayoutGrid1.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconLayoutLeft.svg b/packages/stream_core_flutter/assets_source/icons/IconLayoutLeft.svg new file mode 100644 index 0000000..cf74cdc --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconLayoutLeft.svg @@ -0,0 +1,4 @@ + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconLightBulbSimple.svg b/packages/stream_core_flutter/assets_source/icons/IconLightBulbSimple.svg new file mode 100644 index 0000000..0e27d85 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconLightBulbSimple.svg @@ -0,0 +1,4 @@ + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconLimits.svg b/packages/stream_core_flutter/assets_source/icons/IconLimits.svg new file mode 100644 index 0000000..ca2866e --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconLimits.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconLineChart3.svg b/packages/stream_core_flutter/assets_source/icons/IconLineChart3.svg new file mode 100644 index 0000000..1b137e2 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconLineChart3.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconLock.svg b/packages/stream_core_flutter/assets_source/icons/IconLock.svg new file mode 100644 index 0000000..bdef94e --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconLock.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconMagnifyingGlassSearch.svg b/packages/stream_core_flutter/assets_source/icons/IconMagnifyingGlassSearch.svg new file mode 100644 index 0000000..44f4ea7 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconMagnifyingGlassSearch.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconMapPin.svg b/packages/stream_core_flutter/assets_source/icons/IconMapPin.svg new file mode 100644 index 0000000..c0145af --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconMapPin.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconMicrophone.svg b/packages/stream_core_flutter/assets_source/icons/IconMicrophone.svg new file mode 100644 index 0000000..83bbc1e --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconMicrophone.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconMicrophoneSolid.svg b/packages/stream_core_flutter/assets_source/icons/IconMicrophoneSolid.svg new file mode 100644 index 0000000..d8e6867 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconMicrophoneSolid.svg @@ -0,0 +1,4 @@ + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconMinusLarge.svg b/packages/stream_core_flutter/assets_source/icons/IconMinusLarge.svg new file mode 100644 index 0000000..ee982bc --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconMinusLarge.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconMinusSmall.svg b/packages/stream_core_flutter/assets_source/icons/IconMinusSmall.svg new file mode 100644 index 0000000..6999b73 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconMinusSmall.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconMute.svg b/packages/stream_core_flutter/assets_source/icons/IconMute.svg new file mode 100644 index 0000000..000eb9e --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconMute.svg @@ -0,0 +1,4 @@ + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconNewspaper2.svg b/packages/stream_core_flutter/assets_source/icons/IconNewspaper2.svg new file mode 100644 index 0000000..b0af0de --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconNewspaper2.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconOrganization.svg b/packages/stream_core_flutter/assets_source/icons/IconOrganization.svg new file mode 100644 index 0000000..b3ebecf --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconOrganization.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconPaperPlane.svg b/packages/stream_core_flutter/assets_source/icons/IconPaperPlane.svg new file mode 100644 index 0000000..7f5efa2 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconPaperPlane.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconPaperPlaneTopRight.svg b/packages/stream_core_flutter/assets_source/icons/IconPaperPlaneTopRight.svg new file mode 100644 index 0000000..25fabb5 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconPaperPlaneTopRight.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconPaperclip1.svg b/packages/stream_core_flutter/assets_source/icons/IconPaperclip1.svg new file mode 100644 index 0000000..d552945 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconPaperclip1.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconParagraphsText.svg b/packages/stream_core_flutter/assets_source/icons/IconParagraphsText.svg new file mode 100644 index 0000000..5dfb4a6 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconParagraphsText.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconPause.svg b/packages/stream_core_flutter/assets_source/icons/IconPause.svg new file mode 100644 index 0000000..42dbbde --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconPause.svg @@ -0,0 +1,4 @@ + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconPencil.svg b/packages/stream_core_flutter/assets_source/icons/IconPencil.svg new file mode 100644 index 0000000..6b4fb58 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconPencil.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconPeople.svg b/packages/stream_core_flutter/assets_source/icons/IconPeople.svg new file mode 100644 index 0000000..1f0e521 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconPeople.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconPeople2.svg b/packages/stream_core_flutter/assets_source/icons/IconPeople2.svg new file mode 100644 index 0000000..1973d88 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconPeople2.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconPeopleAdd.svg b/packages/stream_core_flutter/assets_source/icons/IconPeopleAdd.svg new file mode 100644 index 0000000..2011951 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconPeopleAdd.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconPeopleAdded.svg b/packages/stream_core_flutter/assets_source/icons/IconPeopleAdded.svg new file mode 100644 index 0000000..fdf85e3 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconPeopleAdded.svg @@ -0,0 +1,5 @@ + + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconPeopleCircle.svg b/packages/stream_core_flutter/assets_source/icons/IconPeopleCircle.svg new file mode 100644 index 0000000..9d1c7db --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconPeopleCircle.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconPeopleCopy.svg b/packages/stream_core_flutter/assets_source/icons/IconPeopleCopy.svg new file mode 100644 index 0000000..9a0eb3a --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconPeopleCopy.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconPeopleEditUserRights.svg b/packages/stream_core_flutter/assets_source/icons/IconPeopleEditUserRights.svg new file mode 100644 index 0000000..b5679ac --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconPeopleEditUserRights.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconPeopleRemove.svg b/packages/stream_core_flutter/assets_source/icons/IconPeopleRemove.svg new file mode 100644 index 0000000..9c07eac --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconPeopleRemove.svg @@ -0,0 +1,5 @@ + + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconPersona.svg b/packages/stream_core_flutter/assets_source/icons/IconPersona.svg new file mode 100644 index 0000000..75366bb --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconPersona.svg @@ -0,0 +1,17 @@ + + + + + + + + + + + + + + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconPin.svg b/packages/stream_core_flutter/assets_source/icons/IconPin.svg new file mode 100644 index 0000000..f668c95 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconPin.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconPlaySolid.svg b/packages/stream_core_flutter/assets_source/icons/IconPlaySolid.svg new file mode 100644 index 0000000..134c502 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconPlaySolid.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconPlusLarge.svg b/packages/stream_core_flutter/assets_source/icons/IconPlusLarge.svg new file mode 100644 index 0000000..8cffdbb --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconPlusLarge.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconPlusSmall.svg b/packages/stream_core_flutter/assets_source/icons/IconPlusSmall.svg new file mode 100644 index 0000000..6f01def --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconPlusSmall.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconRunShortcut.svg b/packages/stream_core_flutter/assets_source/icons/IconRunShortcut.svg new file mode 100644 index 0000000..65c6395 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconRunShortcut.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconSearchText.svg b/packages/stream_core_flutter/assets_source/icons/IconSearchText.svg new file mode 100644 index 0000000..aafa797 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconSearchText.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconSettingsGear2.svg b/packages/stream_core_flutter/assets_source/icons/IconSettingsGear2.svg new file mode 100644 index 0000000..d081c18 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconSettingsGear2.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconSettingsSliderVer.svg b/packages/stream_core_flutter/assets_source/icons/IconSettingsSliderVer.svg new file mode 100644 index 0000000..b5b558c --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconSettingsSliderVer.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconShapesPlusCloseSquareCircle.svg b/packages/stream_core_flutter/assets_source/icons/IconShapesPlusCloseSquareCircle.svg new file mode 100644 index 0000000..df8c311 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconShapesPlusCloseSquareCircle.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconShapesTriangleSquareCircle.svg b/packages/stream_core_flutter/assets_source/icons/IconShapesTriangleSquareCircle.svg new file mode 100644 index 0000000..d602272 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconShapesTriangleSquareCircle.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconShareOs.svg b/packages/stream_core_flutter/assets_source/icons/IconShareOs.svg new file mode 100644 index 0000000..33f0943 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconShareOs.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconShareRedirectLink.svg b/packages/stream_core_flutter/assets_source/icons/IconShareRedirectLink.svg new file mode 100644 index 0000000..bb446ee --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconShareRedirectLink.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconShield.svg b/packages/stream_core_flutter/assets_source/icons/IconShield.svg new file mode 100644 index 0000000..8adb39d --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconShield.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconSquareBehindSquare2_Copy.svg b/packages/stream_core_flutter/assets_source/icons/IconSquareBehindSquare2_Copy.svg new file mode 100644 index 0000000..823e9f1 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconSquareBehindSquare2_Copy.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconSquareCircleTopRightFeeds.svg b/packages/stream_core_flutter/assets_source/icons/IconSquareCircleTopRightFeeds.svg new file mode 100644 index 0000000..a081e30 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconSquareCircleTopRightFeeds.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconStop.svg b/packages/stream_core_flutter/assets_source/icons/IconStop.svg new file mode 100644 index 0000000..26728fd --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconStop.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconTable.svg b/packages/stream_core_flutter/assets_source/icons/IconTable.svg new file mode 100644 index 0000000..11d3250 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconTable.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconTeam.svg b/packages/stream_core_flutter/assets_source/icons/IconTeam.svg new file mode 100644 index 0000000..9c198b9 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconTeam.svg @@ -0,0 +1,10 @@ + + + + + + + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconTennis.svg b/packages/stream_core_flutter/assets_source/icons/IconTennis.svg new file mode 100644 index 0000000..7bde408 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconTennis.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconTextToImageURLEnrichment.svg b/packages/stream_core_flutter/assets_source/icons/IconTextToImageURLEnrichment.svg new file mode 100644 index 0000000..64a0ab3 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconTextToImageURLEnrichment.svg @@ -0,0 +1,8 @@ + + + + + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconThunder.svg b/packages/stream_core_flutter/assets_source/icons/IconThunder.svg new file mode 100644 index 0000000..0c772ea --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconThunder.svg @@ -0,0 +1,10 @@ + + + + + + + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconTrashBin.svg b/packages/stream_core_flutter/assets_source/icons/IconTrashBin.svg new file mode 100644 index 0000000..c020235 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconTrashBin.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconTrending4.svg b/packages/stream_core_flutter/assets_source/icons/IconTrending4.svg new file mode 100644 index 0000000..714767d --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconTrending4.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconTrophy.svg b/packages/stream_core_flutter/assets_source/icons/IconTrophy.svg new file mode 100644 index 0000000..2baab77 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconTrophy.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconUnlocked.svg b/packages/stream_core_flutter/assets_source/icons/IconUnlocked.svg new file mode 100644 index 0000000..13d6398 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconUnlocked.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconUnpin.svg b/packages/stream_core_flutter/assets_source/icons/IconUnpin.svg new file mode 100644 index 0000000..030b714 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconUnpin.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconUsers.svg b/packages/stream_core_flutter/assets_source/icons/IconUsers.svg new file mode 100644 index 0000000..245055d --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconUsers.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconVideo.svg b/packages/stream_core_flutter/assets_source/icons/IconVideo.svg new file mode 100644 index 0000000..f105607 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconVideo.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconVideoSolid.svg b/packages/stream_core_flutter/assets_source/icons/IconVideoSolid.svg new file mode 100644 index 0000000..ef43256 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconVideoSolid.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconVoiceAndVideo.svg b/packages/stream_core_flutter/assets_source/icons/IconVoiceAndVideo.svg new file mode 100644 index 0000000..daf812f --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconVoiceAndVideo.svg @@ -0,0 +1,10 @@ + + + + + + + + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconVoiceHigh.svg b/packages/stream_core_flutter/assets_source/icons/IconVoiceHigh.svg new file mode 100644 index 0000000..6558962 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconVoiceHigh.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconVolumeFull.svg b/packages/stream_core_flutter/assets_source/icons/IconVolumeFull.svg new file mode 100644 index 0000000..22d105d --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconVolumeFull.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/assets_source/icons/IconWebhook.svg b/packages/stream_core_flutter/assets_source/icons/IconWebhook.svg new file mode 100644 index 0000000..0c285f3 --- /dev/null +++ b/packages/stream_core_flutter/assets_source/icons/IconWebhook.svg @@ -0,0 +1,3 @@ + + + diff --git a/packages/stream_core_flutter/dart_test.yaml b/packages/stream_core_flutter/dart_test.yaml new file mode 100644 index 0000000..f01b955 --- /dev/null +++ b/packages/stream_core_flutter/dart_test.yaml @@ -0,0 +1,2 @@ +tags: + golden: diff --git a/packages/stream_core_flutter/lib/fonts/stream_icons_font.otf b/packages/stream_core_flutter/lib/fonts/stream_icons_font.otf new file mode 100644 index 0000000..fd350a1 Binary files /dev/null and b/packages/stream_core_flutter/lib/fonts/stream_icons_font.otf differ diff --git a/packages/stream_core_flutter/lib/src/components.dart b/packages/stream_core_flutter/lib/src/components.dart new file mode 100644 index 0000000..07ad15c --- /dev/null +++ b/packages/stream_core_flutter/lib/src/components.dart @@ -0,0 +1,28 @@ +export 'components/accessories/stream_audio_waveform.dart'; +export 'components/accessories/stream_emoji.dart' hide DefaultStreamEmoji; +export 'components/accessories/stream_file_type_icon.dart' hide DefaultStreamFileTypeIcon; +export 'components/avatar/stream_avatar.dart' hide DefaultStreamAvatar; +export 'components/avatar/stream_avatar_group.dart' hide DefaultStreamAvatarGroup; +export 'components/avatar/stream_avatar_stack.dart' hide DefaultStreamAvatarStack; +export 'components/badge/stream_badge_count.dart' hide DefaultStreamBadgeCount; +export 'components/badge/stream_badge_notification.dart' hide DefaultStreamBadgeNotification; +export 'components/badge/stream_media_badge.dart'; +export 'components/badge/stream_online_indicator.dart' hide DefaultStreamOnlineIndicator; +export 'components/buttons/stream_button.dart' hide DefaultStreamButton; +export 'components/buttons/stream_emoji_button.dart' hide DefaultStreamEmojiButton; +export 'components/common/stream_checkbox.dart' hide DefaultStreamCheckbox; +export 'components/common/stream_flex.dart'; +export 'components/common/stream_progress_bar.dart' hide DefaultStreamProgressBar; +export 'components/context_menu/stream_context_menu.dart'; +export 'components/context_menu/stream_context_menu_action.dart' hide DefaultStreamContextMenuAction; +export 'components/controls/stream_emoji_chip.dart' hide DefaultStreamEmojiChip; +export 'components/controls/stream_emoji_chip_bar.dart' hide DefaultStreamEmojiChipBar; +export 'components/controls/stream_remove_control.dart'; +export 'components/emoji/data/stream_emoji_data.dart'; +export 'components/emoji/data/stream_supported_emojis.dart'; +export 'components/emoji/stream_emoji_picker_sheet.dart'; +export 'components/list/stream_list_tile.dart' hide DefaultStreamListTile; +export 'components/message_composer.dart'; +export 'components/reaction/stream_reactions.dart' hide DefaultStreamReactions; + +export 'factory/stream_component_factory.dart'; diff --git a/packages/stream_core_flutter/lib/src/components/accessories/stream_audio_waveform.dart b/packages/stream_core_flutter/lib/src/components/accessories/stream_audio_waveform.dart new file mode 100644 index 0000000..73e4e9b --- /dev/null +++ b/packages/stream_core_flutter/lib/src/components/accessories/stream_audio_waveform.dart @@ -0,0 +1,496 @@ +import 'dart:math' as math; +import 'dart:ui'; + +import 'package:collection/collection.dart'; +import 'package:flutter/material.dart'; + +import '../../theme/components/stream_audio_waveform_theme.dart'; +import '../../theme/stream_theme_extensions.dart'; + +const _kAudioWaveformSliderThumbWidth = 12.0; + +/// {@template streamAudioWaveformSlider} +/// A widget that displays an audio waveform and allows the user to interact +/// with it using a slider. +/// {@endtemplate} +class StreamAudioWaveformSlider extends StatefulWidget { + /// {@macro streamAudioWaveformSlider} + const StreamAudioWaveformSlider({ + super.key, + required this.waveform, + this.onChangeStart, + required this.onChanged, + this.onChangeEnd, + this.limit = 100, + this.color, + this.progress = 0, + this.progressColor, + this.minBarHeight, + this.spacingRatio, + this.heightScale, + this.inverse = true, + this.isActive = false, + this.activeThumbColor, + this.idleThumbColor, + this.thumbBorderColor, + }); + + /// The waveform data to be drawn. + /// + /// Note: The values should be between 0 and 1. + final List waveform; + + /// Called when the thumb starts being dragged. + final ValueChanged? onChangeStart; + + /// Called while the thumb is being dragged. + final ValueChanged? onChanged; + + /// Called when the thumb stops being dragged. + final ValueChanged? onChangeEnd; + + /// The color of the wave bars. + /// + /// Defaults to [StreamAudioWaveformThemeData.color]. + final Color? color; + + /// The number of wave bars that will be draw in the screen. When the length + /// of [waveform] is bigger than [limit] only the X last bars will be shown. + /// + /// Defaults to 100. + final int limit; + + /// The progress of the audio track. Used to show the progress of the audio. + /// + /// Defaults to 0. + final double progress; + + /// The color of the progressed wave bars. + /// + /// Defaults to [StreamAudioWaveformThemeData.progressColor]. + final Color? progressColor; + + /// The minimum height of the bars. + /// + /// Defaults to [StreamAudioWaveformThemeData.minBarHeight]. + final double? minBarHeight; + + /// The ratio of the spacing between the bars. + /// + /// Defaults to [StreamAudioWaveformThemeData.spacingRatio]. + final double? spacingRatio; + + /// The scale of the height of the bars. + /// + /// Defaults to [StreamAudioWaveformThemeData.heightScale]. + final double? heightScale; + + /// If true, the bars grow from right to left otherwise they grow from left + /// to right. + /// + /// Defaults to true. + final bool inverse; + + /// Whether the waveform slider is in an active (playing) state. + /// + /// When true, the thumb uses [activeThumbColor]. When false, the thumb + /// uses [idleThumbColor]. + /// + /// Defaults to false. + final bool isActive; + + /// The color of the slider thumb when [isActive] is true. + /// + /// Defaults to [StreamAudioWaveformThemeData.activeThumbColor]. + final Color? activeThumbColor; + + /// The color of the slider thumb when [isActive] is false. + /// + /// Defaults to [StreamAudioWaveformThemeData.idleThumbColor]. + final Color? idleThumbColor; + + /// The color of the slider thumb border. + /// + /// Defaults to [StreamAudioWaveformThemeData.thumbBorderColor]. + final Color? thumbBorderColor; + + @override + State createState() => _StreamAudioWaveformSliderState(); +} + +class _StreamAudioWaveformSliderState extends State { + @override + Widget build(BuildContext context) { + final theme = StreamAudioWaveformTheme.of(context); + final colorScheme = context.streamColorScheme; + + final activeThumbColor = widget.activeThumbColor ?? theme.activeThumbColor ?? colorScheme.accentPrimary; + final idleThumbColor = widget.idleThumbColor ?? theme.idleThumbColor ?? colorScheme.accentNeutral; + final thumbColor = widget.isActive ? activeThumbColor : idleThumbColor; + final thumbBorderColor = widget.thumbBorderColor ?? theme.thumbBorderColor ?? colorScheme.borderOnAccent; + + return HorizontalSlider( + onChangeStart: widget.onChangeStart, + onChanged: widget.onChanged, + onChangeEnd: widget.onChangeEnd, + child: LayoutBuilder( + builder: (context, constraints) => Stack( + fit: StackFit.expand, + clipBehavior: Clip.none, + alignment: Alignment.center, + children: [ + StreamAudioWaveform( + waveform: widget.waveform, + limit: widget.limit, + color: widget.color, + progress: widget.progress, + progressColor: widget.progressColor, + minBarHeight: widget.minBarHeight, + spacingRatio: widget.spacingRatio, + heightScale: widget.heightScale, + inverse: widget.inverse, + ), + Builder( + // Just using it for the calculation of the thumb position. + builder: (context) { + final progressWidth = constraints.maxWidth * widget.progress; + return AnimatedPositioned( + curve: const ElasticOutCurve(1.05), + duration: const Duration(milliseconds: 300), + left: progressWidth - _kAudioWaveformSliderThumbWidth / 2, + child: StreamAudioWaveformSliderThumb( + color: thumbColor, + borderColor: thumbBorderColor, + ), + ); + }, + ), + ], + ), + ), + ); + } +} + +/// {@template streamAudioWaveformSliderThumb} +/// A widget that represents the thumb of the [StreamAudioWaveformSlider]. +/// {@endtemplate} +class StreamAudioWaveformSliderThumb extends StatelessWidget { + /// {@macro streamAudioWaveformSliderThumb} + const StreamAudioWaveformSliderThumb({ + super.key, + this.size = _kAudioWaveformSliderThumbWidth, + this.color = Colors.white, + this.borderColor = const Color(0xffecebeb), + }); + + /// The width of the thumb. + final double size; + + /// The color of the thumb. + final Color color; + + /// The border color of the thumb. + final Color borderColor; + + @override + Widget build(BuildContext context) { + return Container( + width: size, + height: size, + foregroundDecoration: BoxDecoration( + color: color, + border: Border.all( + color: borderColor, + strokeAlign: BorderSide.strokeAlignCenter, + width: 2, + ), + shape: BoxShape.circle, + ), + ); + } +} + +/// {@template streamAudioWaveform} +/// A widget that displays an audio waveform. +/// +/// The waveform is drawn using the [waveform] data. The waveform is drawn +/// horizontally and the bars grow from right to left. +/// {@endtemplate} +class StreamAudioWaveform extends StatelessWidget { + /// {@macro streamAudioWaveform} + const StreamAudioWaveform({ + super.key, + required this.waveform, + this.limit = 100, + this.color, + this.progress = 0, + this.progressColor, + this.minBarHeight, + this.spacingRatio, + this.heightScale, + this.inverse = true, + }); + + /// The waveform data to be drawn. + /// + /// Note: The values should be between 0 and 1. + final List waveform; + + /// The color of the wave bars. + /// + /// Defaults to [StreamAudioWaveformThemeData.color]. + final Color? color; + + /// The number of wave bars that will be drawn on the screen. When the length + /// of [waveform] is bigger than [limit] only the last [limit] bars will be + /// shown. + /// + /// Defaults to 100. + final int limit; + + /// The progress of the audio track. Used to show the progress of the audio. + /// + /// Defaults to 0. + final double progress; + + /// The color of the progressed wave bars. + /// + /// Defaults to [StreamAudioWaveformThemeData.progressColor]. + final Color? progressColor; + + /// The minimum height of the bars. + /// + /// Defaults to [StreamAudioWaveformThemeData.minBarHeight]. + final double? minBarHeight; + + /// The ratio of the spacing between the bars. + /// + /// Defaults to [StreamAudioWaveformThemeData.spacingRatio]. + final double? spacingRatio; + + /// The scale of the height of the bars. + /// + /// Defaults to [StreamAudioWaveformThemeData.heightScale]. + final double? heightScale; + + /// If true, the bars grow from right to left otherwise they grow from left + /// to right. + /// + /// Defaults to true. + final bool inverse; + + @override + Widget build(BuildContext context) { + final theme = StreamAudioWaveformTheme.of(context); + final colorScheme = context.streamColorScheme; + + final color = this.color ?? theme.color ?? colorScheme.borderOpacity25; + final progressColor = this.progressColor ?? theme.progressColor ?? colorScheme.accentPrimary; + final minBarHeight = this.minBarHeight ?? theme.minBarHeight ?? 2.0; + final spacingRatio = this.spacingRatio ?? theme.spacingRatio ?? 0.3; + final heightScale = this.heightScale ?? theme.heightScale ?? 1.0; + + return CustomPaint( + willChange: true, + painter: _WaveformPainter( + waveform: waveform.reversed, + limit: limit, + color: color, + progress: progress, + progressColor: progressColor, + minBarHeight: minBarHeight, + spacingRatio: spacingRatio, + heightScale: heightScale, + inverse: inverse, + ), + ); + } +} + +class _WaveformPainter extends CustomPainter { + _WaveformPainter({ + required Iterable waveform, + this.limit = 100, + this.color = const Color(0xff7E828B), + this.progress = 0, + this.progressColor = const Color(0xff005FFF), + this.minBarHeight = 2, + double spacingRatio = 0.3, + this.heightScale = 1, + this.inverse = true, + }) : waveform = [ + ...waveform.take(limit), + if (waveform.length < limit) + // Fill the remaining bars with 0 value + ...List.filled(limit - waveform.length, 0), + ], + spacingRatio = spacingRatio.clamp(0, 1); + + final List waveform; + final Color color; + final int limit; + final double progress; + final Color progressColor; + final double minBarHeight; + final double spacingRatio; + final bool inverse; + final double heightScale; + + @override + void paint(Canvas canvas, Size size) { + final canvasWidth = size.width; + final canvasHeight = size.height; + + // The total spacing between the bars in the canvas. + final spacingWidth = canvasWidth * spacingRatio; + final barsWidth = canvasWidth - spacingWidth; + final barWidth = barsWidth / limit; + final barSpacing = spacingWidth / (limit - 1); + final progressWidth = progress * canvasWidth; + + void paintBar(int index, double barValue) { + var dx = index * (barWidth + barSpacing) + barWidth / 2; + if (inverse) dx = canvasWidth - dx; + final dy = canvasHeight / 2; + + final barHeight = math.max(barValue * canvasHeight, minBarHeight); + + final rect = RRect.fromRectAndRadius( + Rect.fromCenter( + center: Offset(dx, dy), + width: barWidth, + height: barHeight, + ), + const Radius.circular(2), + ); + + final waveColor = switch (dx <= progressWidth) { + true => progressColor, + false => color, + }; + + final wavePaint = Paint() + ..color = waveColor + ..strokeCap = StrokeCap.round; + + canvas.drawRRect(rect, wavePaint); + } + + // Paint all the bars + waveform.forEachIndexed(paintBar); + } + + @override + bool shouldRepaint(covariant _WaveformPainter oldDelegate) => + !const ListEquality().equals(waveform, oldDelegate.waveform) || + color != oldDelegate.color || + limit != oldDelegate.limit || + progress != oldDelegate.progress || + progressColor != oldDelegate.progressColor || + minBarHeight != oldDelegate.minBarHeight || + spacingRatio != oldDelegate.spacingRatio || + heightScale != oldDelegate.heightScale || + inverse != oldDelegate.inverse; +} + +/// {@template horizontalSlider} +/// A widget that allows interactive horizontal sliding gestures. +/// +/// The `HorizontalSlider` widget wraps a child widget and allows users to +/// perform sliding gestures horizontally. It can be configured with callbacks +/// to notify the parent widget about the changes in the horizontal value. +/// {@endtemplate} +class HorizontalSlider extends StatefulWidget { + /// Creates a horizontal slider. + const HorizontalSlider({ + super.key, + required this.child, + required this.onChanged, + this.onChangeStart, + this.onChangeEnd, + }); + + /// The child widget wrapped by the slider. + final Widget child; + + /// Called when the horizontal value starts changing. + final ValueChanged? onChangeStart; + + /// Called when the horizontal value changes. + final ValueChanged? onChanged; + + /// Called when the horizontal value stops changing. + final ValueChanged? onChangeEnd; + + @override + State createState() => _HorizontalSliderState(); +} + +class _HorizontalSliderState extends State { + var _active = false; + + /// Returns true if the slider is interactive. + bool get isInteractive => widget.onChanged != null; + + /// Converts the visual position to a value based on the text direction. + double _getValueFromVisualPosition(double visualPosition) { + final textDirection = Directionality.of(context); + final value = switch (textDirection) { + TextDirection.rtl => 1.0 - visualPosition, + TextDirection.ltr => visualPosition, + }; + + return clampDouble(value, 0, 1); + } + + /// Converts the local position to a horizontal value. + double _getValueFromLocalPosition(Offset globalPosition) { + final box = context.findRenderObject()! as RenderBox; + final localPosition = box.globalToLocal(globalPosition); + final visualPosition = localPosition.dx / box.size.width; + return _getValueFromVisualPosition(visualPosition); + } + + void _handleDragStart(DragStartDetails details) { + if (!_active && isInteractive) { + _active = true; + final value = _getValueFromLocalPosition(details.globalPosition); + widget.onChangeStart?.call(value); + } + } + + void _handleDragUpdate(DragUpdateDetails details) { + _handleHorizontalDrag(details.globalPosition); + } + + void _handleDragEnd(DragEndDetails details) { + if (!mounted) return; + + if (_active && mounted) { + final value = _getValueFromLocalPosition(details.globalPosition); + widget.onChangeEnd?.call(value); + _active = false; + } + } + + /// Handles the sliding gesture. + void _handleHorizontalDrag(Offset globalPosition) { + if (!mounted) return; + + if (isInteractive) { + final value = _getValueFromLocalPosition(globalPosition); + widget.onChanged?.call(value); + } + } + + @override + Widget build(BuildContext context) { + return GestureDetector( + onHorizontalDragStart: _handleDragStart, + onHorizontalDragUpdate: _handleDragUpdate, + onHorizontalDragEnd: _handleDragEnd, + child: widget.child, + ); + } +} diff --git a/packages/stream_core_flutter/lib/src/components/accessories/stream_emoji.dart b/packages/stream_core_flutter/lib/src/components/accessories/stream_emoji.dart new file mode 100644 index 0000000..0c42e54 --- /dev/null +++ b/packages/stream_core_flutter/lib/src/components/accessories/stream_emoji.dart @@ -0,0 +1,198 @@ +import 'package:flutter/material.dart'; + +import '../../../stream_core_flutter.dart'; +import '../../factory/stream_component_factory.dart'; + +/// Predefined sizes for emoji display. +/// +/// Each size corresponds to a specific dimension in logical pixels, +/// optimized for rendering emoji at common scales. +/// +/// See also: +/// +/// * [StreamEmoji], which uses these size variants. +enum StreamEmojiSize { + /// Small emoji (16px). + sm(16), + + /// Medium emoji (24px). + md(24), + + /// Large emoji (32px). + lg(32), + + /// Extra large emoji (48px). + xl(48), + + /// Extra extra large emoji (64px). + xxl(64) + ; + + /// Constructs a [StreamEmojiSize] with the given dimension. + const StreamEmojiSize(this.value); + + /// The dimension of the emoji in logical pixels. + final double value; +} + +/// A widget that displays an emoji or icon at a consistent size. +/// +/// [StreamEmoji] renders emoji characters or icon widgets at a requested +/// logical-pixel size. It applies platform-appropriate emoji font fallbacks, +/// disables text scaling, and locks the line height to the font size so the +/// emoji glyph occupies exactly the requested area. +/// +/// The widget accepts any [Widget] as the [emoji] parameter, making it +/// suitable for both Unicode emoji text and [Icon] widgets. +/// +/// {@tool snippet} +/// +/// Display a Unicode emoji: +/// +/// ```dart +/// StreamEmoji( +/// size: StreamEmojiSize.lg, +/// emoji: Text('👍'), +/// ) +/// ``` +/// {@end-tool} +/// +/// {@tool snippet} +/// +/// Display a Material Icon: +/// +/// ```dart +/// StreamEmoji( +/// size: StreamEmojiSize.md, +/// emoji: Icon(Icons.favorite), +/// ) +/// ``` +/// {@end-tool} +/// +/// {@tool snippet} +/// +/// Default size (uses [IconTheme] size or [StreamEmojiSize.md]): +/// +/// ```dart +/// StreamEmoji(emoji: Text('🔥')) +/// ``` +/// {@end-tool} +/// +/// {@tool snippet} +/// +/// Use with [IconButton] (size controlled via [IconButton.iconSize]): +/// +/// ```dart +/// IconButton( +/// iconSize: 32, +/// icon: StreamEmoji(emoji: Text('👍')), +/// onPressed: () {}, +/// ) +/// ``` +/// {@end-tool} +/// +/// **Best Practice:** When using [StreamEmoji] inside an [IconButton], set the +/// size using [IconButton.iconSize] instead of [StreamEmoji.size]. The emoji +/// inherits the size automatically from the ambient [IconTheme]. +/// +/// See also: +/// +/// * [StreamEmojiSize], which defines the available size variants. +class StreamEmoji extends StatelessWidget { + /// Creates an emoji display widget. + StreamEmoji({ + super.key, + StreamEmojiSize? size, + required Widget emoji, + }) : props = .new(size: size, emoji: emoji); + + /// The props controlling the appearance of this emoji. + final StreamEmojiProps props; + + @override + Widget build(BuildContext context) { + final builder = StreamComponentFactory.of(context).emoji; + if (builder != null) return builder(context, props); + return DefaultStreamEmoji(props: props); + } +} + +/// Properties for configuring a [StreamEmoji]. +/// +/// This class holds all the configuration options for an emoji display, +/// allowing them to be passed through the [StreamComponentFactory]. +/// +/// See also: +/// +/// * [StreamEmoji], which uses these properties. +@immutable +class StreamEmojiProps { + /// Creates emoji properties. + const StreamEmojiProps({ + required this.size, + required this.emoji, + }); + + /// The display size of the emoji. + /// + /// If null, the size is resolved from the ambient [IconTheme] size. If that + /// is also null, [StreamEmojiSize.md] (24px) is used. + final StreamEmojiSize? size; + + /// The emoji or icon widget to display. + /// + /// Typically a [Text] widget containing a Unicode emoji character, + /// or an [Icon] widget for Material Design icons. + final Widget emoji; +} + +/// Default implementation of [StreamEmoji]. +/// +/// This is the standard emoji display widget used when no custom builder +/// is provided via [StreamComponentFactory]. +/// +/// See also: +/// +/// * [StreamEmoji], which delegates to this widget by default. +/// * [StreamComponentFactory], for providing custom emoji builders. +class DefaultStreamEmoji extends StatelessWidget { + /// Creates a default emoji display widget. + const DefaultStreamEmoji({ + super.key, + required this.props, + }); + + /// The props controlling the appearance of this emoji. + final StreamEmojiProps props; + + @override + Widget build(BuildContext context) { + final iconTheme = IconTheme.of(context); + final effectiveSize = props.size?.value ?? iconTheme.size ?? StreamEmojiSize.md.value; + + return SizedBox.square( + dimension: effectiveSize, + child: MediaQuery.withNoTextScaling( + child: IconTheme( + data: iconTheme.copyWith(size: effectiveSize), + child: DefaultTextStyle.merge( + textAlign: .center, + style: TextStyle( + height: 1, + decoration: .none, + textBaseline: .alphabetic, + fontSize: effectiveSize, + // Commonly available fallback fonts for emoji rendering. + fontFamilyFallback: const [ + 'Apple Color Emoji', // iOS and macOS. + 'Noto Color Emoji', // Android, ChromeOS, Ubuntu, Linux. + 'Segoe UI Emoji', // Windows. + ], + ), + child: props.emoji, + ), + ), + ), + ); + } +} diff --git a/packages/stream_core_flutter/lib/src/components/accessories/stream_file_type_icon.dart b/packages/stream_core_flutter/lib/src/components/accessories/stream_file_type_icon.dart new file mode 100644 index 0000000..bf5e6d7 --- /dev/null +++ b/packages/stream_core_flutter/lib/src/components/accessories/stream_file_type_icon.dart @@ -0,0 +1,362 @@ +import 'package:flutter/widgets.dart'; +import 'package:flutter_svg/flutter_svg.dart'; + +import '../../factory/stream_component_factory.dart'; +import '../../theme/primitives/stream_colors.dart'; +import '../../theme/stream_theme_extensions.dart'; + +/// Predefined sizes for the file type icon. +/// +/// Each size corresponds to a specific width and height in logical pixels. +/// The dimensions are designed to match the SVG asset sizes available. +/// +/// See also: +/// +/// * [StreamFileTypeIcon], which uses these size variants. +enum StreamFileTypeIconSize { + /// Large icon (40×48 pixels). + s48(width: 40, height: 48), + + /// Small icon (32×40 pixels). + s40(width: 32, height: 40) + ; + + /// Constructs a [StreamFileTypeIconSize] with the given dimensions. + const StreamFileTypeIconSize({ + required this.width, + required this.height, + }); + + /// The width of the icon in logical pixels. + final double width; + + /// The height of the icon in logical pixels. + final double height; +} + +/// Supported file types for the file type icon. +/// +/// Each type corresponds to a distinct visual icon representation. +/// Use [StreamFileTypeIcon.fromMimeType] to automatically determine the +/// file type from a MIME type string. +/// +/// See also: +/// +/// * [StreamFileTypeIcon], which uses these file types. +enum StreamFileType { + /// PDF document files (.pdf). + pdf, + + /// Text and word processing files (.doc, .docx, .txt, .rtf, etc.). + text, + + /// Presentation files (.ppt, .pptx, .key, .odp). + presentation, + + /// Spreadsheet files (.xls, .xlsx, .ods). + spreadsheet, + + /// Code and markup files (.html, .csv, .xml, .md). + code, + + /// Video files (.mp4, .mov, .avi, .webm, etc.). + video, + + /// Audio files (.mp3, .wav, .aac, .flac, etc.). + audio, + + /// Compressed archive files (.zip, .rar, .7z, etc.). + compression, + + /// Other or unrecognized file types. + other, +} + +/// An icon widget displaying file type with optional extension label. +/// +/// [StreamFileTypeIcon] displays a visual representation of a file based on +/// its type (e.g., PDF, audio, video). It includes an optional file extension +/// label rendered on the icon. +/// +/// This widget delegates rendering to the [StreamComponentFactory], allowing +/// customization of the default appearance through theming. +/// +/// The icon automatically handles: +/// - Multiple size variants +/// - File type detection from MIME types +/// - Extension label positioning based on icon size +/// - Text scaling (disabled to prevent overflow) +/// +/// {@tool snippet} +/// +/// Basic usage with a specific file type: +/// +/// ```dart +/// StreamFileTypeIcon(type: StreamFileType.pdf) +/// ``` +/// {@end-tool} +/// +/// {@tool snippet} +/// +/// Create from MIME type (automatically detects type and extension): +/// +/// ```dart +/// StreamFileTypeIcon.fromMimeType(mimeType: 'application/pdf') +/// ``` +/// {@end-tool} +/// +/// {@tool snippet} +/// +/// Custom size with explicit extension: +/// +/// ```dart +/// StreamFileTypeIcon( +/// type: StreamFileType.audio, +/// size: StreamFileTypeIconSize.s48, +/// extension: 'mp3', +/// ) +/// ``` +/// {@end-tool} +/// +/// See also: +/// +/// * [StreamFileType], which defines the available file type variants. +/// * [StreamFileTypeIconSize], which defines the available size variants. +/// * [StreamFileTypeIconProps], which holds the configuration for this widget. +/// * [DefaultStreamFileTypeIcon], the default implementation. +class StreamFileTypeIcon extends StatelessWidget { + /// Creates a file type icon. + /// + /// The [type] parameter is required and determines which icon is displayed. + /// Optionally specify [size] and [extension] to customize the appearance. + StreamFileTypeIcon({ + super.key, + required StreamFileType type, + StreamFileTypeIconSize size = .s40, + String? extension, + }) : props = .new(type: type, size: size, extension: extension); + + /// Creates a file type icon from a MIME type string. + /// + /// This factory constructor automatically determines the appropriate + /// [StreamFileType] and file extension from the provided [mimeType]. + /// + /// For example, `'application/pdf'` maps to [StreamFileType.pdf] with + /// extension `'pdf'`, while `'audio/mpeg'` maps to [StreamFileType.audio] + /// with extension `'mp3'`. + /// + /// Unrecognized MIME types default to [StreamFileType.other] with no + /// extension. + factory StreamFileTypeIcon.fromMimeType({ + Key? key, + required String mimeType, + StreamFileTypeIconSize size = .s40, + }) { + final (type, extension) = _getFileTypeFromMimeType(mimeType); + return .new(key: key, type: type, size: size, extension: extension); + } + + /// The properties that configure this file type icon. + final StreamFileTypeIconProps props; + + // Maps a MIME type string to its corresponding file type and extension. + // + // Returns a record containing the [StreamFileType] and optional extension + // string. Unrecognized MIME types return [StreamFileType.other] with null + // extension. + static (StreamFileType type, String? extension) _getFileTypeFromMimeType( + String? mimeType, + ) => switch (mimeType) { + // Audio formats + 'audio/mpeg' => (.audio, 'mp3'), + 'audio/aac' => (.audio, 'aac'), + 'audio/wav' || 'audio/x-wav' => (.audio, 'wav'), + 'audio/flac' => (.audio, 'flac'), + 'audio/mp4' => (.audio, 'm4a'), + 'audio/ogg' => (.audio, 'ogg'), + 'audio/aiff' => (.audio, 'aiff'), + 'audio/alac' => (.audio, 'alac'), + + // Compression formats + 'application/zip' => (.compression, 'zip'), + 'application/x-7z-compressed' => (.compression, '7z'), + 'application/x-arj' => (.compression, 'arj'), + 'application/vnd.debian.binary-package' => (.compression, 'deb'), + 'application/x-apple-diskimage' => (.compression, 'pkg'), + 'application/x-rar-compressed' => (.compression, 'rar'), + 'application/x-rpm' => (.compression, 'rpm'), + 'application/x-tar' => (.code, 'tar'), + 'application/x-compress' => (.compression, 'z'), + + // Presentation formats + 'application/vnd.ms-powerpoint' => (.presentation, 'ppt'), + 'application/vnd.openxmlformats-officedocument.presentationml.presentation' => (.presentation, 'pptx'), + 'application/vnd.apple.keynote' => (.presentation, 'key'), + 'application/vnd.oasis.opendocument.presentation' => (.presentation, 'odp'), + + // Spreadsheet formats + 'application/vnd.ms-excel' => (.spreadsheet, 'xls'), + 'application/vnd.openxmlformats-officedocument.spreadsheetml.sheet' => (.spreadsheet, 'xlsx'), + 'application/vnd.ms-excel.sheet.macroEnabled.12' => (.spreadsheet, 'xlsm'), + 'application/vnd.oasis.opendocument.spreadsheet' => (.spreadsheet, 'ods'), + + // Text/document formats + 'application/msword' => (.text, 'doc'), + 'application/vnd.openxmlformats-officedocument.wordprocessingml.document' => (.text, 'docx'), + 'application/vnd.oasis.opendocument.text' => (.text, 'odt'), + 'text/plain' => (.text, 'txt'), + 'application/rtf' => (.text, 'rtf'), + 'application/x-tex' => (.text, 'tex'), + 'application/vnd.wordperfect' => (.text, 'wdp'), + + // Video formats + 'video/mp4' => (.video, 'mp4'), + 'video/mpeg' => (.video, 'mpeg'), + 'video/x-msvideo' => (.video, 'avi'), + 'video/webm' => (.video, 'webm'), + 'video/ogg' => (.video, 'ogv'), + 'video/quicktime' => (.video, 'mov'), + 'video/3gpp' => (.video, '3gp'), + 'video/3gpp2' => (.video, '3g2'), + 'video/mp2t' => (.video, 'ts'), + + // Code/markup formats + 'text/html' => (.code, 'html'), + 'text/csv' => (.code, 'csv'), + 'application/xml' => (.code, 'xml'), + 'text/markdown' => (.code, 'md'), + + // PDF + 'application/pdf' => (.pdf, 'pdf'), + + // Other/unknown formats + 'application/octet-stream' => (.other, null), + 'application/x-wiki' => (.other, 'wkq'), + _ => (.other, null), + }; + + @override + Widget build(BuildContext context) { + final builder = StreamComponentFactory.of(context).fileTypeIcon; + if (builder != null) return builder(context, props); + return DefaultStreamFileTypeIcon(props: props); + } +} + +/// Properties for configuring a [StreamFileTypeIcon]. +/// +/// This class holds all the configuration options for a file type icon, +/// allowing them to be passed through the [StreamComponentFactory]. +/// +/// See also: +/// +/// * [StreamFileTypeIcon], which uses these properties. +/// * [DefaultStreamFileTypeIcon], the default implementation. +class StreamFileTypeIconProps { + /// Creates properties for a file type icon. + const StreamFileTypeIconProps({ + required this.type, + required this.size, + this.extension, + }); + + /// The file type to display. + /// + /// Determines which icon asset is used for the visual representation. + final StreamFileType type; + + /// The size of the icon. + /// + /// Defaults to [StreamFileTypeIconSize.s40]. + final StreamFileTypeIconSize size; + + /// The file extension to display on the icon. + /// + /// When provided, this text is rendered on the icon (e.g., 'pdf', 'mp3'). + /// If null, no extension label is shown. + final String? extension; +} + +/// The default implementation of [StreamFileTypeIcon]. +/// +/// This widget renders an SVG icon with an optional file extension label +/// positioned at the bottom. It's used as the default factory implementation +/// in [StreamComponentFactory]. +/// +/// See also: +/// +/// * [StreamFileTypeIcon], the public API widget. +/// * [StreamFileTypeIconProps], which configures this widget. +class DefaultStreamFileTypeIcon extends StatelessWidget { + /// Creates a default file type icon with the given [props]. + const DefaultStreamFileTypeIcon({super.key, required this.props}); + + /// The properties that configure this file type icon. + final StreamFileTypeIconProps props; + + @override + Widget build(BuildContext context) { + final textTheme = context.streamTextTheme; + + return Stack( + clipBehavior: .none, + children: [ + SvgPicture.asset( + _iconAssetForTypeAndSize(props.type, props.size), + package: 'stream_core_flutter', + width: props.size.width, + height: props.size.height, + clipBehavior: .none, + ), + if (props.extension case final extension?) ...[ + Positioned( + left: 4, + right: 4, + bottom: _bottomPositionForSize(props.size), + // Need to disable text scaling here so that the text doesn't + // escape the icon when the textScaleFactor is large. + child: MediaQuery.withNoTextScaling( + child: Text( + extension, + maxLines: 1, + textAlign: .center, + overflow: .ellipsis, + style: textTheme.numericSm.copyWith(color: StreamColors.white), + ), + ), + ), + ], + ], + ); + } + + // Returns the appropriate bottom position for the given icon size. + // + // The position determines where the extension label is placed vertically + // on the icon. Larger icons require slightly more offset. + double _bottomPositionForSize( + StreamFileTypeIconSize size, + ) => switch (size) { + .s48 => 5, + .s40 => 4, + }; + + // Returns the appropriate icon asset path for the given file type and size. + // + // Maps each [StreamFileType] to its corresponding SVG asset, using the + // icon height from [size] to select the correct asset variant. + String _iconAssetForTypeAndSize( + StreamFileType type, + StreamFileTypeIconSize size, + ) => switch (type) { + .pdf => 'assets/file_type/filetype-pdf-${size.height.toInt()}.svg', + .text => 'assets/file_type/filetype-text-${size.height.toInt()}.svg', + .presentation => 'assets/file_type/filetype-presentation-${size.height.toInt()}.svg', + .spreadsheet => 'assets/file_type/filetype-spreadsheet-${size.height.toInt()}.svg', + .code => 'assets/file_type/filetype-code-${size.height.toInt()}.svg', + .video => 'assets/file_type/filetype-video-${size.height.toInt()}.svg', + .audio => 'assets/file_type/filetype-audio-${size.height.toInt()}.svg', + .compression => 'assets/file_type/filetype-compression-${size.height.toInt()}.svg', + .other => 'assets/file_type/filetype-other-${size.height.toInt()}.svg', + }; +} diff --git a/packages/stream_core_flutter/lib/src/components/avatar/stream_avatar.dart b/packages/stream_core_flutter/lib/src/components/avatar/stream_avatar.dart new file mode 100644 index 0000000..7539958 --- /dev/null +++ b/packages/stream_core_flutter/lib/src/components/avatar/stream_avatar.dart @@ -0,0 +1,288 @@ +import 'package:cached_network_image/cached_network_image.dart'; +import 'package:flutter/material.dart'; + +import '../../factory/stream_component_factory.dart'; +import '../../theme/components/stream_avatar_theme.dart'; +import '../../theme/primitives/stream_colors.dart'; +import '../../theme/semantics/stream_color_scheme.dart'; +import '../../theme/semantics/stream_text_theme.dart'; +import '../../theme/stream_theme_extensions.dart'; + +/// A circular avatar component for the Stream design system. +/// +/// [StreamAvatar] displays a user's profile image or a placeholder (typically +/// initials or an icon) when no image is available. It supports multiple sizes, +/// customizable colors, and an optional border. +/// +/// The avatar automatically handles: +/// - Loading states while fetching network images +/// - Error states when images fail to load +/// - Text scaling (disabled to prevent overflow) +/// - Theme-aware colors with light/dark mode support +/// +/// {@tool snippet} +/// +/// Basic usage with initials placeholder: +/// +/// ```dart +/// StreamAvatar( +/// imageUrl: user.avatarUrl, +/// placeholder: (context) => Text(user.initials), +/// ) +/// ``` +/// {@end-tool} +/// +/// {@tool snippet} +/// +/// Custom size and colors: +/// +/// ```dart +/// StreamAvatar( +/// imageUrl: user.avatarUrl, +/// size: StreamAvatarSize.sm, +/// backgroundColor: Colors.blue.shade100, +/// foregroundColor: Colors.blue.shade800, +/// placeholder: (context) => Text(user.initials), +/// ) +/// ``` +/// {@end-tool} +/// +/// {@tool snippet} +/// +/// With icon placeholder: +/// +/// ```dart +/// StreamAvatar( +/// size: StreamAvatarSize.md, +/// showBorder: false, +/// placeholder: (context) => Icon(Icons.person), +/// ) +/// ``` +/// {@end-tool} +/// +/// ## Theming +/// +/// [StreamAvatar] uses [StreamAvatarThemeData] for default styling. Colors +/// can be customized globally via the theme or per-instance via constructor +/// parameters. The color palette for deterministic user-based colors is +/// available in [StreamColorScheme.avatarPalette]. +/// +/// See also: +/// +/// * [StreamAvatarSize], which defines the available size variants. +/// * [StreamAvatarThemeData], which provides theme-level customization. +/// * [StreamColorScheme.avatarPalette], which provides colors for user avatars. +class StreamAvatar extends StatelessWidget { + /// Creates a Stream avatar. + /// + /// The [placeholder] is required and is shown when [imageUrl] is null, + /// while the image is loading, or if the image fails to load. + StreamAvatar({ + super.key, + StreamAvatarSize? size, + String? imageUrl, + required WidgetBuilder placeholder, + Color? backgroundColor, + Color? foregroundColor, + bool showBorder = true, + }) : props = .new( + size: size, + imageUrl: imageUrl, + placeholder: placeholder, + backgroundColor: backgroundColor, + foregroundColor: foregroundColor, + showBorder: showBorder, + ); + + /// The properties that configure this avatar. + final StreamAvatarProps props; + + @override + Widget build(BuildContext context) { + final builder = StreamComponentFactory.of(context).avatar; + if (builder != null) return builder(context, props); + return DefaultStreamAvatar(props: props); + } +} + +/// Properties for configuring a [StreamAvatar]. +/// +/// This class holds all the configuration options for an avatar, +/// allowing them to be passed through the [StreamComponentFactory]. +/// +/// See also: +/// +/// * [StreamAvatar], which uses these properties. +/// * [DefaultStreamAvatar], the default implementation. +class StreamAvatarProps { + /// Creates properties for an avatar. + const StreamAvatarProps({ + this.size, + this.imageUrl, + required this.placeholder, + this.backgroundColor, + this.foregroundColor, + this.showBorder = true, + }); + + /// The URL of the avatar image. + /// + /// When null, the [placeholder] is displayed. The image is loaded + /// asynchronously with caching support. + final String? imageUrl; + + /// The size of the avatar. + /// + /// If null, uses [StreamAvatarThemeData.size], or falls back to + /// [StreamAvatarSize.lg] (40.0). + final StreamAvatarSize? size; + + /// A builder for the placeholder content. + /// + /// This is displayed when [imageUrl] is null, while the image is loading, + /// or if the image fails to load. Typically contains initials text or + /// an icon. + /// + /// The placeholder inherits [DefaultTextStyle] and [IconTheme] from the + /// avatar, so text and icons will automatically use [foregroundColor]. + final WidgetBuilder placeholder; + + /// The background color of the avatar. + /// + /// If null, uses [StreamAvatarThemeData.backgroundColor], or falls back + /// to the first color in [StreamColorScheme.avatarPalette]. + final Color? backgroundColor; + + /// The foreground color for text and icons in the placeholder. + /// + /// If null, uses [StreamAvatarThemeData.foregroundColor], or falls back + /// to the first color in [StreamColorScheme.avatarPalette]. + final Color? foregroundColor; + + /// Whether to show a border around the avatar. + /// + /// Defaults to true. The border style is determined by + /// [StreamAvatarThemeData.border]. + final bool showBorder; +} + +/// The default implementation of [StreamAvatar]. +/// +/// This widget renders the avatar with theming support. +/// It's used as the default factory implementation in [StreamComponentFactory]. +/// +/// See also: +/// +/// * [StreamAvatar], the public API widget. +/// * [StreamAvatarProps], which configures this widget. +class DefaultStreamAvatar extends StatelessWidget { + /// Creates a default avatar with the given [props]. + const DefaultStreamAvatar({super.key, required this.props}); + + /// The properties that configure this avatar. + final StreamAvatarProps props; + + @override + Widget build(BuildContext context) { + final textTheme = context.streamTextTheme; + final avatarTheme = context.streamAvatarTheme; + final defaults = _StreamAvatarThemeDefaults(context); + + final effectiveSize = props.size ?? avatarTheme.size ?? defaults.size; + final effectiveBackgroundColor = props.backgroundColor ?? avatarTheme.backgroundColor ?? defaults.backgroundColor; + final effectiveForegroundColor = props.foregroundColor ?? avatarTheme.foregroundColor ?? defaults.foregroundColor; + final effectiveBorder = avatarTheme.border ?? defaults.border; + + final border = props.showBorder ? effectiveBorder : null; + final textStyle = _textStyleForSize(effectiveSize, textTheme).copyWith(color: effectiveForegroundColor); + final iconTheme = IconTheme.of(context).copyWith( + color: effectiveForegroundColor, + size: _iconSizeForSize(effectiveSize), + ); + + return AnimatedContainer( + alignment: .center, + clipBehavior: .antiAlias, + width: effectiveSize.value, + height: effectiveSize.value, + duration: kThemeChangeDuration, + foregroundDecoration: BoxDecoration(shape: .circle, border: border), + decoration: BoxDecoration(shape: .circle, color: effectiveBackgroundColor), + child: Center( + // Need to disable text scaling here so that the text doesn't + // escape the avatar when the textScaleFactor is large. + child: MediaQuery.withNoTextScaling( + child: IconTheme( + data: iconTheme, + child: DefaultTextStyle( + style: textStyle, + child: switch (props.imageUrl) { + final imageUrl? => CachedNetworkImage( + fit: .cover, + imageUrl: imageUrl, + width: effectiveSize.value, + height: effectiveSize.value, + placeholder: (context, _) => Center(child: props.placeholder.call(context)), + errorWidget: (context, _, _) => Center(child: props.placeholder.call(context)), + ), + _ => props.placeholder.call(context), + }, + ), + ), + ), + ), + ); + } + + // Returns the appropriate text style for the given avatar size. + TextStyle _textStyleForSize( + StreamAvatarSize size, + StreamTextTheme textTheme, + ) => switch (size) { + .xs => textTheme.metadataEmphasis, + .sm || .md => textTheme.captionEmphasis, + .lg => textTheme.bodyEmphasis, + .xl => textTheme.headingMd, + .xxl => textTheme.headingLg, + }; + + // Returns the appropriate icon size for the given avatar size. + double _iconSizeForSize( + StreamAvatarSize size, + ) => switch (size) { + .xs => 10, + .sm => 12, + .md => 16, + .lg => 20, + .xl => 24, + .xxl => 32, + }; +} + +// Default theme values for [StreamAvatar]. +// +// These defaults are used when no explicit value is provided via +// constructor parameters or [StreamAvatarThemeData]. +// +// The defaults are context-aware and use colors from +// [StreamColorScheme.avatarPalette]. +class _StreamAvatarThemeDefaults extends StreamAvatarThemeData { + _StreamAvatarThemeDefaults( + this.context, + ) : _colorScheme = context.streamColorScheme; + + final BuildContext context; + final StreamColorScheme _colorScheme; + + @override + StreamAvatarSize get size => StreamAvatarSize.lg; + + @override + BoxBorder get border => Border.all(color: StreamColors.black10); + + @override + Color get backgroundColor => _colorScheme.avatarPalette.first.backgroundColor; + + @override + Color get foregroundColor => _colorScheme.avatarPalette.first.foregroundColor; +} diff --git a/packages/stream_core_flutter/lib/src/components/avatar/stream_avatar_group.dart b/packages/stream_core_flutter/lib/src/components/avatar/stream_avatar_group.dart new file mode 100644 index 0000000..bc1d4a0 --- /dev/null +++ b/packages/stream_core_flutter/lib/src/components/avatar/stream_avatar_group.dart @@ -0,0 +1,377 @@ +import 'package:flutter/material.dart'; + +import '../../factory/stream_component_factory.dart'; +import '../../theme/components/stream_avatar_theme.dart'; +import '../../theme/components/stream_badge_count_theme.dart'; +import '../../theme/stream_theme_extensions.dart'; +import '../badge/stream_badge_count.dart'; +import 'stream_avatar.dart'; + +/// Predefined avatar group sizes. +/// +/// Each size corresponds to a specific diameter in logical pixels. +/// +/// See also: +/// +/// * [StreamAvatarGroup], which uses these size variants. +enum StreamAvatarGroupSize { + /// Large avatar group (40px diameter). + lg(40), + + /// Extra large avatar group (48px diameter). + xl(48), + + /// Extra-extra large avatar group (80px diameter). + xxl(80) + ; + + /// Constructs a [StreamAvatarGroupSize] with the given diameter. + const StreamAvatarGroupSize(this.value); + + /// The diameter of the avatar group in logical pixels. + final double value; +} + +/// A widget that displays multiple avatars in a grid layout. +/// +/// [StreamAvatarGroup] arranges avatars in a 2x2 grid pattern, typically used +/// for displaying group channel participants. It supports two sizes and +/// automatically handles overflow with a [StreamBadgeCount] indicator. +/// +/// The avatar automatically handles: +/// - Grid layout for up to 4 avatars +/// - Overflow indicator using [StreamBadgeCount] for additional participants +/// - Consistent sizing across all child avatars +/// +/// {@tool snippet} +/// +/// Basic usage with avatars: +/// +/// ```dart +/// StreamAvatarGroup( +/// children: [ +/// StreamAvatar(placeholder: (context) => Text('A')), +/// StreamAvatar(placeholder: (context) => Text('B')), +/// StreamAvatar(placeholder: (context) => Text('C')), +/// StreamAvatar(placeholder: (context) => Text('D')), +/// ], +/// ) +/// ``` +/// {@end-tool} +/// +/// {@tool snippet} +/// +/// With custom size: +/// +/// ```dart +/// StreamAvatarGroup( +/// size: StreamAvatarGroupSize.xl, +/// children: [ +/// StreamAvatar(placeholder: (context) => Text('A')), +/// StreamAvatar(placeholder: (context) => Text('B')), +/// ], +/// ) +/// ``` +/// {@end-tool} +/// +/// ## Theming +/// +/// [StreamAvatarGroup] uses [StreamAvatarThemeData] for styling the child +/// avatars. Colors are inherited from the theme or can be customized +/// per-avatar. +/// +/// See also: +/// +/// * [StreamAvatarGroupSize], which defines the available size variants. +/// * [StreamAvatar], the individual avatar widget. +/// * [StreamBadgeCount], used for the overflow indicator. +/// * [StreamAvatarThemeData], which provides theme-level customization. +class StreamAvatarGroup extends StatelessWidget { + /// Creates a Stream avatar group. + StreamAvatarGroup({ + super.key, + StreamAvatarGroupSize? size, + required Iterable children, + }) : props = .new(size: size, children: children); + + /// The properties that configure this avatar group. + final StreamAvatarGroupProps props; + + @override + Widget build(BuildContext context) { + final builder = StreamComponentFactory.of(context).avatarGroup; + if (builder != null) return builder(context, props); + return DefaultStreamAvatarGroup(props: props); + } +} + +/// Properties for configuring a [StreamAvatarGroup]. +/// +/// This class holds all the configuration options for an avatar group, +/// allowing them to be passed through the [StreamComponentFactory]. +/// +/// See also: +/// +/// * [StreamAvatarGroup], which uses these properties. +/// * [DefaultStreamAvatarGroup], the default implementation. +class StreamAvatarGroupProps { + /// Creates properties for an avatar group. + const StreamAvatarGroupProps({ + this.size, + required this.children, + }); + + /// The list of avatars to display in the group. + /// + /// Typically a list of [StreamAvatar] widgets. + final Iterable children; + + /// The size of the avatar group. + /// + /// If null, defaults to [StreamAvatarGroupSize.lg]. + final StreamAvatarGroupSize? size; +} + +/// The default implementation of [StreamAvatarGroup]. +/// +/// This widget renders the avatar group with theming support. +/// It's used as the default factory implementation in [StreamComponentFactory]. +/// +/// See also: +/// +/// * [StreamAvatarGroup], the public API widget. +/// * [StreamAvatarGroupProps], which configures this widget. +class DefaultStreamAvatarGroup extends StatelessWidget { + /// Creates a default avatar group with the given [props]. + const DefaultStreamAvatarGroup({super.key, required this.props}); + + /// The properties that configure this avatar group. + final StreamAvatarGroupProps props; + + @override + Widget build(BuildContext context) { + if (props.children.isEmpty) return const SizedBox.shrink(); + + final colorScheme = context.streamColorScheme; + + final effectiveSize = props.size ?? StreamAvatarGroupSize.lg; + final avatarSize = _avatarSizeForGroupSize(effectiveSize); + final badgeCountSize = _badgeCountSizeForGroupSize(effectiveSize); + + const avatarBorderWidth = 2.0; + + return AnimatedContainer( + width: effectiveSize.value, + height: effectiveSize.value, + duration: kThemeChangeDuration, + // Need to disable text scaling here so that the text doesn't + // escape the avatar when the textScaleFactor is large. + child: MediaQuery.withNoTextScaling( + child: StreamAvatarTheme( + data: StreamAvatarThemeData( + size: avatarSize, + border: Border.all( + width: avatarBorderWidth, + color: colorScheme.borderOnDark, + strokeAlign: BorderSide.strokeAlignOutside, + ), + ), + child: StreamBadgeCountTheme( + data: StreamBadgeCountThemeData(size: badgeCountSize), + child: Builder( + builder: (context) => switch (props.children.length) { + 1 => _buildForOne(context, props.children), + 2 => _buildForTwo(context, props.children), + 3 => _buildForThree(context, props.children), + 4 => _buildForFour(context, props.children), + _ => _buildForFourOrMore(context, props.children), + }, + ), + ), + ), + ), + ); + } + + // Build the widget for 1 avatar. + Widget _buildForOne( + BuildContext context, + Iterable avatars, + ) { + final avatarOne = avatars.first; + + return Stack( + clipBehavior: .none, + children: [ + Positioned.fill( + child: Align( + alignment: AlignmentDirectional.topStart, + child: StreamAvatar( + placeholder: (context) => Icon(context.streamIcons.people), + ), + ), + ), + Positioned.fill( + child: Align( + alignment: AlignmentDirectional.bottomEnd, + child: avatarOne, + ), + ), + ], + ); + } + + // Build the widget for 2 avatars. + Widget _buildForTwo( + BuildContext context, + Iterable avatars, + ) { + final avatarOne = avatars.first; + final avatarTwo = avatars.last; + + return Stack( + clipBehavior: .none, + children: [ + Positioned.fill( + child: Align( + alignment: AlignmentDirectional.topStart, + child: avatarOne, + ), + ), + Positioned.fill( + child: Align( + alignment: AlignmentDirectional.bottomEnd, + child: avatarTwo, + ), + ), + ], + ); + } + + // Builds the widget for 3 avatars. + Widget _buildForThree( + BuildContext context, + Iterable avatars, + ) { + final avatarOne = avatars.first; + final avatarTwo = avatars.elementAt(1); + final avatarThree = avatars.last; + + return Stack( + clipBehavior: .none, + children: [ + Positioned.fill( + child: Align( + alignment: AlignmentDirectional.topCenter, + child: avatarOne, + ), + ), + Positioned.fill( + child: Align( + alignment: AlignmentDirectional.bottomStart, + child: avatarTwo, + ), + ), + Positioned.fill( + child: Align( + alignment: AlignmentDirectional.bottomEnd, + child: avatarThree, + ), + ), + ], + ); + } + + // Builds the widget for 4 avatars. + Widget _buildForFour( + BuildContext context, + Iterable avatars, + ) { + final avatarOne = avatars.first; + final avatarTwo = avatars.elementAt(1); + final avatarThree = avatars.elementAt(2); + final avatarFour = avatars.last; + + return Stack( + clipBehavior: .none, + children: [ + Positioned.fill( + child: Align( + alignment: AlignmentDirectional.topStart, + child: avatarOne, + ), + ), + Positioned.fill( + child: Align( + alignment: AlignmentDirectional.topEnd, + child: avatarTwo, + ), + ), + Positioned.fill( + child: Align( + alignment: AlignmentDirectional.bottomStart, + child: avatarThree, + ), + ), + Positioned.fill( + child: Align( + alignment: AlignmentDirectional.bottomEnd, + child: avatarFour, + ), + ), + ], + ); + } + + // Builds the widget for 4 or more avatars. + Widget _buildForFourOrMore( + BuildContext context, + Iterable avatars, + ) { + final avatarOne = avatars.first; + final avatarTwo = avatars.elementAt(1); + final extraCount = avatars.length - 2; + + return Stack( + clipBehavior: .none, + children: [ + Positioned.fill( + child: Align( + alignment: AlignmentDirectional.topStart, + child: avatarOne, + ), + ), + Positioned.fill( + child: Align( + alignment: AlignmentDirectional.topEnd, + child: avatarTwo, + ), + ), + Positioned.fill( + child: Align( + alignment: AlignmentDirectional.bottomCenter, + child: StreamBadgeCount(label: '+$extraCount'), + ), + ), + ], + ); + } + + // Returns the appropriate avatar size for the given group size. + StreamAvatarSize _avatarSizeForGroupSize( + StreamAvatarGroupSize size, + ) => switch (size) { + .lg => StreamAvatarSize.sm, + .xl => StreamAvatarSize.md, + .xxl => StreamAvatarSize.lg, + }; + + // Returns the appropriate badge count size for the given group size. + StreamBadgeCountSize _badgeCountSizeForGroupSize( + StreamAvatarGroupSize size, + ) => switch (size) { + .lg => StreamBadgeCountSize.sm, + .xl => StreamBadgeCountSize.md, + .xxl => StreamBadgeCountSize.md, + }; +} diff --git a/packages/stream_core_flutter/lib/src/components/avatar/stream_avatar_stack.dart b/packages/stream_core_flutter/lib/src/components/avatar/stream_avatar_stack.dart new file mode 100644 index 0000000..facc65b --- /dev/null +++ b/packages/stream_core_flutter/lib/src/components/avatar/stream_avatar_stack.dart @@ -0,0 +1,226 @@ +import 'package:flutter/material.dart'; + +import '../../factory/stream_component_factory.dart'; +import '../../theme/components/stream_avatar_theme.dart'; +import '../../theme/components/stream_badge_count_theme.dart'; +import '../badge/stream_badge_count.dart'; +import '../common/stream_flex.dart'; + +/// Predefined avatar stack sizes. +/// +/// Each size corresponds to a specific diameter in logical pixels. +/// +/// See also: +/// +/// * [StreamAvatarStack], which uses these size variants. +enum StreamAvatarStackSize { + /// Extra small avatar stack (20px diameter). + xs(20), + + /// Small avatar stack (24px diameter). + sm(24) + ; + + /// Constructs a [StreamAvatarStackSize] with the given diameter. + const StreamAvatarStackSize(this.value); + + /// The diameter of the avatar stack in logical pixels. + final double value; +} + +/// A widget that displays a stack of [StreamAvatar] widgets with overlap. +/// +/// This is useful for showing multiple participants in a chat, group, or team. +/// The [size], [overlap], and [max] can be customized. +/// +/// {@tool snippet} +/// +/// Basic usage with default size and overlap: +/// +/// ```dart +/// StreamAvatarStack( +/// children: [ +/// StreamAvatar(placeholder: (context) => Text('A')), +/// StreamAvatar(placeholder: (context) => Text('B')), +/// StreamAvatar(placeholder: (context) => Text('C')), +/// ], +/// ) +/// ``` +/// {@end-tool} +/// +/// {@tool snippet} +/// +/// With max limit showing overflow badge: +/// +/// ```dart +/// StreamAvatarStack( +/// max: 3, +/// children: [ +/// StreamAvatar(placeholder: (context) => Text('A')), +/// StreamAvatar(placeholder: (context) => Text('B')), +/// StreamAvatar(placeholder: (context) => Text('C')), +/// StreamAvatar(placeholder: (context) => Text('D')), +/// StreamAvatar(placeholder: (context) => Text('E')), +/// ], +/// ) +/// // Shows: [A] [B] [C] [StreamBadgeCount with +2] +/// ``` +/// {@end-tool} +/// +/// {@tool snippet} +/// +/// Custom size and overlap: +/// +/// ```dart +/// StreamAvatarStack( +/// size: StreamAvatarStackSize.sm, +/// overlap: 0.5, // 50% overlap +/// children: [ +/// StreamAvatar(placeholder: (context) => Text('A')), +/// StreamAvatar(placeholder: (context) => Text('B')), +/// StreamAvatar(placeholder: (context) => Text('C')), +/// ], +/// ) +/// ``` +/// {@end-tool} +/// +/// See also: +/// +/// * [StreamAvatarStackSize], which defines the available size variants. +/// * [StreamAvatar], the individual avatar widget. +/// * [StreamBadgeCount], used for the overflow indicator. +/// * [StreamAvatarThemeData], for customizing avatar theme properties. +class StreamAvatarStack extends StatelessWidget { + /// Creates a [StreamAvatarStack] with the given children. + /// + /// The [children] are typically [StreamAvatar] widgets. + /// The [overlap] controls how much each avatar overlaps the previous one, + /// ranging from 0.0 (no overlap) to 1.0 (fully stacked). + StreamAvatarStack({ + super.key, + StreamAvatarStackSize? size, + required Iterable children, + double overlap = 0.33, + int max = 5, + }) : assert(max >= 2, 'max must be at least 2'), + props = .new(size: size, children: children, overlap: overlap, max: max); + + /// The properties that configure this avatar stack. + final StreamAvatarStackProps props; + + @override + Widget build(BuildContext context) { + final builder = StreamComponentFactory.of(context).avatarStack; + if (builder != null) return builder(context, props); + return DefaultStreamAvatarStack(props: props); + } +} + +/// Properties for configuring a [StreamAvatarStack]. +/// +/// This class holds all the configuration options for an avatar stack, +/// allowing them to be passed through the [StreamComponentFactory]. +/// +/// See also: +/// +/// * [StreamAvatarStack], which uses these properties. +/// * [DefaultStreamAvatarStack], the default implementation. +class StreamAvatarStackProps { + /// Creates properties for an avatar stack. + const StreamAvatarStackProps({ + this.size, + required this.children, + this.overlap = 0.33, + this.max = 5, + }); + + /// The list of widgets to display in the stack. + /// + /// Typically a list of [StreamAvatar] widgets. + final Iterable children; + + /// The size of the avatar stack. + /// + /// If null, defaults to [StreamAvatarStackSize.sm]. + final StreamAvatarStackSize? size; + + /// How much each avatar overlaps the previous one, as a fraction of size. + /// + /// - `0.0`: No overlap (side by side) + /// - `0.33`: 33% overlap (default) + /// - `1.0`: Fully stacked + final double overlap; + + /// Maximum number of avatars to display before showing overflow badge. + /// + /// When [children] exceeds this value, displays [max] avatars followed + /// by a [StreamBadgeCount] showing the overflow count. + /// + /// Must be at least 2. Defaults to 5. + final int max; +} + +/// The default implementation of [StreamAvatarStack]. +/// +/// This widget renders the avatar stack with theming support. +/// It's used as the default factory implementation in [StreamComponentFactory]. +/// +/// See also: +/// +/// * [StreamAvatarStack], the public API widget. +/// * [StreamAvatarStackProps], which configures this widget. +class DefaultStreamAvatarStack extends StatelessWidget { + /// Creates a default avatar stack with the given [props]. + const DefaultStreamAvatarStack({super.key, required this.props}); + + /// The properties that configure this avatar stack. + final StreamAvatarStackProps props; + + @override + Widget build(BuildContext context) { + if (props.children.isEmpty) return const SizedBox.shrink(); + + final effectiveSize = props.size ?? StreamAvatarStackSize.sm; + final avatarSize = _avatarSizeForStackSize(effectiveSize); + final extraBadgeSize = _badgeCountSizeForStackSize(effectiveSize); + + final diameter = avatarSize.value; + + final visible = props.children.take(props.max).toList(); + final extraCount = props.children.length - visible.length; + + return MediaQuery.withNoTextScaling( + child: StreamAvatarTheme( + data: StreamAvatarThemeData(size: avatarSize), + child: StreamRow( + spacing: -diameter * props.overlap, + mainAxisSize: MainAxisSize.min, + children: [ + ...visible, + if (extraCount > 0) + StreamBadgeCount( + label: '+$extraCount', + size: extraBadgeSize, + ), + ], + ), + ), + ); + } + + // Returns the appropriate avatar size for the given stack size. + StreamAvatarSize _avatarSizeForStackSize( + StreamAvatarStackSize size, + ) => switch (size) { + .xs => StreamAvatarSize.xs, + .sm => StreamAvatarSize.sm, + }; + + // Returns the appropriate badge count size for the given stack size. + StreamBadgeCountSize _badgeCountSizeForStackSize( + StreamAvatarStackSize size, + ) => switch (size) { + .xs => StreamBadgeCountSize.xs, + .sm => StreamBadgeCountSize.sm, + }; +} diff --git a/packages/stream_core_flutter/lib/src/components/badge/stream_badge_count.dart b/packages/stream_core_flutter/lib/src/components/badge/stream_badge_count.dart new file mode 100644 index 0000000..76bd76c --- /dev/null +++ b/packages/stream_core_flutter/lib/src/components/badge/stream_badge_count.dart @@ -0,0 +1,225 @@ +import 'package:flutter/material.dart'; + +import '../../factory/stream_component_factory.dart'; +import '../../theme/components/stream_badge_count_theme.dart'; +import '../../theme/primitives/stream_spacing.dart'; +import '../../theme/semantics/stream_color_scheme.dart'; +import '../../theme/semantics/stream_text_theme.dart'; +import '../../theme/stream_theme_extensions.dart'; + +/// A badge component for displaying counts or labels. +/// +/// [StreamBadgeCount] displays a text label in a pill-shaped badge. +/// It's typically positioned on avatars, icons, or list items to indicate +/// new messages, notifications, overflow counts, or other information. +/// +/// The badge automatically handles: +/// - Adapting width based on the label length +/// - Consistent styling across size variants +/// - Proper text theming from [StreamBadgeCountThemeData] +/// +/// {@tool snippet} +/// +/// Basic usage with a count: +/// +/// ```dart +/// StreamBadgeCount(label: '5') +/// ``` +/// {@end-tool} +/// +/// {@tool snippet} +/// +/// Positioned on an avatar: +/// +/// ```dart +/// Stack( +/// children: [ +/// StreamAvatar(placeholder: (context) => Text('AB')), +/// Positioned( +/// right: 0, +/// top: 0, +/// child: StreamBadgeCount(label: '3'), +/// ), +/// ], +/// ) +/// ``` +/// {@end-tool} +/// +/// {@tool snippet} +/// +/// Overflow indicator: +/// +/// ```dart +/// StreamBadgeCount( +/// label: '+5', +/// size: StreamBadgeCountSize.sm, +/// ) +/// ``` +/// {@end-tool} +/// +/// ## Theming +/// +/// [StreamBadgeCount] uses [StreamBadgeCountThemeData] for default styling. +/// Colors are determined by the current [StreamColorScheme]. +/// +/// See also: +/// +/// * [StreamBadgeCountSize], which defines the available size variants. +/// * [StreamBadgeCountThemeData], for customizing badge appearance. +/// * [StreamBadgeCountTheme], for overriding theme in a widget subtree. +/// * [StreamAvatar], which often displays this badge. +class StreamBadgeCount extends StatelessWidget { + /// Creates a badge count indicator. + StreamBadgeCount({ + super.key, + StreamBadgeCountSize? size, + required String label, + }) : props = .new(size: size, label: label); + + /// The properties that configure this badge count. + final StreamBadgeCountProps props; + + @override + Widget build(BuildContext context) { + final builder = StreamComponentFactory.of(context).badgeCount; + if (builder != null) return builder(context, props); + return DefaultStreamBadgeCount(props: props); + } +} + +/// Properties for configuring a [StreamBadgeCount]. +/// +/// This class holds all the configuration options for a badge count, +/// allowing them to be passed through the [StreamComponentFactory]. +/// +/// See also: +/// +/// * [StreamBadgeCount], which uses these properties. +/// * [DefaultStreamBadgeCount], the default implementation. +class StreamBadgeCountProps { + /// Creates properties for a badge count. + const StreamBadgeCountProps({ + this.size, + required this.label, + }); + + /// The text label to display in the badge. + /// + /// Typically a numeric count (e.g., "5") or an overflow indicator + /// (e.g., "+3", "99+"). + final String label; + + /// The size of the badge. + /// + /// If null, uses [StreamBadgeCountThemeData.size], or falls back to + /// [StreamBadgeCountSize.xs]. + final StreamBadgeCountSize? size; +} + +/// The default implementation of [StreamBadgeCount]. +/// +/// This widget renders the badge count with theming support. +/// It's used as the default factory implementation in [StreamComponentFactory]. +/// +/// See also: +/// +/// * [StreamBadgeCount], the public API widget. +/// * [StreamBadgeCountProps], which configures this widget. +class DefaultStreamBadgeCount extends StatelessWidget { + /// Creates a default badge count with the given [props]. + const DefaultStreamBadgeCount({super.key, required this.props}); + + /// The properties that configure this badge count. + final StreamBadgeCountProps props; + + @override + Widget build(BuildContext context) { + final spacing = context.streamSpacing; + final boxShadow = context.streamBoxShadow; + final textTheme = context.streamTextTheme; + + final badgeCountTheme = context.streamBadgeCountTheme; + final defaults = _StreamBadgeCountThemeDefaults(context); + + final effectiveSize = props.size ?? badgeCountTheme.size ?? defaults.size; + final effectiveBackgroundColor = badgeCountTheme.backgroundColor ?? defaults.backgroundColor; + final effectiveBorderColor = badgeCountTheme.borderColor ?? defaults.borderColor; + final effectiveTextColor = badgeCountTheme.textColor ?? defaults.textColor; + + final padding = _paddingForSize(effectiveSize, spacing); + final textStyle = _textStyleForSize(effectiveSize, textTheme).copyWith(color: effectiveTextColor); + + return IntrinsicWidth( + child: AnimatedContainer( + height: effectiveSize.value, + constraints: BoxConstraints(minWidth: effectiveSize.value), + padding: padding, + alignment: Alignment.center, + clipBehavior: Clip.antiAlias, + duration: kThemeChangeDuration, + decoration: ShapeDecoration( + color: effectiveBackgroundColor, + shape: const StadiumBorder(), + shadows: boxShadow.elevation2, + ), + foregroundDecoration: ShapeDecoration( + shape: StadiumBorder( + side: BorderSide( + color: effectiveBorderColor, + strokeAlign: BorderSide.strokeAlignOutside, + ), + ), + ), + child: DefaultTextStyle( + style: textStyle, + child: Text(props.label), + ), + ), + ); + } + + // Returns the appropriate text style for the given badge size. + TextStyle _textStyleForSize( + StreamBadgeCountSize size, + StreamTextTheme textTheme, + ) => switch (size) { + .xs => textTheme.numericMd, + .sm || .md => textTheme.numericXl, + }; + + // Returns the appropriate padding for the given badge size. + EdgeInsetsGeometry _paddingForSize( + StreamBadgeCountSize size, + StreamSpacing spacing, + ) => switch (size) { + .xs => .symmetric(horizontal: spacing.xxs), + .sm || .md => .symmetric(horizontal: spacing.xs), + }; +} + +// Default theme values for [StreamBadgeCount]. +// +// These defaults are used when no explicit value is provided via +// constructor parameters or [StreamBadgeCountThemeData]. +// +// The defaults are context-aware and use colors from the current +// [StreamColorScheme]. +class _StreamBadgeCountThemeDefaults extends StreamBadgeCountThemeData { + _StreamBadgeCountThemeDefaults(this._context); + + final BuildContext _context; + + late final _colorScheme = _context.streamColorScheme; + + @override + StreamBadgeCountSize get size => StreamBadgeCountSize.xs; + + @override + Color get backgroundColor => _colorScheme.backgroundApp; + + @override + Color get borderColor => _colorScheme.borderSubtle; + + @override + Color get textColor => _colorScheme.textPrimary; +} diff --git a/packages/stream_core_flutter/lib/src/components/badge/stream_badge_notification.dart b/packages/stream_core_flutter/lib/src/components/badge/stream_badge_notification.dart new file mode 100644 index 0000000..e88092d --- /dev/null +++ b/packages/stream_core_flutter/lib/src/components/badge/stream_badge_notification.dart @@ -0,0 +1,233 @@ +import 'package:flutter/material.dart'; + +import '../../factory/stream_component_factory.dart'; +import '../../theme/components/stream_badge_notification_theme.dart'; +import '../../theme/primitives/stream_spacing.dart'; +import '../../theme/semantics/stream_color_scheme.dart'; +import '../../theme/semantics/stream_text_theme.dart'; +import '../../theme/stream_theme_extensions.dart'; + +/// A notification badge for displaying counts in colored pill shapes. +/// +/// [StreamBadgeNotification] displays a count label in a colored pill-shaped +/// badge with a border. It's used in channel list items and other places to +/// indicate unread messages or pending notifications. +/// +/// Unlike [StreamBadgeCount], which uses neutral colors, this badge uses +/// prominent colored backgrounds (primary, error, neutral) to draw attention. +/// +/// The badge has three visual types controlled by +/// [StreamBadgeNotificationType]: +/// +/// * [StreamBadgeNotificationType.primary] — Brand accent background. +/// * [StreamBadgeNotificationType.error] — Error/red background. +/// * [StreamBadgeNotificationType.neutral] — Muted gray background. +/// +/// {@tool snippet} +/// +/// Basic usage with unread count: +/// +/// ```dart +/// StreamBadgeNotification(label: '3') +/// ``` +/// {@end-tool} +/// +/// {@tool snippet} +/// +/// Error variant: +/// +/// ```dart +/// StreamBadgeNotification( +/// label: '!', +/// type: StreamBadgeNotificationType.error, +/// ) +/// ``` +/// {@end-tool} +/// +/// ## Theming +/// +/// [StreamBadgeNotification] uses [StreamBadgeNotificationThemeData] for +/// default styling. Colors are determined by the current [StreamColorScheme]. +/// +/// See also: +/// +/// * [StreamBadgeNotificationSize], the available size variants. +/// * [StreamBadgeNotificationType], the available style variants. +/// * [StreamBadgeNotificationThemeData], for customizing appearance. +/// * [StreamBadgeNotificationTheme], for overriding theme in a subtree. +/// * [StreamBadgeCount], a neutral count badge without colored backgrounds. +class StreamBadgeNotification extends StatelessWidget { + /// Creates a badge notification indicator. + StreamBadgeNotification({ + super.key, + StreamBadgeNotificationType? type, + StreamBadgeNotificationSize? size, + required String label, + }) : props = StreamBadgeNotificationProps( + type: type, + size: size, + label: label, + ); + + /// The properties that configure this badge notification. + final StreamBadgeNotificationProps props; + + @override + Widget build(BuildContext context) { + final builder = StreamComponentFactory.of(context).badgeNotification; + if (builder != null) return builder(context, props); + return DefaultStreamBadgeNotification(props: props); + } +} + +/// Properties for configuring a [StreamBadgeNotification]. +/// +/// This class holds all the configuration options for a badge notification, +/// allowing them to be passed through the [StreamComponentFactory]. +/// +/// See also: +/// +/// * [StreamBadgeNotification], which uses these properties. +/// * [DefaultStreamBadgeNotification], the default implementation. +class StreamBadgeNotificationProps { + /// Creates properties for a badge notification. + const StreamBadgeNotificationProps({ + this.type, + this.size, + required this.label, + }); + + /// The visual type determining the badge background color. + /// + /// If null, defaults to [StreamBadgeNotificationType.primary]. + final StreamBadgeNotificationType? type; + + /// The size of the badge. + /// + /// If null, uses [StreamBadgeNotificationThemeData.size], or falls back to + /// [StreamBadgeNotificationSize.sm]. + final StreamBadgeNotificationSize? size; + + /// The text label to display in the badge. + /// + /// Typically a numeric count (e.g., "5") or an overflow indicator + /// (e.g., "99+"). + final String label; +} + +/// The default implementation of [StreamBadgeNotification]. +/// +/// This widget renders the badge notification with theming support. +/// It's used as the default factory implementation in +/// [StreamComponentFactory]. +/// +/// See also: +/// +/// * [StreamBadgeNotification], the public API widget. +/// * [StreamBadgeNotificationProps], which configures this widget. +class DefaultStreamBadgeNotification extends StatelessWidget { + /// Creates a default badge notification with the given [props]. + const DefaultStreamBadgeNotification({super.key, required this.props}); + + /// The properties that configure this badge notification. + final StreamBadgeNotificationProps props; + + @override + Widget build(BuildContext context) { + final spacing = context.streamSpacing; + final textTheme = context.streamTextTheme; + + final theme = context.streamBadgeNotificationTheme; + final defaults = _StreamBadgeNotificationThemeDefaults(context); + + final effectiveSize = props.size ?? theme.size ?? defaults.size; + final effectiveType = props.type ?? StreamBadgeNotificationType.primary; + final effectiveTextColor = theme.textColor ?? defaults.textColor; + final effectiveBorderColor = theme.borderColor ?? defaults.borderColor; + final effectiveBackgroundColor = _resolveBackgroundColor( + effectiveType, + theme, + defaults, + ); + + final padding = _paddingForSize(effectiveSize, spacing); + final textStyle = _textStyleForSize(effectiveSize, textTheme).copyWith(color: effectiveTextColor); + + return IntrinsicWidth( + child: Container( + constraints: BoxConstraints( + minWidth: effectiveSize.value, + minHeight: effectiveSize.value, + ), + padding: padding, + alignment: Alignment.center, + decoration: ShapeDecoration( + color: effectiveBackgroundColor, + shape: StadiumBorder( + side: BorderSide( + color: effectiveBorderColor, + width: 2, + strokeAlign: BorderSide.strokeAlignOutside, + ), + ), + ), + child: DefaultTextStyle( + style: textStyle, + child: Text(props.label), + ), + ), + ); + } + + Color _resolveBackgroundColor( + StreamBadgeNotificationType type, + StreamBadgeNotificationThemeData theme, + _StreamBadgeNotificationThemeDefaults defaults, + ) => switch (type) { + StreamBadgeNotificationType.primary => theme.primaryBackgroundColor ?? defaults.primaryBackgroundColor, + StreamBadgeNotificationType.error => theme.errorBackgroundColor ?? defaults.errorBackgroundColor, + StreamBadgeNotificationType.neutral => theme.neutralBackgroundColor ?? defaults.neutralBackgroundColor, + }; + + TextStyle _textStyleForSize( + StreamBadgeNotificationSize size, + StreamTextTheme textTheme, + ) => switch (size) { + .xs => textTheme.numericMd, + .sm => textTheme.numericXl, + }; + + EdgeInsetsGeometry _paddingForSize( + StreamBadgeNotificationSize size, + StreamSpacing spacing, + ) => switch (size) { + .xs => EdgeInsets.symmetric(horizontal: spacing.xxs), + .sm => EdgeInsets.symmetric(horizontal: spacing.xxs), + }; +} + +class _StreamBadgeNotificationThemeDefaults extends StreamBadgeNotificationThemeData { + _StreamBadgeNotificationThemeDefaults(this._context); + + final BuildContext _context; + + late final _colorScheme = _context.streamColorScheme; + + @override + StreamBadgeNotificationSize get size => StreamBadgeNotificationSize.sm; + + @override + Color get primaryBackgroundColor => _colorScheme.accentPrimary; + + @override + Color get errorBackgroundColor => _colorScheme.accentError; + + @override + Color get neutralBackgroundColor => _colorScheme.accentNeutral; + + @override + Color get textColor => _colorScheme.textOnAccent; + + @override + Color get borderColor => _colorScheme.borderOnDark; +} diff --git a/packages/stream_core_flutter/lib/src/components/badge/stream_media_badge.dart b/packages/stream_core_flutter/lib/src/components/badge/stream_media_badge.dart new file mode 100644 index 0000000..b522606 --- /dev/null +++ b/packages/stream_core_flutter/lib/src/components/badge/stream_media_badge.dart @@ -0,0 +1,57 @@ +import 'package:flutter/widgets.dart'; + +import '../../../stream_core_flutter.dart'; + +class StreamMediaBadge extends StatelessWidget { + const StreamMediaBadge({super.key, required this.type, this.duration}); + + final MediaBadgeType type; + final Duration? duration; + + @override + Widget build(BuildContext context) { + return Container( + decoration: BoxDecoration( + color: context.streamColorScheme.backgroundInverse, + borderRadius: BorderRadius.all(context.streamRadius.max), + ), + padding: EdgeInsets.symmetric( + horizontal: context.streamSpacing.xs, + vertical: context.streamSpacing.xxs, + ), + child: Row( + mainAxisSize: MainAxisSize.min, + children: [ + Icon( + switch (type) { + MediaBadgeType.video => context.streamIcons.videoSolid, + MediaBadgeType.audio => context.streamIcons.microphoneSolid, + }, + size: 12, + color: context.streamColorScheme.textOnDark, + ), + + if (duration case final duration?) + Text( + duration.toReadableString(), + style: context.streamTextTheme.numericMd.copyWith(color: context.streamColorScheme.textOnDark), + ), + ], + ), + ); + } +} + +extension on Duration { + String toReadableString() { + if (inSeconds < 60) { + return '${inSeconds}s'; + } + if (inSeconds < 3600) { + return '${inMinutes}m'; + } + return '${inHours}h'; + } +} + +enum MediaBadgeType { video, audio } diff --git a/packages/stream_core_flutter/lib/src/components/badge/stream_online_indicator.dart b/packages/stream_core_flutter/lib/src/components/badge/stream_online_indicator.dart new file mode 100644 index 0000000..19bf17b --- /dev/null +++ b/packages/stream_core_flutter/lib/src/components/badge/stream_online_indicator.dart @@ -0,0 +1,250 @@ +import 'package:flutter/material.dart'; + +import '../../factory/stream_component_factory.dart'; +import '../../theme/components/stream_online_indicator_theme.dart'; +import '../../theme/semantics/stream_color_scheme.dart'; +import '../../theme/stream_theme_extensions.dart'; + +/// A circular indicator showing online/offline presence status. +/// +/// This indicator is typically positioned on or near an avatar to show +/// whether a user is currently online or offline. +/// +/// When [child] is provided, the indicator is automatically positioned +/// relative to the child using a [Stack], similar to Flutter's [Badge] widget. +/// +/// {@tool snippet} +/// +/// Basic usage (standalone indicator): +/// +/// ```dart +/// StreamOnlineIndicator(isOnline: true) +/// ``` +/// {@end-tool} +/// +/// {@tool snippet} +/// +/// With a child widget (automatically positioned): +/// +/// ```dart +/// StreamOnlineIndicator( +/// isOnline: user.isOnline, +/// child: StreamAvatar(placeholder: (context) => Text('AB')), +/// ) +/// ``` +/// {@end-tool} +/// +/// {@tool snippet} +/// +/// Custom positioning: +/// +/// ```dart +/// StreamOnlineIndicator( +/// isOnline: true, +/// alignment: Alignment.topRight, +/// offset: Offset(2, -2), +/// child: StreamAvatar(placeholder: (context) => Text('AB')), +/// ) +/// ``` +/// {@end-tool} +/// +/// {@tool snippet} +/// +/// Custom size: +/// +/// ```dart +/// StreamOnlineIndicator( +/// isOnline: false, +/// size: StreamOnlineIndicatorSize.lg, +/// ) +/// ``` +/// {@end-tool} +/// +/// See also: +/// +/// * [StreamOnlineIndicatorThemeData], for customizing indicator appearance. +/// * [StreamOnlineIndicatorTheme], for overriding theme in a widget subtree. +/// * [StreamAvatar], which often displays this indicator. +class StreamOnlineIndicator extends StatelessWidget { + /// Creates an online indicator. + /// + /// If [child] is provided, the indicator will be positioned relative to the + /// child using [alignment] and [offset]. + StreamOnlineIndicator({ + super.key, + required bool isOnline, + StreamOnlineIndicatorSize? size, + Widget? child, + AlignmentGeometry? alignment, + Offset? offset, + }) : props = .new( + isOnline: isOnline, + size: size, + child: child, + alignment: alignment, + offset: offset, + ); + + /// The properties that configure this online indicator. + final StreamOnlineIndicatorProps props; + + @override + Widget build(BuildContext context) { + final builder = StreamComponentFactory.of(context).onlineIndicator; + if (builder != null) return builder(context, props); + return DefaultStreamOnlineIndicator(props: props); + } +} + +/// Properties for configuring a [StreamOnlineIndicator]. +/// +/// This class holds all the configuration options for an online indicator, +/// allowing them to be passed through the [StreamComponentFactory]. +/// +/// See also: +/// +/// * [StreamOnlineIndicator], which uses these properties. +/// * [DefaultStreamOnlineIndicator], the default implementation. +class StreamOnlineIndicatorProps { + /// Creates properties for an online indicator. + const StreamOnlineIndicatorProps({ + required this.isOnline, + this.size, + this.child, + this.alignment, + this.offset, + }); + + /// Whether the user is online. + /// + /// When true, displays [StreamOnlineIndicatorThemeData.backgroundOnline]. + /// When false, displays [StreamOnlineIndicatorThemeData.backgroundOffline]. + final bool isOnline; + + /// The size of the indicator. + /// + /// If null, uses [StreamOnlineIndicatorThemeData.size], or falls back to + /// [StreamOnlineIndicatorSize.lg]. + final StreamOnlineIndicatorSize? size; + + /// The widget below this widget in the tree. + /// + /// When provided, the indicator is positioned relative to this child + /// using a [Stack]. When null, only the indicator is displayed. + final Widget? child; + + /// The alignment of the indicator relative to [child]. + /// + /// Only used when [child] is provided. + /// Falls back to [StreamOnlineIndicatorThemeData.alignment], or + /// [AlignmentDirectional.topEnd]. + final AlignmentGeometry? alignment; + + /// The offset for fine-tuning indicator position. + /// + /// Applied after [alignment] to adjust the indicator's final position. + /// Falls back to [StreamOnlineIndicatorThemeData.offset], or [Offset.zero]. + final Offset? offset; +} + +/// The default implementation of [StreamOnlineIndicator]. +/// +/// This widget renders the online indicator with theming support. +/// It's used as the default factory implementation in [StreamComponentFactory]. +/// +/// See also: +/// +/// * [StreamOnlineIndicator], the public API widget. +/// * [StreamOnlineIndicatorProps], which configures this widget. +class DefaultStreamOnlineIndicator extends StatelessWidget { + /// Creates a default online indicator with the given [props]. + const DefaultStreamOnlineIndicator({super.key, required this.props}); + + /// The properties that configure this online indicator. + final StreamOnlineIndicatorProps props; + + @override + Widget build(BuildContext context) { + final onlineIndicatorTheme = context.streamOnlineIndicatorTheme; + final defaults = _StreamOnlineIndicatorThemeDefaults(context); + + final effectiveSize = props.size ?? onlineIndicatorTheme.size ?? defaults.size; + final effectiveBackgroundOnline = onlineIndicatorTheme.backgroundOnline ?? defaults.backgroundOnline; + final effectiveBackgroundOffline = onlineIndicatorTheme.backgroundOffline ?? defaults.backgroundOffline; + final effectiveBorderColor = onlineIndicatorTheme.borderColor ?? defaults.borderColor; + + final color = props.isOnline ? effectiveBackgroundOnline : effectiveBackgroundOffline; + final border = Border.all( + color: effectiveBorderColor, + width: _borderWidthForSize(effectiveSize), + ); + + final indicator = AnimatedContainer( + width: effectiveSize.value, + height: effectiveSize.value, + duration: kThemeChangeDuration, + decoration: BoxDecoration(shape: BoxShape.circle, color: color), + foregroundDecoration: BoxDecoration(shape: BoxShape.circle, border: border), + ); + + // If no child, just return the indicator. + if (props.child == null) return indicator; + + // Otherwise, wrap in Stack like Badge. + final effectiveAlignment = props.alignment ?? onlineIndicatorTheme.alignment ?? defaults.alignment; + final effectiveOffset = props.offset ?? onlineIndicatorTheme.offset ?? defaults.offset; + + return Stack( + clipBehavior: Clip.none, + children: [ + props.child!, + Positioned.fill( + child: Align( + alignment: effectiveAlignment, + child: Transform.translate( + offset: effectiveOffset, + child: indicator, + ), + ), + ), + ], + ); + } + + // Returns the appropriate border width for the given indicator size. + double _borderWidthForSize( + StreamOnlineIndicatorSize size, + ) => switch (size) { + .sm => 1, + .md || .lg || .xl => 2, + }; +} + +// Provides default values for [StreamOnlineIndicatorThemeData] based on +// the current [StreamColorScheme]. +class _StreamOnlineIndicatorThemeDefaults extends StreamOnlineIndicatorThemeData { + _StreamOnlineIndicatorThemeDefaults( + this.context, + ) : _colorScheme = context.streamColorScheme; + + final BuildContext context; + final StreamColorScheme _colorScheme; + + @override + StreamOnlineIndicatorSize get size => StreamOnlineIndicatorSize.lg; + + @override + Color get backgroundOnline => _colorScheme.accentSuccess; + + @override + Color get backgroundOffline => _colorScheme.accentNeutral; + + @override + Color get borderColor => _colorScheme.borderOnDark; + + @override + AlignmentGeometry get alignment => AlignmentDirectional.topEnd; + + @override + Offset get offset => Offset.zero; +} diff --git a/packages/stream_core_flutter/lib/src/components/buttons/stream_button.dart b/packages/stream_core_flutter/lib/src/components/buttons/stream_button.dart new file mode 100644 index 0000000..d3cc62a --- /dev/null +++ b/packages/stream_core_flutter/lib/src/components/buttons/stream_button.dart @@ -0,0 +1,653 @@ +import 'package:flutter/material.dart'; + +import '../../factory/stream_component_factory.dart'; +import '../../theme/components/stream_button_theme.dart'; +import '../../theme/primitives/stream_colors.dart'; +import '../../theme/semantics/stream_color_scheme.dart'; +import '../../theme/stream_theme_extensions.dart'; + +/// A versatile button with support for multiple styles, types, and sizes. +/// +/// [StreamButton] renders a label-based button or an icon-only button via the +/// [StreamButton.icon] constructor. The button adapts its appearance based on +/// the combination of [StreamButtonStyle], [StreamButtonType], and interaction +/// state (hover, pressed, disabled, selected). +/// +/// All visual states can be customized via [StreamButtonTheme]. +/// +/// {@tool snippet} +/// +/// Display a primary solid button: +/// +/// ```dart +/// StreamButton( +/// label: 'Submit', +/// onTap: () => print('submitted'), +/// ) +/// ``` +/// {@end-tool} +/// +/// {@tool snippet} +/// +/// Display a selectable ghost button: +/// +/// ```dart +/// StreamButton( +/// label: 'Filter', +/// style: StreamButtonStyle.secondary, +/// type: StreamButtonType.ghost, +/// isSelected: isActive, +/// onTap: () => toggleFilter(), +/// ) +/// ``` +/// {@end-tool} +/// +/// See also: +/// +/// * [StreamButtonTheme], for customizing button appearance. +/// * [StreamButtonStyle], for available style variants. +/// * [StreamButtonType], for available type variants. +/// * [StreamButtonSize], for available size variants. +class StreamButton extends StatelessWidget { + /// Creates a label button with optional leading and trailing icons. + StreamButton({ + super.key, + required String label, + VoidCallback? onTap, + StreamButtonStyle style = .primary, + StreamButtonType type = .solid, + StreamButtonSize size = .medium, + IconData? iconLeft, + IconData? iconRight, + bool? isSelected, + }) : props = .new( + label: label, + onTap: onTap, + style: style, + type: type, + size: size, + iconLeft: iconLeft, + iconRight: iconRight, + isSelected: isSelected, + ); + + /// Creates a circular icon-only button. + /// + /// Set [isFloating] to true for an floating button with a shadow. + StreamButton.icon({ + super.key, + VoidCallback? onTap, + StreamButtonStyle style = .primary, + StreamButtonType type = .solid, + StreamButtonSize size = .medium, + IconData? icon, + bool? isFloating, + bool? isSelected, + }) : props = .new( + onTap: onTap, + style: style, + type: type, + size: size, + iconLeft: icon, + isFloating: isFloating, + isSelected: isSelected, + ); + + /// The props controlling the appearance and behavior of this button. + final StreamButtonProps props; + + @override + Widget build(BuildContext context) { + final builder = StreamComponentFactory.of(context).button; + if (builder != null) return builder(context, props); + return DefaultStreamButton(props: props); + } +} + +/// Properties for configuring a [StreamButton]. +/// +/// This class holds all the configuration options for a button, +/// allowing them to be passed through the [StreamComponentFactory]. +/// +/// See also: +/// +/// * [StreamButton], which uses these properties. +/// * [DefaultStreamButton], the default implementation. +class StreamButtonProps { + /// Creates properties for a button. + const StreamButtonProps({ + this.label, + this.onTap, + this.style = .primary, + this.type = .solid, + this.size = .medium, + this.iconLeft, + this.iconRight, + this.isFloating, + this.isSelected, + }); + + /// The label text displayed on the button. + /// + /// If null, the button is rendered as a circular icon-only button. + final String? label; + + /// Called when the button is pressed. + /// + /// If null, the button will be disabled. + final VoidCallback? onTap; + + /// The visual style variant of the button. + /// + /// Determines the color scheme used (primary, secondary, destructive). + final StreamButtonStyle style; + + /// The type variant of the button. + /// + /// Controls the visual weight (solid, outline, ghost). + final StreamButtonType type; + + /// The size of the button. + final StreamButtonSize size; + + /// The icon displayed on the left side of the label. + final IconData? iconLeft; + + /// The icon displayed on the right side of the label. + final IconData? iconRight; + + /// Whether the button has a floating (elevated) appearance. + /// + /// When true, the button gains elevation and a background fill + /// for outline and ghost types. + /// When false or null, the button is not floating. + final bool? isFloating; + + /// Whether the button is in a selected state. + /// + /// When true, the button displays selected styling. + /// When false or null, the button is not selected. + final bool? isSelected; +} + +/// The color scheme variant for a [StreamButton]. +/// +/// Each style maps to a distinct set of colors defined in the theme. +enum StreamButtonStyle { + /// Uses the brand/accent color scheme. + primary, + + /// Uses the neutral/surface color scheme. + secondary, + + /// Uses the error/danger color scheme. + destructive, +} + +/// The visual weight variant for a [StreamButton]. +/// +/// Controls how prominently the button is displayed. +enum StreamButtonType { + /// Filled background with high visual emphasis. + solid, + + /// Bordered with transparent background for medium emphasis. + outline, + + /// No border or background for low emphasis. + ghost, +} + +/// Predefined sizes for [StreamButton]. +/// +/// Each size corresponds to a specific dimension in logical pixels. +/// +/// See also: +/// +/// * [StreamButtonThemeData], for setting global button styles. +enum StreamButtonSize { + /// Small button (32px). + small(32), + + /// Medium button (40px). + medium(40), + + /// Large button (48px). + large(48) + ; + + /// Constructs a [StreamButtonSize] with the given dimension. + const StreamButtonSize(this.value); + + /// The dimension of the button in logical pixels. + final double value; +} + +/// Default implementation of [StreamButton]. +/// +/// Renders the button using [ElevatedButton] with theme-aware styling and +/// state-based visual feedback. Uses [WidgetStatesController] to manage +/// the selected state. +class DefaultStreamButton extends StatefulWidget { + /// Creates a default button. + const DefaultStreamButton({super.key, required this.props}); + + /// The props controlling the appearance and behavior of this button. + final StreamButtonProps props; + + @override + State createState() => _DefaultStreamButtonState(); +} + +class _DefaultStreamButtonState extends State { + StreamButtonProps get props => widget.props; + late final WidgetStatesController _statesController; + + @override + void initState() { + super.initState(); + _statesController = WidgetStatesController( + {if (props.isSelected ?? false) WidgetState.selected}, + ); + } + + @override + void didUpdateWidget(DefaultStreamButton oldWidget) { + super.didUpdateWidget(oldWidget); + _statesController.update(WidgetState.selected, props.isSelected ?? false); + } + + @override + void dispose() { + _statesController.dispose(); + super.dispose(); + } + + @override + Widget build(BuildContext context) { + final radius = context.streamRadius; + final spacing = context.streamSpacing; + final buttonTheme = context.streamButtonTheme; + + final themeStyle = switch ((props.style, props.type)) { + (.primary, .solid) => buttonTheme.primary?.solid, + (.primary, .outline) => buttonTheme.primary?.outline, + (.primary, .ghost) => buttonTheme.primary?.ghost, + (.secondary, .solid) => buttonTheme.secondary?.solid, + (.secondary, .outline) => buttonTheme.secondary?.outline, + (.secondary, .ghost) => buttonTheme.secondary?.ghost, + (.destructive, .solid) => buttonTheme.destructive?.solid, + (.destructive, .outline) => buttonTheme.destructive?.outline, + (.destructive, .ghost) => buttonTheme.destructive?.ghost, + }; + + final isFloating = props.isFloating ?? false; + final defaults = switch ((props.style, props.type)) { + (.primary, .solid) => _PrimarySolidDefaults(context, isFloating: isFloating), + (.primary, .outline) => _PrimaryOutlineDefaults(context, isFloating: isFloating), + (.primary, .ghost) => _PrimaryGhostDefaults(context, isFloating: isFloating), + (.secondary, .solid) => _SecondarySolidDefaults(context, isFloating: isFloating), + (.secondary, .outline) => _SecondaryOutlineDefaults(context, isFloating: isFloating), + (.secondary, .ghost) => _SecondaryGhostDefaults(context, isFloating: isFloating), + (.destructive, .solid) => _DestructiveSolidDefaults(context, isFloating: isFloating), + (.destructive, .outline) => _DestructiveOutlineDefaults(context, isFloating: isFloating), + (.destructive, .ghost) => _DestructiveGhostDefaults(context, isFloating: isFloating), + }; + + final effectiveBackgroundColor = themeStyle?.backgroundColor ?? defaults.backgroundColor; + final effectiveForegroundColor = themeStyle?.foregroundColor ?? defaults.foregroundColor; + final effectiveBorderColor = themeStyle?.borderColor ?? defaults.borderColor; + final effectiveOverlayColor = themeStyle?.overlayColor ?? defaults.overlayColor; + final effectiveElevation = themeStyle?.elevation ?? defaults.elevation; + final effectiveIconSize = themeStyle?.iconSize ?? defaults.iconSize; + + final buttonSize = props.size.value; + final isIconButton = props.label == null; + + return ElevatedButton( + onPressed: props.onTap, + statesController: _statesController, + style: ButtonStyle( + tapTargetSize: .padded, + visualDensity: .standard, + iconSize: effectiveIconSize, + elevation: effectiveElevation, + backgroundColor: effectiveBackgroundColor, + foregroundColor: effectiveForegroundColor, + overlayColor: effectiveOverlayColor, + minimumSize: .all(.square(buttonSize)), + maximumSize: .all(isIconButton ? .square(buttonSize) : .fromHeight(buttonSize)), + padding: .all(isIconButton ? .zero : .symmetric(horizontal: spacing.md)), + side: switch (effectiveBorderColor) { + final color? => .resolveWith( + (states) { + final resolvedColor = color.resolve(states); + if (resolvedColor == null) return null; + return BorderSide(color: resolvedColor); + }, + ), + _ => null, + }, + shape: switch (props.label) { + null => .all(const CircleBorder()), + _ => .all(RoundedRectangleBorder(borderRadius: .all(radius.max))), + }, + ), + child: switch (isIconButton) { + true => Icon(props.iconLeft), + false => Row( + mainAxisSize: MainAxisSize.min, + mainAxisAlignment: MainAxisAlignment.center, + spacing: spacing.xs, + children: [ + if (props.iconLeft case final iconLeft?) Icon(iconLeft), + if (props.label case final label?) Flexible(child: Text(label)), + if (props.iconRight case final iconRight?) Icon(iconRight), + ], + ), + }, + ); + } +} + +// -- Shared defaults -------------------------------------------------------- + +mixin _SharedButtonDefaults on StreamButtonThemeStyle { + bool get isFloating; + StreamColorScheme get colorScheme; + + @override + WidgetStateProperty get iconSize => const WidgetStatePropertyAll(20); + + @override + WidgetStateProperty get overlayColor => WidgetStateProperty.resolveWith((states) { + if (states.contains(WidgetState.pressed)) return colorScheme.statePressed; + if (states.contains(WidgetState.hovered)) return colorScheme.stateHover; + return StreamColors.transparent; + }); + + @override + WidgetStateProperty get elevation => WidgetStateProperty.resolveWith((states) { + if (!isFloating) return 0; + if (states.contains(WidgetState.disabled)) return 0.0; + if (states.contains(WidgetState.pressed)) return 6.0; + if (states.contains(WidgetState.hovered)) return 8.0; + return 6.0; + }); +} + +// -- Primary defaults ------------------------------------------------------- + +// Default style for primary solid buttons. +class _PrimarySolidDefaults extends StreamButtonThemeStyle with _SharedButtonDefaults { + _PrimarySolidDefaults( + this.context, { + required this.isFloating, + }) : colorScheme = context.streamColorScheme; + + final BuildContext context; + @override + final StreamColorScheme colorScheme; + @override + final bool isFloating; + + @override + WidgetStateProperty? get backgroundColor => WidgetStateProperty.resolveWith((states) { + if (states.contains(WidgetState.disabled)) return colorScheme.backgroundDisabled; + final base = colorScheme.accentPrimary; + if (states.contains(WidgetState.selected)) return .alphaBlend(colorScheme.stateSelected, base); + return base; + }); + + @override + WidgetStateProperty? get foregroundColor => WidgetStateProperty.resolveWith((states) { + if (states.contains(WidgetState.disabled)) return colorScheme.textDisabled; + return colorScheme.textOnAccent; + }); +} + +// Default style for primary outline buttons. +class _PrimaryOutlineDefaults extends StreamButtonThemeStyle with _SharedButtonDefaults { + _PrimaryOutlineDefaults( + this.context, { + required this.isFloating, + }) : colorScheme = context.streamColorScheme; + + final BuildContext context; + @override + final StreamColorScheme colorScheme; + @override + final bool isFloating; + + @override + WidgetStateProperty? get backgroundColor => WidgetStateProperty.resolveWith((states) { + if (states.contains(WidgetState.disabled)) return StreamColors.transparent; + final base = isFloating ? colorScheme.backgroundElevation1 : StreamColors.transparent; + if (states.contains(WidgetState.selected)) return .alphaBlend(colorScheme.stateSelected, base); + return base; + }); + + @override + WidgetStateProperty? get borderColor => WidgetStateProperty.resolveWith((states) { + if (states.contains(WidgetState.disabled)) return colorScheme.borderDisabled; + return colorScheme.brand.shade200; + }); + + @override + WidgetStateProperty? get foregroundColor => WidgetStateProperty.resolveWith((states) { + if (states.contains(WidgetState.disabled)) return colorScheme.textDisabled; + return colorScheme.accentPrimary; + }); +} + +// Default style for primary ghost buttons. +class _PrimaryGhostDefaults extends StreamButtonThemeStyle with _SharedButtonDefaults { + _PrimaryGhostDefaults( + this.context, { + required this.isFloating, + }) : colorScheme = context.streamColorScheme; + + final BuildContext context; + @override + final StreamColorScheme colorScheme; + @override + final bool isFloating; + + @override + WidgetStateProperty? get backgroundColor => WidgetStateProperty.resolveWith((states) { + if (states.contains(WidgetState.disabled)) return StreamColors.transparent; + final base = isFloating ? colorScheme.backgroundElevation1 : StreamColors.transparent; + if (states.contains(WidgetState.selected)) return .alphaBlend(colorScheme.stateSelected, base); + return base; + }); + + @override + WidgetStateProperty? get foregroundColor => WidgetStateProperty.resolveWith((states) { + if (states.contains(WidgetState.disabled)) return colorScheme.textDisabled; + return colorScheme.accentPrimary; + }); +} + +// -- Secondary defaults ----------------------------------------------------- + +// Default style for secondary solid buttons. +class _SecondarySolidDefaults extends StreamButtonThemeStyle with _SharedButtonDefaults { + _SecondarySolidDefaults( + this.context, { + required this.isFloating, + }) : colorScheme = context.streamColorScheme; + + final BuildContext context; + @override + final StreamColorScheme colorScheme; + @override + final bool isFloating; + + @override + WidgetStateProperty? get backgroundColor => WidgetStateProperty.resolveWith((states) { + if (states.contains(WidgetState.disabled)) return colorScheme.backgroundDisabled; + final base = colorScheme.backgroundSurface; + if (states.contains(WidgetState.selected)) return .alphaBlend(colorScheme.stateSelected, base); + return base; + }); + + @override + WidgetStateProperty? get foregroundColor => WidgetStateProperty.resolveWith((states) { + if (states.contains(WidgetState.disabled)) return colorScheme.textDisabled; + return colorScheme.textPrimary; + }); +} + +// Default style for secondary outline buttons. +class _SecondaryOutlineDefaults extends StreamButtonThemeStyle with _SharedButtonDefaults { + _SecondaryOutlineDefaults( + this.context, { + required this.isFloating, + }) : colorScheme = context.streamColorScheme; + + final BuildContext context; + @override + final StreamColorScheme colorScheme; + @override + final bool isFloating; + + @override + WidgetStateProperty? get backgroundColor => WidgetStateProperty.resolveWith((states) { + if (states.contains(WidgetState.disabled)) return StreamColors.transparent; + final base = isFloating ? colorScheme.backgroundElevation1 : StreamColors.transparent; + if (states.contains(WidgetState.selected)) return .alphaBlend(colorScheme.stateSelected, base); + return base; + }); + + @override + WidgetStateProperty? get foregroundColor => WidgetStateProperty.resolveWith((states) { + if (states.contains(WidgetState.disabled)) return colorScheme.textDisabled; + return colorScheme.textPrimary; + }); + + @override + WidgetStateProperty? get borderColor => WidgetStateProperty.resolveWith((states) { + if (states.contains(WidgetState.disabled)) return colorScheme.borderDisabled; + return colorScheme.borderDefault; + }); +} + +// Default style for secondary ghost buttons. +class _SecondaryGhostDefaults extends StreamButtonThemeStyle with _SharedButtonDefaults { + _SecondaryGhostDefaults( + this.context, { + required this.isFloating, + }) : colorScheme = context.streamColorScheme; + + final BuildContext context; + @override + final StreamColorScheme colorScheme; + @override + final bool isFloating; + + @override + WidgetStateProperty? get backgroundColor => WidgetStateProperty.resolveWith((states) { + if (states.contains(WidgetState.disabled)) return StreamColors.transparent; + final base = isFloating ? colorScheme.backgroundElevation1 : StreamColors.transparent; + if (states.contains(WidgetState.selected)) return .alphaBlend(colorScheme.stateSelected, base); + return base; + }); + + @override + WidgetStateProperty? get foregroundColor => WidgetStateProperty.resolveWith((states) { + if (states.contains(WidgetState.disabled)) return colorScheme.textDisabled; + return colorScheme.textPrimary; + }); +} + +// -- Destructive defaults --------------------------------------------------- + +// Default style for destructive solid buttons. +class _DestructiveSolidDefaults extends StreamButtonThemeStyle with _SharedButtonDefaults { + _DestructiveSolidDefaults( + this.context, { + required this.isFloating, + }) : colorScheme = context.streamColorScheme; + + final BuildContext context; + @override + final StreamColorScheme colorScheme; + @override + final bool isFloating; + + @override + WidgetStateProperty? get backgroundColor => WidgetStateProperty.resolveWith((states) { + if (states.contains(WidgetState.disabled)) return colorScheme.backgroundDisabled; + final base = colorScheme.accentError; + if (states.contains(WidgetState.selected)) return .alphaBlend(colorScheme.stateSelected, base); + return base; + }); + + @override + WidgetStateProperty? get foregroundColor => WidgetStateProperty.resolveWith((states) { + if (states.contains(WidgetState.disabled)) return colorScheme.textDisabled; + return colorScheme.textOnAccent; + }); +} + +// Default style for destructive outline buttons. +class _DestructiveOutlineDefaults extends StreamButtonThemeStyle with _SharedButtonDefaults { + _DestructiveOutlineDefaults( + this.context, { + required this.isFloating, + }) : colorScheme = context.streamColorScheme; + + final BuildContext context; + @override + final StreamColorScheme colorScheme; + @override + final bool isFloating; + + @override + WidgetStateProperty? get backgroundColor => WidgetStateProperty.resolveWith((states) { + if (states.contains(WidgetState.disabled)) return StreamColors.transparent; + final base = isFloating ? colorScheme.backgroundElevation1 : StreamColors.transparent; + if (states.contains(WidgetState.selected)) return .alphaBlend(colorScheme.stateSelected, base); + return base; + }); + + @override + WidgetStateProperty? get borderColor => WidgetStateProperty.resolveWith((states) { + if (states.contains(WidgetState.disabled)) return colorScheme.borderDisabled; + return colorScheme.accentError; + }); + + @override + WidgetStateProperty? get foregroundColor => WidgetStateProperty.resolveWith((states) { + if (states.contains(WidgetState.disabled)) return colorScheme.textDisabled; + return colorScheme.accentError; + }); +} + +// Default style for destructive ghost buttons. +class _DestructiveGhostDefaults extends StreamButtonThemeStyle with _SharedButtonDefaults { + _DestructiveGhostDefaults( + this.context, { + required this.isFloating, + }) : colorScheme = context.streamColorScheme; + + final BuildContext context; + @override + final StreamColorScheme colorScheme; + @override + final bool isFloating; + + @override + WidgetStateProperty? get backgroundColor => WidgetStateProperty.resolveWith((states) { + if (states.contains(WidgetState.disabled)) return StreamColors.transparent; + final base = isFloating ? colorScheme.backgroundElevation1 : StreamColors.transparent; + if (states.contains(WidgetState.selected)) return .alphaBlend(colorScheme.stateSelected, base); + return base; + }); + + @override + WidgetStateProperty? get foregroundColor => WidgetStateProperty.resolveWith((states) { + if (states.contains(WidgetState.disabled)) return colorScheme.textDisabled; + return colorScheme.accentError; + }); +} diff --git a/packages/stream_core_flutter/lib/src/components/buttons/stream_emoji_button.dart b/packages/stream_core_flutter/lib/src/components/buttons/stream_emoji_button.dart new file mode 100644 index 0000000..c85b8d2 --- /dev/null +++ b/packages/stream_core_flutter/lib/src/components/buttons/stream_emoji_button.dart @@ -0,0 +1,238 @@ +import 'package:flutter/material.dart'; + +import '../../factory/stream_component_factory.dart'; +import '../../theme/components/stream_emoji_button_theme.dart'; +import '../../theme/primitives/stream_colors.dart'; +import '../../theme/semantics/stream_color_scheme.dart'; +import '../../theme/stream_theme_extensions.dart'; +import '../accessories/stream_emoji.dart'; + +/// A tappable circular button that displays an emoji or icon. +/// +/// Used within reaction pickers and other emoji selectors to render +/// individual emoji options with consistent sizing and styling. +/// +/// The button adapts its appearance based on interaction state (hover, +/// pressed, disabled, selected, focused). All states can be customized +/// via [StreamEmojiButtonTheme]. +/// +/// The button size can be controlled via [size] or globally through +/// the theme. +/// +/// {@tool snippet} +/// +/// Display an emoji button: +/// +/// ```dart +/// StreamEmojiButton( +/// emoji: Text('👍'), +/// onPressed: () => print('thumbs up selected'), +/// ) +/// ``` +/// {@end-tool} +/// +/// {@tool snippet} +/// +/// Display a selected emoji button: +/// +/// ```dart +/// StreamEmojiButton( +/// emoji: Text('❤️'), +/// isSelected: true, +/// onPressed: () => print('heart selected'), +/// ) +/// ``` +/// {@end-tool} +/// +/// {@tool snippet} +/// +/// With long press for skin tone variants: +/// +/// ```dart +/// StreamEmojiButton( +/// emoji: Text('👍'), +/// onPressed: () => addReaction('👍'), +/// onLongPress: () => showSkinTonePicker('👍'), +/// ) +/// ``` +/// {@end-tool} +/// +/// See also: +/// +/// * [StreamEmojiButtonTheme], for customizing emoji button appearance. +/// * [StreamEmojiButtonSize], for available size variants. +/// * [StreamEmoji], the component used to render the emoji. +class StreamEmojiButton extends StatelessWidget { + /// Creates an emoji button. + StreamEmojiButton({ + super.key, + StreamEmojiButtonSize? size, + required Widget emoji, + VoidCallback? onPressed, + VoidCallback? onLongPress, + bool? isSelected, + }) : props = .new( + size: size, + emoji: emoji, + onPressed: onPressed, + onLongPress: onLongPress, + isSelected: isSelected, + ); + + /// The props controlling the appearance and behavior of this emoji button. + final StreamEmojiButtonProps props; + + @override + Widget build(BuildContext context) { + final builder = StreamComponentFactory.of(context).emojiButton; + if (builder != null) return builder(context, props); + return DefaultStreamEmojiButton(props: props); + } +} + +/// Properties for configuring a [StreamEmojiButton]. +/// +/// This class holds all the configuration options for an emoji button, +/// allowing them to be passed through the [StreamComponentFactory]. +/// +/// See also: +/// +/// * [StreamEmojiButton], which uses these properties. +/// * [DefaultStreamEmojiButton], the default implementation. +class StreamEmojiButtonProps { + /// Creates properties for an emoji button. + const StreamEmojiButtonProps({ + this.size, + required this.emoji, + this.onPressed, + this.onLongPress, + this.isSelected, + }); + + /// The size of the emoji button. + /// + /// If null, falls back to [StreamEmojiButtonThemeStyle.size], then + /// [StreamEmojiButtonSize.xl]. + final StreamEmojiButtonSize? size; + + /// The emoji or icon widget to display. + final Widget emoji; + + /// Called when the emoji button is pressed. + /// + /// If null, the button will be disabled. + final VoidCallback? onPressed; + + /// Called when the emoji button is long-pressed. + /// + /// Commonly used to show skin tone variants or emoji details. + final VoidCallback? onLongPress; + + /// Whether the button is in a selected state. + /// + /// When true, the button displays selected styling. + /// When false or null, the button is not selected. + final bool? isSelected; +} + +/// Default implementation of [StreamEmojiButton]. +/// +/// Renders the emoji using [StreamEmoji] with theme-aware styling and +/// state-based visual feedback. +class DefaultStreamEmojiButton extends StatelessWidget { + /// Creates a default emoji button. + const DefaultStreamEmojiButton({super.key, required this.props}); + + /// The props controlling the appearance and behavior of this emoji button. + final StreamEmojiButtonProps props; + + @override + Widget build(BuildContext context) { + final emojiButtonStyle = context.streamEmojiButtonTheme.style; + final defaults = _StreamEmojiButtonThemeDefaults(context); + + final effectiveSize = props.size ?? emojiButtonStyle?.size ?? defaults.size; + final effectiveBackgroundColor = emojiButtonStyle?.backgroundColor ?? defaults.backgroundColor; + final effectiveForegroundColor = emojiButtonStyle?.foregroundColor ?? defaults.foregroundColor; + final effectiveOverlayColor = emojiButtonStyle?.overlayColor ?? defaults.overlayColor; + final effectiveSide = emojiButtonStyle?.side ?? defaults.side; + + final emojiSize = _emojiSizeForButtonSize(effectiveSize); + + return IconButton( + onPressed: props.onPressed, + onLongPress: props.onLongPress, + isSelected: props.isSelected, + iconSize: emojiSize.value, + icon: StreamEmoji(emoji: props.emoji), + style: ButtonStyle( + tapTargetSize: .shrinkWrap, + visualDensity: .standard, + fixedSize: .all(.square(effectiveSize.value)), + minimumSize: .all(.square(effectiveSize.value)), + maximumSize: .all(.square(effectiveSize.value)), + padding: .all(EdgeInsets.zero), + shape: .all(const CircleBorder()), + backgroundColor: effectiveBackgroundColor, + foregroundColor: effectiveForegroundColor, + overlayColor: effectiveOverlayColor, + side: effectiveSide, + ), + ); + } + + // Returns the appropriate emoji size for the given button size. + StreamEmojiSize _emojiSizeForButtonSize( + StreamEmojiButtonSize buttonSize, + ) => switch (buttonSize) { + .md => StreamEmojiSize.md, + .lg => StreamEmojiSize.md, + .xl => StreamEmojiSize.lg, + }; +} + +// Provides default values for [StreamEmojiButtonThemeStyle] based on +// the current [StreamColorScheme]. +class _StreamEmojiButtonThemeDefaults extends StreamEmojiButtonThemeStyle { + _StreamEmojiButtonThemeDefaults( + this.context, + ) : _colorScheme = context.streamColorScheme; + + final BuildContext context; + final StreamColorScheme _colorScheme; + + @override + StreamEmojiButtonSize get size => StreamEmojiButtonSize.xl; + + @override + WidgetStateProperty get backgroundColor => WidgetStateProperty.resolveWith((states) { + if (states.contains(WidgetState.disabled)) return StreamColors.transparent; + if (states.contains(WidgetState.selected)) return _colorScheme.stateSelected; + return StreamColors.transparent; + }); + + @override + WidgetStateProperty get foregroundColor => WidgetStateProperty.resolveWith((states) { + if (states.contains(WidgetState.disabled)) return _colorScheme.stateDisabled; + return null; // Let emoji/icon use its natural color + }); + + @override + WidgetStateProperty get overlayColor => WidgetStateProperty.resolveWith((states) { + if (states.contains(WidgetState.pressed)) return _colorScheme.statePressed; + if (states.contains(WidgetState.hovered)) return _colorScheme.stateHover; + return StreamColors.transparent; + }); + + @override + WidgetStateBorderSide? get side => WidgetStateBorderSide.resolveWith((states) { + if (states.contains(WidgetState.focused)) { + return BorderSide( + width: 2, + color: _colorScheme.borderFocus, + strokeAlign: BorderSide.strokeAlignOutside, + ); + } + return BorderSide.none; + }); +} diff --git a/packages/stream_core_flutter/lib/src/components/common/stream_checkbox.dart b/packages/stream_core_flutter/lib/src/components/common/stream_checkbox.dart new file mode 100644 index 0000000..066f6ec --- /dev/null +++ b/packages/stream_core_flutter/lib/src/components/common/stream_checkbox.dart @@ -0,0 +1,261 @@ +import 'package:flutter/material.dart'; + +import '../../factory/stream_component_factory.dart'; +import '../../theme/components/stream_checkbox_theme.dart'; +import '../../theme/primitives/stream_colors.dart'; +import '../../theme/primitives/stream_radius.dart'; +import '../../theme/semantics/stream_color_scheme.dart'; +import '../../theme/stream_theme_extensions.dart'; + +/// A checkbox styled for the Stream design system. +/// +/// [StreamCheckbox] displays a toggleable check indicator that adapts its +/// appearance based on interaction state (hover, pressed, disabled, selected). +/// Visual properties can be customized via [StreamCheckboxTheme] and +/// [StreamCheckboxStyle]. +/// +/// The checkbox itself does not maintain any state. Instead, when the state of +/// the checkbox changes, the widget calls the [onChanged] callback. Most +/// widgets that use a checkbox will listen for the [onChanged] callback and +/// rebuild the checkbox with a new [value] to update the visual appearance. +/// +/// Use [StreamCheckbox.circular] for a circle-shaped variant commonly used in +/// single-selection (radio-like) patterns. +/// +/// The widget wraps its content with [Semantics] for accessibility support. +/// Provide a [semanticLabel] to give screen readers a meaningful description. +/// +/// {@tool snippet} +/// +/// Basic checkbox: +/// +/// ```dart +/// StreamCheckbox( +/// value: isChecked, +/// onChanged: (value) => setState(() => isChecked = value), +/// ) +/// ``` +/// {@end-tool} +/// +/// {@tool snippet} +/// +/// Small disabled checkbox: +/// +/// ```dart +/// StreamCheckbox( +/// value: true, +/// size: StreamCheckboxSize.sm, +/// onChanged: null, +/// ) +/// ``` +/// {@end-tool} +/// +/// See also: +/// +/// * [StreamCheckboxTheme], for customizing checkbox appearance. +/// * [StreamCheckboxStyle], for the visual style properties. +/// * [StreamCheckboxSize], for available size variants. +class StreamCheckbox extends StatelessWidget { + /// Creates a Stream checkbox. + StreamCheckbox({ + super.key, + required bool value, + required ValueChanged? onChanged, + StreamCheckboxSize? size, + OutlinedBorder? shape, + String? semanticLabel, + }) : props = .new( + value: value, + onChanged: onChanged, + size: size, + shape: shape, + semanticLabel: semanticLabel, + ); + + /// Creates a circular Stream checkbox (radio check). + /// + /// This is a convenience constructor that sets the shape to [CircleBorder], + /// commonly used for single-selection (radio-like) patterns. + StreamCheckbox.circular({ + super.key, + required bool value, + required ValueChanged? onChanged, + StreamCheckboxSize? size, + String? semanticLabel, + }) : props = .new( + value: value, + onChanged: onChanged, + size: size, + shape: const CircleBorder(), + semanticLabel: semanticLabel, + ); + + /// The props controlling the appearance and behavior of this checkbox. + final StreamCheckboxProps props; + + @override + Widget build(BuildContext context) { + final builder = StreamComponentFactory.of(context).checkbox; + if (builder != null) return builder(context, props); + return DefaultStreamCheckbox(props: props); + } +} + +/// Properties for configuring a [StreamCheckbox]. +/// +/// This class holds all the configuration options for a checkbox, +/// allowing them to be passed through the [StreamComponentFactory]. +/// +/// See also: +/// +/// * [StreamCheckbox], which uses these properties. +/// * [DefaultStreamCheckbox], the default implementation. +class StreamCheckboxProps { + /// Creates properties for a checkbox. + const StreamCheckboxProps({ + required this.value, + required this.onChanged, + this.size, + this.shape, + this.semanticLabel, + }); + + /// Whether this checkbox is checked. + final bool value; + + /// Called when the value of the checkbox should change. + /// + /// The checkbox passes the new value to the callback but does not actually + /// change state until the parent widget rebuilds the checkbox with the new + /// value. + /// + /// If null, the checkbox will be displayed as disabled. + final ValueChanged? onChanged; + + /// The size of the checkbox. + /// + /// If null, falls back to [StreamCheckboxStyle.size], then + /// [StreamCheckboxSize.md]. + final StreamCheckboxSize? size; + + /// The shape of the checkbox. + /// + /// If null, falls back to [StreamCheckboxStyle.shape], then + /// the design system defaults. + final OutlinedBorder? shape; + + /// The semantic label for the checkbox that will be announced by + /// screen readers. + /// + /// This label does not show in the UI. + final String? semanticLabel; +} + +/// Default implementation of [StreamCheckbox]. +/// +/// Renders a checkbox using [IconButton] wrapped in [Semantics] for +/// accessibility. Styling is resolved from widget props, theme, and +/// built-in defaults in that order. +class DefaultStreamCheckbox extends StatelessWidget { + /// Creates a default checkbox. + const DefaultStreamCheckbox({super.key, required this.props}); + + /// The props controlling the appearance and behavior of this checkbox. + final StreamCheckboxProps props; + + @override + Widget build(BuildContext context) { + final checkboxStyle = context.streamCheckboxTheme.style; + final defaults = _StreamCheckboxStyleDefaults(context); + + final effectiveSize = props.size ?? checkboxStyle?.size ?? defaults.size; + final effectiveCheckSize = checkboxStyle?.checkSize ?? defaults.checkSize; + final effectiveFillColor = checkboxStyle?.fillColor ?? defaults.fillColor; + final effectiveCheckColor = checkboxStyle?.checkColor ?? defaults.checkColor; + final effectiveOverlayColor = checkboxStyle?.overlayColor ?? defaults.overlayColor; + final effectiveSide = checkboxStyle?.side ?? defaults.side; + final effectiveShape = props.shape ?? checkboxStyle?.shape ?? defaults.shape; + + final icons = context.streamIcons; + final dimension = effectiveSize.value; + + return Semantics( + label: props.semanticLabel, + checked: props.value, + child: IconButton( + onPressed: switch (props.onChanged) { + final callback? => () => callback(!props.value), + _ => null, + }, + isSelected: props.value, + iconSize: effectiveCheckSize, + icon: Icon(icons.checkmark2), + style: ButtonStyle( + tapTargetSize: .shrinkWrap, + visualDensity: .standard, + fixedSize: .all(.square(dimension)), + minimumSize: .all(.square(dimension)), + maximumSize: .all(.square(dimension)), + padding: .all(.zero), + shape: .all(effectiveShape), + backgroundColor: effectiveFillColor, + foregroundColor: effectiveCheckColor, + overlayColor: effectiveOverlayColor, + side: effectiveSide, + ), + ), + ); + } +} + +// Provides default values for [StreamCheckboxStyle] based on the current +// [StreamColorScheme]. +class _StreamCheckboxStyleDefaults extends StreamCheckboxStyle { + _StreamCheckboxStyleDefaults(this.context); + + final BuildContext context; + late final StreamColorScheme _colorScheme = context.streamColorScheme; + late final StreamRadius _radius = context.streamRadius; + + @override + StreamCheckboxSize get size => .md; + + @override + double get checkSize => 16; + + @override + WidgetStateProperty get fillColor => WidgetStateProperty.resolveWith((states) { + if (states.contains(WidgetState.selected)) { + if (states.contains(WidgetState.disabled)) return _colorScheme.backgroundDisabled; + return _colorScheme.accentPrimary; + } + + return StreamColors.transparent; + }); + + @override + WidgetStateProperty get checkColor => WidgetStateProperty.resolveWith((states) { + if (states.contains(WidgetState.selected)) { + if (states.contains(WidgetState.disabled)) return _colorScheme.textDisabled; + return _colorScheme.textOnDark; + } + return StreamColors.transparent; + }); + + @override + WidgetStateProperty get overlayColor => WidgetStateProperty.resolveWith((states) { + if (states.contains(WidgetState.pressed)) return _colorScheme.statePressed; + if (states.contains(WidgetState.hovered)) return _colorScheme.stateHover; + return StreamColors.transparent; + }); + + @override + WidgetStateBorderSide? get side => WidgetStateBorderSide.resolveWith((states) { + if (states.contains(WidgetState.selected)) return BorderSide.none; + if (states.contains(WidgetState.disabled)) return BorderSide(color: _colorScheme.borderDisabled); + return BorderSide(color: _colorScheme.borderDefault); + }); + + @override + OutlinedBorder get shape => RoundedRectangleBorder(borderRadius: .all(_radius.sm)); +} diff --git a/packages/stream_core_flutter/lib/src/components/common/stream_flex.dart b/packages/stream_core_flutter/lib/src/components/common/stream_flex.dart new file mode 100644 index 0000000..9964b11 --- /dev/null +++ b/packages/stream_core_flutter/lib/src/components/common/stream_flex.dart @@ -0,0 +1,295 @@ +import 'package:flutter/rendering.dart'; +import 'package:flutter/widgets.dart'; + +/// A widget that displays its children in a one-dimensional array, +/// supporting negative [spacing] for overlapping layouts. +/// +/// [StreamFlex] allows you to control the axis along which the children are +/// placed (horizontal or vertical). The [spacing] parameter can be positive +/// (gap between children), zero (flush), or negative (children overlap). +/// +/// If you know the main axis in advance, consider using [StreamRow] +/// (horizontal) or [StreamColumn] (vertical) instead, since that will be +/// less verbose. +/// +/// {@tool snippet} +/// +/// Overlapping avatars with -8px spacing: +/// +/// ```dart +/// StreamRow( +/// spacing: -8, +/// children: [ +/// CircleAvatar(child: Text('A')), +/// CircleAvatar(child: Text('B')), +/// CircleAvatar(child: Text('C')), +/// ], +/// ) +/// ``` +/// {@end-tool} +/// +/// ## Layout algorithm +/// +/// 1. Layout inflexible children with unbounded main-axis constraints. +/// 2. Distribute remaining main-axis space to flexible children. +/// 3. Layout flexible children with allocated space. +/// 4. Cross-axis extent = maximum child cross extent. +/// 5. Main-axis extent determined by [mainAxisSize] and constraints. +/// 6. Position children according to [mainAxisAlignment] and +/// [crossAxisAlignment], applying [spacing] between each pair. +/// +/// With negative spacing, the total main-axis extent shrinks and children +/// are positioned closer together, producing overlap. Later children in the +/// list paint on top of earlier ones (natural z-order). +/// +/// See also: +/// +/// * [StreamRow], for a horizontal variant. +/// * [StreamColumn], for a vertical variant. +class StreamFlex extends MultiChildRenderObjectWidget { + /// Creates a flex layout that supports negative spacing. + /// + /// The [direction] is required. + /// + /// The [spacing] parameter can be negative to produce overlapping children. + /// When negative, later children in the list paint on top of earlier ones. + /// + /// If [crossAxisAlignment] is [CrossAxisAlignment.baseline], then + /// [textBaseline] must not be null. + /// + /// The [textDirection] argument defaults to the ambient [Directionality], if + /// any. If there is no ambient directionality, and a text direction is going + /// to be necessary to decide which direction to lay the children in or to + /// disambiguate `start` or `end` values for the main or cross axis + /// directions, the [textDirection] must not be null. + const StreamFlex({ + super.key, + required this.direction, + this.mainAxisAlignment = MainAxisAlignment.start, + this.mainAxisSize = MainAxisSize.max, + this.crossAxisAlignment = CrossAxisAlignment.center, + this.textDirection, + this.verticalDirection = VerticalDirection.down, + this.textBaseline, // NO DEFAULT: we don't know what the text's baseline should be + this.clipBehavior = Clip.none, + this.spacing = 0.0, + super.children, + }) : assert( + !identical(crossAxisAlignment, CrossAxisAlignment.baseline) || textBaseline != null, + 'textBaseline is required if you specify the crossAxisAlignment with CrossAxisAlignment.baseline', + ); + // Cannot use == in the assert above instead of identical because of https://github.com/dart-lang/language/issues/1811. + + /// The direction to use as the main axis. + /// + /// If you know the axis in advance, then consider using a [StreamRow] + /// (if it's horizontal) or [StreamColumn] (if it's vertical) instead, + /// since that will be less verbose. + final Axis direction; + + /// How the children should be placed along the main axis. + /// + /// For example, [MainAxisAlignment.start], the default, places the children + /// at the start (i.e., the left for a [StreamRow] or the top for a + /// [StreamColumn]) of the main axis. + final MainAxisAlignment mainAxisAlignment; + + /// How much space should be occupied in the main axis. + /// + /// After allocating space to children, there might be some remaining free + /// space. This value controls whether to maximize or minimize the amount of + /// free space, subject to the incoming layout constraints. + final MainAxisSize mainAxisSize; + + /// How the children should be placed along the cross axis. + /// + /// For example, [CrossAxisAlignment.center], the default, centers the + /// children in the cross axis. + final CrossAxisAlignment crossAxisAlignment; + + /// Determines the order to lay children out horizontally and how to interpret + /// `start` and `end` in the horizontal direction. + /// + /// Defaults to the ambient [Directionality]. + final TextDirection? textDirection; + + /// Determines the order to lay children out vertically and how to interpret + /// `start` and `end` in the vertical direction. + /// + /// Defaults to [VerticalDirection.down]. + final VerticalDirection verticalDirection; + + /// If aligning items according to their baseline, which baseline to use. + /// + /// This must be set if using baseline alignment. There is no default because + /// there is no way for the framework to know the correct baseline _a priori_. + final TextBaseline? textBaseline; + + /// How to clip children that extend beyond the widget's bounds. + /// + /// Defaults to [Clip.none]. + final Clip clipBehavior; + + /// The amount of space between children along the main axis. + /// + /// Positive values add gaps between children. Zero makes children flush. + /// Negative values cause children to overlap — later children in the list + /// paint on top of earlier ones. + /// + /// Defaults to 0.0. + final double spacing; + + bool get _needTextDirection => switch (direction) { + Axis.horizontal => true, + Axis.vertical => crossAxisAlignment == CrossAxisAlignment.start || crossAxisAlignment == CrossAxisAlignment.end, + }; + + /// The resolved text direction for layout. + /// + /// This value is derived from the [textDirection] property and the ambient + /// [Directionality]. Returns null when text direction is not needed for + /// the current layout configuration. + /// + /// This method exists so that subclasses of [StreamFlex] that create their + /// own render objects can reuse the text direction resolution logic. + @protected + TextDirection? getEffectiveTextDirection(BuildContext context) { + return textDirection ?? (_needTextDirection ? Directionality.maybeOf(context) : null); + } + + @override + RenderFlex createRenderObject(BuildContext context) { + return _RenderStreamFlex( + direction: direction, + mainAxisAlignment: mainAxisAlignment, + mainAxisSize: mainAxisSize, + crossAxisAlignment: crossAxisAlignment, + textDirection: getEffectiveTextDirection(context), + verticalDirection: verticalDirection, + textBaseline: textBaseline, + clipBehavior: clipBehavior, + spacing: spacing, + ); + } + + @override + void updateRenderObject( + BuildContext context, + covariant RenderFlex renderObject, + ) { + renderObject + ..direction = direction + ..mainAxisAlignment = mainAxisAlignment + ..mainAxisSize = mainAxisSize + ..crossAxisAlignment = crossAxisAlignment + ..textDirection = getEffectiveTextDirection(context) + ..verticalDirection = verticalDirection + ..textBaseline = textBaseline + ..clipBehavior = clipBehavior + ..spacing = spacing; + } +} + +/// A widget that displays its children in a horizontal array, +/// supporting negative [spacing] for overlapping layouts. +/// +/// This is the horizontal specialization of [StreamFlex]. +/// +/// {@tool snippet} +/// +/// Overlapping chips with -4px horizontal spacing: +/// +/// ```dart +/// StreamRow( +/// spacing: -4, +/// children: [ +/// Chip(label: Text('One')), +/// Chip(label: Text('Two')), +/// Chip(label: Text('Three')), +/// ], +/// ) +/// ``` +/// {@end-tool} +/// +/// See also: +/// +/// * [StreamColumn], the vertical variant. +/// * [StreamFlex], the direction-agnostic variant. +class StreamRow extends StreamFlex { + /// Creates a horizontal flex layout that supports negative spacing. + const StreamRow({ + super.key, + super.mainAxisAlignment, + super.mainAxisSize, + super.crossAxisAlignment, + super.textDirection, + super.verticalDirection, + super.textBaseline, + super.clipBehavior, + super.spacing, + super.children, + }) : super(direction: Axis.horizontal); +} + +/// A widget that displays its children in a vertical array, +/// supporting negative [spacing] for overlapping layouts. +/// +/// This is the vertical specialization of [StreamFlex]. +/// +/// {@tool snippet} +/// +/// Stacked cards with -12px vertical overlap: +/// +/// ```dart +/// StreamColumn( +/// spacing: -12, +/// children: [ +/// Card(child: Text('Top')), +/// Card(child: Text('Middle')), +/// Card(child: Text('Bottom')), +/// ], +/// ) +/// ``` +/// {@end-tool} +/// +/// See also: +/// +/// * [StreamRow], the horizontal variant. +/// * [StreamFlex], the direction-agnostic variant. +class StreamColumn extends StreamFlex { + /// Creates a vertical flex layout that supports negative spacing. + const StreamColumn({ + super.key, + super.mainAxisAlignment, + super.mainAxisSize, + super.crossAxisAlignment, + super.textDirection, + super.verticalDirection, + super.textBaseline, + super.clipBehavior, + super.spacing, + super.children, + }) : super(direction: Axis.vertical); +} + +// Render object for [StreamFlex] that supports negative [spacing]. +// +// When [spacing] is negative, children overlap along the main axis. +// Later children in the child list paint on top of earlier ones. +class _RenderStreamFlex extends RenderFlex { + _RenderStreamFlex({ + super.direction, + super.mainAxisAlignment, + super.mainAxisSize, + super.crossAxisAlignment, + super.textDirection, + super.verticalDirection, + super.textBaseline, + super.clipBehavior, + double spacing = 0.0, + }) { + // RenderFlex asserts spacing >= 0 in its constructor. The setter has no + // such assertion, so we set the value here to support negative spacing. + this.spacing = spacing; + } +} diff --git a/packages/stream_core_flutter/lib/src/components/common/stream_progress_bar.dart b/packages/stream_core_flutter/lib/src/components/common/stream_progress_bar.dart new file mode 100644 index 0000000..c1a02ca --- /dev/null +++ b/packages/stream_core_flutter/lib/src/components/common/stream_progress_bar.dart @@ -0,0 +1,197 @@ +import 'package:flutter/material.dart'; + +import '../../factory/stream_component_factory.dart'; +import '../../theme/components/stream_progress_bar_theme.dart'; +import '../../theme/primitives/stream_radius.dart'; +import '../../theme/semantics/stream_color_scheme.dart'; +import '../../theme/stream_theme_extensions.dart'; + +/// A linear progress indicator styled for the Stream design system. +/// +/// [StreamProgressBar] displays a horizontal bar that fills to indicate +/// progress. It supports both determinate (fixed value) and indeterminate +/// (loading animation) states. +/// +/// Visual properties can be customized per-instance via constructor parameters, +/// or globally via [StreamProgressBarThemeData]. +/// +/// {@tool snippet} +/// +/// Basic determinate progress bar: +/// +/// ```dart +/// StreamProgressBar(value: 0.5) +/// ``` +/// {@end-tool} +/// +/// {@tool snippet} +/// +/// Indeterminate progress bar (loading state): +/// +/// ```dart +/// StreamProgressBar() +/// ``` +/// {@end-tool} +/// +/// {@tool snippet} +/// +/// Customized progress bar: +/// +/// ```dart +/// StreamProgressBar( +/// value: 0.75, +/// trackColor: Colors.grey.shade200, +/// fillColor: Colors.green, +/// minHeight: 12, +/// ) +/// ``` +/// {@end-tool} +/// +/// ## Theming +/// +/// [StreamProgressBar] uses [StreamProgressBarThemeData] for default styling. +/// +/// See also: +/// +/// * [StreamProgressBarThemeData], for customizing progress bar appearance. +/// * [StreamProgressBarTheme], for overriding theme in a widget subtree. +class StreamProgressBar extends StatelessWidget { + /// Creates a Stream progress bar. + /// + /// If [value] is non-null, it must be between 0.0 and 1.0. + /// If [value] is null, the progress bar shows an indeterminate animation. + StreamProgressBar({ + super.key, + double? value, + Color? trackColor, + Color? fillColor, + double? minHeight, + BorderRadiusGeometry? borderRadius, + }) : props = .new( + value: value, + trackColor: trackColor, + fillColor: fillColor, + minHeight: minHeight, + borderRadius: borderRadius, + ); + + /// The props controlling the appearance and behavior of this progress bar. + final StreamProgressBarProps props; + + @override + Widget build(BuildContext context) { + final builder = StreamComponentFactory.of(context).progressBar; + if (builder != null) return builder(context, props); + return DefaultStreamProgressBar(props: props); + } +} + +/// Properties for configuring a [StreamProgressBar]. +/// +/// This class holds all the configuration options for a progress bar, +/// allowing them to be passed through the [StreamComponentFactory]. +/// +/// See also: +/// +/// * [StreamProgressBar], which uses these properties. +/// * [DefaultStreamProgressBar], the default implementation. +class StreamProgressBarProps { + /// Creates properties for a progress bar. + const StreamProgressBarProps({ + this.value, + this.trackColor, + this.fillColor, + this.minHeight, + this.borderRadius, + }); + + /// The progress value from 0.0 to 1.0. + /// + /// If null, the progress bar is indeterminate, displaying a looping + /// animation rather than a fixed fill. + final double? value; + + /// The color of the unfilled track. + /// + /// If null, uses [StreamProgressBarThemeData.trackColor], or falls back + /// to the design system default. + final Color? trackColor; + + /// The color of the filled portion. + /// + /// If null, uses [StreamProgressBarThemeData.fillColor], or falls back + /// to the design system default. + final Color? fillColor; + + /// The minimum height of the progress bar. + /// + /// If null, uses [StreamProgressBarThemeData.minHeight], or falls back + /// to 8. + final double? minHeight; + + /// The border radius of the progress bar. + /// + /// If null, uses [StreamProgressBarThemeData.borderRadius], or falls back + /// to the design system's max radius. + final BorderRadiusGeometry? borderRadius; +} + +/// Default implementation of [StreamProgressBar]. +/// +/// Renders a progress bar using [LinearProgressIndicator]. Styling is resolved +/// from widget props, theme, and built-in defaults in that order. +/// +/// See also: +/// +/// * [StreamProgressBar], the public API widget. +class DefaultStreamProgressBar extends StatelessWidget { + /// Creates a default Stream progress bar. + const DefaultStreamProgressBar({super.key, required this.props}); + + /// The props controlling the appearance and behavior of this progress bar. + final StreamProgressBarProps props; + + @override + Widget build(BuildContext context) { + final theme = context.streamProgressBarTheme; + final defaults = _StreamProgressBarStyleDefaults(context); + + final effectiveTrackColor = props.trackColor ?? theme.trackColor ?? defaults.trackColor; + final effectiveFillColor = props.fillColor ?? theme.fillColor ?? defaults.fillColor; + final effectiveMinHeight = props.minHeight ?? theme.minHeight ?? defaults.minHeight; + final effectiveBorderRadius = props.borderRadius ?? theme.borderRadius ?? defaults.borderRadius; + + return LinearProgressIndicator( + trackGap: 0, + stopIndicatorRadius: 0, + value: props.value?.clamp(0.0, 1.0), + backgroundColor: effectiveTrackColor, + color: effectiveFillColor, + minHeight: effectiveMinHeight, + borderRadius: effectiveBorderRadius, + ); + } +} + +// Provides default values for [StreamProgressBarThemeData] based on the +// current [StreamColorScheme]. +class _StreamProgressBarStyleDefaults extends StreamProgressBarThemeData { + _StreamProgressBarStyleDefaults(this.context); + + final BuildContext context; + + late final StreamRadius _radius = context.streamRadius; + late final StreamColorScheme _colorScheme = context.streamColorScheme; + + @override + double? get minHeight => 8; + + @override + Color get fillColor => _colorScheme.accentNeutral; + + @override + Color get trackColor => _colorScheme.backgroundSurfaceStrong; + + @override + BorderRadiusGeometry get borderRadius => .all(_radius.max); +} diff --git a/packages/stream_core_flutter/lib/src/components/context_menu/stream_context_menu.dart b/packages/stream_core_flutter/lib/src/components/context_menu/stream_context_menu.dart new file mode 100644 index 0000000..65f8e9b --- /dev/null +++ b/packages/stream_core_flutter/lib/src/components/context_menu/stream_context_menu.dart @@ -0,0 +1,199 @@ +import 'package:flutter/material.dart'; + +import '../../theme/components/stream_context_menu_theme.dart'; +import '../../theme/primitives/stream_radius.dart'; +import '../../theme/primitives/stream_spacing.dart'; +import '../../theme/semantics/stream_color_scheme.dart'; +import '../../theme/stream_theme_extensions.dart'; + +/// A contextual menu container that displays a list of menu items. +/// +/// [StreamContextMenu] renders its [children] in a vertical list inside a +/// decorated container with a shape, border, and drop shadow. The container +/// is sized intrinsically to the width of its widest child. +/// +/// Children are typically [StreamContextMenuAction] and +/// [StreamContextMenuSeparator] widgets. For automatic separator insertion, +/// use [StreamContextMenuAction.separated] to divide every item, or +/// [StreamContextMenuAction.sectioned] to divide logical groups. +/// +/// The container's appearance can be customized via [StreamContextMenuTheme]. +/// +/// {@tool snippet} +/// +/// A basic context menu with a manual separator: +/// +/// ```dart +/// StreamContextMenu( +/// children: [ +/// StreamContextMenuAction( +/// value: 'reply', +/// label: Text('Reply'), +/// leading: Icon(Icons.reply), +/// ), +/// StreamContextMenuAction( +/// value: 'copy', +/// label: Text('Copy Message'), +/// leading: Icon(Icons.copy), +/// ), +/// StreamContextMenuSeparator(), +/// StreamContextMenuAction.destructive( +/// value: 'block', +/// label: Text('Block User'), +/// leading: Icon(Icons.block), +/// ), +/// ], +/// ) +/// ``` +/// {@end-tool} +/// +/// See also: +/// +/// * [StreamContextMenuAction], for individual menu items. +/// * [StreamContextMenuAction.separated], for auto-inserting separators between +/// every item. +/// * [StreamContextMenuAction.sectioned], for auto-inserting separators between +/// logical groups of items. +/// * [StreamContextMenuSeparator], for manual visual dividers. +/// * [StreamContextMenuTheme], for customizing container appearance. +/// * [StreamContextMenuActionTheme], for customizing item appearance. +class StreamContextMenu extends StatelessWidget { + /// Creates a context menu container. + const StreamContextMenu({ + super.key, + required this.children, + this.clipBehavior = Clip.hardEdge, + this.elevation, + }); + + /// The menu items to display. + /// + /// Typically a list of [StreamContextMenuAction] and + /// [StreamContextMenuSeparator] widgets. + final List children; + + /// The clip behavior for the menu container. + /// + /// Clips the menu content to the container's rounded shape. + /// + /// Defaults to [Clip.hardEdge]. + final Clip clipBehavior; + + /// The z-coordinate at which to place this menu. + /// + /// Higher values increase the size and intensity of the menu's drop shadow. + /// + /// If null, resolves from [StreamContextMenuStyle.elevation], then falls + /// back to `3`. + final double? elevation; + + @override + Widget build(BuildContext context) { + final themeStyle = context.streamContextMenuTheme.style; + final defaults = _ContextMenuStyleDefaults(context); + + final effectiveBackgroundColor = themeStyle?.backgroundColor ?? defaults.backgroundColor; + final effectiveElevation = elevation ?? themeStyle?.elevation ?? defaults.elevation; + final effectivePadding = themeStyle?.padding ?? defaults.padding; + final effectiveSide = themeStyle?.side ?? defaults.side; + final effectiveShape = (themeStyle?.shape ?? defaults.shape).copyWith(side: effectiveSide); + + return IntrinsicWidth( + child: Material( + elevation: effectiveElevation, + shape: effectiveShape, + clipBehavior: clipBehavior, + color: effectiveBackgroundColor, + child: SingleChildScrollView( + padding: effectivePadding, + child: Column( + mainAxisSize: .min, + crossAxisAlignment: .stretch, + children: children, + ), + ), + ), + ); + } +} + +/// A visual separator between groups of items in a [StreamContextMenu]. +/// +/// Displays a thin horizontal line with vertical padding. Use it to visually +/// separate groups of related context menu items, for example between regular +/// actions and destructive actions. +/// +/// For automatic separator insertion, use [StreamContextMenuAction.separated] +/// (between every item) or [StreamContextMenuAction.sectioned] (between logical +/// groups) instead of placing separators manually. +/// +/// {@tool snippet} +/// +/// Add a separator between item groups: +/// +/// ```dart +/// StreamContextMenu( +/// children: [ +/// StreamContextMenuAction(label: Text('Reply')), +/// StreamContextMenuAction(label: Text('Copy')), +/// StreamContextMenuSeparator(), +/// StreamContextMenuAction.destructive( +/// label: Text('Delete'), +/// ), +/// ], +/// ) +/// ``` +/// {@end-tool} +/// +/// See also: +/// +/// * [StreamContextMenu], which contains this separator. +/// * [StreamContextMenuAction.separated], which auto-inserts separators +/// between every item. +/// * [StreamContextMenuAction.sectioned], which auto-inserts separators +/// between logical groups of items. +/// * [StreamContextMenuAction], for menu items. +class StreamContextMenuSeparator extends StatelessWidget { + /// Creates a context menu separator. + const StreamContextMenuSeparator({super.key}); + + @override + Widget build(BuildContext context) { + final spacing = context.streamSpacing; + final colorScheme = context.streamColorScheme; + + return Padding( + padding: .symmetric(vertical: spacing.xxs), + child: Divider(height: 1, thickness: 1, color: colorScheme.borderDefault), + ); + } +} + +/// Default values for [StreamContextMenuStyle]. +/// +/// Provides sensible defaults based on the current [StreamColorScheme], +/// [StreamRadius], and [StreamSpacing]. +class _ContextMenuStyleDefaults extends StreamContextMenuStyle { + _ContextMenuStyleDefaults(this.context); + + final BuildContext context; + + late final StreamRadius _radius = context.streamRadius; + late final StreamSpacing _spacing = context.streamSpacing; + late final StreamColorScheme _colorScheme = context.streamColorScheme; + + @override + double get elevation => 3; + + @override + OutlinedBorder get shape => RoundedRectangleBorder(borderRadius: .all(_radius.lg)); + + @override + BorderSide get side => BorderSide(color: _colorScheme.borderDefault); + + @override + Color get backgroundColor => _colorScheme.backgroundElevation2; + + @override + EdgeInsetsGeometry get padding => EdgeInsets.all(_spacing.xxs); +} diff --git a/packages/stream_core_flutter/lib/src/components/context_menu/stream_context_menu_action.dart b/packages/stream_core_flutter/lib/src/components/context_menu/stream_context_menu_action.dart new file mode 100644 index 0000000..448c717 --- /dev/null +++ b/packages/stream_core_flutter/lib/src/components/context_menu/stream_context_menu_action.dart @@ -0,0 +1,462 @@ +import 'package:flutter/material.dart'; +import 'package:stream_core/stream_core.dart'; + +import '../../factory/stream_component_factory.dart'; +import '../../theme/components/stream_context_menu_action_theme.dart'; +import '../../theme/primitives/stream_colors.dart'; +import '../../theme/primitives/stream_radius.dart'; +import '../../theme/primitives/stream_spacing.dart'; +import '../../theme/semantics/stream_color_scheme.dart'; +import '../../theme/semantics/stream_text_theme.dart'; +import '../../theme/stream_theme_extensions.dart'; +import 'stream_context_menu.dart'; + +/// A single action row in a [StreamContextMenu]. +/// +/// [StreamContextMenuAction] displays a tappable row with an optional [leading] +/// widget, a [label] widget, and an optional [trailing] widget. It supports +/// both normal and destructive styles. +/// +/// The visual appearance adapts to interaction states (hover, pressed, +/// disabled) and can be fully customized via [StreamContextMenuActionTheme]. +/// +/// Each action carries a [value], and when tapped the default implementation +/// calls [Navigator.pop] with that value so the dialog caller can handle it. +/// Use [enabled] to control whether the action is interactive (disabled actions +/// remain visible but are not tappable). +/// +/// The type parameter [T] represents the type of [value] that will be returned +/// when the action is selected. +/// +/// A typical use case is to pass a [Text] as the [label]. If the text may be +/// long, set [Text.overflow] to [TextOverflow.ellipsis] and [Text.maxLines] +/// to 1, as without it the text will wrap to the next line. +/// +/// {@tool snippet} +/// +/// Display a normal context menu action: +/// +/// ```dart +/// StreamContextMenuAction( +/// value: 'reply', +/// label: Text('Reply'), +/// leading: Icon(Icons.reply), +/// ) +/// ``` +/// {@end-tool} +/// +/// {@tool snippet} +/// +/// Display a destructive context menu action: +/// +/// ```dart +/// StreamContextMenuAction.destructive( +/// value: 'block', +/// label: Text('Block User'), +/// leading: Icon(Icons.block), +/// ) +/// ``` +/// {@end-tool} +/// +/// See also: +/// +/// * [StreamContextMenu], which contains these actions. +/// * [StreamContextMenuSeparator], for visual dividers between actions. +/// * [StreamContextMenuActionTheme], for customizing action appearance. +class StreamContextMenuAction extends StatelessWidget { + /// Creates a context menu action. + StreamContextMenuAction({ + super.key, + T? value, + required Widget label, + VoidCallback? onTap, + bool enabled = true, + Widget? leading, + Widget? trailing, + bool isDestructive = false, + }) : props = .new( + value: value, + label: label, + onTap: onTap, + enabled: enabled, + leading: leading, + trailing: trailing, + isDestructive: isDestructive, + ); + + /// Creates a destructive context menu action. + /// + /// Uses error/danger colors for text and icons, typically for + /// actions like "Delete", "Block", or "Remove". + /// + /// {@tool snippet} + /// + /// ```dart + /// StreamContextMenuAction.destructive( + /// value: 'block', + /// label: Text('Block User'), + /// leading: Icon(Icons.block), + /// ) + /// ``` + /// {@end-tool} + StreamContextMenuAction.destructive({ + super.key, + T? value, + required Widget label, + VoidCallback? onTap, + bool enabled = true, + Widget? leading, + Widget? trailing, + }) : props = .new( + value: value, + label: label, + onTap: onTap, + enabled: enabled, + leading: leading, + trailing: trailing, + isDestructive: true, + ); + + /// Add a [StreamContextMenuSeparator] between each action in the given + /// [items]. + /// + /// If [items] is empty or contains a single element, no separators are + /// added. The result can be passed directly to [StreamContextMenu.new]'s + /// `children` parameter. + /// + /// {@tool snippet} + /// + /// ```dart + /// StreamContextMenu( + /// children: StreamContextMenuAction.separated( + /// items: [ + /// StreamContextMenuAction(label: Text('Reply')), + /// StreamContextMenuAction(label: Text('Copy')), + /// StreamContextMenuAction(label: Text('Delete')), + /// ], + /// ), + /// ) + /// ``` + /// {@end-tool} + /// + /// See also: + /// + /// * [StreamContextMenuSeparator], which you can use to obtain this effect + /// manually. + static List separated({ + required List items, + }) { + return [ + for (final (index, child) in items.indexed) ...[ + if (index > 0) const StreamContextMenuSeparator(), + child, + ], + ]; + } + + /// Flatten [sections] into a single list, inserting a + /// [StreamContextMenuSeparator] between each non-empty section. + /// + /// Each section is an [Iterable] of widgets that belong together as a + /// logical group. Empty sections are silently ignored so that no stray + /// separators appear. The result can be passed directly to + /// [StreamContextMenu.new]'s `children` parameter. + /// + /// {@tool snippet} + /// + /// ```dart + /// StreamContextMenu( + /// children: StreamContextMenuAction.sectioned( + /// sections: [ + /// [ + /// StreamContextMenuAction(label: Text('Reply')), + /// StreamContextMenuAction(label: Text('Copy')), + /// ], + /// [ + /// StreamContextMenuAction.destructive( + /// label: Text('Delete'), + /// ), + /// ], + /// ], + /// ), + /// ) + /// ``` + /// {@end-tool} + /// + /// See also: + /// + /// * [StreamContextMenuSeparator], which you can use to obtain this effect + /// manually. + /// * [separated], which inserts a separator between every action instead + /// of between groups. + static List sectioned({ + required Iterable> sections, + }) { + final nonEmptySections = sections.where((s) => s.isNotEmpty); + return [ + for (final (index, section) in nonEmptySections.indexed) ...[ + if (index > 0) const StreamContextMenuSeparator(), + ...section, + ], + ]; + } + + /// Partition [items] into non-destructive and destructive groups, then + /// insert a [StreamContextMenuSeparator] between the two groups. + /// + /// Items whose [StreamContextMenuActionProps.isDestructive] is `false` form + /// the leading section; destructive items form the trailing section. + /// Under the hood this calls [sectioned] with the two groups. + /// + /// {@tool snippet} + /// + /// ```dart + /// StreamContextMenu( + /// children: StreamContextMenuAction.partitioned( + /// items: actions, + /// ), + /// ) + /// ``` + /// {@end-tool} + /// + /// See also: + /// + /// * [sectioned], which lets you provide arbitrary section groupings. + static List partitioned({ + required List> items, + }) { + final (normal, destructive) = items.partition((it) => !it.props.isDestructive); + return sectioned(sections: [normal, destructive]); + } + + /// The props controlling the appearance and behavior of this action. + final StreamContextMenuActionProps props; + + @override + Widget build(BuildContext context) { + final builder = StreamComponentFactory.of(context).contextMenuAction; + if (builder != null) return builder(context, props); + return DefaultStreamContextMenuAction(props: props); + } +} + +/// Properties for configuring a [StreamContextMenuAction]. +/// +/// This class holds all the configuration options for a context menu action, +/// including its visual representation, behavior, and an optional [value] +/// that is returned when the action is selected. +/// +/// The type parameter [T] represents the type of [value]. +/// +/// See also: +/// +/// * [StreamContextMenuAction], which uses these properties. +/// * [DefaultStreamContextMenuAction], the default implementation. +@immutable +class StreamContextMenuActionProps { + /// Creates properties for a context menu action. + const StreamContextMenuActionProps({ + this.value, + required this.label, + this.onTap, + this.enabled = true, + this.leading, + this.trailing, + this.isDestructive = false, + }); + + /// The value returned when this action is selected inside a popup route + /// (e.g. a dialog or bottom sheet). + /// + /// When the action is rendered inline — outside any popup route — the value + /// is not returned; only [onTap] fires. + /// + /// Consumers can also use this to find, remove, reorder, or replace specific + /// actions when customizing a default list of context menu actions. + final T? value; + + /// The label widget displayed on the action. + /// + /// Typically a [Text] widget. The label fills the available horizontal + /// space, so text wrapping and overflow behavior are controlled by the + /// consumer. If the text may be long, use [TextOverflow.ellipsis] on the + /// [Text.overflow] property to truncate rather than wrap: + /// + /// ```dart + /// StreamContextMenuAction( + /// label: Text('Very long label text', overflow: TextOverflow.ellipsis), + /// ) + /// ``` + final Widget label; + + /// Called when the action is tapped. + /// + /// When used inside a popup route, this is called **after** the route is + /// dismissed with [value]. The dismissal happens first so that [onTap] can + /// safely push a new route without conflicting with the closing menu. + /// + /// When used inline (outside any popup route), this is the only callback + /// that fires. + final VoidCallback? onTap; + + /// Whether this action is interactive. + /// + /// When `false`, the action is visually styled as disabled and taps are + /// ignored. + /// + /// Defaults to `true`. + final bool enabled; + + /// An optional widget displayed before the label. + /// + /// Typically an [Icon] widget. The icon color and size are controlled by + /// [StreamContextMenuActionStyle.foregroundColor] and + /// [StreamContextMenuActionStyle.iconSize]. + final Widget? leading; + + /// An optional widget displayed after the label. + /// + /// Typically a chevron icon for sub-menu navigation, or a keyboard shortcut + /// indicator. + final Widget? trailing; + + /// Whether this action uses destructive (error/danger) styling. + /// + /// When true, the action uses [StreamColorScheme.accentError] for text and + /// icon colors. Use [StreamContextMenuAction.destructive] for convenience. + final bool isDestructive; +} + +/// Default implementation of [StreamContextMenuAction]. +/// +/// Lays out the optional [StreamContextMenuActionProps.leading], the +/// [StreamContextMenuActionProps.label], and optional +/// [StreamContextMenuActionProps.trailing] in a horizontal row. +/// +/// All visual properties are resolved from [StreamContextMenuActionTheme] with +/// fallback to sensible defaults, providing automatic state-based feedback +/// (hover, pressed, disabled). +class DefaultStreamContextMenuAction extends StatelessWidget { + /// Creates a default context menu action. + const DefaultStreamContextMenuAction({super.key, required this.props}); + + /// The props controlling the appearance and behavior of this action. + final StreamContextMenuActionProps props; + + @override + Widget build(BuildContext context) { + final spacing = context.streamSpacing; + final themeStyle = context.streamContextMenuActionTheme.style; + final defaults = _ContextMenuActionThemeDefaults(context, isDestructive: props.isDestructive); + + final effectiveBackgroundColor = themeStyle?.backgroundColor ?? defaults.backgroundColor; + final effectiveForegroundColor = themeStyle?.foregroundColor ?? defaults.foregroundColor; + final effectiveOverlayColor = themeStyle?.overlayColor ?? defaults.overlayColor; + final effectiveIconColor = themeStyle?.iconColor ?? defaults.iconColor; + final effectiveTextStyle = themeStyle?.textStyle ?? defaults.textStyle; + final effectiveIconSize = themeStyle?.iconSize ?? defaults.iconSize; + final effectiveMinimumSize = themeStyle?.minimumSize ?? defaults.minimumSize; + final effectiveMaximumSize = themeStyle?.maximumSize ?? defaults.maximumSize; + final effectivePadding = themeStyle?.padding ?? defaults.padding; + final effectiveShape = themeStyle?.shape ?? defaults.shape; + + void handleTap() { + // Dismiss the route first so that onTap can safely push a new route + // without conflicting with the closing menu. + // + // The guard ensures we only pop when the action is actually inside a + // popup route (dialog, bottom sheet, etc.). When rendered inline there + // is no route to dismiss, so only onTap fires. + if (ModalRoute.of(context) case PopupRoute()) { + Navigator.pop(context, props.value); + } + + props.onTap?.call(); + } + + return TextButton( + onPressed: props.enabled ? handleTap : null, + style: ButtonStyle( + tapTargetSize: .shrinkWrap, + visualDensity: .standard, + backgroundColor: effectiveBackgroundColor, + foregroundColor: effectiveForegroundColor, + overlayColor: effectiveOverlayColor, + iconColor: effectiveIconColor, + iconSize: effectiveIconSize, + textStyle: effectiveTextStyle, + minimumSize: effectiveMinimumSize, + maximumSize: effectiveMaximumSize, + padding: effectivePadding, + shape: effectiveShape, + ), + child: Row( + spacing: spacing.xs, + mainAxisSize: MainAxisSize.min, + children: [ + ?props.leading, + Expanded(child: props.label), + ?props.trailing, + ], + ), + ); + } +} + +// Provides default values for [StreamContextMenuActionStyle] based on +// the current [StreamColorScheme]. +class _ContextMenuActionThemeDefaults extends StreamContextMenuActionStyle { + _ContextMenuActionThemeDefaults(this.context, {required this.isDestructive}); + + final BuildContext context; + final bool isDestructive; + + late final StreamColorScheme _colorScheme = context.streamColorScheme; + late final StreamTextTheme _textTheme = context.streamTextTheme; + late final StreamSpacing _spacing = context.streamSpacing; + late final StreamRadius _radius = context.streamRadius; + + @override + WidgetStateProperty get backgroundColor => const WidgetStatePropertyAll(StreamColors.transparent); + + @override + WidgetStateProperty get foregroundColor => WidgetStateProperty.resolveWith((states) { + if (states.contains(WidgetState.disabled)) return _colorScheme.textDisabled; + return isDestructive ? _colorScheme.accentError : _colorScheme.textPrimary; + }); + + @override + WidgetStateProperty get overlayColor => WidgetStateProperty.resolveWith((states) { + if (states.contains(WidgetState.pressed)) return _colorScheme.statePressed; + if (states.contains(WidgetState.hovered)) return _colorScheme.stateHover; + return StreamColors.transparent; + }); + + @override + WidgetStateProperty get textStyle => WidgetStatePropertyAll(_textTheme.bodyEmphasis); + + @override + WidgetStateProperty get iconColor => WidgetStateProperty.resolveWith((states) { + if (states.contains(WidgetState.disabled)) return _colorScheme.textDisabled; + return isDestructive ? _colorScheme.accentError : _colorScheme.textSecondary; + }); + + @override + WidgetStateProperty get iconSize => const WidgetStatePropertyAll(20); + + @override + WidgetStateProperty get minimumSize => const WidgetStatePropertyAll(Size(242, 40)); + + @override + WidgetStateProperty get maximumSize => const WidgetStatePropertyAll(Size.infinite); + + @override + WidgetStateProperty get padding => WidgetStatePropertyAll( + .symmetric(horizontal: _spacing.sm, vertical: _spacing.xs + _spacing.xxxs), + ); + + @override + WidgetStateProperty get shape => WidgetStatePropertyAll( + RoundedRectangleBorder(borderRadius: .all(_radius.md)), + ); +} diff --git a/packages/stream_core_flutter/lib/src/components/controls/stream_emoji_chip.dart b/packages/stream_core_flutter/lib/src/components/controls/stream_emoji_chip.dart new file mode 100644 index 0000000..87ea183 --- /dev/null +++ b/packages/stream_core_flutter/lib/src/components/controls/stream_emoji_chip.dart @@ -0,0 +1,381 @@ +import 'package:flutter/material.dart'; + +import '../../factory/stream_component_factory.dart'; +import '../../theme/components/stream_emoji_chip_theme.dart'; +import '../../theme/primitives/stream_colors.dart'; +import '../../theme/stream_theme_extensions.dart'; +import '../accessories/stream_emoji.dart'; + +/// A pill-shaped chip for displaying emoji reactions with an optional count. +/// +/// [StreamEmojiChip] renders one or more emojis alongside an optional reaction +/// count. Use the default constructor for a single-emoji chip, [StreamEmojiChip.cluster] +/// for a multi-emoji chip, and [StreamEmojiChip.addEmoji] for the add-reaction +/// button variant. +/// +/// All variants share the same theming and support hover, press, selected, +/// and disabled interaction states. +/// +/// {@tool snippet} +/// +/// Display a single-emoji reaction chip: +/// +/// ```dart +/// StreamEmojiChip( +/// emoji: Text('👍'), +/// count: 3, +/// isSelected: true, +/// onPressed: () => toggleReaction('👍'), +/// ) +/// ``` +/// {@end-tool} +/// +/// {@tool snippet} +/// +/// Display a clustered chip with multiple emojis and a total count: +/// +/// ```dart +/// StreamEmojiChip.cluster( +/// emojis: [Text('👍'), Text('❤️'), Text('😂')], +/// count: 12, +/// onPressed: () => showReactionDetails(), +/// ) +/// ``` +/// {@end-tool} +/// +/// {@tool snippet} +/// +/// Display an add-reaction chip: +/// +/// ```dart +/// StreamEmojiChip.addEmoji( +/// onPressed: () => showReactionPicker(), +/// ) +/// ``` +/// {@end-tool} +/// +/// See also: +/// +/// * [StreamEmojiChipTheme], for customizing chip appearance. +/// * [StreamEmojiButton], for a circular emoji-only button. +class StreamEmojiChip extends StatelessWidget { + /// Creates a single-emoji chip displaying [emoji] and an optional [count]. + /// + /// When [count] is null the count label is hidden. + /// When [onPressed] is null the chip is disabled. + StreamEmojiChip({ + super.key, + required Widget emoji, + int? count, + VoidCallback? onPressed, + VoidCallback? onLongPress, + bool isSelected = false, + }) : props = .new( + emojis: [emoji], + count: count, + onPressed: onPressed, + onLongPress: onLongPress, + isSelected: isSelected, + ); + + /// Creates a clustered chip displaying multiple [emojis] and an optional [count]. + /// + /// Each emoji in [emojis] is rendered individually at the chip's icon size, + /// so the full list is visible without overflow. + /// + /// When [count] is null the count label is hidden. + /// When [onPressed] is null the chip is disabled. + StreamEmojiChip.cluster({ + super.key, + required List emojis, + int? count, + VoidCallback? onPressed, + VoidCallback? onLongPress, + bool isSelected = false, + }) : props = .new( + emojis: emojis, + count: count, + onPressed: onPressed, + onLongPress: onLongPress, + isSelected: isSelected, + ); + + /// Creates an overflow chip displaying a `+N` count label. + /// + /// Unlike the default constructor, the `+` is rendered as text using the + /// chip's text style rather than going through [StreamEmoji]. + static Widget overflow({ + Key? key, + required int count, + VoidCallback? onPressed, + VoidCallback? onLongPress, + }) { + return _OverflowEmojiChip( + key: key, + count: count, + onPressed: onPressed, + onLongPress: onLongPress, + ); + } + + /// Creates an add-emoji chip showing the add-reaction icon. + /// + /// When [onPressed] is null the chip is disabled. + static Widget addEmoji({ + Key? key, + VoidCallback? onPressed, + VoidCallback? onLongPress, + }) { + return StreamEmojiChipTheme( + // The add-reaction icon needs to be a bit bigger than the default + // emoji size to look visually balanced. + data: const .new(style: .new(emojiSize: 20)), + child: StreamEmojiChip( + key: key, + emoji: const _AddEmojiIcon(), + onPressed: onPressed, + onLongPress: onLongPress, + ), + ); + } + + /// The props controlling the appearance and behavior of this chip. + final StreamEmojiChipProps props; + + @override + Widget build(BuildContext context) { + final builder = StreamComponentFactory.of(context).emojiChip; + if (builder != null) return builder(context, props); + return DefaultStreamEmojiChip(props: props); + } +} + +/// Properties for configuring a [StreamEmojiChip]. +/// +/// This class holds all the configuration options for an emoji chip, +/// allowing them to be passed through the [StreamComponentFactory]. +/// +/// See also: +/// +/// * [StreamEmojiChip], which uses these properties. +/// * [DefaultStreamEmojiChip], the default implementation. +class StreamEmojiChipProps { + /// Creates properties for an emoji chip. + const StreamEmojiChipProps({ + required this.emojis, + this.count, + this.onPressed, + this.onLongPress, + this.isSelected = false, + }) : assert(emojis.length > 0, 'emojis must not be empty'); + + /// The emoji widgets to display inside the chip. + /// + /// For a standard single-emoji chip this is a one-element list, e.g. + /// `[Text('👍')]`. For a clustered chip it contains multiple emoji widgets, + /// e.g. `[Text('👍'), Text('❤️'), Text('😂')]`. + /// + /// Each item is individually wrapped in a [StreamEmoji] to ensure consistent + /// sizing and platform-specific font fallbacks. + final List emojis; + + /// The reaction count to display next to the emojis. + /// + /// When null the count label is hidden. + final int? count; + + /// Called when the chip is pressed. + /// + /// When null the chip is disabled. + final VoidCallback? onPressed; + + /// Called when the chip is long-pressed. + /// + /// Commonly used to open a skin-tone picker. + final VoidCallback? onLongPress; + + /// Whether the chip is in a selected state. + /// + /// When true the chip shows a selected background overlay. + final bool isSelected; +} + +/// Default implementation of [StreamEmojiChip]. +class DefaultStreamEmojiChip extends StatelessWidget { + /// Creates a default emoji chip. + const DefaultStreamEmojiChip({super.key, required this.props}); + + /// The props controlling the appearance and behavior of this chip. + final StreamEmojiChipProps props; + + @override + Widget build(BuildContext context) { + return _RawEmojiChip( + onPressed: props.onPressed, + onLongPress: props.onLongPress, + isSelected: props.isSelected, + child: Row( + mainAxisSize: .min, + textBaseline: .alphabetic, + crossAxisAlignment: .baseline, + spacing: context.streamSpacing.xxs, + children: [ + for (final emoji in props.emojis) StreamEmoji(emoji: emoji), + if (props.count case final count?) Text('$count'), + ], + ), + ); + } +} + +// Renders the add-reaction icon using the current theme's icon set. +class _AddEmojiIcon extends StatelessWidget { + const _AddEmojiIcon(); + + @override + Widget build(BuildContext context) => Icon(context.streamIcons.emojiAddReaction); +} + +// Overflow chip that renders `+N` as a single text label styled with the +// chip's text style. Bypasses [StreamEmoji] so the `+` uses the numeric +// font rather than emoji font sizing. +class _OverflowEmojiChip extends StatelessWidget { + const _OverflowEmojiChip({ + super.key, + required this.count, + this.onPressed, + this.onLongPress, + }); + + final int count; + final VoidCallback? onPressed; + final VoidCallback? onLongPress; + + @override + Widget build(BuildContext context) { + return _RawEmojiChip( + onPressed: onPressed, + onLongPress: onLongPress, + child: Text('+$count'), + ); + } +} + +// Shared themed button shell used by both [DefaultStreamEmojiChip] and +// [_OverflowEmojiChip]. Resolves all chip theme properties and renders +// an [IconButton] with the given [child]. +class _RawEmojiChip extends StatelessWidget { + const _RawEmojiChip({ + required this.child, + this.onPressed, + this.onLongPress, + this.isSelected = false, + }); + + final Widget child; + final VoidCallback? onPressed; + final VoidCallback? onLongPress; + final bool isSelected; + + @override + Widget build(BuildContext context) { + final chipThemeStyle = context.streamEmojiChipTheme.style; + final defaults = _StreamEmojiChipThemeDefaults(context); + + final effectiveBackgroundColor = chipThemeStyle?.backgroundColor ?? defaults.backgroundColor; + final effectiveForegroundColor = chipThemeStyle?.foregroundColor ?? defaults.foregroundColor; + final effectiveOverlayColor = chipThemeStyle?.overlayColor ?? defaults.overlayColor; + final effectiveTextStyle = chipThemeStyle?.textStyle ?? defaults.textStyle; + final effectiveEmojiSize = chipThemeStyle?.emojiSize ?? defaults.emojiSize; + final effectiveMinimumSize = chipThemeStyle?.minimumSize ?? defaults.minimumSize; + final effectiveMaximumSize = chipThemeStyle?.maximumSize ?? defaults.maximumSize; + final effectivePadding = chipThemeStyle?.padding ?? defaults.padding; + final effectiveShape = chipThemeStyle?.shape ?? defaults.shape; + final effectiveSide = chipThemeStyle?.side ?? defaults.side; + + return IconButton( + onPressed: onPressed, + onLongPress: onLongPress, + isSelected: isSelected, + iconSize: effectiveEmojiSize, + // Need to disable text scaling here so that the text doesn't + // escape the chip when the textScaleFactor is large. + icon: MediaQuery.withNoTextScaling(child: child), + style: ButtonStyle( + tapTargetSize: .shrinkWrap, + visualDensity: .standard, + textStyle: effectiveTextStyle, + backgroundColor: effectiveBackgroundColor, + foregroundColor: effectiveForegroundColor, + overlayColor: effectiveOverlayColor, + minimumSize: .all(effectiveMinimumSize), + maximumSize: .all(effectiveMaximumSize), + padding: .all(effectivePadding), + shape: .all(effectiveShape), + side: effectiveSide, + ), + ); + } +} + +// Provides default values for [StreamEmojiChipThemeStyle] based on +// the current [StreamColorScheme]. +class _StreamEmojiChipThemeDefaults extends StreamEmojiChipThemeStyle { + _StreamEmojiChipThemeDefaults(this._context); + + final BuildContext _context; + + late final _colorScheme = _context.streamColorScheme; + late final _textTheme = _context.streamTextTheme; + late final _radius = _context.streamRadius; + late final _spacing = _context.streamSpacing; + + @override + double get emojiSize => StreamEmojiSize.sm.value; + + @override + Size get minimumSize => const Size(64, 32); + + @override + Size get maximumSize => const Size.fromHeight(32); + + @override + WidgetStateProperty get backgroundColor => .resolveWith((states) { + if (states.contains(WidgetState.disabled)) return StreamColors.transparent; + if (states.contains(WidgetState.selected)) { + return Color.alphaBlend(_colorScheme.stateSelected, StreamColors.transparent); + } + return StreamColors.transparent; + }); + + @override + WidgetStateProperty get foregroundColor => .resolveWith((states) { + if (states.contains(WidgetState.disabled)) return _colorScheme.textDisabled; + return _colorScheme.textPrimary; + }); + + @override + WidgetStateProperty get overlayColor => .resolveWith((states) { + if (states.contains(WidgetState.disabled)) return StreamColors.transparent; + if (states.contains(WidgetState.pressed)) return _colorScheme.statePressed; + if (states.contains(WidgetState.hovered)) return _colorScheme.stateHover; + return StreamColors.transparent; + }); + + @override + WidgetStateProperty get textStyle => .all( + _textTheme.bodyEmphasis.copyWith(fontFeatures: const [.tabularFigures()]), + ); + + @override + EdgeInsetsGeometry get padding => .symmetric(horizontal: _spacing.sm, vertical: _spacing.xxs + _spacing.xxxs); + + @override + OutlinedBorder get shape => RoundedRectangleBorder(borderRadius: .all(_radius.max)); + + @override + WidgetStateBorderSide get side => .resolveWith((states) { + if (states.contains(WidgetState.disabled)) return BorderSide(color: _colorScheme.borderDisabled); + return BorderSide(color: _colorScheme.borderDefault); + }); +} diff --git a/packages/stream_core_flutter/lib/src/components/controls/stream_emoji_chip_bar.dart b/packages/stream_core_flutter/lib/src/components/controls/stream_emoji_chip_bar.dart new file mode 100644 index 0000000..642204f --- /dev/null +++ b/packages/stream_core_flutter/lib/src/components/controls/stream_emoji_chip_bar.dart @@ -0,0 +1,262 @@ +import 'package:flutter/material.dart'; + +import '../../factory/stream_component_factory.dart'; +import '../../theme/stream_theme_extensions.dart'; +import 'stream_emoji_chip.dart'; + +/// A horizontally scrollable bar of [StreamEmojiChip]s for filtering by +/// reaction type. +/// +/// [StreamEmojiChipBar] renders a row of emoji chips where each +/// [StreamEmojiChipItem] represents a reaction type with its count. +/// Selection is value-based using [T] and supports toggle behavior: tapping +/// the already-selected item deselects it. +/// +/// The generic type [T] represents the value associated with each item +/// (e.g. a reaction type string, an enum, or even a [Widget]). Selection +/// comparison uses [T.==], so ensure [T] has meaningful equality semantics. +/// +/// An optional [leading] widget (typically [StreamEmojiChip.addEmoji]) is +/// rendered before the items inside the same scrollable row. +/// +/// To customize the appearance of chips inside the bar, wrap it with a +/// [StreamEmojiChipTheme]. +/// +/// {@tool snippet} +/// +/// Basic usage with `String` values: +/// +/// ```dart +/// StreamEmojiChipBar( +/// leading: StreamEmojiChip.addEmoji( +/// onPressed: () => showReactionPicker(), +/// ), +/// items: [ +/// StreamEmojiChipItem(value: '👍', emoji: Text('👍'), count: 7), +/// StreamEmojiChipItem(value: '❤️', emoji: Text('❤️'), count: 5), +/// ], +/// selected: _selectedReaction, +/// onSelected: (value) => setState(() => _selectedReaction = value), +/// ) +/// ``` +/// {@end-tool} +/// +/// See also: +/// +/// * [StreamEmojiChipTheme], for customizing chip appearance inside the bar. +/// * [StreamEmojiChip], which renders each individual chip. +/// * [StreamEmojiChipItem], which describes a single filter item. +class StreamEmojiChipBar extends StatelessWidget { + /// Creates an emoji chip bar. + StreamEmojiChipBar({ + super.key, + Widget? leading, + required List> items, + T? selected, + ValueChanged? onSelected, + EdgeInsetsGeometry? padding, + double? spacing, + }) : props = .new( + leading: leading, + items: items, + selected: selected, + onSelected: onSelected, + padding: padding, + spacing: spacing, + ); + + /// The props controlling the appearance and behavior of this bar. + final StreamEmojiChipBarProps props; + + @override + Widget build(BuildContext context) { + final builder = StreamComponentFactory.of(context).emojiChipBar; + if (builder != null) return builder(context, props); + return DefaultStreamEmojiChipBar(props: props); + } +} + +/// Properties for configuring a [StreamEmojiChipBar]. +/// +/// This class holds all the configuration options for an emoji chip bar, +/// allowing them to be passed through the [StreamComponentFactory]. +/// +/// See also: +/// +/// * [StreamEmojiChipBar], which uses these properties. +/// * [DefaultStreamEmojiChipBar], the default implementation. +class StreamEmojiChipBarProps { + /// Creates properties for an emoji chip bar. + const StreamEmojiChipBarProps({ + this.leading, + required this.items, + this.selected, + this.onSelected, + this.padding, + this.spacing, + }); + + /// An optional widget rendered before the filter items. + /// + /// Typically a [StreamEmojiChip.addEmoji] for adding new reactions. + /// Rendered inside the same scrollable row as the items. + final Widget? leading; + + /// The filter items to display. + /// + /// Each item renders as a [StreamEmojiChip] using [StreamEmojiChipItem.emoji] + /// and [StreamEmojiChipItem.count]. The bar manages [isSelected] and + /// [onPressed] internally. + final List> items; + + /// The currently selected value, or `null` if no filter is active. + /// + /// Compared against each [StreamEmojiChipItem.value] using [==]. + /// When `null`, no chip is highlighted (all reactions are shown). + final T? selected; + + /// Called when an item is tapped. + /// + /// Receives the tapped item's [value], or `null` when the already-selected + /// item is tapped again (toggle-off / deselect). When `null`, the bar is + /// non-interactive. + final ValueChanged? onSelected; + + /// The padding around the scrollable chip row. + /// + /// Falls back to horizontal `StreamSpacing.md`. + final EdgeInsetsGeometry? padding; + + /// The gap between chips in the row. + /// + /// Falls back to `StreamSpacing.xs` (8px). + final double? spacing; +} + +/// A single item in a [StreamEmojiChipBar]. +/// +/// Pairs a [value] of type [T] (used for selection identity) with visual +/// properties ([emoji] and optional [count]) rendered inside a +/// [StreamEmojiChip]. +/// +/// This follows the same pattern as [ButtonSegment] in Flutter's +/// [SegmentedButton], where the generic value drives selection and widget +/// fields drive rendering. +class StreamEmojiChipItem { + /// Creates a filter bar item. + const StreamEmojiChipItem({ + required this.value, + required this.emoji, + this.count, + }); + + /// The value this item represents. + /// + /// Used to match against [StreamEmojiChipBarProps.selected] via [==]. + /// For reaction filtering, this is typically a reaction type identifier. + final T value; + + /// The emoji content to display inside the chip. + /// + /// Typically a reaction icon builder result or a [Text] widget containing + /// a Unicode emoji character. + final Widget emoji; + + /// The reaction count to display next to [emoji]. + /// + /// When `null` the count label is hidden. + final int? count; +} + +/// Default implementation of [StreamEmojiChipBar]. +/// +/// Renders a horizontally scrollable [SingleChildScrollView] containing the +/// optional [StreamEmojiChipBarProps.leading] widget followed by a +/// [StreamEmojiChip] for each item. Handles toggle selection and +/// auto-scrolls to keep the selected item visible. +class DefaultStreamEmojiChipBar extends StatefulWidget { + /// Creates a default emoji chip bar. + const DefaultStreamEmojiChipBar({super.key, required this.props}); + + /// The props controlling the appearance and behavior of this bar. + final StreamEmojiChipBarProps props; + + @override + State> createState() => _DefaultStreamEmojiChipBarState(); +} + +class _DefaultStreamEmojiChipBarState extends State> { + late Map _valueKeys; + + StreamEmojiChipBarProps get props => widget.props; + + @override + void initState() { + super.initState(); + _valueKeys = {for (final item in props.items) item.value: GlobalKey()}; + } + + @override + void didUpdateWidget(DefaultStreamEmojiChipBar oldWidget) { + super.didUpdateWidget(oldWidget); + if (!identical(oldWidget.props.items, props.items)) { + _valueKeys = {for (final item in props.items) item.value: GlobalKey()}; + } + if (widget.props.selected != oldWidget.props.selected) { + _scrollToSelected(); + } + } + + void _scrollToSelected() { + final selected = props.selected; + if (selected == null) return; + + final key = _valueKeys[selected]; + if (key == null) return; + + WidgetsBinding.instance.addPostFrameCallback((_) { + if (!mounted) return; + final keyContext = key.currentContext; + if (keyContext == null) return; + + Scrollable.ensureVisible( + keyContext, + curve: Curves.easeInOut, + alignment: 0.5, // Center the item (0.0 is start, 1.0 is end) + duration: const Duration(milliseconds: 300), + ); + }); + } + + @override + Widget build(BuildContext context) { + final spacing = context.streamSpacing; + + final effectiveSpacing = props.spacing ?? spacing.xs; + final effectivePadding = props.padding ?? .symmetric(horizontal: spacing.md); + + return SingleChildScrollView( + padding: effectivePadding, + scrollDirection: .horizontal, + child: Row( + spacing: effectiveSpacing, + children: [ + ?props.leading, + for (final item in props.items) + StreamEmojiChip( + key: _valueKeys[item.value], + emoji: item.emoji, + count: item.count, + isSelected: item.value == props.selected, + onPressed: switch (props.onSelected) { + final onSelected? => () => onSelected( + item.value == props.selected ? null : item.value, + ), + _ => null, + }, + ), + ], + ), + ); + } +} diff --git a/packages/stream_core_flutter/lib/src/components/controls/stream_remove_control.dart b/packages/stream_core_flutter/lib/src/components/controls/stream_remove_control.dart new file mode 100644 index 0000000..58a60cd --- /dev/null +++ b/packages/stream_core_flutter/lib/src/components/controls/stream_remove_control.dart @@ -0,0 +1,36 @@ +import 'package:flutter/widgets.dart'; + +import '../../../stream_core_flutter.dart'; + +class StreamRemoveControl extends StatelessWidget { + const StreamRemoveControl({ + super.key, + required this.onPressed, + }); + + final VoidCallback onPressed; + + @override + Widget build(BuildContext context) { + final colorScheme = context.streamColorScheme; + + return GestureDetector( + onTap: onPressed, + child: Container( + decoration: BoxDecoration( + color: colorScheme.accentBlack, + shape: BoxShape.circle, + border: Border.all(color: colorScheme.borderOnDark, width: 2), + ), + alignment: Alignment.center, + height: 20, + width: 20, + child: Icon( + context.streamIcons.crossSmall, + color: colorScheme.textOnAccent, + size: 10, + ), + ), + ); + } +} diff --git a/packages/stream_core_flutter/lib/src/components/emoji/data/stream_emoji_data.dart b/packages/stream_core_flutter/lib/src/components/emoji/data/stream_emoji_data.dart new file mode 100644 index 0000000..e450d76 --- /dev/null +++ b/packages/stream_core_flutter/lib/src/components/emoji/data/stream_emoji_data.dart @@ -0,0 +1,62 @@ +import 'package:flutter/foundation.dart'; + +/// A data class representing a single emoji entry. +/// +/// Used by the emoji picker and reaction system to provide a curated, +/// self-contained set of emojis without relying on external packages. +/// +/// {@tool snippet} +/// +/// ```dart +/// const emoji = StreamEmojiData( +/// name: 'grinning face', +/// emoji: '😀', +/// shortName: 'grinning', +/// shortNames: ['grinning'], +/// sortOrder: 1, +/// ); +/// ``` +/// {@end-tool} +/// +/// See also: +/// +/// * [streamSupportedEmojis], a curated map of commonly used emojis. +/// * [StreamEmojiPickerSheet], which displays emojis in a picker grid. +@immutable +class StreamEmojiData { + /// Creates an emoji data entry. + const StreamEmojiData({ + required this.name, + required this.emoji, + required this.shortName, + required this.shortNames, + required this.sortOrder, + }); + + /// The human-readable name of the emoji (e.g., "Grinning Face"). + final String name; + + /// The emoji character itself (e.g., "😀"). + final String emoji; + + /// The canonical short name used as a reaction type identifier + /// (e.g., "grinning"). + final String shortName; + + /// All known short name aliases for this emoji, including [shortName]. + final List shortNames; + + /// The sort order for display purposes, matching the Unicode CLDR ordering. + final int sortOrder; + + @override + bool operator ==(Object other) => + identical(this, other) || + other is StreamEmojiData && runtimeType == other.runtimeType && shortName == other.shortName; + + @override + int get hashCode => shortName.hashCode; + + @override + String toString() => 'StreamEmojiData($shortName, $emoji)'; +} diff --git a/packages/stream_core_flutter/lib/src/components/emoji/data/stream_supported_emojis.dart b/packages/stream_core_flutter/lib/src/components/emoji/data/stream_supported_emojis.dart new file mode 100644 index 0000000..6531224 --- /dev/null +++ b/packages/stream_core_flutter/lib/src/components/emoji/data/stream_supported_emojis.dart @@ -0,0 +1,1185 @@ +import 'stream_emoji_data.dart'; + +/// A curated map of commonly used emojis, keyed by short name. +/// +/// Provides a balanced selection of popular emojis across categories. +/// Iteration order matches the insertion order (display order). +/// +/// See also: +/// +/// * [StreamEmojiData], the data model for each entry. +/// * [StreamEmojiPickerSheet], which displays these emojis in a picker. +const streamSupportedEmojis = { + // Smileys & Emotion — face-smiling + 'grinning': StreamEmojiData( + name: 'grinning face', + emoji: '😀', + shortName: 'grinning', + shortNames: ['grinning'], + sortOrder: 1, + ), + 'smiley': StreamEmojiData( + name: 'smiling face with open mouth', + emoji: '😃', + shortName: 'smiley', + shortNames: ['smiley'], + sortOrder: 2, + ), + 'smile': StreamEmojiData( + name: 'smiling face with open mouth and smiling eyes', + emoji: '😄', + shortName: 'smile', + shortNames: ['smile'], + sortOrder: 3, + ), + 'grin': StreamEmojiData( + name: 'grinning face with smiling eyes', + emoji: '😁', + shortName: 'grin', + shortNames: ['grin'], + sortOrder: 4, + ), + 'laughing': StreamEmojiData( + name: 'smiling face with open mouth and tightly-closed eyes', + emoji: '😆', + shortName: 'laughing', + shortNames: ['laughing', 'satisfied'], + sortOrder: 5, + ), + 'sweat_smile': StreamEmojiData( + name: 'smiling face with open mouth and cold sweat', + emoji: '😅', + shortName: 'sweat_smile', + shortNames: ['sweat_smile'], + sortOrder: 6, + ), + 'rofl': StreamEmojiData( + name: 'rolling on the floor laughing', + emoji: '🤣', + shortName: 'rofl', + shortNames: ['rofl', 'rolling_on_the_floor_laughing'], + sortOrder: 7, + ), + 'haha': StreamEmojiData( + name: 'face with tears of joy', + emoji: '😂', + shortName: 'haha', + shortNames: ['haha', 'joy'], + sortOrder: 8, + ), + 'slightly_smiling_face': StreamEmojiData( + name: 'slightly smiling face', + emoji: '🙂', + shortName: 'slightly_smiling_face', + shortNames: ['slightly_smiling_face'], + sortOrder: 9, + ), + 'upside_down_face': StreamEmojiData( + name: 'upside-down face', + emoji: '🙃', + shortName: 'upside_down_face', + shortNames: ['upside_down_face'], + sortOrder: 10, + ), + 'wink': StreamEmojiData( + name: 'winking face', + emoji: '😉', + shortName: 'wink', + shortNames: ['wink'], + sortOrder: 12, + ), + 'blush': StreamEmojiData( + name: 'smiling face with smiling eyes', + emoji: '😊', + shortName: 'blush', + shortNames: ['blush'], + sortOrder: 13, + ), + 'innocent': StreamEmojiData( + name: 'smiling face with halo', + emoji: '😇', + shortName: 'innocent', + shortNames: ['innocent'], + sortOrder: 14, + ), + + // Smileys & Emotion — face-affection + 'smiling_face_with_three_hearts': StreamEmojiData( + name: 'smiling face with smiling eyes and three hearts', + emoji: '🥰', + shortName: 'smiling_face_with_three_hearts', + shortNames: ['smiling_face_with_three_hearts', 'smiling_face_with_3_hearts'], + sortOrder: 15, + ), + 'heart_eyes': StreamEmojiData( + name: 'smiling face with heart-shaped eyes', + emoji: '😍', + shortName: 'heart_eyes', + shortNames: ['heart_eyes'], + sortOrder: 16, + ), + 'star_struck': StreamEmojiData( + name: 'grinning face with star eyes', + emoji: '🤩', + shortName: 'star_struck', + shortNames: ['star_struck', 'star-struck', 'grinning_face_with_star_eyes'], + sortOrder: 17, + ), + 'kissing_heart': StreamEmojiData( + name: 'face throwing a kiss', + emoji: '😘', + shortName: 'kissing_heart', + shortNames: ['kissing_heart'], + sortOrder: 18, + ), + 'kissing': StreamEmojiData( + name: 'kissing face', + emoji: '😗', + shortName: 'kissing', + shortNames: ['kissing'], + sortOrder: 19, + ), + 'kissing_closed_eyes': StreamEmojiData( + name: 'kissing face with closed eyes', + emoji: '😚', + shortName: 'kissing_closed_eyes', + shortNames: ['kissing_closed_eyes'], + sortOrder: 21, + ), + 'kissing_smiling_eyes': StreamEmojiData( + name: 'kissing face with smiling eyes', + emoji: '😙', + shortName: 'kissing_smiling_eyes', + shortNames: ['kissing_smiling_eyes'], + sortOrder: 22, + ), + + // Smileys & Emotion — face-tongue + 'yum': StreamEmojiData( + name: 'face savouring delicious food', + emoji: '😋', + shortName: 'yum', + shortNames: ['yum'], + sortOrder: 24, + ), + 'stuck_out_tongue': StreamEmojiData( + name: 'face with stuck-out tongue', + emoji: '😛', + shortName: 'stuck_out_tongue', + shortNames: ['stuck_out_tongue'], + sortOrder: 25, + ), + 'stuck_out_tongue_winking_eye': StreamEmojiData( + name: 'face with stuck-out tongue and winking eye', + emoji: '😜', + shortName: 'stuck_out_tongue_winking_eye', + shortNames: ['stuck_out_tongue_winking_eye'], + sortOrder: 26, + ), + 'zany_face': StreamEmojiData( + name: 'grinning face with one large and one small eye', + emoji: '🤪', + shortName: 'zany_face', + shortNames: ['zany_face', 'grinning_face_with_one_large_and_one_small_eye'], + sortOrder: 27, + ), + 'stuck_out_tongue_closed_eyes': StreamEmojiData( + name: 'face with stuck-out tongue and tightly-closed eyes', + emoji: '😝', + shortName: 'stuck_out_tongue_closed_eyes', + shortNames: ['stuck_out_tongue_closed_eyes'], + sortOrder: 28, + ), + 'money_mouth_face': StreamEmojiData( + name: 'money-mouth face', + emoji: '🤑', + shortName: 'money_mouth_face', + shortNames: ['money_mouth_face'], + sortOrder: 29, + ), + + // Smileys & Emotion — face-hand + 'hugs': StreamEmojiData( + name: 'hugging face', + emoji: '🤗', + shortName: 'hugs', + shortNames: ['hugs', 'hugging_face'], + sortOrder: 30, + ), + 'hand_over_mouth': StreamEmojiData( + name: 'smiling face with smiling eyes and hand covering mouth', + emoji: '🤭', + shortName: 'hand_over_mouth', + shortNames: [ + 'hand_over_mouth', + 'face_with_hand_over_mouth', + 'smiling_face_with_smiling_eyes_and_hand_covering_mouth', + ], + sortOrder: 31, + ), + 'shushing_face': StreamEmojiData( + name: 'face with finger covering closed lips', + emoji: '🤫', + shortName: 'shushing_face', + shortNames: [ + 'shushing_face', + 'face_with_finger_covering_closed_lips', + ], + sortOrder: 34, + ), + 'thinking': StreamEmojiData( + name: 'thinking face', + emoji: '🤔', + shortName: 'thinking', + shortNames: ['thinking', 'thinking_face'], + sortOrder: 35, + ), + + // Smileys & Emotion — face-neutral-skeptical + 'zipper_mouth_face': StreamEmojiData( + name: 'zipper-mouth face', + emoji: '🤐', + shortName: 'zipper_mouth_face', + shortNames: ['zipper_mouth_face'], + sortOrder: 37, + ), + 'raised_eyebrow': StreamEmojiData( + name: 'face with one eyebrow raised', + emoji: '🤨', + shortName: 'raised_eyebrow', + shortNames: [ + 'raised_eyebrow', + 'face_with_raised_eyebrow', + 'face_with_one_eyebrow_raised', + ], + sortOrder: 38, + ), + 'neutral_face': StreamEmojiData( + name: 'neutral face', + emoji: '😐', + shortName: 'neutral_face', + shortNames: ['neutral_face'], + sortOrder: 39, + ), + 'expressionless': StreamEmojiData( + name: 'expressionless face', + emoji: '😑', + shortName: 'expressionless', + shortNames: ['expressionless'], + sortOrder: 40, + ), + 'no_mouth': StreamEmojiData( + name: 'face without mouth', + emoji: '😶', + shortName: 'no_mouth', + shortNames: ['no_mouth'], + sortOrder: 41, + ), + 'face_in_clouds': StreamEmojiData( + name: 'face in clouds', + emoji: '😶\u200D\u{1F32B}\uFE0F', + shortName: 'face_in_clouds', + shortNames: ['face_in_clouds'], + sortOrder: 43, + ), + 'smirk': StreamEmojiData( + name: 'smirking face', + emoji: '😏', + shortName: 'smirk', + shortNames: ['smirk'], + sortOrder: 44, + ), + 'unamused': StreamEmojiData( + name: 'unamused face', + emoji: '😒', + shortName: 'unamused', + shortNames: ['unamused'], + sortOrder: 45, + ), + 'roll_eyes': StreamEmojiData( + name: 'face with rolling eyes', + emoji: '🙄', + shortName: 'roll_eyes', + shortNames: ['roll_eyes', 'face_with_rolling_eyes'], + sortOrder: 46, + ), + 'grimacing': StreamEmojiData( + name: 'grimacing face', + emoji: '😬', + shortName: 'grimacing', + shortNames: ['grimacing'], + sortOrder: 47, + ), + 'lying_face': StreamEmojiData( + name: 'lying face', + emoji: '🤥', + shortName: 'lying_face', + shortNames: ['lying_face'], + sortOrder: 49, + ), + + // Smileys & Emotion — face-sleepy + 'relieved': StreamEmojiData( + name: 'relieved face', + emoji: '😌', + shortName: 'relieved', + shortNames: ['relieved'], + sortOrder: 53, + ), + 'pensive': StreamEmojiData( + name: 'pensive face', + emoji: '😔', + shortName: 'pensive', + shortNames: ['pensive'], + sortOrder: 54, + ), + 'sleepy': StreamEmojiData( + name: 'sleepy face', + emoji: '😪', + shortName: 'sleepy', + shortNames: ['sleepy'], + sortOrder: 55, + ), + 'drooling_face': StreamEmojiData( + name: 'drooling face', + emoji: '🤤', + shortName: 'drooling_face', + shortNames: ['drooling_face'], + sortOrder: 56, + ), + 'sleeping': StreamEmojiData( + name: 'sleeping face', + emoji: '😴', + shortName: 'sleeping', + shortNames: ['sleeping'], + sortOrder: 57, + ), + + // Smileys & Emotion — face-unwell + 'mask': StreamEmojiData( + name: 'face with medical mask', + emoji: '😷', + shortName: 'mask', + shortNames: ['mask'], + sortOrder: 59, + ), + 'face_with_thermometer': StreamEmojiData( + name: 'face with thermometer', + emoji: '🤒', + shortName: 'face_with_thermometer', + shortNames: ['face_with_thermometer'], + sortOrder: 60, + ), + 'face_with_head_bandage': StreamEmojiData( + name: 'face with head-bandage', + emoji: '🤕', + shortName: 'face_with_head_bandage', + shortNames: ['face_with_head_bandage'], + sortOrder: 61, + ), + 'nauseated_face': StreamEmojiData( + name: 'nauseated face', + emoji: '🤢', + shortName: 'nauseated_face', + shortNames: ['nauseated_face'], + sortOrder: 62, + ), + 'vomiting_face': StreamEmojiData( + name: 'face with open mouth vomiting', + emoji: '🤮', + shortName: 'vomiting_face', + shortNames: [ + 'vomiting_face', + 'face_vomiting', + 'face_with_open_mouth_vomiting', + ], + sortOrder: 63, + ), + 'sneezing_face': StreamEmojiData( + name: 'sneezing face', + emoji: '🤧', + shortName: 'sneezing_face', + shortNames: ['sneezing_face'], + sortOrder: 64, + ), + 'hot_face': StreamEmojiData( + name: 'overheated face', + emoji: '🥵', + shortName: 'hot_face', + shortNames: ['hot_face'], + sortOrder: 65, + ), + 'cold_face': StreamEmojiData( + name: 'freezing face', + emoji: '🥶', + shortName: 'cold_face', + shortNames: ['cold_face'], + sortOrder: 66, + ), + 'woozy_face': StreamEmojiData( + name: 'face with uneven eyes and wavy mouth', + emoji: '🥴', + shortName: 'woozy_face', + shortNames: ['woozy_face'], + sortOrder: 67, + ), + 'face_with_spiral_eyes': StreamEmojiData( + name: 'face with spiral eyes', + emoji: '😵\u200D\u{1F4AB}', + shortName: 'face_with_spiral_eyes', + shortNames: ['face_with_spiral_eyes'], + sortOrder: 69, + ), + 'exploding_head': StreamEmojiData( + name: 'shocked face with exploding head', + emoji: '🤯', + shortName: 'exploding_head', + shortNames: ['exploding_head', 'shocked_face_with_exploding_head'], + sortOrder: 70, + ), + + // Smileys & Emotion — face-hat / face-glasses + 'cowboy_hat_face': StreamEmojiData( + name: 'face with cowboy hat', + emoji: '🤠', + shortName: 'cowboy_hat_face', + shortNames: ['cowboy_hat_face', 'face_with_cowboy_hat'], + sortOrder: 71, + ), + 'partying_face': StreamEmojiData( + name: 'face with party horn and party hat', + emoji: '🥳', + shortName: 'partying_face', + shortNames: ['partying_face'], + sortOrder: 72, + ), + 'sunglasses': StreamEmojiData( + name: 'smiling face with sunglasses', + emoji: '😎', + shortName: 'sunglasses', + shortNames: ['sunglasses'], + sortOrder: 74, + ), + 'nerd_face': StreamEmojiData( + name: 'nerd face', + emoji: '🤓', + shortName: 'nerd_face', + shortNames: ['nerd_face'], + sortOrder: 75, + ), + 'monocle_face': StreamEmojiData( + name: 'face with monocle', + emoji: '🧐', + shortName: 'monocle_face', + shortNames: ['monocle_face', 'face_with_monocle'], + sortOrder: 76, + ), + + // Smileys & Emotion — face-concerned + 'confused': StreamEmojiData( + name: 'confused face', + emoji: '😕', + shortName: 'confused', + shortNames: ['confused'], + sortOrder: 77, + ), + 'worried': StreamEmojiData( + name: 'worried face', + emoji: '😟', + shortName: 'worried', + shortNames: ['worried'], + sortOrder: 79, + ), + 'slightly_frowning_face': StreamEmojiData( + name: 'slightly frowning face', + emoji: '🙁', + shortName: 'slightly_frowning_face', + shortNames: ['slightly_frowning_face'], + sortOrder: 80, + ), + 'frowning_face': StreamEmojiData( + name: 'frowning face', + emoji: '\u2639\uFE0F', + shortName: 'frowning_face', + shortNames: ['frowning_face', 'white_frowning_face'], + sortOrder: 81, + ), + 'wow': StreamEmojiData( + name: 'face with open mouth', + emoji: '😮', + shortName: 'wow', + shortNames: ['wow', 'open_mouth'], + sortOrder: 82, + ), + 'hushed': StreamEmojiData( + name: 'hushed face', + emoji: '😯', + shortName: 'hushed', + shortNames: ['hushed'], + sortOrder: 83, + ), + 'astonished': StreamEmojiData( + name: 'astonished face', + emoji: '😲', + shortName: 'astonished', + shortNames: ['astonished'], + sortOrder: 84, + ), + 'flushed': StreamEmojiData( + name: 'flushed face', + emoji: '😳', + shortName: 'flushed', + shortNames: ['flushed'], + sortOrder: 85, + ), + 'pleading_face': StreamEmojiData( + name: 'face with pleading eyes', + emoji: '🥺', + shortName: 'pleading_face', + shortNames: ['pleading_face'], + sortOrder: 86, + ), + 'frowning': StreamEmojiData( + name: 'frowning face with open mouth', + emoji: '😦', + shortName: 'frowning', + shortNames: ['frowning'], + sortOrder: 88, + ), + 'anguished': StreamEmojiData( + name: 'anguished face', + emoji: '😧', + shortName: 'anguished', + shortNames: ['anguished'], + sortOrder: 89, + ), + 'fearful': StreamEmojiData( + name: 'fearful face', + emoji: '😨', + shortName: 'fearful', + shortNames: ['fearful'], + sortOrder: 90, + ), + 'cold_sweat': StreamEmojiData( + name: 'face with open mouth and cold sweat', + emoji: '😰', + shortName: 'cold_sweat', + shortNames: ['cold_sweat'], + sortOrder: 91, + ), + 'disappointed_relieved': StreamEmojiData( + name: 'disappointed but relieved face', + emoji: '😥', + shortName: 'disappointed_relieved', + shortNames: ['disappointed_relieved'], + sortOrder: 92, + ), + 'cry': StreamEmojiData( + name: 'crying face', + emoji: '😢', + shortName: 'cry', + shortNames: ['cry'], + sortOrder: 93, + ), + 'sob': StreamEmojiData( + name: 'loudly crying face', + emoji: '😭', + shortName: 'sob', + shortNames: ['sob'], + sortOrder: 94, + ), + 'scream': StreamEmojiData( + name: 'face screaming in fear', + emoji: '😱', + shortName: 'scream', + shortNames: ['scream'], + sortOrder: 95, + ), + 'confounded': StreamEmojiData( + name: 'confounded face', + emoji: '😖', + shortName: 'confounded', + shortNames: ['confounded'], + sortOrder: 96, + ), + 'persevere': StreamEmojiData( + name: 'persevering face', + emoji: '😣', + shortName: 'persevere', + shortNames: ['persevere'], + sortOrder: 97, + ), + 'disappointed': StreamEmojiData( + name: 'disappointed face', + emoji: '😞', + shortName: 'disappointed', + shortNames: ['disappointed'], + sortOrder: 98, + ), + 'sweat': StreamEmojiData( + name: 'face with cold sweat', + emoji: '😓', + shortName: 'sweat', + shortNames: ['sweat'], + sortOrder: 99, + ), + 'weary': StreamEmojiData( + name: 'weary face', + emoji: '😩', + shortName: 'weary', + shortNames: ['weary'], + sortOrder: 100, + ), + 'tired_face': StreamEmojiData( + name: 'tired face', + emoji: '😫', + shortName: 'tired_face', + shortNames: ['tired_face'], + sortOrder: 101, + ), + 'yawning_face': StreamEmojiData( + name: 'yawning face', + emoji: '🥱', + shortName: 'yawning_face', + shortNames: ['yawning_face'], + sortOrder: 102, + ), + + // Smileys & Emotion — face-negative + 'triumph': StreamEmojiData( + name: 'face with look of triumph', + emoji: '😤', + shortName: 'triumph', + shortNames: ['triumph'], + sortOrder: 103, + ), + 'rage': StreamEmojiData( + name: 'pouting face', + emoji: '😡', + shortName: 'rage', + shortNames: ['rage'], + sortOrder: 104, + ), + 'angry': StreamEmojiData( + name: 'angry face', + emoji: '😠', + shortName: 'angry', + shortNames: ['angry'], + sortOrder: 105, + ), + 'cursing_face': StreamEmojiData( + name: 'serious face with symbols covering mouth', + emoji: '🤬', + shortName: 'cursing_face', + shortNames: [ + 'cursing_face', + 'face_with_symbols_on_mouth', + 'serious_face_with_symbols_covering_mouth', + ], + sortOrder: 106, + ), + + // Smileys & Emotion — face-costume + 'smiling_imp': StreamEmojiData( + name: 'smiling face with horns', + emoji: '😈', + shortName: 'smiling_imp', + shortNames: ['smiling_imp'], + sortOrder: 107, + ), + 'imp': StreamEmojiData( + name: 'imp', + emoji: '👿', + shortName: 'imp', + shortNames: ['imp'], + sortOrder: 108, + ), + 'skull': StreamEmojiData( + name: 'skull', + emoji: '💀', + shortName: 'skull', + shortNames: ['skull'], + sortOrder: 109, + ), + 'skull_and_crossbones': StreamEmojiData( + name: 'skull and crossbones', + emoji: '\u2620\uFE0F', + shortName: 'skull_and_crossbones', + shortNames: ['skull_and_crossbones'], + sortOrder: 110, + ), + 'poop': StreamEmojiData( + name: 'pile of poo', + emoji: '💩', + shortName: 'poop', + shortNames: ['poop', 'hankey', 'shit'], + sortOrder: 111, + ), + 'clown_face': StreamEmojiData( + name: 'clown face', + emoji: '🤡', + shortName: 'clown_face', + shortNames: ['clown_face'], + sortOrder: 112, + ), + 'japanese_ogre': StreamEmojiData( + name: 'japanese ogre', + emoji: '👹', + shortName: 'japanese_ogre', + shortNames: ['japanese_ogre'], + sortOrder: 113, + ), + 'japanese_goblin': StreamEmojiData( + name: 'japanese goblin', + emoji: '👺', + shortName: 'japanese_goblin', + shortNames: ['japanese_goblin'], + sortOrder: 114, + ), + 'ghost': StreamEmojiData( + name: 'ghost', + emoji: '👻', + shortName: 'ghost', + shortNames: ['ghost'], + sortOrder: 115, + ), + 'alien': StreamEmojiData( + name: 'extraterrestrial alien', + emoji: '👽', + shortName: 'alien', + shortNames: ['alien'], + sortOrder: 116, + ), + 'space_invader': StreamEmojiData( + name: 'alien monster', + emoji: '👾', + shortName: 'space_invader', + shortNames: ['space_invader'], + sortOrder: 117, + ), + 'robot': StreamEmojiData( + name: 'robot face', + emoji: '🤖', + shortName: 'robot', + shortNames: ['robot', 'robot_face'], + sortOrder: 118, + ), + + // Smileys & Emotion — cat-face + 'smiley_cat': StreamEmojiData( + name: 'smiling cat face with open mouth', + emoji: '😺', + shortName: 'smiley_cat', + shortNames: ['smiley_cat'], + sortOrder: 119, + ), + 'smile_cat': StreamEmojiData( + name: 'grinning cat face with smiling eyes', + emoji: '😸', + shortName: 'smile_cat', + shortNames: ['smile_cat'], + sortOrder: 120, + ), + 'joy_cat': StreamEmojiData( + name: 'cat face with tears of joy', + emoji: '😹', + shortName: 'joy_cat', + shortNames: ['joy_cat'], + sortOrder: 121, + ), + 'heart_eyes_cat': StreamEmojiData( + name: 'smiling cat face with heart-shaped eyes', + emoji: '😻', + shortName: 'heart_eyes_cat', + shortNames: ['heart_eyes_cat'], + sortOrder: 122, + ), + 'smirk_cat': StreamEmojiData( + name: 'cat face with wry smile', + emoji: '😼', + shortName: 'smirk_cat', + shortNames: ['smirk_cat'], + sortOrder: 123, + ), + 'kissing_cat': StreamEmojiData( + name: 'kissing cat face with closed eyes', + emoji: '😽', + shortName: 'kissing_cat', + shortNames: ['kissing_cat'], + sortOrder: 124, + ), + 'scream_cat': StreamEmojiData( + name: 'weary cat face', + emoji: '🙀', + shortName: 'scream_cat', + shortNames: ['scream_cat'], + sortOrder: 125, + ), + 'crying_cat_face': StreamEmojiData( + name: 'crying cat face', + emoji: '😿', + shortName: 'crying_cat_face', + shortNames: ['crying_cat_face'], + sortOrder: 126, + ), + 'pouting_cat': StreamEmojiData( + name: 'pouting cat face', + emoji: '😾', + shortName: 'pouting_cat', + shortNames: ['pouting_cat'], + sortOrder: 127, + ), + + // Smileys & Emotion — heart + 'cupid': StreamEmojiData( + name: 'heart with arrow', + emoji: '💘', + shortName: 'cupid', + shortNames: ['cupid'], + sortOrder: 132, + ), + 'gift_heart': StreamEmojiData( + name: 'heart with ribbon', + emoji: '💝', + shortName: 'gift_heart', + shortNames: ['gift_heart'], + sortOrder: 133, + ), + 'sparkling_heart': StreamEmojiData( + name: 'sparkling heart', + emoji: '💖', + shortName: 'sparkling_heart', + shortNames: ['sparkling_heart'], + sortOrder: 134, + ), + 'growing_heart': StreamEmojiData( + name: 'growing heart', + emoji: '💗', + shortName: 'growing_heart', + shortNames: ['growing_heart', 'heartpulse'], + sortOrder: 135, + ), + 'heartbeat': StreamEmojiData( + name: 'beating heart', + emoji: '💓', + shortName: 'heartbeat', + shortNames: ['heartbeat'], + sortOrder: 136, + ), + 'revolving_hearts': StreamEmojiData( + name: 'revolving hearts', + emoji: '💞', + shortName: 'revolving_hearts', + shortNames: ['revolving_hearts'], + sortOrder: 137, + ), + 'two_hearts': StreamEmojiData( + name: 'two hearts', + emoji: '💕', + shortName: 'two_hearts', + shortNames: ['two_hearts'], + sortOrder: 138, + ), + 'heart_exclamation': StreamEmojiData( + name: 'heart exclamation', + emoji: '\u2763\uFE0F', + shortName: 'heart_exclamation', + shortNames: [ + 'heart_exclamation', + 'heavy_heart_exclamation_mark_ornament', + ], + sortOrder: 140, + ), + 'broken_heart': StreamEmojiData( + name: 'broken heart', + emoji: '💔', + shortName: 'broken_heart', + shortNames: ['broken_heart'], + sortOrder: 141, + ), + 'love': StreamEmojiData( + name: 'heavy black heart', + emoji: '\u2764\uFE0F', + shortName: 'love', + shortNames: ['love', 'heart'], + sortOrder: 144, + ), + 'orange_heart': StreamEmojiData( + name: 'orange heart', + emoji: '🧡', + shortName: 'orange_heart', + shortNames: ['orange_heart'], + sortOrder: 146, + ), + 'yellow_heart': StreamEmojiData( + name: 'yellow heart', + emoji: '💛', + shortName: 'yellow_heart', + shortNames: ['yellow_heart'], + sortOrder: 147, + ), + 'green_heart': StreamEmojiData( + name: 'green heart', + emoji: '💚', + shortName: 'green_heart', + shortNames: ['green_heart'], + sortOrder: 148, + ), + 'blue_heart': StreamEmojiData( + name: 'blue heart', + emoji: '💙', + shortName: 'blue_heart', + shortNames: ['blue_heart'], + sortOrder: 149, + ), + 'purple_heart': StreamEmojiData( + name: 'purple heart', + emoji: '💜', + shortName: 'purple_heart', + shortNames: ['purple_heart'], + sortOrder: 151, + ), + 'brown_heart': StreamEmojiData( + name: 'brown heart', + emoji: '🤎', + shortName: 'brown_heart', + shortNames: ['brown_heart'], + sortOrder: 152, + ), + 'black_heart': StreamEmojiData( + name: 'black heart', + emoji: '🖤', + shortName: 'black_heart', + shortNames: ['black_heart'], + sortOrder: 153, + ), + 'white_heart': StreamEmojiData( + name: 'white heart', + emoji: '🤍', + shortName: 'white_heart', + shortNames: ['white_heart'], + sortOrder: 155, + ), + + // Smileys & Emotion — emotion + 'kiss': StreamEmojiData( + name: 'kiss mark', + emoji: '💋', + shortName: 'kiss', + shortNames: ['kiss'], + sortOrder: 156, + ), + + // People & Body — hand-fingers-open + 'wave': StreamEmojiData( + name: 'waving hand sign', + emoji: '👋', + shortName: 'wave', + shortNames: ['wave'], + sortOrder: 170, + ), + 'raised_back_of_hand': StreamEmojiData( + name: 'raised back of hand', + emoji: '🤚', + shortName: 'raised_back_of_hand', + shortNames: ['raised_back_of_hand'], + sortOrder: 171, + ), + 'raised_hand_with_fingers_splayed': StreamEmojiData( + name: 'hand with fingers splayed', + emoji: '\u{1F590}\uFE0F', + shortName: 'raised_hand_with_fingers_splayed', + shortNames: ['raised_hand_with_fingers_splayed'], + sortOrder: 172, + ), + 'raised_hand': StreamEmojiData( + name: 'raised hand', + emoji: '\u270B', + shortName: 'raised_hand', + shortNames: ['raised_hand', 'hand'], + sortOrder: 173, + ), + 'vulcan_salute': StreamEmojiData( + name: 'raised hand with part between middle and ring fingers', + emoji: '🖖', + shortName: 'vulcan_salute', + shortNames: ['vulcan_salute', 'spock-hand'], + sortOrder: 174, + ), + + // People & Body — hand-fingers-partial + 'ok_hand': StreamEmojiData( + name: 'ok hand sign', + emoji: '👌', + shortName: 'ok_hand', + shortNames: ['ok_hand'], + sortOrder: 181, + ), + 'pinched_fingers': StreamEmojiData( + name: 'pinched fingers', + emoji: '🤌', + shortName: 'pinched_fingers', + shortNames: ['pinched_fingers'], + sortOrder: 182, + ), + 'pinching_hand': StreamEmojiData( + name: 'pinching hand', + emoji: '🤏', + shortName: 'pinching_hand', + shortNames: ['pinching_hand'], + sortOrder: 183, + ), + 'v': StreamEmojiData( + name: 'victory hand', + emoji: '\u270C\uFE0F', + shortName: 'v', + shortNames: ['v'], + sortOrder: 184, + ), + 'crossed_fingers': StreamEmojiData( + name: 'hand with index and middle fingers crossed', + emoji: '🤞', + shortName: 'crossed_fingers', + shortNames: [ + 'crossed_fingers', + 'hand_with_index_and_middle_fingers_crossed', + ], + sortOrder: 185, + ), + 'love_you_gesture': StreamEmojiData( + name: 'i love you hand sign', + emoji: '🤟', + shortName: 'love_you_gesture', + shortNames: ['love_you_gesture', 'i_love_you_hand_sign'], + sortOrder: 187, + ), + 'metal': StreamEmojiData( + name: 'sign of the horns', + emoji: '🤘', + shortName: 'metal', + shortNames: ['metal', 'the_horns', 'sign_of_the_horns'], + sortOrder: 188, + ), + 'call_me_hand': StreamEmojiData( + name: 'call me hand', + emoji: '🤙', + shortName: 'call_me_hand', + shortNames: ['call_me_hand'], + sortOrder: 189, + ), + + // People & Body — hand-single-finger + 'point_left': StreamEmojiData( + name: 'white left pointing backhand index', + emoji: '👈', + shortName: 'point_left', + shortNames: ['point_left'], + sortOrder: 190, + ), + 'point_right': StreamEmojiData( + name: 'white right pointing backhand index', + emoji: '👉', + shortName: 'point_right', + shortNames: ['point_right'], + sortOrder: 191, + ), + 'point_up_2': StreamEmojiData( + name: 'white up pointing backhand index', + emoji: '👆', + shortName: 'point_up_2', + shortNames: ['point_up_2'], + sortOrder: 192, + ), + 'point_down': StreamEmojiData( + name: 'white down pointing backhand index', + emoji: '👇', + shortName: 'point_down', + shortNames: ['point_down'], + sortOrder: 194, + ), + 'point_up': StreamEmojiData( + name: 'white up pointing index', + emoji: '\u261D\uFE0F', + shortName: 'point_up', + shortNames: ['point_up'], + sortOrder: 195, + ), + + // People & Body — hand-fingers-closed + 'like': StreamEmojiData( + name: 'thumbs up sign', + emoji: '👍', + shortName: 'like', + shortNames: ['like', '+1', 'thumbsup'], + sortOrder: 197, + ), + 'sad': StreamEmojiData( + name: 'thumbs down sign', + emoji: '👎', + shortName: 'sad', + shortNames: ['sad', '-1', 'thumbsdown'], + sortOrder: 198, + ), + + // People & Body — hands + 'heart_hands': StreamEmojiData( + name: 'heart hands', + emoji: '🫶', + shortName: 'heart_hands', + shortNames: ['heart_hands'], + sortOrder: 205, + ), + 'handshake': StreamEmojiData( + name: 'handshake', + emoji: '🤝', + shortName: 'handshake', + shortNames: ['handshake'], + sortOrder: 208, + ), + 'pray': StreamEmojiData( + name: 'person with folded hands', + emoji: '🙏', + shortName: 'pray', + shortNames: ['pray'], + sortOrder: 209, + ), + + // People & Body — body-parts + 'muscle': StreamEmojiData( + name: 'flexed biceps', + emoji: '💪', + shortName: 'muscle', + shortNames: ['muscle'], + sortOrder: 213, + ), + 'brain': StreamEmojiData( + name: 'brain', + emoji: '🧠', + shortName: 'brain', + shortNames: ['brain'], + sortOrder: 221, + ), + 'eyes': StreamEmojiData( + name: 'eyes', + emoji: '👀', + shortName: 'eyes', + shortNames: ['eyes'], + sortOrder: 226, + ), + 'footprints': StreamEmojiData( + name: 'footprints', + emoji: '👣', + shortName: 'footprints', + shortNames: ['footprints'], + sortOrder: 554, + ), + + // Activities — event + 'jack_o_lantern': StreamEmojiData( + name: 'jack-o-lantern', + emoji: '🎃', + shortName: 'jack_o_lantern', + shortNames: ['jack_o_lantern'], + sortOrder: 1069, + ), +}; diff --git a/packages/stream_core_flutter/lib/src/components/emoji/stream_emoji_picker_sheet.dart b/packages/stream_core_flutter/lib/src/components/emoji/stream_emoji_picker_sheet.dart new file mode 100644 index 0000000..cbd21bd --- /dev/null +++ b/packages/stream_core_flutter/lib/src/components/emoji/stream_emoji_picker_sheet.dart @@ -0,0 +1,134 @@ +import 'package:flutter/material.dart'; + +import '../../components.dart'; + +import '../../theme/components/stream_emoji_button_theme.dart'; +import '../../theme/stream_theme_extensions.dart'; + +const _kGridCrossAxisCount = 7; + +/// A scrollable sheet that displays a curated set of emojis in a flat grid. +/// +/// The recommended way to display the picker is via the [show] method, +/// which presents it as a modal bottom sheet and returns the selected emoji. +/// +/// The emoji buttons are styled using [StreamEmojiButtonTheme]. +/// +/// {@tool snippet} +/// +/// ```dart +/// final emoji = await StreamEmojiPickerSheet.show( +/// context: context, +/// ); +/// if (emoji != null) { +/// sendReaction(emoji); +/// } +/// ``` +/// {@end-tool} +/// +/// See also: +/// +/// * [StreamEmojiButton], which displays individual emoji options. +/// * [StreamEmojiButtonSize], which defines button size variants. +/// * [StreamEmojiData], the data model for each emoji entry. +/// * [streamSupportedEmojis], the default set of emojis shown. +class StreamEmojiPickerSheet extends StatelessWidget { + /// Creates an emoji picker sheet. + const StreamEmojiPickerSheet._({ + required this.scrollController, + required this.emojis, + this.emojiButtonSize, + this.selectedReactions, + }); + + /// The size of each emoji button in the grid. + /// + /// Defaults to [StreamEmojiButtonSize.xl]. + final StreamEmojiButtonSize? emojiButtonSize; + + /// The set of emoji short names that are currently selected. + /// + /// When non-null, emojis whose [StreamEmojiData.shortName] is contained in + /// this set are rendered in the selected state. + final Set? selectedReactions; + + /// The scroll controller for the emoji grid. + final ScrollController scrollController; + + /// The emojis to display in the grid. + final Iterable emojis; + + /// Shows the emoji picker as a modal bottom sheet. + /// + /// Returns the selected [StreamEmojiData], or `null` if dismissed. + static Future show({ + required BuildContext context, + Iterable? emojis, + StreamEmojiButtonSize? emojiButtonSize, + Set? selectedReactions, + Color? backgroundColor, + }) { + final radius = context.streamRadius; + final colorScheme = context.streamColorScheme; + + final effectiveEmojis = emojis ?? streamSupportedEmojis.values; + final effectiveBackgroundColor = backgroundColor ?? colorScheme.backgroundElevation2; + + return showModalBottomSheet( + context: context, + useSafeArea: true, + isScrollControlled: true, + showDragHandle: true, + backgroundColor: effectiveBackgroundColor, + shape: RoundedRectangleBorder( + borderRadius: BorderRadiusDirectional.only(topStart: radius.xl, topEnd: radius.xl), + ), + builder: (context) => DraggableScrollableSheet( + snap: true, + expand: false, + minChildSize: 0.5, + snapSizes: const [0.5, 1], + builder: (_, scrollController) => StreamEmojiPickerSheet._( + scrollController: scrollController, + emojis: effectiveEmojis, + emojiButtonSize: emojiButtonSize, + selectedReactions: selectedReactions, + ), + ), + ); + } + + @override + Widget build(BuildContext context) { + final spacing = context.streamSpacing; + + final effectiveButtonSize = emojiButtonSize ?? StreamEmojiButtonSize.xl; + + return CustomScrollView( + controller: scrollController, + slivers: [ + SliverPadding( + padding: EdgeInsets.symmetric(horizontal: spacing.md), + sliver: SliverGrid.builder( + gridDelegate: SliverGridDelegateWithFixedCrossAxisCount( + crossAxisCount: _kGridCrossAxisCount, + mainAxisSpacing: spacing.xxxs, + crossAxisSpacing: spacing.xxxs, + mainAxisExtent: effectiveButtonSize.value, + ), + itemCount: emojis.length, + itemBuilder: (context, index) { + final emoji = emojis.elementAt(index); + return StreamEmojiButton( + size: effectiveButtonSize, + emoji: Text(emoji.emoji), + isSelected: selectedReactions?.contains(emoji.shortName), + onPressed: () => Navigator.of(context).pop(emoji), + ); + }, + ), + ), + ], + ); + } +} diff --git a/packages/stream_core_flutter/lib/src/components/list/stream_list_tile.dart b/packages/stream_core_flutter/lib/src/components/list/stream_list_tile.dart new file mode 100644 index 0000000..3751404 --- /dev/null +++ b/packages/stream_core_flutter/lib/src/components/list/stream_list_tile.dart @@ -0,0 +1,445 @@ +import 'package:flutter/material.dart'; + +import '../../factory/stream_component_factory.dart'; +import '../../theme/components/stream_list_tile_theme.dart'; +import '../../theme/primitives/stream_colors.dart'; +import '../../theme/primitives/stream_radius.dart'; +import '../../theme/primitives/stream_spacing.dart'; +import '../../theme/semantics/stream_color_scheme.dart'; +import '../../theme/semantics/stream_text_theme.dart'; +import '../../theme/stream_theme_extensions.dart'; + +/// A single fixed-height row inspired by Flutter's [ListTile], adapted for the +/// Stream design system. +/// +/// [StreamListTile] displays an optional [leading] widget, a [title], an +/// optional [subtitle] below the title, an optional right-side [description], +/// and an optional [trailing] widget. All slots accept arbitrary widgets — +/// the [leading] is typically a [StreamAvatar] but can be any widget. +/// +/// The tile responds to taps and long-presses via [onTap] and [onLongPress], +/// and supports [enabled] and [selected] states. +/// +/// ## Theming +/// +/// Visual properties are resolved from [StreamListTileTheme], with sensible +/// defaults derived from [StreamColorScheme] and [StreamTextTheme]. +/// +/// ## Material requirement +/// +/// Like Flutter's [ListTile], [StreamListTile] requires a [Material] widget +/// somewhere in its ancestor tree for ink effects to render. A [Scaffold] +/// satisfies this automatically in full-page layouts. When using the tile in +/// isolation (e.g. inside a card or a custom container), wrap it with a +/// [Material]: +/// +/// ```dart +/// Material( +/// type: MaterialType.transparency, +/// child: StreamListTile(...), +/// ) +/// ``` +/// +/// {@tool snippet} +/// +/// A simple list tile with an avatar and a chevron: +/// +/// ```dart +/// StreamListTile( +/// leading: StreamAvatar(name: 'Alice'), +/// title: Text('Alice'), +/// subtitle: Text('Online'), +/// trailing: Icon(Icons.chevron_right), +/// onTap: () => Navigator.push(context, ...), +/// ) +/// ``` +/// {@end-tool} +/// +/// {@tool snippet} +/// +/// A selected tile with a description: +/// +/// ```dart +/// StreamListTile( +/// leading: StreamAvatar(name: 'Bob'), +/// title: Text('Bob'), +/// description: Text('2 min ago'), +/// selected: true, +/// onTap: () {}, +/// ) +/// ``` +/// {@end-tool} +/// +/// See also: +/// +/// * [StreamListTileTheme], for customizing tile appearance globally. +/// * [DefaultStreamListTile], the default visual implementation. +class StreamListTile extends StatelessWidget { + /// Creates a list tile. + StreamListTile({ + super.key, + Widget? leading, + Widget? title, + Widget? subtitle, + Widget? description, + Widget? trailing, + VoidCallback? onTap, + VoidCallback? onLongPress, + bool enabled = true, + bool selected = false, + }) : props = .new( + leading: leading, + title: title, + subtitle: subtitle, + description: description, + trailing: trailing, + onTap: onTap, + onLongPress: onLongPress, + enabled: enabled, + selected: selected, + ); + + /// The props controlling the appearance and behavior of this tile. + final StreamListTileProps props; + + @override + Widget build(BuildContext context) { + final builder = StreamComponentFactory.of(context).listTile; + if (builder != null) return builder(context, props); + return DefaultStreamListTile(props: props); + } +} + +/// Properties for configuring a [StreamListTile]. +/// +/// This class holds all the configuration options for a list tile, allowing +/// them to be passed through the [StreamComponentFactory]. +/// +/// See also: +/// +/// * [StreamListTile], which uses these properties. +/// * [DefaultStreamListTile], the default implementation. +class StreamListTileProps { + /// Creates properties for a list tile. + const StreamListTileProps({ + this.leading, + this.title, + this.subtitle, + this.description, + this.trailing, + this.onTap, + this.onLongPress, + this.enabled = true, + this.selected = false, + }); + + /// A widget displayed before the title. + /// + /// Typically a [StreamAvatar], [CircleAvatar], or [Icon]. + final Widget? leading; + + /// The primary content of the list tile. + /// + /// Typically a [Text] widget. + final Widget? title; + + /// Additional content displayed below the title. + /// + /// Typically a [Text] widget. Should not wrap — use [Text.maxLines] to + /// enforce a single line. + final Widget? subtitle; + + /// A widget displayed on the right side of the tile, between the title + /// column and [trailing]. + /// + /// Typically a [Text] widget showing secondary metadata such as a timestamp + /// or status. Uses [StreamColorScheme.textTertiary] by default. + final Widget? description; + + /// A widget displayed at the end of the tile. + /// + /// Typically an [Icon] (e.g. a chevron) or a control widget. + final Widget? trailing; + + /// Called when the user taps this tile. + /// + /// Inoperative if [enabled] is false. + final VoidCallback? onTap; + + /// Called when the user long-presses this tile. + /// + /// Inoperative if [enabled] is false. + final VoidCallback? onLongPress; + + /// Whether this tile is interactive. + /// + /// When false, the tile is styled with the disabled color and [onTap] / + /// [onLongPress] are inoperative, mirroring [ListTile.enabled]. + final bool enabled; + + /// Whether this tile is in a selected state. + /// + /// When true, the tile applies selected-state styling via + /// [StreamListTileThemeData] (background color, text colors, and icon + /// colors). This is independent of tap handling. + final bool selected; +} + +/// The default implementation of [StreamListTile]. +/// +/// Renders the tile with theming support from [StreamListTileTheme]. +/// It is used as the default factory implementation in [StreamComponentFactory]. +/// +/// See also: +/// +/// * [StreamListTile], the public API widget. +/// * [StreamListTileProps], which configures this widget. +class DefaultStreamListTile extends StatelessWidget { + /// Creates a default list tile. + const DefaultStreamListTile({super.key, required this.props}); + + /// The props controlling the appearance and behavior of this tile. + final StreamListTileProps props; + + @override + Widget build(BuildContext context) { + assert(debugCheckHasMaterial(context)); + + final spacing = context.streamSpacing; + final theme = context.streamListTileTheme; + final defaults = _StreamListTileThemeDefaults(context); + + // Build the WidgetState set once and share it across all color resolvers. + final states = { + if (!props.enabled) WidgetState.disabled, + if (props.selected) WidgetState.selected, + }; + + final effectiveTitleColor = (theme.titleColor ?? defaults.titleColor).resolve(states)!; + final effectiveSubtitleColor = (theme.subtitleColor ?? defaults.subtitleColor).resolve(states)!; + final effectiveDescriptionColor = (theme.descriptionColor ?? defaults.descriptionColor).resolve(states)!; + final effectiveIconColor = (theme.iconColor ?? defaults.iconColor).resolve(states)!; + + final effectiveTitleTextStyle = theme.titleTextStyle ?? defaults.titleTextStyle; + final effectiveSubtitleTextStyle = theme.subtitleTextStyle ?? defaults.subtitleTextStyle; + final effectiveDescriptionTextStyle = theme.descriptionTextStyle ?? defaults.descriptionTextStyle; + final effectiveMinTileHeight = theme.minTileHeight ?? defaults.minTileHeight; + + Widget? leadingWidget; + if (props.leading case final leading?) { + leadingWidget = AnimatedDefaultTextStyle( + style: TextStyle(color: effectiveIconColor), + duration: kThemeChangeDuration, + child: leading, + ); + } + + Widget? titleWidget; + if (props.title case final title?) { + titleWidget = AnimatedDefaultTextStyle( + style: effectiveTitleTextStyle.copyWith(color: effectiveTitleColor), + duration: kThemeChangeDuration, + child: title, + ); + } + + Widget? subtitleWidget; + if (props.subtitle case final subtitle?) { + subtitleWidget = AnimatedDefaultTextStyle( + style: effectiveSubtitleTextStyle.copyWith(color: effectiveSubtitleColor), + duration: kThemeChangeDuration, + child: subtitle, + ); + } + + Widget? descriptionWidget; + if (props.description case final description?) { + descriptionWidget = AnimatedDefaultTextStyle( + style: effectiveDescriptionTextStyle.copyWith(color: effectiveDescriptionColor), + duration: kThemeChangeDuration, + child: description, + ); + } + + Widget? trailingWidget; + if (props.trailing case final trailing?) { + trailingWidget = AnimatedDefaultTextStyle( + style: TextStyle(color: effectiveIconColor), + duration: kThemeChangeDuration, + child: trailing, + ); + } + + return StreamListTileContainer( + enabled: props.enabled, + selected: props.selected, + onTap: props.onTap, + onLongPress: props.onLongPress, + child: IconTheme.merge( + data: IconThemeData(color: effectiveIconColor), + child: ConstrainedBox( + constraints: BoxConstraints(minHeight: effectiveMinTileHeight), + child: Row( + spacing: spacing.xs, + children: [ + ?leadingWidget, + Expanded( + child: Column( + mainAxisSize: .min, + crossAxisAlignment: .start, + children: [?titleWidget, ?subtitleWidget], + ), + ), + ?descriptionWidget, + ?trailingWidget, + ], + ), + ), + ), + ); + } +} + +// Default theme values for [StreamListTile]. +// +// These defaults are used when no explicit value is provided via +// [StreamListTileThemeData]. The defaults are context-aware and use values +// from [StreamColorScheme], [StreamTextTheme], [StreamSpacing], and +// [StreamRadius]. +class _StreamListTileThemeDefaults extends StreamListTileThemeData { + _StreamListTileThemeDefaults(this._context); + + final BuildContext _context; + + late final StreamColorScheme _colorScheme = _context.streamColorScheme; + late final StreamTextTheme _textTheme = _context.streamTextTheme; + late final StreamSpacing _spacing = _context.streamSpacing; + late final StreamRadius _radius = _context.streamRadius; + + @override + double get minTileHeight => 40; + + @override + TextStyle get titleTextStyle => _textTheme.bodyDefault; + + @override + TextStyle get subtitleTextStyle => _textTheme.metadataDefault; + + @override + TextStyle get descriptionTextStyle => _textTheme.bodyDefault; + + @override + ShapeBorder get shape => RoundedRectangleBorder(borderRadius: .all(_radius.lg)); + + @override + EdgeInsetsGeometry get contentPadding => .symmetric(horizontal: _spacing.sm, vertical: _spacing.xs); + + @override + WidgetStateProperty get titleColor => .resolveWith((states) { + if (states.contains(WidgetState.disabled)) return _colorScheme.textDisabled; + return _colorScheme.textPrimary; + }); + + @override + WidgetStateProperty get subtitleColor => .resolveWith((states) { + if (states.contains(WidgetState.disabled)) return _colorScheme.textDisabled; + return _colorScheme.textTertiary; + }); + + @override + WidgetStateProperty get descriptionColor => .resolveWith((states) { + if (states.contains(WidgetState.disabled)) return _colorScheme.textDisabled; + return _colorScheme.textTertiary; + }); + + @override + WidgetStateProperty get iconColor => .resolveWith((states) { + if (states.contains(WidgetState.disabled)) return _colorScheme.textDisabled; + return _colorScheme.textSecondary; + }); + + @override + WidgetStateProperty get backgroundColor => .resolveWith((states) { + const base = StreamColors.transparent; + if (states.contains(WidgetState.selected)) return .alphaBlend(_colorScheme.stateSelected, base); + return base; + }); + + @override + WidgetStateProperty get overlayColor => .resolveWith((states) { + if (states.contains(WidgetState.pressed)) return _colorScheme.statePressed; + if (states.contains(WidgetState.hovered)) return _colorScheme.stateHover; + return StreamColors.transparent; + }); +} + +class StreamListTileContainer extends StatelessWidget { + const StreamListTileContainer({ + super.key, + required this.child, + required this.enabled, + required this.selected, + required this.onTap, + required this.onLongPress, + }); + + final Widget child; + + final bool enabled; + final bool selected; + final VoidCallback? onTap; + final VoidCallback? onLongPress; + + @override + Widget build(BuildContext context) { + final theme = context.streamListTileTheme; + final defaults = _StreamListTileThemeDefaults(context); + + // Build the WidgetState set once and share it across all color resolvers. + final states = { + if (!enabled) WidgetState.disabled, + if (selected) WidgetState.selected, + }; + + final textDirection = Directionality.of(context); + + final effectiveBackgroundColor = (theme.backgroundColor ?? defaults.backgroundColor).resolve(states); + final effectiveShape = theme.shape ?? defaults.shape; + final effectiveContentPadding = (theme.contentPadding ?? defaults.contentPadding).resolve(textDirection); + final effectiveOverlayColor = theme.overlayColor ?? defaults.overlayColor; + + // Mouse cursor: show a non-interactive cursor when the tile is disabled + // OR when no gesture callbacks are wired. + final mouseStates = { + if (!enabled || (onTap == null && onLongPress == null)) WidgetState.disabled, + }; + + final effectiveMouseCursor = WidgetStateMouseCursor.clickable.resolve(mouseStates); + + return InkWell( + customBorder: effectiveShape, + onTap: enabled ? onTap : null, + onLongPress: enabled ? onLongPress : null, + canRequestFocus: enabled, + mouseCursor: effectiveMouseCursor, + overlayColor: effectiveOverlayColor, + child: Semantics( + button: onTap != null || onLongPress != null, + selected: selected, + enabled: enabled, + child: Ink( + decoration: ShapeDecoration( + shape: effectiveShape, + color: effectiveBackgroundColor, + ), + child: SafeArea( + top: false, + bottom: false, + minimum: effectiveContentPadding, + child: child, + ), + ), + ), + ); + } +} diff --git a/packages/stream_core_flutter/lib/src/components/message_composer.dart b/packages/stream_core_flutter/lib/src/components/message_composer.dart new file mode 100644 index 0000000..9a681bc --- /dev/null +++ b/packages/stream_core_flutter/lib/src/components/message_composer.dart @@ -0,0 +1,8 @@ +export 'message_composer/attachment/message_composer_attachment_container.dart'; +export 'message_composer/attachment/message_composer_file_attachment.dart'; +export 'message_composer/attachment/message_composer_link_preview_attachment.dart'; +export 'message_composer/attachment/message_composer_media_file_attachment.dart'; +export 'message_composer/attachment/message_composer_reply_attachment.dart'; +export 'message_composer/message_composer.dart'; +export 'message_composer/message_composer_input.dart'; +export 'message_composer/message_composer_input_trailing.dart'; diff --git a/packages/stream_core_flutter/lib/src/components/message_composer/attachment/message_composer_attachment_container.dart b/packages/stream_core_flutter/lib/src/components/message_composer/attachment/message_composer_attachment_container.dart new file mode 100644 index 0000000..570bcbd --- /dev/null +++ b/packages/stream_core_flutter/lib/src/components/message_composer/attachment/message_composer_attachment_container.dart @@ -0,0 +1,50 @@ +import 'package:flutter/widgets.dart'; + +import '../../../../stream_core_flutter.dart'; + +class StreamMessageComposerAttachmentContainer extends StatelessWidget { + const StreamMessageComposerAttachmentContainer({ + super.key, + required this.child, + this.onRemovePressed, + this.backgroundColor, + this.borderColor, + this.padding, + }); + + final Widget child; + final VoidCallback? onRemovePressed; + final Color? backgroundColor; + final Color? borderColor; + final EdgeInsets? padding; + + @override + Widget build(BuildContext context) { + final spacing = context.streamSpacing; + + return Stack( + children: [ + Container( + margin: EdgeInsets.all(spacing.xxs), + padding: padding ?? EdgeInsets.all(spacing.xs), + foregroundDecoration: borderColor != null + ? BoxDecoration( + borderRadius: BorderRadius.all(context.streamRadius.lg), + border: Border.all(color: borderColor!), + ) + : null, + decoration: BoxDecoration( + color: backgroundColor, + borderRadius: BorderRadius.all(context.streamRadius.lg), + ), + child: child, + ), + if (onRemovePressed case final VoidCallback onRemovePressed?) + Align( + alignment: Alignment.topRight, + child: StreamRemoveControl(onPressed: onRemovePressed), + ), + ], + ); + } +} diff --git a/packages/stream_core_flutter/lib/src/components/message_composer/attachment/message_composer_file_attachment.dart b/packages/stream_core_flutter/lib/src/components/message_composer/attachment/message_composer_file_attachment.dart new file mode 100644 index 0000000..e3798b5 --- /dev/null +++ b/packages/stream_core_flutter/lib/src/components/message_composer/attachment/message_composer_file_attachment.dart @@ -0,0 +1,53 @@ +import 'package:flutter/widgets.dart'; + +import '../../../../stream_core_flutter.dart'; + +class MessageComposerFileAttachment extends StatelessWidget { + const MessageComposerFileAttachment({ + super.key, + this.title, + this.fileTypeIcon, + this.subtitle, + this.onRemovePressed, + }); + + final StreamFileTypeIcon? fileTypeIcon; + final String? title; + final Widget? subtitle; + final VoidCallback? onRemovePressed; + + @override + Widget build(BuildContext context) { + final textColor = context.streamColorScheme.textPrimary; + final titleStyle = context.streamTextTheme.captionEmphasis.copyWith(color: textColor); + final spacing = context.streamSpacing; + + return StreamMessageComposerAttachmentContainer( + padding: EdgeInsets.fromLTRB(spacing.md, spacing.md, spacing.sm, spacing.md), + onRemovePressed: onRemovePressed, + borderColor: context.streamColorScheme.borderDefault, + child: Row( + children: [ + ?fileTypeIcon, + SizedBox(width: spacing.xs), + Expanded( + child: Column( + mainAxisSize: MainAxisSize.min, + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + if (title case final title?) + Text( + title, + style: titleStyle, + maxLines: 1, + overflow: TextOverflow.ellipsis, + ), + ?subtitle, + ], + ), + ), + ], + ), + ); + } +} diff --git a/packages/stream_core_flutter/lib/src/components/message_composer/attachment/message_composer_link_preview_attachment.dart b/packages/stream_core_flutter/lib/src/components/message_composer/attachment/message_composer_link_preview_attachment.dart new file mode 100644 index 0000000..13eac27 --- /dev/null +++ b/packages/stream_core_flutter/lib/src/components/message_composer/attachment/message_composer_link_preview_attachment.dart @@ -0,0 +1,89 @@ +import 'package:flutter/widgets.dart'; + +import '../../../../stream_core_flutter.dart'; + +class MessageComposerLinkPreviewAttachment extends StatelessWidget { + const MessageComposerLinkPreviewAttachment({ + super.key, + this.title, + this.subtitle, + this.url, + this.image, + this.onRemovePressed, + }); + + final String? title; + final String? subtitle; + final String? url; + final ImageProvider? image; + final VoidCallback? onRemovePressed; + + @override + Widget build(BuildContext context) { + final messageTheme = context.streamMessageTheme.mergeWithDefaults(context); + final backgroundColor = messageTheme.outgoing?.backgroundColor; + final textColor = messageTheme.outgoing?.textColor; + + final titleStyle = context.streamTextTheme.metadataEmphasis.copyWith(color: textColor); + final bodyStyle = context.streamTextTheme.metadataDefault.copyWith(color: textColor); + + final spacing = context.streamSpacing; + return StreamMessageComposerAttachmentContainer( + onRemovePressed: onRemovePressed, + backgroundColor: backgroundColor, + child: Row( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + if (image != null) ...[ + Container( + width: 40, + height: 40, + decoration: BoxDecoration( + borderRadius: BorderRadius.all(context.streamRadius.md), + image: DecorationImage(image: image!, fit: BoxFit.cover), + ), + ), + SizedBox(width: spacing.xs), + ], + Expanded( + child: Column( + mainAxisSize: MainAxisSize.min, + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + if (title case final title?) + Text( + title, + style: titleStyle, + maxLines: 1, + overflow: TextOverflow.ellipsis, + ), + if (subtitle case final subtitle?) + Text( + subtitle, + style: bodyStyle, + maxLines: 1, + overflow: TextOverflow.ellipsis, + ), + if (url case final url?) + Row( + children: [ + Icon(context.streamIcons.chainLink3, size: 12), + SizedBox(width: spacing.xxs), + Expanded( + child: Text( + url, + style: bodyStyle, + maxLines: 1, + overflow: TextOverflow.ellipsis, + ), + ), + ], + ), + ], + ), + ), + ], + ), + ); + } +} diff --git a/packages/stream_core_flutter/lib/src/components/message_composer/attachment/message_composer_media_file_attachment.dart b/packages/stream_core_flutter/lib/src/components/message_composer/attachment/message_composer_media_file_attachment.dart new file mode 100644 index 0000000..8ea5756 --- /dev/null +++ b/packages/stream_core_flutter/lib/src/components/message_composer/attachment/message_composer_media_file_attachment.dart @@ -0,0 +1,71 @@ +import 'package:flutter/widgets.dart'; + +import '../../../../stream_core_flutter.dart'; + +class MessageComposerMediaFileAttachment extends StatelessWidget { + const MessageComposerMediaFileAttachment({ + super.key, + required this.child, + this.onRemovePressed, + this.mediaBadge, + }); + + MessageComposerMediaFileAttachment.image({ + super.key, + required ImageProvider image, + required this.onRemovePressed, + ImageFrameBuilder? frameBuilder, + ImageErrorWidgetBuilder? errorBuilder, + this.mediaBadge, + }) : child = Image( + image: image, + frameBuilder: frameBuilder, + errorBuilder: errorBuilder, + fit: BoxFit.cover, + ); + + final Widget child; + final Widget? mediaBadge; + final VoidCallback? onRemovePressed; + + @override + Widget build(BuildContext context) { + return SizedBox( + height: 80, + width: 80, + child: Stack( + children: [ + Padding( + padding: EdgeInsets.all(context.streamSpacing.xxs), + child: Container( + clipBehavior: Clip.antiAlias, + foregroundDecoration: BoxDecoration( + borderRadius: BorderRadius.all(context.streamRadius.lg), + border: Border.all( + color: context.streamColorScheme.borderDefault.withAlpha(25), + ), + ), + decoration: BoxDecoration( + borderRadius: BorderRadius.all(context.streamRadius.lg), + ), + child: child, + ), + ), + if (onRemovePressed case final VoidCallback onRemovePressed?) + Align( + alignment: Alignment.topRight, + child: StreamRemoveControl(onPressed: onRemovePressed), + ), + if (mediaBadge case final Widget mediaBadge?) + Align( + alignment: Alignment.bottomLeft, + child: Padding( + padding: EdgeInsets.all(context.streamSpacing.xs), + child: mediaBadge, + ), + ), + ], + ), + ); + } +} diff --git a/packages/stream_core_flutter/lib/src/components/message_composer/attachment/message_composer_reply_attachment.dart b/packages/stream_core_flutter/lib/src/components/message_composer/attachment/message_composer_reply_attachment.dart new file mode 100644 index 0000000..a6d7a31 --- /dev/null +++ b/packages/stream_core_flutter/lib/src/components/message_composer/attachment/message_composer_reply_attachment.dart @@ -0,0 +1,95 @@ +import 'package:flutter/material.dart'; +import 'package:flutter/widgets.dart'; + +import '../../../../stream_core_flutter.dart'; + +class MessageComposerReplyAttachment extends StatelessWidget { + const MessageComposerReplyAttachment({ + super.key, + required this.title, + required this.subtitle, + this.image, + this.onRemovePressed, + this.style = ReplyStyle.incoming, + }); + + final String title; + final String subtitle; + final ImageProvider? image; + final VoidCallback? onRemovePressed; + final ReplyStyle style; + + @override + Widget build(BuildContext context) { + final messageTheme = context.streamMessageTheme.mergeWithDefaults(context); + final messageStyle = switch (style) { + ReplyStyle.incoming => messageTheme.incoming, + ReplyStyle.outgoing => messageTheme.outgoing, + }; + + final indicatorColor = messageStyle?.replyIndicatorColor; + final backgroundColor = messageStyle?.backgroundColor; + final textColor = messageStyle?.textColor; + + final spacing = context.streamSpacing; + return StreamMessageComposerAttachmentContainer( + onRemovePressed: onRemovePressed, + backgroundColor: backgroundColor, + child: IntrinsicHeight( + child: Row( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + Container( + margin: const EdgeInsets.only(top: 2, bottom: 2), + color: indicatorColor, + child: const SizedBox( + width: 2, + height: double.infinity, + ), + ), + SizedBox(width: spacing.xs), + Expanded( + child: Column( + mainAxisSize: MainAxisSize.min, + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + Text(title, style: context.streamTextTheme.metadataEmphasis.copyWith(color: textColor)), + Row( + children: [ + if (image != null) ...[ + Icon(context.streamIcons.camera1, size: 12), + SizedBox(width: spacing.xxs), + ], + Expanded( + child: Text( + subtitle, + style: context.streamTextTheme.metadataDefault.copyWith(color: textColor), + ), + ), + ], + ), + ], + ), + ), + if (image != null) ...[ + SizedBox(width: spacing.xs), + Container( + width: 40, + height: 40, + decoration: BoxDecoration( + borderRadius: BorderRadius.all(context.streamRadius.md), + image: DecorationImage(image: image!, fit: BoxFit.cover), + ), + ), + ], + ], + ), + ), + ); + } +} + +enum ReplyStyle { + incoming, + outgoing, +} diff --git a/packages/stream_core_flutter/lib/src/components/message_composer/message_composer.dart b/packages/stream_core_flutter/lib/src/components/message_composer/message_composer.dart new file mode 100644 index 0000000..1d20794 --- /dev/null +++ b/packages/stream_core_flutter/lib/src/components/message_composer/message_composer.dart @@ -0,0 +1,125 @@ +import 'package:flutter/material.dart'; +import 'package:flutter/widgets.dart'; + +import '../../../stream_core_flutter.dart'; + +class StreamCoreMessageComposer extends StatefulWidget { + const StreamCoreMessageComposer({ + super.key, + required this.controller, + required this.isFloating, + this.placeholder = '', + this.focusNode, + this.composerLeading, + this.composerTrailing, + this.inputLeading, + this.inputTrailing, + this.inputBody, + this.inputHeader, + }); + + final TextEditingController? controller; + final bool isFloating; + final String placeholder; + final FocusNode? focusNode; + + final Widget? composerLeading; + final Widget? composerTrailing; + final Widget? inputLeading; + final Widget? inputTrailing; + final Widget? inputBody; + final Widget? inputHeader; + + @override + State createState() => _StreamCoreMessageComposerState(); +} + +class _StreamCoreMessageComposerState extends State { + late TextEditingController _controller; + + @override + void initState() { + super.initState(); + _initController(); + } + + @override + void didUpdateWidget(StreamCoreMessageComposer oldWidget) { + super.didUpdateWidget(oldWidget); + if (widget.controller != oldWidget.controller) { + _disposeController(oldWidget); + _initController(); + } + } + + @override + void dispose() { + _disposeController(widget); + super.dispose(); + } + + void _initController() { + _controller = widget.controller ?? TextEditingController(); + } + + void _disposeController(StreamCoreMessageComposer widget) { + if (widget.controller == null) { + _controller.dispose(); + } + } + + @override + Widget build(BuildContext context) { + final spacing = context.streamSpacing; + + return Container( + padding: EdgeInsets.only(top: spacing.md), + decoration: widget.isFloating + ? null + : BoxDecoration( + color: context.streamColorScheme.backgroundElevation1, + border: Border( + top: BorderSide(color: context.streamColorScheme.borderDefault), + ), + ), + child: Row( + crossAxisAlignment: CrossAxisAlignment.end, + children: [ + SizedBox(width: spacing.md), + ?widget.composerLeading, + Expanded( + child: StreamMessageComposerInput( + controller: _controller, + placeholder: widget.placeholder, + isFloating: widget.isFloating, + inputLeading: widget.inputLeading, + inputTrailing: widget.inputTrailing, + inputBody: widget.inputBody, + inputHeader: widget.inputHeader, + focusNode: widget.focusNode, + ), + ), + ?widget.composerTrailing, + SizedBox(width: spacing.md), + ], + ), + ); + } +} + +class MessageData {} + +class InputThemeDefaults { + InputThemeDefaults({required this.context}) : _colorScheme = context.streamColorScheme; + + final BuildContext context; + final StreamColorScheme _colorScheme; + + StreamInputThemeData get data => StreamInputThemeData( + textColor: _colorScheme.textPrimary, + placeholderColor: _colorScheme.textTertiary, + disabledColor: _colorScheme.textDisabled, + iconColor: _colorScheme.textTertiary, + borderColor: _colorScheme.borderDefault, + ); +} diff --git a/packages/stream_core_flutter/lib/src/components/message_composer/message_composer_input.dart b/packages/stream_core_flutter/lib/src/components/message_composer/message_composer_input.dart new file mode 100644 index 0000000..989f9c6 --- /dev/null +++ b/packages/stream_core_flutter/lib/src/components/message_composer/message_composer_input.dart @@ -0,0 +1,117 @@ +import 'package:flutter/material.dart'; + +import '../../../stream_core_flutter.dart'; + +class StreamMessageComposerInput extends StatelessWidget { + const StreamMessageComposerInput({ + super.key, + required this.controller, + this.placeholder = '', + this.isFloating = false, + this.inputLeading, + this.inputTrailing, + this.inputBody, + this.inputHeader, + this.focusNode, + }); + + final TextEditingController controller; + final String placeholder; + final bool isFloating; + final Widget? inputLeading; + final Widget? inputTrailing; + final Widget? inputBody; + final Widget? inputHeader; + final FocusNode? focusNode; + + @override + Widget build(BuildContext context) { + return Container( + clipBehavior: Clip.antiAlias, + foregroundDecoration: BoxDecoration( + borderRadius: BorderRadius.all(context.streamRadius.xxxl), + border: Border.all( + color: context.streamColorScheme.borderDefault, + ), + ), + decoration: BoxDecoration( + color: context.streamColorScheme.backgroundElevation1, + borderRadius: BorderRadius.all(context.streamRadius.xxxl), + boxShadow: isFloating ? context.streamBoxShadow.elevation3 : null, + ), + child: Column( + mainAxisSize: MainAxisSize.min, + children: [ + ?inputHeader, + Row( + crossAxisAlignment: CrossAxisAlignment.end, + children: [ + ?inputLeading, + Expanded( + child: + inputBody ?? + _MessageComposerInputField( + controller: controller, + placeholder: placeholder, + focusNode: focusNode, + ), + ), + ?inputTrailing, + ], + ), + ], + ), + ); + } +} + +class _MessageComposerInputField extends StatelessWidget { + const _MessageComposerInputField({ + required this.controller, + required this.placeholder, + this.focusNode, + }); + + final TextEditingController controller; + final String placeholder; + final FocusNode? focusNode; + + @override + Widget build(BuildContext context) { + // TODO: fully implement the input field + + final composerBorderRadius = context.streamRadius.xxxl; + final inputTheme = context.streamInputTheme; + final inputDefaults = InputThemeDefaults(context: context).data; + + final border = OutlineInputBorder( + borderSide: BorderSide.none, + borderRadius: BorderRadius.all(composerBorderRadius), + ); + + return ConstrainedBox( + constraints: const BoxConstraints(maxHeight: 124), + child: TextField( + controller: controller, + focusNode: focusNode, + style: TextStyle( + color: inputTheme.textColor ?? inputDefaults.textColor, + ), + maxLines: null, + decoration: InputDecoration( + border: border, + focusedBorder: border, + enabledBorder: border, + errorBorder: border, + disabledBorder: border, + fillColor: Colors.transparent, + contentPadding: const EdgeInsets.fromLTRB(12, 8, 12, 8), + hintText: placeholder, + hintStyle: TextStyle( + color: inputTheme.placeholderColor ?? inputDefaults.placeholderColor, + ), + ), + ), + ); + } +} diff --git a/packages/stream_core_flutter/lib/src/components/message_composer/message_composer_input_trailing.dart b/packages/stream_core_flutter/lib/src/components/message_composer/message_composer_input_trailing.dart new file mode 100644 index 0000000..b026259 --- /dev/null +++ b/packages/stream_core_flutter/lib/src/components/message_composer/message_composer_input_trailing.dart @@ -0,0 +1,106 @@ +import 'package:flutter/material.dart'; +import 'package:flutter/widgets.dart'; + +import '../../../stream_core_flutter.dart'; + +enum StreamMessageComposerInputTrailingState { + send, + edit, + microphone, + voiceRecordingActive, +} + +class StreamCoreMessageComposerInputTrailing extends StatelessWidget { + const StreamCoreMessageComposerInputTrailing({ + super.key, + required this.controller, + required this.onSendPressed, + required this.voiceRecordingCallback, + this.buttonState = StreamMessageComposerInputTrailingState.send, + }); + + final TextEditingController controller; + final VoidCallback? onSendPressed; + final VoiceRecordingCallback? voiceRecordingCallback; + final StreamMessageComposerInputTrailingState buttonState; + + @override + Widget build(BuildContext context) { + if (buttonState == StreamMessageComposerInputTrailingState.send || + buttonState == StreamMessageComposerInputTrailingState.edit || + voiceRecordingCallback == null) { + return StreamButton.icon( + key: _messageComposerInputTrailingSendKey, + icon: buttonState == StreamMessageComposerInputTrailingState.edit + ? context.streamIcons.checkmark2Small + : context.streamIcons.paperPlane, + size: StreamButtonSize.small, + onTap: onSendPressed, + ); + } + return StreamVoiceRecordingButton( + voiceRecordingCallback: voiceRecordingCallback!, + isRecording: buttonState == StreamMessageComposerInputTrailingState.voiceRecordingActive, + ); + } +} + +class StreamVoiceRecordingButton extends StatelessWidget { + const StreamVoiceRecordingButton({ + super.key, + required this.voiceRecordingCallback, + required this.isRecording, + }); + + final VoiceRecordingCallback voiceRecordingCallback; + final bool isRecording; + + @override + Widget build(BuildContext context) { + return GestureDetector( + key: _messageComposerInputTrailingMicrophoneKey, + onLongPress: voiceRecordingCallback.onLongPressStart, + onLongPressCancel: voiceRecordingCallback.onLongPressCancel, + onLongPressEnd: voiceRecordingCallback.onLongPressEnd, + onLongPressMoveUpdate: voiceRecordingCallback.onLongPressMoveUpdate, + behavior: HitTestBehavior.translucent, + child: StreamButtonTheme( + data: StreamButtonThemeData( + secondary: StreamButtonTypeStyle( + ghost: StreamButtonThemeStyle( + backgroundColor: isRecording + ? WidgetStateProperty.all( + context.streamColorScheme.statePressed, + ) + : null, + ), + ), + ), + child: StreamButton.icon( + icon: context.streamIcons.microphone, + type: StreamButtonType.ghost, + style: StreamButtonStyle.secondary, + size: StreamButtonSize.small, + onTap: () {}, + ), + ), + ); + } +} + +class VoiceRecordingCallback { + VoiceRecordingCallback({ + required this.onLongPressStart, + required this.onLongPressCancel, + required this.onLongPressEnd, + this.onLongPressMoveUpdate, + }); + + final VoidCallback onLongPressStart; + final VoidCallback onLongPressCancel; + final GestureLongPressEndCallback onLongPressEnd; + final GestureLongPressMoveUpdateCallback? onLongPressMoveUpdate; +} + +final _messageComposerInputTrailingSendKey = UniqueKey(); +final _messageComposerInputTrailingMicrophoneKey = UniqueKey(); diff --git a/packages/stream_core_flutter/lib/src/components/reaction/stream_reactions.dart b/packages/stream_core_flutter/lib/src/components/reaction/stream_reactions.dart new file mode 100644 index 0000000..268c9a8 --- /dev/null +++ b/packages/stream_core_flutter/lib/src/components/reaction/stream_reactions.dart @@ -0,0 +1,380 @@ +import 'package:flutter/material.dart'; +import 'package:stream_core/stream_core.dart'; + +import '../../factory/stream_component_factory.dart'; +import '../../theme/components/stream_emoji_chip_theme.dart'; +import '../../theme/components/stream_reactions_theme.dart'; +import '../../theme/stream_theme_extensions.dart'; +import '../accessories/stream_emoji.dart'; +import '../common/stream_flex.dart'; +import '../controls/stream_emoji_chip.dart'; + +/// Displays reactions as either individual chips or a single grouped chip. +/// +/// Use [StreamReactions.segmented] to render each reaction type as its own +/// chip, and [StreamReactions.clustered] to group all reaction types into a +/// single chip. +/// +/// Reactions can be displayed on their own or positioned relative to a +/// [child], such as a message bubble or container. +/// +/// {@tool snippet} +/// +/// Display segmented reactions below a child: +/// +/// ```dart +/// StreamReactions.segmented( +/// items: [ +/// StreamReactionsItem(emoji: Text('👍'), count: 3), +/// StreamReactionsItem(emoji: Text('❤️'), count: 2), +/// ], +/// child: Container( +/// padding: EdgeInsets.all(12), +/// child: Text('Looks good to me'), +/// ), +/// ) +/// ``` +/// {@end-tool} +/// +/// {@tool snippet} +/// +/// Display clustered reactions above a child: +/// +/// ```dart +/// StreamReactions.clustered( +/// items: [ +/// StreamReactionsItem(emoji: Text('👍'), count: 4), +/// StreamReactionsItem(emoji: Text('😂'), count: 2), +/// StreamReactionsItem(emoji: Text('🔥')), +/// ], +/// position: StreamReactionsPosition.header, +/// child: Container( +/// padding: EdgeInsets.all(12), +/// child: Text('Let us ship this'), +/// ), +/// ) +/// ``` +/// {@end-tool} +/// +/// See also: +/// +/// * [StreamReactionsTheme], for customizing reaction layout. +/// * [StreamEmojiChipTheme], for customizing chip appearance. +class StreamReactions extends StatelessWidget { + /// Creates segmented reactions where each type is rendered as its own chip. + StreamReactions.segmented({ + super.key, + required List items, + Widget? child, + StreamReactionsPosition position = .footer, + StreamReactionsAlignment alignment = .start, + int? max, + bool overlap = true, + double? indent, + CrossAxisAlignment? crossAxisAlignment, + Clip clipBehavior = Clip.none, + VoidCallback? onPressed, + }) : props = .new( + items: items, + child: child, + type: .segmented, + position: position, + alignment: alignment, + max: max, + overlap: overlap, + indent: indent, + crossAxisAlignment: crossAxisAlignment, + clipBehavior: clipBehavior, + onPressed: onPressed, + ); + + /// Creates clustered reactions that group all reaction types into one chip. + StreamReactions.clustered({ + super.key, + required List items, + Widget? child, + StreamReactionsPosition position = .header, + StreamReactionsAlignment alignment = .end, + int? max, + bool overlap = true, + double? indent, + CrossAxisAlignment? crossAxisAlignment, + Clip clipBehavior = Clip.none, + VoidCallback? onPressed, + }) : props = .new( + items: items, + child: child, + type: .clustered, + position: position, + alignment: alignment, + max: max, + overlap: overlap, + indent: indent, + crossAxisAlignment: crossAxisAlignment, + clipBehavior: clipBehavior, + onPressed: onPressed, + ); + + /// The properties that configure this widget. + final StreamReactionsProps props; + + @override + Widget build(BuildContext context) { + final builder = StreamComponentFactory.of(context).reactions; + if (builder != null) return builder(context, props); + + final spacing = context.streamSpacing; + final textTheme = context.streamTextTheme; + + return StreamEmojiChipTheme( + data: StreamEmojiChipThemeData( + style: StreamEmojiChipThemeStyle( + // Reaction chips must shrink to their content width so that multiple + // chips fit side-by-side within the bubble bounds. The global default + // (64px minimum) is designed for stand-alone emoji chip bars and is + // too wide for a segmented reaction row. + minimumSize: const Size(32, 24), + maximumSize: const Size.fromHeight(28), + emojiSize: StreamEmojiSize.sm.value, + backgroundColor: .all(context.streamColorScheme.backgroundElevation2), + textStyle: .all(textTheme.numericMd.copyWith(fontFeatures: const [.tabularFigures()])), + padding: EdgeInsetsGeometry.symmetric(vertical: spacing.xxxs, horizontal: spacing.xs), + ), + ), + child: DefaultStreamReactions(props: props), + ); + } +} + +/// Properties for configuring [StreamReactions]. +/// +/// This class holds the configuration for a reactions widget so it can be +/// passed through the [StreamComponentFactory]. +/// +/// See also: +/// +/// * [StreamReactions], which uses these properties. +/// * [DefaultStreamReactions], the default implementation. +@immutable +class StreamReactionsProps { + /// Creates reaction properties. + const StreamReactionsProps({ + required this.type, + required this.items, + this.child, + required this.position, + required this.alignment, + this.max, + this.overlap = true, + this.indent, + this.crossAxisAlignment, + this.clipBehavior = Clip.none, + this.onPressed, + }); + + /// The reaction presentation style. + final StreamReactionsType type; + + /// The reaction items to display. + final List items; + + /// Optional widget the reactions should be positioned relative to. + /// + /// Typically a message bubble or any container widget. + /// + /// When null, [StreamReactions] renders as a standalone reaction strip. + final Widget? child; + + /// The vertical position of the reactions relative to the child. + final StreamReactionsPosition position; + + /// The horizontal alignment of the reactions relative to the child. + final StreamReactionsAlignment alignment; + + /// Maximum number of visible items. + /// + /// In segmented mode, items beyond this limit are collapsed into an overflow + /// chip. In clustered mode, this limits how many emoji widgets are shown in + /// the cluster. + final int? max; + + /// Whether reactions overlap the child edge. + /// + /// When `false`, reactions are displayed with a gap from the child. + final bool overlap; + + /// Horizontal offset applied to the reaction strip. + final double? indent; + + /// Cross-axis alignment used when laying out the child and reactions. + final CrossAxisAlignment? crossAxisAlignment; + + /// The clip behavior applied to the layout. + final Clip clipBehavior; + + /// Called when any reaction chip is tapped. + /// + /// In segmented mode, this is used for each visible chip, including the + /// overflow chip. In clustered mode, it is used for the grouped chip. + final VoidCallback? onPressed; +} + +/// A single reaction item with an emoji widget and optional count. +/// +/// Used by [StreamReactions] to describe each distinct reaction type. +/// +/// See also: +/// +/// * [StreamReactionsProps], which holds a list of these items. +@immutable +class StreamReactionsItem { + /// Creates a reaction item. + const StreamReactionsItem({ + required this.emoji, + this.count, + }); + + /// The widget representing this reaction's emoji. + /// + /// Typically a [Text] widget containing an emoji character + /// (e.g. `Text('👍')`). + final Widget emoji; + + /// The number of times this reaction was used. + /// + /// When null, the reaction is treated as having a count of 1. + final int? count; +} + +const _kMaxVisibleSegments = 4; + +/// Default implementation of [StreamReactions]. +/// +/// See also: +/// +/// * [StreamReactions], the public API widget. +/// * [StreamReactionsProps], which configures this widget. +class DefaultStreamReactions extends StatelessWidget { + /// Creates a default reaction widget with the given [props]. + const DefaultStreamReactions({super.key, required this.props}); + + /// The properties that configure this widget. + final StreamReactionsProps props; + + @override + Widget build(BuildContext context) { + if (props.items.isEmpty) return props.child ?? const SizedBox.shrink(); + + final reactionTheme = context.streamReactionsTheme; + final defaults = _StreamReactionsThemeDefaults(context); + + final effectiveSpacing = reactionTheme.spacing ?? defaults.spacing; + final effectiveGap = reactionTheme.gap ?? defaults.gap; + final effectiveOverlapExtent = reactionTheme.overlapExtent ?? defaults.overlapExtent; + // Limit is only applied when reactions overlap the child; otherwise show all. + final maxVisible = props.overlap ? (props.max ?? _kMaxVisibleSegments) : props.items.length; + + final reactionStrip = switch (props.type) { + .clustered => _buildClustered(maxVisible), + .segmented => _buildSegmented(effectiveSpacing, maxVisible), + }; + + // Standalone mode — no child to position relative to. + if (props.child == null) return reactionStrip; + + // Negative spacing when overlapping makes reactions overlap the child edge. + final columnSpacing = props.overlap ? -effectiveOverlapExtent : effectiveGap; + + final effectiveCrossAxisAlignment = props.crossAxisAlignment ?? CrossAxisAlignment.start; + + final effectiveIndent = props.indent ?? reactionTheme.indent ?? defaults.indent; + final indentedStrip = Transform.translate(offset: .new(effectiveIndent, 0), child: reactionStrip); + + final alignedStrip = switch (props.alignment) { + .start => Align(alignment: AlignmentDirectional.centerStart, child: indentedStrip), + .end => Align(alignment: AlignmentDirectional.centerEnd, child: indentedStrip), + }; + + // Reactions are always the LAST child so they paint on top of the child + // when overlapping (later children have higher z-order in Flex layout). + // For top-positioned reactions we flip verticalDirection so the column + // still lays out bottom-to-top while keeping reactions last in the + // paint order. + final column = StreamColumn( + mainAxisSize: .min, + spacing: columnSpacing, + crossAxisAlignment: effectiveCrossAxisAlignment, + clipBehavior: props.clipBehavior, + verticalDirection: switch (props.position) { + .header => VerticalDirection.up, + .footer => VerticalDirection.down, + }, + children: [props.child!, alignedStrip], + ); + + if (props.overlap) return IntrinsicWidth(child: column); + return column; + } + + Widget _buildSegmented(double itemSpacing, int maxVisible) { + final items = props.items; + final showCounts = items.any((item) => (item.count ?? 1) > 1); + + final visible = items.take(maxVisible).toList(); + final overflow = items.skip(maxVisible).toList(); + final overflowCount = overflow.sumOf((item) => item.count ?? 1); + + final children = [ + for (final item in visible) + StreamEmojiChip( + emoji: item.emoji, + count: showCounts ? item.count ?? 1 : null, + onPressed: props.onPressed, + ), + if (overflow.isNotEmpty) + StreamEmojiChip.overflow( + count: overflowCount, + onPressed: props.onPressed, + ), + ]; + + if (props.overlap) return Row(mainAxisSize: .min, spacing: itemSpacing, children: children); + return Wrap(spacing: itemSpacing, runSpacing: itemSpacing, children: children); + } + + Widget _buildClustered(int maxVisible) { + final items = props.items; + final visible = items.take(maxVisible).map((item) => item.emoji).toList(); + final totalCount = items.sumOf((item) => item.count ?? 1); + + return StreamEmojiChip.cluster( + emojis: visible, + count: totalCount > 1 ? totalCount : null, + onPressed: props.onPressed, + ); + } +} + +// Context-aware default values for [StreamReactionsThemeData]. +// +// Used by [DefaultStreamReactions] as a fallback when a property is not +// explicitly set in the inherited theme. +class _StreamReactionsThemeDefaults extends StreamReactionsThemeData { + _StreamReactionsThemeDefaults(this._context); + + final BuildContext _context; + + late final _spacing = _context.streamSpacing; + + @override + double get spacing => _spacing.xxs; + + @override + double get gap => _spacing.xxs; + + @override + double get overlapExtent => _spacing.xs; + + @override + double get indent => 0; +} diff --git a/packages/stream_core_flutter/lib/src/factory/stream_component_factory.dart b/packages/stream_core_flutter/lib/src/factory/stream_component_factory.dart new file mode 100644 index 0000000..a0c3a68 --- /dev/null +++ b/packages/stream_core_flutter/lib/src/factory/stream_component_factory.dart @@ -0,0 +1,385 @@ +import 'package:flutter/widgets.dart'; +import 'package:theme_extensions_builder_annotation/theme_extensions_builder_annotation.dart'; + +import '../components.dart'; + +part 'stream_component_factory.g.theme.dart'; + +/// Provides component builders to descendant Stream widgets. +/// +/// Wrap a subtree with [StreamComponentFactory] to customize how Stream +/// components are rendered. Access the builders using +/// [StreamComponentFactory.of], [StreamComponentFactory.maybeOf], or the +/// [BuildContext] extension +/// [StreamComponentFactoryExtension.streamComponentFactory]. +/// +/// The nearest [StreamComponentFactory] ancestor takes precedence - nested +/// factories completely override their parents rather than merging. +/// +/// {@tool snippet} +/// +/// Override button rendering for a subtree: +/// +/// ```dart +/// StreamComponentFactory( +/// builders: StreamComponentBuilders( +/// button: (context, props) => MyCustomButton(props: props), +/// ), +/// child: Column( +/// children: [ +/// StreamButton(label: 'Uses custom builder'), +/// StreamFileTypeIcon(type: StreamFileType.pdf), // Uses default +/// ], +/// ), +/// ) +/// ``` +/// {@end-tool} +/// +/// See also: +/// +/// * [StreamComponentBuilders], which holds the builder functions. +/// * [StreamButton], [StreamFileTypeIcon], widgets affected by this factory. +class StreamComponentFactory extends InheritedWidget { + /// Creates a component factory that controls rendering of descendant widgets. + const StreamComponentFactory({ + super.key, + required this.builders, + required super.child, + }); + + /// The component builders for descendant widgets. + final StreamComponentBuilders builders; + + /// Finds the [StreamComponentBuilders] from the closest + /// [StreamComponentFactory] ancestor that encloses the given context. + /// + /// This will return a default empty [StreamComponentBuilders] if no [StreamComponentFactory] is found + /// + /// Typical usage: + /// + /// ```dart + /// final builders = StreamComponentFactory.of(context); + /// ``` + /// + /// If you're calling this in the same `build()` method that creates the + /// `StreamComponentFactory`, consider using a `Builder` or refactoring into + /// a separate widget to obtain a context below the [StreamComponentFactory]. + static StreamComponentBuilders of(BuildContext context) { + final streamComponentFactory = context.dependOnInheritedWidgetOfExactType(); + return streamComponentFactory?.builders ?? StreamComponentBuilders(); + } + + @override + bool updateShouldNotify(StreamComponentFactory oldWidget) => builders != oldWidget.builders; +} + +/// A function type that builds a widget from a [BuildContext] and typed props. +/// +/// Used by [StreamComponentBuilders] to define custom component builders. +typedef StreamComponentBuilder = Widget Function(BuildContext context, T props); + +/// A collection of builders for customizing Stream component rendering. +/// +/// All builders are nullable - when null, the component uses its default +/// implementation. +/// +/// {@tool snippet} +/// +/// Create builders with custom button implementation: +/// +/// ```dart +/// final builders = StreamComponentBuilders( +/// button: (context, props) => MyCustomButton(props: props), +/// ); +/// ``` +/// {@end-tool} +/// +/// {@tool snippet} +/// +/// Register a custom component builder via [extensions]: +/// +/// ```dart +/// final builders = StreamComponentBuilders( +/// extensions: [ +/// StreamComponentBuilderExtension( +/// builder: (context, props) => MyCustomMessage(props: props), +/// ), +/// ], +/// ); +/// ``` +/// +/// Then retrieve it with [extension]: +/// +/// ```dart +/// final builder = StreamComponentFactory.of(context).extension(); +/// if (builder != null) return builder(context, props); +/// ``` +/// {@end-tool} +/// +/// See also: +/// +/// * [StreamComponentFactory], which provides builders to descendants. +/// * [StreamComponentBuilderExtension], which wraps a custom component builder. +@immutable +@ThemeGen(constructor: 'raw') +class StreamComponentBuilders with _$StreamComponentBuilders { + /// Creates component builders with optional custom implementations. + /// + /// Any builder not provided (null) will cause the component to use its + /// default implementation. + /// + /// [extensions] accepts an [Iterable] of [StreamComponentBuilderExtension] instances, which are + /// converted to a map keyed by [StreamComponentBuilderExtension.type] internally. + factory StreamComponentBuilders({ + StreamComponentBuilder? avatar, + StreamComponentBuilder? avatarGroup, + StreamComponentBuilder? avatarStack, + StreamComponentBuilder? badgeCount, + StreamComponentBuilder? badgeNotification, + StreamComponentBuilder? button, + StreamComponentBuilder? checkbox, + StreamComponentBuilder? contextMenuAction, + StreamComponentBuilder? emoji, + StreamComponentBuilder? emojiButton, + StreamComponentBuilder? emojiChip, + StreamComponentBuilder? emojiChipBar, + StreamComponentBuilder? fileTypeIcon, + StreamComponentBuilder? listTile, + StreamComponentBuilder? onlineIndicator, + StreamComponentBuilder? progressBar, + StreamComponentBuilder? reactions, + Iterable>? extensions, + }) { + extensions ??= >[]; + + return .raw( + avatar: avatar, + avatarGroup: avatarGroup, + avatarStack: avatarStack, + badgeCount: badgeCount, + badgeNotification: badgeNotification, + button: button, + checkbox: checkbox, + contextMenuAction: contextMenuAction, + emoji: emoji, + emojiButton: emojiButton, + emojiChip: emojiChip, + emojiChipBar: emojiChipBar, + fileTypeIcon: fileTypeIcon, + listTile: listTile, + onlineIndicator: onlineIndicator, + progressBar: progressBar, + reactions: reactions, + extensions: _extensionIterableToMap(extensions), + ); + } + + /// Creates component builders from a pre-built extensions map. + const StreamComponentBuilders.raw({ + required this.avatar, + required this.avatarGroup, + required this.avatarStack, + required this.badgeCount, + required this.badgeNotification, + required this.button, + required this.checkbox, + required this.contextMenuAction, + required this.emoji, + required this.emojiButton, + required this.emojiChip, + required this.emojiChipBar, + required this.fileTypeIcon, + required this.listTile, + required this.onlineIndicator, + required this.progressBar, + required this.reactions, + required this.extensions, + }); + + /// Arbitrary additions to this builder set. + /// + /// To define extensions, pass an [Iterable] of [StreamComponentBuilderExtension] instances to + /// [StreamComponentBuilders.new]. + /// + /// To obtain an extension, use [extension]. + /// + /// See also: + /// + /// * [extension], a convenience function for obtaining a specific extension. + final Map> extensions; + + /// Used to obtain a [StreamComponentBuilder] from [extensions]. + /// + /// Obtain with `StreamComponentFactory.of(context).extension()`. + /// + /// See [extensions]. + StreamComponentBuilder? extension() => (extensions[T] as StreamComponentBuilderExtension?)?.call; + + /// Custom builder for avatar widgets. + /// + /// When null, [StreamAvatar] uses [DefaultStreamAvatar]. + final StreamComponentBuilder? avatar; + + /// Custom builder for avatar group widgets. + /// + /// When null, [StreamAvatarGroup] uses [DefaultStreamAvatarGroup]. + final StreamComponentBuilder? avatarGroup; + + /// Custom builder for avatar stack widgets. + /// + /// When null, [StreamAvatarStack] uses [DefaultStreamAvatarStack]. + final StreamComponentBuilder? avatarStack; + + /// Custom builder for badge count widgets. + /// + /// When null, [StreamBadgeCount] uses [DefaultStreamBadgeCount]. + final StreamComponentBuilder? badgeCount; + + /// Custom builder for badge notification widgets. + /// + /// When null, [StreamBadgeNotification] uses + /// [DefaultStreamBadgeNotification]. + final StreamComponentBuilder? badgeNotification; + + /// Custom builder for button widgets. + /// + /// When null, [StreamButton] uses [DefaultStreamButton]. + final StreamComponentBuilder? button; + + /// Custom builder for checkbox widgets. + /// + /// When null, [StreamCheckbox] uses [DefaultStreamCheckbox]. + final StreamComponentBuilder? checkbox; + + /// Custom builder for context menu action widgets. + /// + /// When null, [StreamContextMenuAction] uses [DefaultStreamContextMenuAction]. + final StreamComponentBuilder? contextMenuAction; + + /// Custom builder for emoji widgets. + /// + /// When null, [StreamEmoji] uses [DefaultStreamEmoji]. + final StreamComponentBuilder? emoji; + + /// Custom builder for emoji button widgets. + /// + /// When null, [StreamEmojiButton] uses [DefaultStreamEmojiButton]. + final StreamComponentBuilder? emojiButton; + + /// Custom builder for emoji chip widgets. + /// + /// When null, [StreamEmojiChip] uses [DefaultStreamEmojiChip]. + final StreamComponentBuilder? emojiChip; + + /// Custom builder for emoji chip bar widgets. + /// + /// When null, [StreamEmojiChipBar] uses [DefaultStreamEmojiChipBar]. + final StreamComponentBuilder? emojiChipBar; + + /// Custom builder for file type icon widgets. + /// + /// When null, [StreamFileTypeIcon] uses [DefaultStreamFileTypeIcon]. + final StreamComponentBuilder? fileTypeIcon; + + /// Custom builder for list tile widgets. + /// + /// When null, [StreamListTile] uses [DefaultStreamListTile]. + final StreamComponentBuilder? listTile; + + /// Custom builder for online indicator widgets. + /// + /// When null, [StreamOnlineIndicator] uses [DefaultStreamOnlineIndicator]. + final StreamComponentBuilder? onlineIndicator; + + /// Custom builder for progress bar widgets. + /// + /// When null, [StreamProgressBar] uses [DefaultStreamProgressBar]. + final StreamComponentBuilder? progressBar; + + /// Custom builder for reaction widgets. + /// + /// When null, [StreamReactions] uses [DefaultStreamReactions]. + final StreamComponentBuilder? reactions; + + // Convert the [extensionsIterable] passed to [StreamComponentBuilders.new] + // to the stored [extensions] map, where each entry's key consists of the extension's type. + static Map> _extensionIterableToMap( + Iterable> extensionsIterable, + ) { + return >{ + for (final extension in extensionsIterable) extension.type: extension, + }; + } +} + +/// A typed builder extension for [StreamComponentBuilders]. +/// +/// Wraps a single [StreamComponentBuilder] and uses the Props type [T] as the +/// lookup key. This allows external packages to register custom component +/// builders without modifying the core [StreamComponentBuilders] class. +/// +/// {@tool snippet} +/// +/// Register a custom message builder: +/// +/// ```dart +/// StreamComponentFactory( +/// builders: StreamComponentBuilders( +/// extensions: [ +/// StreamComponentBuilderExtension( +/// builder: (context, props) => MyCustomMessage(props: props), +/// ), +/// ], +/// ), +/// child: child, +/// ) +/// ``` +/// +/// Consume it inside a custom component: +/// +/// ```dart +/// final builder = StreamComponentFactory.of(context).extension(); +/// if (builder != null) return builder(context, props); +/// return DefaultStreamMessage(props: props); +/// ``` +/// {@end-tool} +/// +/// See also: +/// +/// * [StreamComponentBuilders], which holds extensions. +/// * [StreamComponentBuilders.extension], for obtaining a specific extension. +@immutable +final class StreamComponentBuilderExtension { + /// Creates a builder extension for a component with Props type [T]. + const StreamComponentBuilderExtension({ + required StreamComponentBuilder builder, + }) : _builder = builder; + + // The internal builder function that creates the widget from the context and props. + final StreamComponentBuilder _builder; + + /// Invokes the builder with the given [context] and [props]. + Widget call(BuildContext context, T props) => _builder(context, props); + + /// The extension's type, used as the lookup key. + Object get type => T; +} + +/// Extension on [BuildContext] for convenient access to [StreamComponentBuilders]. +/// +/// {@tool snippet} +/// +/// Access component builders from context: +/// +/// ```dart +/// final builders = context.streamComponentFactory; +/// final button = builders?.button?.call(context, props); +/// ``` +/// {@end-tool} +extension StreamComponentFactoryExtension on BuildContext { + /// Returns the [StreamComponentBuilders] from the nearest + /// [StreamComponentFactory] ancestor, or null if none exists. + /// + /// This is equivalent to calling [StreamComponentFactory.of]. + StreamComponentBuilders get streamComponentFactory => StreamComponentFactory.of(this); +} diff --git a/packages/stream_core_flutter/lib/src/factory/stream_component_factory.g.theme.dart b/packages/stream_core_flutter/lib/src/factory/stream_component_factory.g.theme.dart new file mode 100644 index 0000000..2e76e62 --- /dev/null +++ b/packages/stream_core_flutter/lib/src/factory/stream_component_factory.g.theme.dart @@ -0,0 +1,193 @@ +// dart format width=80 +// coverage:ignore-file +// GENERATED CODE - DO NOT MODIFY BY HAND +// ignore_for_file: type=lint, unused_element + +part of 'stream_component_factory.dart'; + +// ************************************************************************** +// ThemeGenGenerator +// ************************************************************************** + +mixin _$StreamComponentBuilders { + bool get canMerge => true; + + static StreamComponentBuilders? lerp( + StreamComponentBuilders? a, + StreamComponentBuilders? b, + double t, + ) { + if (identical(a, b)) { + return a; + } + + if (a == null) { + return t == 1.0 ? b : null; + } + + if (b == null) { + return t == 0.0 ? a : null; + } + + return StreamComponentBuilders.raw( + extensions: t < 0.5 ? a.extensions : b.extensions, + avatar: t < 0.5 ? a.avatar : b.avatar, + avatarGroup: t < 0.5 ? a.avatarGroup : b.avatarGroup, + avatarStack: t < 0.5 ? a.avatarStack : b.avatarStack, + badgeCount: t < 0.5 ? a.badgeCount : b.badgeCount, + badgeNotification: t < 0.5 ? a.badgeNotification : b.badgeNotification, + button: t < 0.5 ? a.button : b.button, + checkbox: t < 0.5 ? a.checkbox : b.checkbox, + contextMenuAction: t < 0.5 ? a.contextMenuAction : b.contextMenuAction, + emoji: t < 0.5 ? a.emoji : b.emoji, + emojiButton: t < 0.5 ? a.emojiButton : b.emojiButton, + emojiChip: t < 0.5 ? a.emojiChip : b.emojiChip, + emojiChipBar: t < 0.5 ? a.emojiChipBar : b.emojiChipBar, + fileTypeIcon: t < 0.5 ? a.fileTypeIcon : b.fileTypeIcon, + listTile: t < 0.5 ? a.listTile : b.listTile, + onlineIndicator: t < 0.5 ? a.onlineIndicator : b.onlineIndicator, + progressBar: t < 0.5 ? a.progressBar : b.progressBar, + reactions: t < 0.5 ? a.reactions : b.reactions, + ); + } + + StreamComponentBuilders copyWith({ + Map>? extensions, + Widget Function(BuildContext, StreamAvatarProps)? avatar, + Widget Function(BuildContext, StreamAvatarGroupProps)? avatarGroup, + Widget Function(BuildContext, StreamAvatarStackProps)? avatarStack, + Widget Function(BuildContext, StreamBadgeCountProps)? badgeCount, + Widget Function(BuildContext, StreamBadgeNotificationProps)? + badgeNotification, + Widget Function(BuildContext, StreamButtonProps)? button, + Widget Function(BuildContext, StreamCheckboxProps)? checkbox, + Widget Function(BuildContext, StreamContextMenuActionProps)? + contextMenuAction, + Widget Function(BuildContext, StreamEmojiProps)? emoji, + Widget Function(BuildContext, StreamEmojiButtonProps)? emojiButton, + Widget Function(BuildContext, StreamEmojiChipProps)? emojiChip, + Widget Function(BuildContext, StreamEmojiChipBarProps)? + emojiChipBar, + Widget Function(BuildContext, StreamFileTypeIconProps)? fileTypeIcon, + Widget Function(BuildContext, StreamListTileProps)? listTile, + Widget Function(BuildContext, StreamOnlineIndicatorProps)? onlineIndicator, + Widget Function(BuildContext, StreamProgressBarProps)? progressBar, + Widget Function(BuildContext, StreamReactionsProps)? reactions, + }) { + final _this = (this as StreamComponentBuilders); + + return StreamComponentBuilders.raw( + extensions: extensions ?? _this.extensions, + avatar: avatar ?? _this.avatar, + avatarGroup: avatarGroup ?? _this.avatarGroup, + avatarStack: avatarStack ?? _this.avatarStack, + badgeCount: badgeCount ?? _this.badgeCount, + badgeNotification: badgeNotification ?? _this.badgeNotification, + button: button ?? _this.button, + checkbox: checkbox ?? _this.checkbox, + contextMenuAction: contextMenuAction ?? _this.contextMenuAction, + emoji: emoji ?? _this.emoji, + emojiButton: emojiButton ?? _this.emojiButton, + emojiChip: emojiChip ?? _this.emojiChip, + emojiChipBar: emojiChipBar ?? _this.emojiChipBar, + fileTypeIcon: fileTypeIcon ?? _this.fileTypeIcon, + listTile: listTile ?? _this.listTile, + onlineIndicator: onlineIndicator ?? _this.onlineIndicator, + progressBar: progressBar ?? _this.progressBar, + reactions: reactions ?? _this.reactions, + ); + } + + StreamComponentBuilders merge(StreamComponentBuilders? other) { + final _this = (this as StreamComponentBuilders); + + if (other == null || identical(_this, other)) { + return _this; + } + + if (!other.canMerge) { + return other; + } + + return copyWith( + extensions: other.extensions, + avatar: other.avatar, + avatarGroup: other.avatarGroup, + avatarStack: other.avatarStack, + badgeCount: other.badgeCount, + badgeNotification: other.badgeNotification, + button: other.button, + checkbox: other.checkbox, + contextMenuAction: other.contextMenuAction, + emoji: other.emoji, + emojiButton: other.emojiButton, + emojiChip: other.emojiChip, + emojiChipBar: other.emojiChipBar, + fileTypeIcon: other.fileTypeIcon, + listTile: other.listTile, + onlineIndicator: other.onlineIndicator, + progressBar: other.progressBar, + reactions: other.reactions, + ); + } + + @override + bool operator ==(Object other) { + if (identical(this, other)) { + return true; + } + + if (other.runtimeType != runtimeType) { + return false; + } + + final _this = (this as StreamComponentBuilders); + final _other = (other as StreamComponentBuilders); + + return _other.extensions == _this.extensions && + _other.avatar == _this.avatar && + _other.avatarGroup == _this.avatarGroup && + _other.avatarStack == _this.avatarStack && + _other.badgeCount == _this.badgeCount && + _other.badgeNotification == _this.badgeNotification && + _other.button == _this.button && + _other.checkbox == _this.checkbox && + _other.contextMenuAction == _this.contextMenuAction && + _other.emoji == _this.emoji && + _other.emojiButton == _this.emojiButton && + _other.emojiChip == _this.emojiChip && + _other.emojiChipBar == _this.emojiChipBar && + _other.fileTypeIcon == _this.fileTypeIcon && + _other.listTile == _this.listTile && + _other.onlineIndicator == _this.onlineIndicator && + _other.progressBar == _this.progressBar && + _other.reactions == _this.reactions; + } + + @override + int get hashCode { + final _this = (this as StreamComponentBuilders); + + return Object.hash( + runtimeType, + _this.extensions, + _this.avatar, + _this.avatarGroup, + _this.avatarStack, + _this.badgeCount, + _this.badgeNotification, + _this.button, + _this.checkbox, + _this.contextMenuAction, + _this.emoji, + _this.emojiButton, + _this.emojiChip, + _this.emojiChipBar, + _this.fileTypeIcon, + _this.listTile, + _this.onlineIndicator, + _this.progressBar, + _this.reactions, + ); + } +} diff --git a/packages/stream_core_flutter/lib/src/theme.dart b/packages/stream_core_flutter/lib/src/theme.dart new file mode 100644 index 0000000..c4e8284 --- /dev/null +++ b/packages/stream_core_flutter/lib/src/theme.dart @@ -0,0 +1,31 @@ +export 'factory/stream_component_factory.dart'; + +export 'theme/components/stream_audio_waveform_theme.dart'; +export 'theme/components/stream_avatar_theme.dart'; +export 'theme/components/stream_badge_count_theme.dart'; +export 'theme/components/stream_badge_notification_theme.dart'; +export 'theme/components/stream_button_theme.dart'; +export 'theme/components/stream_checkbox_theme.dart'; +export 'theme/components/stream_context_menu_action_theme.dart'; +export 'theme/components/stream_context_menu_theme.dart'; +export 'theme/components/stream_emoji_button_theme.dart'; +export 'theme/components/stream_emoji_chip_theme.dart'; +export 'theme/components/stream_input_theme.dart'; +export 'theme/components/stream_list_tile_theme.dart'; +export 'theme/components/stream_message_theme.dart'; +export 'theme/components/stream_online_indicator_theme.dart'; +export 'theme/components/stream_progress_bar_theme.dart'; +export 'theme/components/stream_reactions_theme.dart'; + +export 'theme/primitives/stream_colors.dart'; +export 'theme/primitives/stream_icons.dart'; +export 'theme/primitives/stream_radius.dart'; +export 'theme/primitives/stream_spacing.dart'; +export 'theme/primitives/stream_typography.dart'; + +export 'theme/semantics/stream_box_shadow.dart'; +export 'theme/semantics/stream_color_scheme.dart'; +export 'theme/semantics/stream_text_theme.dart'; + +export 'theme/stream_theme.dart'; +export 'theme/stream_theme_extensions.dart'; diff --git a/packages/stream_core_flutter/lib/src/theme/components/stream_audio_waveform_theme.dart b/packages/stream_core_flutter/lib/src/theme/components/stream_audio_waveform_theme.dart new file mode 100644 index 0000000..c74c4f5 --- /dev/null +++ b/packages/stream_core_flutter/lib/src/theme/components/stream_audio_waveform_theme.dart @@ -0,0 +1,163 @@ +import 'package:flutter/widgets.dart'; +import 'package:theme_extensions_builder_annotation/theme_extensions_builder_annotation.dart'; + +import '../stream_theme.dart'; + +part 'stream_audio_waveform_theme.g.theme.dart'; + +/// Applies an audio waveform theme to descendant [StreamAudioWaveform] and +/// [StreamAudioWaveformSlider] widgets. +/// +/// Wrap a subtree with [StreamAudioWaveformTheme] to override waveform +/// styling. Access the merged theme using +/// [BuildContext.streamAudioWaveformTheme]. +/// +/// {@tool snippet} +/// +/// Override waveform colors for a specific section: +/// +/// ```dart +/// StreamAudioWaveformTheme( +/// data: StreamAudioWaveformThemeData( +/// color: Colors.grey, +/// progressColor: Colors.blue, +/// activeThumbColor: Colors.blue, +/// idleThumbColor: Colors.grey, +/// ), +/// child: StreamAudioWaveformSlider( +/// waveform: waveformData, +/// onChanged: (value) {}, +/// ), +/// ) +/// ``` +/// {@end-tool} +/// +/// See also: +/// +/// * [StreamAudioWaveformThemeData], which describes the waveform theme. +/// * [StreamAudioWaveform], the waveform widget affected by this theme. +/// * [StreamAudioWaveformSlider], the slider widget affected by this theme. +class StreamAudioWaveformTheme extends InheritedTheme { + /// Creates an audio waveform theme that controls descendant waveforms. + const StreamAudioWaveformTheme({ + super.key, + required this.data, + required super.child, + }); + + /// The audio waveform theme data for descendant widgets. + final StreamAudioWaveformThemeData data; + + /// Returns the [StreamAudioWaveformThemeData] merged from local and global + /// themes. + /// + /// Local values from the nearest [StreamAudioWaveformTheme] ancestor take + /// precedence over global values from [StreamTheme.of]. + /// + /// This allows partial overrides - for example, overriding only + /// [StreamAudioWaveformThemeData.color] while inheriting other properties + /// from the global theme. + static StreamAudioWaveformThemeData of(BuildContext context) { + final localTheme = context.dependOnInheritedWidgetOfExactType(); + return StreamTheme.of(context).audioWaveformTheme.merge(localTheme?.data); + } + + @override + Widget wrap(BuildContext context, Widget child) { + return StreamAudioWaveformTheme(data: data, child: child); + } + + @override + bool updateShouldNotify(StreamAudioWaveformTheme oldWidget) => data != oldWidget.data; +} + +/// Theme data for customizing [StreamAudioWaveform] and +/// [StreamAudioWaveformSlider] widgets. +/// +/// {@tool snippet} +/// +/// Customize waveform appearance globally: +/// +/// ```dart +/// StreamTheme( +/// audioWaveformTheme: StreamAudioWaveformThemeData( +/// color: Colors.grey, +/// progressColor: Colors.blue, +/// minBarHeight: 2, +/// spacingRatio: 0.3, +/// heightScale: 1, +/// activeThumbColor: Colors.blue, +/// idleThumbColor: Colors.grey, +/// thumbBorderColor: Colors.grey, +/// ), +/// ) +/// ``` +/// {@end-tool} +/// +/// See also: +/// +/// * [StreamAudioWaveform], the widget that uses this theme data. +/// * [StreamAudioWaveformSlider], the slider widget that uses this theme data. +/// * [StreamAudioWaveformTheme], for overriding theme in a widget subtree. +@themeGen +@immutable +class StreamAudioWaveformThemeData with _$StreamAudioWaveformThemeData { + /// Creates audio waveform theme data with optional style overrides. + const StreamAudioWaveformThemeData({ + this.color, + this.progressColor, + this.minBarHeight, + this.spacingRatio, + this.heightScale, + this.activeThumbColor, + this.idleThumbColor, + this.thumbBorderColor, + }); + + /// The color of the waveform bars. + /// + /// Falls back to [StreamColorScheme.borderOpacity25]. + final Color? color; + + /// The color of the progressed waveform bars. + /// + /// Falls back to [StreamColorScheme.accentPrimary]. + final Color? progressColor; + + /// The minimum height of the waveform bars. + /// + /// Falls back to 2 logical pixels. + final double? minBarHeight; + + /// The ratio of the spacing between the waveform bars. + /// + /// Falls back to 0.3. + final double? spacingRatio; + + /// The scale of the height of the waveform bars. + /// + /// Falls back to 1. + final double? heightScale; + + /// The color of the slider thumb when the waveform is active (playing). + /// + /// Falls back to [StreamColorScheme.accentPrimary]. + final Color? activeThumbColor; + + /// The color of the slider thumb when the waveform is idle (not playing). + /// + /// Falls back to [StreamColorScheme.accentNeutral]. + final Color? idleThumbColor; + + /// The border color of the slider thumb. + /// + /// Falls back to [StreamColorScheme.borderOnAccent]. + final Color? thumbBorderColor; + + /// Linearly interpolate between two [StreamAudioWaveformThemeData] objects. + static StreamAudioWaveformThemeData? lerp( + StreamAudioWaveformThemeData? a, + StreamAudioWaveformThemeData? b, + double t, + ) => _$StreamAudioWaveformThemeData.lerp(a, b, t); +} diff --git a/packages/stream_core_flutter/lib/src/theme/components/stream_audio_waveform_theme.g.theme.dart b/packages/stream_core_flutter/lib/src/theme/components/stream_audio_waveform_theme.g.theme.dart new file mode 100644 index 0000000..c335d3c --- /dev/null +++ b/packages/stream_core_flutter/lib/src/theme/components/stream_audio_waveform_theme.g.theme.dart @@ -0,0 +1,130 @@ +// dart format width=80 +// coverage:ignore-file +// GENERATED CODE - DO NOT MODIFY BY HAND +// ignore_for_file: type=lint, unused_element + +part of 'stream_audio_waveform_theme.dart'; + +// ************************************************************************** +// ThemeGenGenerator +// ************************************************************************** + +mixin _$StreamAudioWaveformThemeData { + bool get canMerge => true; + + static StreamAudioWaveformThemeData? lerp( + StreamAudioWaveformThemeData? a, + StreamAudioWaveformThemeData? b, + double t, + ) { + if (identical(a, b)) { + return a; + } + + if (a == null) { + return t == 1.0 ? b : null; + } + + if (b == null) { + return t == 0.0 ? a : null; + } + + return StreamAudioWaveformThemeData( + color: Color.lerp(a.color, b.color, t), + progressColor: Color.lerp(a.progressColor, b.progressColor, t), + minBarHeight: lerpDouble$(a.minBarHeight, b.minBarHeight, t), + spacingRatio: lerpDouble$(a.spacingRatio, b.spacingRatio, t), + heightScale: lerpDouble$(a.heightScale, b.heightScale, t), + activeThumbColor: Color.lerp(a.activeThumbColor, b.activeThumbColor, t), + idleThumbColor: Color.lerp(a.idleThumbColor, b.idleThumbColor, t), + thumbBorderColor: Color.lerp(a.thumbBorderColor, b.thumbBorderColor, t), + ); + } + + StreamAudioWaveformThemeData copyWith({ + Color? color, + Color? progressColor, + double? minBarHeight, + double? spacingRatio, + double? heightScale, + Color? activeThumbColor, + Color? idleThumbColor, + Color? thumbBorderColor, + }) { + final _this = (this as StreamAudioWaveformThemeData); + + return StreamAudioWaveformThemeData( + color: color ?? _this.color, + progressColor: progressColor ?? _this.progressColor, + minBarHeight: minBarHeight ?? _this.minBarHeight, + spacingRatio: spacingRatio ?? _this.spacingRatio, + heightScale: heightScale ?? _this.heightScale, + activeThumbColor: activeThumbColor ?? _this.activeThumbColor, + idleThumbColor: idleThumbColor ?? _this.idleThumbColor, + thumbBorderColor: thumbBorderColor ?? _this.thumbBorderColor, + ); + } + + StreamAudioWaveformThemeData merge(StreamAudioWaveformThemeData? other) { + final _this = (this as StreamAudioWaveformThemeData); + + if (other == null || identical(_this, other)) { + return _this; + } + + if (!other.canMerge) { + return other; + } + + return copyWith( + color: other.color, + progressColor: other.progressColor, + minBarHeight: other.minBarHeight, + spacingRatio: other.spacingRatio, + heightScale: other.heightScale, + activeThumbColor: other.activeThumbColor, + idleThumbColor: other.idleThumbColor, + thumbBorderColor: other.thumbBorderColor, + ); + } + + @override + bool operator ==(Object other) { + if (identical(this, other)) { + return true; + } + + if (other.runtimeType != runtimeType) { + return false; + } + + final _this = (this as StreamAudioWaveformThemeData); + final _other = (other as StreamAudioWaveformThemeData); + + return _other.color == _this.color && + _other.progressColor == _this.progressColor && + _other.minBarHeight == _this.minBarHeight && + _other.spacingRatio == _this.spacingRatio && + _other.heightScale == _this.heightScale && + _other.activeThumbColor == _this.activeThumbColor && + _other.idleThumbColor == _this.idleThumbColor && + _other.thumbBorderColor == _this.thumbBorderColor; + } + + @override + int get hashCode { + final _this = (this as StreamAudioWaveformThemeData); + + return Object.hash( + runtimeType, + _this.color, + _this.progressColor, + _this.minBarHeight, + _this.spacingRatio, + _this.heightScale, + _this.activeThumbColor, + _this.idleThumbColor, + _this.thumbBorderColor, + ); + } +} diff --git a/packages/stream_core_flutter/lib/src/theme/components/stream_avatar_theme.dart b/packages/stream_core_flutter/lib/src/theme/components/stream_avatar_theme.dart new file mode 100644 index 0000000..ea24406 --- /dev/null +++ b/packages/stream_core_flutter/lib/src/theme/components/stream_avatar_theme.dart @@ -0,0 +1,166 @@ +import 'package:flutter/widgets.dart'; +import 'package:theme_extensions_builder_annotation/theme_extensions_builder_annotation.dart'; + +import '../semantics/stream_color_scheme.dart'; +import '../stream_theme.dart'; + +part 'stream_avatar_theme.g.theme.dart'; + +/// Predefined avatar sizes for the Stream design system. +/// +/// Each size corresponds to a specific diameter in logical pixels. +/// +/// See also: +/// +/// * [StreamAvatar], which uses these size variants. +/// * [StreamAvatarThemeData.size], for setting a global default size. +enum StreamAvatarSize { + /// Extra small avatar (20px diameter). + xs(20), + + /// Small avatar (24px diameter). + sm(24), + + /// Medium avatar (32px diameter). + md(32), + + /// Large avatar (40px diameter). + lg(40), + + /// Extra large avatar (48px diameter). + xl(48), + + /// Extra-extra large avatar (80px diameter). + xxl(80) + ; + + /// Constructs a [StreamAvatarSize] with the given diameter. + const StreamAvatarSize(this.value); + + /// The diameter of the avatar in logical pixels. + final double value; +} + +/// Applies an avatar theme to descendant [StreamAvatar] widgets. +/// +/// Wrap a subtree with [StreamAvatarTheme] to override avatar styling. +/// Access the merged theme using [BuildContext.streamAvatarTheme]. +/// +/// {@tool snippet} +/// +/// Override avatar colors for a specific section: +/// +/// ```dart +/// StreamAvatarTheme( +/// data: StreamAvatarThemeData( +/// backgroundColor: Colors.blue.shade100, +/// foregroundColor: Colors.blue.shade800, +/// ), +/// child: Row( +/// children: [ +/// StreamAvatar(placeholder: (context) => Text('A')), +/// StreamAvatar(placeholder: (context) => Text('B')), +/// ], +/// ), +/// ) +/// ``` +/// {@end-tool} +/// +/// See also: +/// +/// * [StreamAvatarThemeData], which describes the avatar theme. +/// * [StreamAvatar], the widget affected by this theme. +class StreamAvatarTheme extends InheritedTheme { + /// Creates an avatar theme that controls the styling of descendant avatars. + const StreamAvatarTheme({ + super.key, + required this.data, + required super.child, + }); + + /// The avatar theme data for descendant widgets. + final StreamAvatarThemeData data; + + /// Returns the [StreamAvatarThemeData] merged from local and global themes. + /// + /// Local values from the nearest [StreamAvatarTheme] ancestor take + /// precedence over global values from [StreamTheme.of]. + /// + /// This allows partial overrides - for example, overriding only [size] + /// while inheriting colors from the global theme. + static StreamAvatarThemeData of(BuildContext context) { + final localTheme = context.dependOnInheritedWidgetOfExactType(); + return StreamTheme.of(context).avatarTheme.merge(localTheme?.data); + } + + @override + Widget wrap(BuildContext context, Widget child) { + return StreamAvatarTheme(data: data, child: child); + } + + @override + bool updateShouldNotify(StreamAvatarTheme oldWidget) => data != oldWidget.data; +} + +/// Theme data for customizing [StreamAvatar] widgets. +/// +/// {@tool snippet} +/// +/// Customize avatar appearance globally: +/// +/// ```dart +/// StreamTheme( +/// avatarTheme: StreamAvatarThemeData( +/// backgroundColor: Colors.grey.shade200, +/// foregroundColor: Colors.grey.shade800, +/// border: Border.all(color: Colors.grey.shade300, width: 2), +/// ), +/// ) +/// ``` +/// {@end-tool} +/// +/// See also: +/// +/// * [StreamAvatar], the widget that uses this theme data. +/// * [StreamAvatarTheme], for overriding theme in a widget subtree. +/// * [StreamColorScheme.avatarPalette], for user-specific avatar colors. +@themeGen +@immutable +class StreamAvatarThemeData with _$StreamAvatarThemeData { + /// Creates an avatar theme with optional style overrides. + const StreamAvatarThemeData({ + this.size, + this.backgroundColor, + this.foregroundColor, + this.border, + }); + + /// The default size for avatars. + /// + /// Falls back to [StreamAvatarSize.lg]. The text style for initials is + /// automatically determined based on this size. + final StreamAvatarSize? size; + + /// The background color for this avatar. + /// + /// Used as the fill color behind the avatar image or placeholder content. + final Color? backgroundColor; + + /// The foreground color for this avatar's placeholder content. + /// + /// Applied to text (initials) and icons when no image is available. + final Color? foregroundColor; + + /// The border for this avatar. + /// + /// Applied when [StreamAvatar.showBorder] is true. Allows customization + /// of both border color and width. + final BoxBorder? border; + + /// Linearly interpolate between two [StreamAvatarThemeData] objects. + static StreamAvatarThemeData? lerp( + StreamAvatarThemeData? a, + StreamAvatarThemeData? b, + double t, + ) => _$StreamAvatarThemeData.lerp(a, b, t); +} diff --git a/packages/stream_core_flutter/lib/src/theme/components/stream_avatar_theme.g.theme.dart b/packages/stream_core_flutter/lib/src/theme/components/stream_avatar_theme.g.theme.dart new file mode 100644 index 0000000..4a2b883 --- /dev/null +++ b/packages/stream_core_flutter/lib/src/theme/components/stream_avatar_theme.g.theme.dart @@ -0,0 +1,106 @@ +// dart format width=80 +// coverage:ignore-file +// GENERATED CODE - DO NOT MODIFY BY HAND +// ignore_for_file: type=lint, unused_element + +part of 'stream_avatar_theme.dart'; + +// ************************************************************************** +// ThemeGenGenerator +// ************************************************************************** + +mixin _$StreamAvatarThemeData { + bool get canMerge => true; + + static StreamAvatarThemeData? lerp( + StreamAvatarThemeData? a, + StreamAvatarThemeData? b, + double t, + ) { + if (identical(a, b)) { + return a; + } + + if (a == null) { + return t == 1.0 ? b : null; + } + + if (b == null) { + return t == 0.0 ? a : null; + } + + return StreamAvatarThemeData( + size: t < 0.5 ? a.size : b.size, + backgroundColor: Color.lerp(a.backgroundColor, b.backgroundColor, t), + foregroundColor: Color.lerp(a.foregroundColor, b.foregroundColor, t), + border: BoxBorder.lerp(a.border, b.border, t), + ); + } + + StreamAvatarThemeData copyWith({ + StreamAvatarSize? size, + Color? backgroundColor, + Color? foregroundColor, + BoxBorder? border, + }) { + final _this = (this as StreamAvatarThemeData); + + return StreamAvatarThemeData( + size: size ?? _this.size, + backgroundColor: backgroundColor ?? _this.backgroundColor, + foregroundColor: foregroundColor ?? _this.foregroundColor, + border: border ?? _this.border, + ); + } + + StreamAvatarThemeData merge(StreamAvatarThemeData? other) { + final _this = (this as StreamAvatarThemeData); + + if (other == null || identical(_this, other)) { + return _this; + } + + if (!other.canMerge) { + return other; + } + + return copyWith( + size: other.size, + backgroundColor: other.backgroundColor, + foregroundColor: other.foregroundColor, + border: other.border, + ); + } + + @override + bool operator ==(Object other) { + if (identical(this, other)) { + return true; + } + + if (other.runtimeType != runtimeType) { + return false; + } + + final _this = (this as StreamAvatarThemeData); + final _other = (other as StreamAvatarThemeData); + + return _other.size == _this.size && + _other.backgroundColor == _this.backgroundColor && + _other.foregroundColor == _this.foregroundColor && + _other.border == _this.border; + } + + @override + int get hashCode { + final _this = (this as StreamAvatarThemeData); + + return Object.hash( + runtimeType, + _this.size, + _this.backgroundColor, + _this.foregroundColor, + _this.border, + ); + } +} diff --git a/packages/stream_core_flutter/lib/src/theme/components/stream_badge_count_theme.dart b/packages/stream_core_flutter/lib/src/theme/components/stream_badge_count_theme.dart new file mode 100644 index 0000000..bba210c --- /dev/null +++ b/packages/stream_core_flutter/lib/src/theme/components/stream_badge_count_theme.dart @@ -0,0 +1,152 @@ +import 'package:flutter/widgets.dart'; +import 'package:theme_extensions_builder_annotation/theme_extensions_builder_annotation.dart'; + +import '../stream_theme.dart'; + +part 'stream_badge_count_theme.g.theme.dart'; + +/// Predefined sizes for the badge count indicator. +/// +/// Each size corresponds to a specific height in logical pixels. +/// +/// See also: +/// +/// * [StreamBadgeCount], which uses these size variants. +/// * [StreamBadgeCountThemeData.size], for setting a global default size. +enum StreamBadgeCountSize { + /// Extra small badge (20px height). + xs(20), + + /// Small badge (24px height). + sm(24), + + /// Medium badge (32px height). + md(32) + ; + + /// Constructs a [StreamBadgeCountSize] with the given height. + const StreamBadgeCountSize(this.value); + + /// The height of the badge in logical pixels. + final double value; +} + +/// Applies a badge count theme to descendant [StreamBadgeCount] widgets. +/// +/// Wrap a subtree with [StreamBadgeCountTheme] to override badge styling. +/// Access the merged theme using [BuildContext.streamBadgeCountTheme]. +/// +/// {@tool snippet} +/// +/// Override badge colors for a specific section: +/// +/// ```dart +/// StreamBadgeCountTheme( +/// data: StreamBadgeCountThemeData( +/// backgroundColor: Colors.red, +/// textColor: Colors.white, +/// ), +/// child: StreamBadgeCount(label: '5'), +/// ) +/// ``` +/// {@end-tool} +/// +/// See also: +/// +/// * [StreamBadgeCountThemeData], which describes the badge theme. +/// * [StreamBadgeCount], the widget affected by this theme. +class StreamBadgeCountTheme extends InheritedTheme { + /// Creates a badge count theme that controls descendant badges. + const StreamBadgeCountTheme({ + super.key, + required this.data, + required super.child, + }); + + /// The badge count theme data for descendant widgets. + final StreamBadgeCountThemeData data; + + /// Returns the [StreamBadgeCountThemeData] merged from local and global + /// themes. + /// + /// Local values from the nearest [StreamBadgeCountTheme] ancestor take + /// precedence over global values from [StreamTheme.of]. + /// + /// This allows partial overrides - for example, overriding only + /// [backgroundColor] while inheriting other properties from the global theme. + static StreamBadgeCountThemeData of(BuildContext context) { + final localTheme = context.dependOnInheritedWidgetOfExactType(); + return StreamTheme.of(context).badgeCountTheme.merge(localTheme?.data); + } + + @override + Widget wrap(BuildContext context, Widget child) { + return StreamBadgeCountTheme(data: data, child: child); + } + + @override + bool updateShouldNotify(StreamBadgeCountTheme oldWidget) => data != oldWidget.data; +} + +/// Theme data for customizing [StreamBadgeCount] widgets. +/// +/// {@tool snippet} +/// +/// Customize badge appearance globally: +/// +/// ```dart +/// StreamTheme( +/// badgeCountTheme: StreamBadgeCountThemeData( +/// size: StreamBadgeCountSize.sm, +/// backgroundColor: Colors.red, +/// textColor: Colors.white, +/// borderColor: Colors.white, +/// ), +/// ) +/// ``` +/// {@end-tool} +/// +/// See also: +/// +/// * [StreamBadgeCount], the widget that uses this theme data. +/// * [StreamBadgeCountTheme], for overriding theme in a widget subtree. +@themeGen +@immutable +class StreamBadgeCountThemeData with _$StreamBadgeCountThemeData { + /// Creates a badge count theme with optional style overrides. + const StreamBadgeCountThemeData({ + this.size, + this.textColor, + this.backgroundColor, + this.borderColor, + }); + + /// The default size for badge counts. + /// + /// Falls back to [StreamBadgeCountSize.xs]. + final StreamBadgeCountSize? size; + + /// The text color for the count label. + /// + /// Applied to the numeric count displayed inside the badge. + final Color? textColor; + + /// The background color of the badge. + /// + /// The fill color behind the count text. Typically uses a color that + /// contrasts with the surface it's placed on. + final Color? backgroundColor; + + /// The border color of the badge. + /// + /// A thin outline around the badge that helps separate it from the + /// underlying content. + final Color? borderColor; + + /// Linearly interpolate between two [StreamBadgeCountThemeData] objects. + static StreamBadgeCountThemeData? lerp( + StreamBadgeCountThemeData? a, + StreamBadgeCountThemeData? b, + double t, + ) => _$StreamBadgeCountThemeData.lerp(a, b, t); +} diff --git a/packages/stream_core_flutter/lib/src/theme/components/stream_badge_count_theme.g.theme.dart b/packages/stream_core_flutter/lib/src/theme/components/stream_badge_count_theme.g.theme.dart new file mode 100644 index 0000000..99450d3 --- /dev/null +++ b/packages/stream_core_flutter/lib/src/theme/components/stream_badge_count_theme.g.theme.dart @@ -0,0 +1,106 @@ +// dart format width=80 +// coverage:ignore-file +// GENERATED CODE - DO NOT MODIFY BY HAND +// ignore_for_file: type=lint, unused_element + +part of 'stream_badge_count_theme.dart'; + +// ************************************************************************** +// ThemeGenGenerator +// ************************************************************************** + +mixin _$StreamBadgeCountThemeData { + bool get canMerge => true; + + static StreamBadgeCountThemeData? lerp( + StreamBadgeCountThemeData? a, + StreamBadgeCountThemeData? b, + double t, + ) { + if (identical(a, b)) { + return a; + } + + if (a == null) { + return t == 1.0 ? b : null; + } + + if (b == null) { + return t == 0.0 ? a : null; + } + + return StreamBadgeCountThemeData( + size: t < 0.5 ? a.size : b.size, + textColor: Color.lerp(a.textColor, b.textColor, t), + backgroundColor: Color.lerp(a.backgroundColor, b.backgroundColor, t), + borderColor: Color.lerp(a.borderColor, b.borderColor, t), + ); + } + + StreamBadgeCountThemeData copyWith({ + StreamBadgeCountSize? size, + Color? textColor, + Color? backgroundColor, + Color? borderColor, + }) { + final _this = (this as StreamBadgeCountThemeData); + + return StreamBadgeCountThemeData( + size: size ?? _this.size, + textColor: textColor ?? _this.textColor, + backgroundColor: backgroundColor ?? _this.backgroundColor, + borderColor: borderColor ?? _this.borderColor, + ); + } + + StreamBadgeCountThemeData merge(StreamBadgeCountThemeData? other) { + final _this = (this as StreamBadgeCountThemeData); + + if (other == null || identical(_this, other)) { + return _this; + } + + if (!other.canMerge) { + return other; + } + + return copyWith( + size: other.size, + textColor: other.textColor, + backgroundColor: other.backgroundColor, + borderColor: other.borderColor, + ); + } + + @override + bool operator ==(Object other) { + if (identical(this, other)) { + return true; + } + + if (other.runtimeType != runtimeType) { + return false; + } + + final _this = (this as StreamBadgeCountThemeData); + final _other = (other as StreamBadgeCountThemeData); + + return _other.size == _this.size && + _other.textColor == _this.textColor && + _other.backgroundColor == _this.backgroundColor && + _other.borderColor == _this.borderColor; + } + + @override + int get hashCode { + final _this = (this as StreamBadgeCountThemeData); + + return Object.hash( + runtimeType, + _this.size, + _this.textColor, + _this.backgroundColor, + _this.borderColor, + ); + } +} diff --git a/packages/stream_core_flutter/lib/src/theme/components/stream_badge_notification_theme.dart b/packages/stream_core_flutter/lib/src/theme/components/stream_badge_notification_theme.dart new file mode 100644 index 0000000..40fc0a0 --- /dev/null +++ b/packages/stream_core_flutter/lib/src/theme/components/stream_badge_notification_theme.dart @@ -0,0 +1,127 @@ +import 'package:flutter/widgets.dart'; +import 'package:theme_extensions_builder_annotation/theme_extensions_builder_annotation.dart'; + +import '../stream_theme.dart'; + +part 'stream_badge_notification_theme.g.theme.dart'; + +/// Predefined sizes for the badge notification indicator. +/// +/// Each size corresponds to a specific height in logical pixels. +/// +/// See also: +/// +/// * [StreamBadgeNotification], which uses these size variants. +/// * [StreamBadgeNotificationThemeData.size], for setting a global default. +enum StreamBadgeNotificationSize { + /// Extra small badge (16px height). + xs(16), + + /// Small badge (20px height). + sm(20) + ; + + /// Constructs a [StreamBadgeNotificationSize] with the given height. + const StreamBadgeNotificationSize(this.value); + + /// The height of the badge in logical pixels. + final double value; +} + +/// The visual type of a [StreamBadgeNotification]. +/// +/// Determines which background color is applied to the badge. +enum StreamBadgeNotificationType { + /// Primary style — uses the brand accent color. + primary, + + /// Error style — uses the error accent color. + error, + + /// Neutral style — uses a muted neutral color. + neutral, +} + +/// Applies a badge notification theme to descendant widgets. +/// +/// Wrap a subtree with [StreamBadgeNotificationTheme] to override badge +/// notification styling. Access the merged theme using +/// [BuildContext.streamBadgeNotificationTheme]. +/// +/// See also: +/// +/// * [StreamBadgeNotificationThemeData], which describes the theme. +/// * [StreamBadgeNotification], the widget affected by this theme. +class StreamBadgeNotificationTheme extends InheritedTheme { + /// Creates a badge notification theme. + const StreamBadgeNotificationTheme({ + super.key, + required this.data, + required super.child, + }); + + /// The badge notification theme data for descendant widgets. + final StreamBadgeNotificationThemeData data; + + /// Returns the merged [StreamBadgeNotificationThemeData] from local and + /// global themes. + static StreamBadgeNotificationThemeData of(BuildContext context) { + final localTheme = context.dependOnInheritedWidgetOfExactType(); + return StreamTheme.of(context).badgeNotificationTheme.merge(localTheme?.data); + } + + @override + Widget wrap(BuildContext context, Widget child) { + return StreamBadgeNotificationTheme(data: data, child: child); + } + + @override + bool updateShouldNotify(StreamBadgeNotificationTheme oldWidget) => data != oldWidget.data; +} + +/// Theme data for customizing [StreamBadgeNotification] widgets. +/// +/// See also: +/// +/// * [StreamBadgeNotification], the widget that uses this theme data. +/// * [StreamBadgeNotificationTheme], for overriding theme in a widget subtree. +@themeGen +@immutable +class StreamBadgeNotificationThemeData with _$StreamBadgeNotificationThemeData { + /// Creates a badge notification theme with optional style overrides. + const StreamBadgeNotificationThemeData({ + this.size, + this.primaryBackgroundColor, + this.errorBackgroundColor, + this.neutralBackgroundColor, + this.textColor, + this.borderColor, + }); + + /// The default size for badge notifications. + /// + /// Falls back to [StreamBadgeNotificationSize.sm]. + final StreamBadgeNotificationSize? size; + + /// The background color for the [StreamBadgeNotificationType.primary] type. + final Color? primaryBackgroundColor; + + /// The background color for the [StreamBadgeNotificationType.error] type. + final Color? errorBackgroundColor; + + /// The background color for the [StreamBadgeNotificationType.neutral] type. + final Color? neutralBackgroundColor; + + /// The text color for the count label. + final Color? textColor; + + /// The border color of the badge. + final Color? borderColor; + + /// Linearly interpolate between two [StreamBadgeNotificationThemeData]. + static StreamBadgeNotificationThemeData? lerp( + StreamBadgeNotificationThemeData? a, + StreamBadgeNotificationThemeData? b, + double t, + ) => _$StreamBadgeNotificationThemeData.lerp(a, b, t); +} diff --git a/packages/stream_core_flutter/lib/src/theme/components/stream_badge_notification_theme.g.theme.dart b/packages/stream_core_flutter/lib/src/theme/components/stream_badge_notification_theme.g.theme.dart new file mode 100644 index 0000000..cbb6539 --- /dev/null +++ b/packages/stream_core_flutter/lib/src/theme/components/stream_badge_notification_theme.g.theme.dart @@ -0,0 +1,134 @@ +// dart format width=80 +// coverage:ignore-file +// GENERATED CODE - DO NOT MODIFY BY HAND +// ignore_for_file: type=lint, unused_element + +part of 'stream_badge_notification_theme.dart'; + +// ************************************************************************** +// ThemeGenGenerator +// ************************************************************************** + +mixin _$StreamBadgeNotificationThemeData { + bool get canMerge => true; + + static StreamBadgeNotificationThemeData? lerp( + StreamBadgeNotificationThemeData? a, + StreamBadgeNotificationThemeData? b, + double t, + ) { + if (identical(a, b)) { + return a; + } + + if (a == null) { + return t == 1.0 ? b : null; + } + + if (b == null) { + return t == 0.0 ? a : null; + } + + return StreamBadgeNotificationThemeData( + size: t < 0.5 ? a.size : b.size, + primaryBackgroundColor: Color.lerp( + a.primaryBackgroundColor, + b.primaryBackgroundColor, + t, + ), + errorBackgroundColor: Color.lerp( + a.errorBackgroundColor, + b.errorBackgroundColor, + t, + ), + neutralBackgroundColor: Color.lerp( + a.neutralBackgroundColor, + b.neutralBackgroundColor, + t, + ), + textColor: Color.lerp(a.textColor, b.textColor, t), + borderColor: Color.lerp(a.borderColor, b.borderColor, t), + ); + } + + StreamBadgeNotificationThemeData copyWith({ + StreamBadgeNotificationSize? size, + Color? primaryBackgroundColor, + Color? errorBackgroundColor, + Color? neutralBackgroundColor, + Color? textColor, + Color? borderColor, + }) { + final _this = (this as StreamBadgeNotificationThemeData); + + return StreamBadgeNotificationThemeData( + size: size ?? _this.size, + primaryBackgroundColor: + primaryBackgroundColor ?? _this.primaryBackgroundColor, + errorBackgroundColor: errorBackgroundColor ?? _this.errorBackgroundColor, + neutralBackgroundColor: + neutralBackgroundColor ?? _this.neutralBackgroundColor, + textColor: textColor ?? _this.textColor, + borderColor: borderColor ?? _this.borderColor, + ); + } + + StreamBadgeNotificationThemeData merge( + StreamBadgeNotificationThemeData? other, + ) { + final _this = (this as StreamBadgeNotificationThemeData); + + if (other == null || identical(_this, other)) { + return _this; + } + + if (!other.canMerge) { + return other; + } + + return copyWith( + size: other.size, + primaryBackgroundColor: other.primaryBackgroundColor, + errorBackgroundColor: other.errorBackgroundColor, + neutralBackgroundColor: other.neutralBackgroundColor, + textColor: other.textColor, + borderColor: other.borderColor, + ); + } + + @override + bool operator ==(Object other) { + if (identical(this, other)) { + return true; + } + + if (other.runtimeType != runtimeType) { + return false; + } + + final _this = (this as StreamBadgeNotificationThemeData); + final _other = (other as StreamBadgeNotificationThemeData); + + return _other.size == _this.size && + _other.primaryBackgroundColor == _this.primaryBackgroundColor && + _other.errorBackgroundColor == _this.errorBackgroundColor && + _other.neutralBackgroundColor == _this.neutralBackgroundColor && + _other.textColor == _this.textColor && + _other.borderColor == _this.borderColor; + } + + @override + int get hashCode { + final _this = (this as StreamBadgeNotificationThemeData); + + return Object.hash( + runtimeType, + _this.size, + _this.primaryBackgroundColor, + _this.errorBackgroundColor, + _this.neutralBackgroundColor, + _this.textColor, + _this.borderColor, + ); + } +} diff --git a/packages/stream_core_flutter/lib/src/theme/components/stream_button_theme.dart b/packages/stream_core_flutter/lib/src/theme/components/stream_button_theme.dart new file mode 100644 index 0000000..aef4180 --- /dev/null +++ b/packages/stream_core_flutter/lib/src/theme/components/stream_button_theme.dart @@ -0,0 +1,197 @@ +import 'package:flutter/widgets.dart'; +import 'package:theme_extensions_builder_annotation/theme_extensions_builder_annotation.dart'; + +import '../stream_theme.dart'; + +part 'stream_button_theme.g.theme.dart'; + +/// Applies a button theme to descendant [StreamButton] widgets. +/// +/// Wrap a subtree with [StreamButtonTheme] to override button styling. +/// Access the merged theme using [BuildContext.streamButtonTheme]. +/// +/// {@tool snippet} +/// +/// Override button styling for a specific section: +/// +/// ```dart +/// StreamButtonTheme( +/// data: StreamButtonThemeData( +/// primary: StreamButtonTypeStyle( +/// solid: StreamButtonThemeStyle( +/// backgroundColor: WidgetStateProperty.all(Colors.blue), +/// ), +/// ), +/// ), +/// child: StreamButton( +/// label: 'Submit', +/// onTap: () {}, +/// ), +/// ) +/// ``` +/// {@end-tool} +/// +/// See also: +/// +/// * [StreamButtonThemeData], which describes the button theme. +/// * [StreamButton], which uses this theme. +class StreamButtonTheme extends InheritedTheme { + /// Creates a button theme that controls descendant buttons. + const StreamButtonTheme({ + super.key, + required this.data, + required super.child, + }); + + /// The button theme data for descendant widgets. + final StreamButtonThemeData data; + + /// Returns the [StreamButtonThemeData] from the current theme context. + /// + /// This merges the local theme (if any) with the global theme from + /// [StreamTheme]. + static StreamButtonThemeData of(BuildContext context) { + final localTheme = context.dependOnInheritedWidgetOfExactType(); + return StreamTheme.of(context).buttonTheme.merge(localTheme?.data); + } + + @override + Widget wrap(BuildContext context, Widget child) { + return StreamButtonTheme(data: data, child: child); + } + + @override + bool updateShouldNotify(StreamButtonTheme oldWidget) => data != oldWidget.data; +} + +/// Theme data for customizing [StreamButton] widgets. +/// +/// Organizes button styles by [StreamButtonStyle] variant (primary, +/// secondary, destructive). Each variant can define styles for all +/// [StreamButtonType]s (solid, outline, ghost). +/// +/// See also: +/// +/// * [StreamButtonTheme], for overriding theme in a widget subtree. +/// * [StreamButtonTypeStyle], for per-type styling. +@themeGen +@immutable +class StreamButtonThemeData with _$StreamButtonThemeData { + /// Creates button theme data with optional style overrides per variant. + const StreamButtonThemeData({ + this.primary, + this.secondary, + this.destructive, + }); + + /// Styles for primary (brand/accent) buttons. + final StreamButtonTypeStyle? primary; + + /// Styles for secondary (neutral) buttons. + final StreamButtonTypeStyle? secondary; + + /// Styles for destructive (error/danger) buttons. + final StreamButtonTypeStyle? destructive; + + /// Linearly interpolate between two [StreamButtonThemeData] objects. + static StreamButtonThemeData? lerp( + StreamButtonThemeData? a, + StreamButtonThemeData? b, + double t, + ) => _$StreamButtonThemeData.lerp(a, b, t); +} + +/// Organizes button theme styles by [StreamButtonType] variant. +/// +/// See also: +/// +/// * [StreamButtonThemeData], which uses this per style variant. +/// * [StreamButtonThemeStyle], for the individual style properties. +@themeGen +@immutable +class StreamButtonTypeStyle with _$StreamButtonTypeStyle { + /// Creates type-specific button styles. + const StreamButtonTypeStyle({ + this.solid, + this.outline, + this.ghost, + }); + + /// Style for solid (filled) buttons. + final StreamButtonThemeStyle? solid; + + /// Style for outline (bordered) buttons. + final StreamButtonThemeStyle? outline; + + /// Style for ghost (borderless) buttons. + final StreamButtonThemeStyle? ghost; + + /// Linearly interpolate between two [StreamButtonTypeStyle] objects. + static StreamButtonTypeStyle? lerp( + StreamButtonTypeStyle? a, + StreamButtonTypeStyle? b, + double t, + ) => _$StreamButtonTypeStyle.lerp(a, b, t); +} + +/// Visual styling properties for a single button style/type combination. +/// +/// Defines the appearance of buttons including colors and borders. +/// All color properties support state-based styling for interactive feedback +/// (default, hover, pressed, disabled, selected). +/// +/// See also: +/// +/// * [StreamButtonTypeStyle], which wraps this style per type variant. +/// * [StreamButton], which uses this styling. +@themeGen +@immutable +class StreamButtonThemeStyle with _$StreamButtonThemeStyle { + /// Creates button style properties. + const StreamButtonThemeStyle({ + this.backgroundColor, + this.foregroundColor, + this.borderColor, + this.overlayColor, + this.elevation, + this.iconSize, + }); + + /// The background color for the button. + /// + /// Supports state-based colors for different interaction states + /// (default, hover, pressed, disabled, selected). + final WidgetStateProperty? backgroundColor; + + /// The foreground color for the button text and icons. + /// + /// Supports state-based colors for different interaction states. + final WidgetStateProperty? foregroundColor; + + /// The border color for the button. + /// + /// Typically used by outline-type buttons. If null, no border is rendered. + final WidgetStateProperty? borderColor; + + /// The overlay color for the button's interaction feedback. + /// + /// Supports state-based colors for hover and press states. + final WidgetStateProperty? overlayColor; + + /// The elevation of the button. + /// + /// Controls the shadow depth. Typically non-zero only for floating buttons. + final WidgetStateProperty? elevation; + + /// The size of icons inside the button. + /// + /// If null, defaults to 20. + final WidgetStateProperty? iconSize; + + /// Linearly interpolate between two [StreamButtonThemeStyle] objects. + static StreamButtonThemeStyle? lerp( + StreamButtonThemeStyle? a, + StreamButtonThemeStyle? b, + double t, + ) => _$StreamButtonThemeStyle.lerp(a, b, t); +} diff --git a/packages/stream_core_flutter/lib/src/theme/components/stream_button_theme.g.theme.dart b/packages/stream_core_flutter/lib/src/theme/components/stream_button_theme.g.theme.dart new file mode 100644 index 0000000..c9e8b81 --- /dev/null +++ b/packages/stream_core_flutter/lib/src/theme/components/stream_button_theme.g.theme.dart @@ -0,0 +1,324 @@ +// dart format width=80 +// coverage:ignore-file +// GENERATED CODE - DO NOT MODIFY BY HAND +// ignore_for_file: type=lint, unused_element + +part of 'stream_button_theme.dart'; + +// ************************************************************************** +// ThemeGenGenerator +// ************************************************************************** + +mixin _$StreamButtonThemeData { + bool get canMerge => true; + + static StreamButtonThemeData? lerp( + StreamButtonThemeData? a, + StreamButtonThemeData? b, + double t, + ) { + if (identical(a, b)) { + return a; + } + + if (a == null) { + return t == 1.0 ? b : null; + } + + if (b == null) { + return t == 0.0 ? a : null; + } + + return StreamButtonThemeData( + primary: StreamButtonTypeStyle.lerp(a.primary, b.primary, t), + secondary: StreamButtonTypeStyle.lerp(a.secondary, b.secondary, t), + destructive: StreamButtonTypeStyle.lerp(a.destructive, b.destructive, t), + ); + } + + StreamButtonThemeData copyWith({ + StreamButtonTypeStyle? primary, + StreamButtonTypeStyle? secondary, + StreamButtonTypeStyle? destructive, + }) { + final _this = (this as StreamButtonThemeData); + + return StreamButtonThemeData( + primary: primary ?? _this.primary, + secondary: secondary ?? _this.secondary, + destructive: destructive ?? _this.destructive, + ); + } + + StreamButtonThemeData merge(StreamButtonThemeData? other) { + final _this = (this as StreamButtonThemeData); + + if (other == null || identical(_this, other)) { + return _this; + } + + if (!other.canMerge) { + return other; + } + + return copyWith( + primary: _this.primary?.merge(other.primary) ?? other.primary, + secondary: _this.secondary?.merge(other.secondary) ?? other.secondary, + destructive: + _this.destructive?.merge(other.destructive) ?? other.destructive, + ); + } + + @override + bool operator ==(Object other) { + if (identical(this, other)) { + return true; + } + + if (other.runtimeType != runtimeType) { + return false; + } + + final _this = (this as StreamButtonThemeData); + final _other = (other as StreamButtonThemeData); + + return _other.primary == _this.primary && + _other.secondary == _this.secondary && + _other.destructive == _this.destructive; + } + + @override + int get hashCode { + final _this = (this as StreamButtonThemeData); + + return Object.hash( + runtimeType, + _this.primary, + _this.secondary, + _this.destructive, + ); + } +} + +mixin _$StreamButtonTypeStyle { + bool get canMerge => true; + + static StreamButtonTypeStyle? lerp( + StreamButtonTypeStyle? a, + StreamButtonTypeStyle? b, + double t, + ) { + if (identical(a, b)) { + return a; + } + + if (a == null) { + return t == 1.0 ? b : null; + } + + if (b == null) { + return t == 0.0 ? a : null; + } + + return StreamButtonTypeStyle( + solid: StreamButtonThemeStyle.lerp(a.solid, b.solid, t), + outline: StreamButtonThemeStyle.lerp(a.outline, b.outline, t), + ghost: StreamButtonThemeStyle.lerp(a.ghost, b.ghost, t), + ); + } + + StreamButtonTypeStyle copyWith({ + StreamButtonThemeStyle? solid, + StreamButtonThemeStyle? outline, + StreamButtonThemeStyle? ghost, + }) { + final _this = (this as StreamButtonTypeStyle); + + return StreamButtonTypeStyle( + solid: solid ?? _this.solid, + outline: outline ?? _this.outline, + ghost: ghost ?? _this.ghost, + ); + } + + StreamButtonTypeStyle merge(StreamButtonTypeStyle? other) { + final _this = (this as StreamButtonTypeStyle); + + if (other == null || identical(_this, other)) { + return _this; + } + + if (!other.canMerge) { + return other; + } + + return copyWith( + solid: _this.solid?.merge(other.solid) ?? other.solid, + outline: _this.outline?.merge(other.outline) ?? other.outline, + ghost: _this.ghost?.merge(other.ghost) ?? other.ghost, + ); + } + + @override + bool operator ==(Object other) { + if (identical(this, other)) { + return true; + } + + if (other.runtimeType != runtimeType) { + return false; + } + + final _this = (this as StreamButtonTypeStyle); + final _other = (other as StreamButtonTypeStyle); + + return _other.solid == _this.solid && + _other.outline == _this.outline && + _other.ghost == _this.ghost; + } + + @override + int get hashCode { + final _this = (this as StreamButtonTypeStyle); + + return Object.hash(runtimeType, _this.solid, _this.outline, _this.ghost); + } +} + +mixin _$StreamButtonThemeStyle { + bool get canMerge => true; + + static StreamButtonThemeStyle? lerp( + StreamButtonThemeStyle? a, + StreamButtonThemeStyle? b, + double t, + ) { + if (identical(a, b)) { + return a; + } + + if (a == null) { + return t == 1.0 ? b : null; + } + + if (b == null) { + return t == 0.0 ? a : null; + } + + return StreamButtonThemeStyle( + backgroundColor: WidgetStateProperty.lerp( + a.backgroundColor, + b.backgroundColor, + t, + Color.lerp, + ), + foregroundColor: WidgetStateProperty.lerp( + a.foregroundColor, + b.foregroundColor, + t, + Color.lerp, + ), + borderColor: WidgetStateProperty.lerp( + a.borderColor, + b.borderColor, + t, + Color.lerp, + ), + overlayColor: WidgetStateProperty.lerp( + a.overlayColor, + b.overlayColor, + t, + Color.lerp, + ), + elevation: WidgetStateProperty.lerp( + a.elevation, + b.elevation, + t, + lerpDouble$, + ), + iconSize: WidgetStateProperty.lerp( + a.iconSize, + b.iconSize, + t, + lerpDouble$, + ), + ); + } + + StreamButtonThemeStyle copyWith({ + WidgetStateProperty? backgroundColor, + WidgetStateProperty? foregroundColor, + WidgetStateProperty? borderColor, + WidgetStateProperty? overlayColor, + WidgetStateProperty? elevation, + WidgetStateProperty? iconSize, + }) { + final _this = (this as StreamButtonThemeStyle); + + return StreamButtonThemeStyle( + backgroundColor: backgroundColor ?? _this.backgroundColor, + foregroundColor: foregroundColor ?? _this.foregroundColor, + borderColor: borderColor ?? _this.borderColor, + overlayColor: overlayColor ?? _this.overlayColor, + elevation: elevation ?? _this.elevation, + iconSize: iconSize ?? _this.iconSize, + ); + } + + StreamButtonThemeStyle merge(StreamButtonThemeStyle? other) { + final _this = (this as StreamButtonThemeStyle); + + if (other == null || identical(_this, other)) { + return _this; + } + + if (!other.canMerge) { + return other; + } + + return copyWith( + backgroundColor: other.backgroundColor, + foregroundColor: other.foregroundColor, + borderColor: other.borderColor, + overlayColor: other.overlayColor, + elevation: other.elevation, + iconSize: other.iconSize, + ); + } + + @override + bool operator ==(Object other) { + if (identical(this, other)) { + return true; + } + + if (other.runtimeType != runtimeType) { + return false; + } + + final _this = (this as StreamButtonThemeStyle); + final _other = (other as StreamButtonThemeStyle); + + return _other.backgroundColor == _this.backgroundColor && + _other.foregroundColor == _this.foregroundColor && + _other.borderColor == _this.borderColor && + _other.overlayColor == _this.overlayColor && + _other.elevation == _this.elevation && + _other.iconSize == _this.iconSize; + } + + @override + int get hashCode { + final _this = (this as StreamButtonThemeStyle); + + return Object.hash( + runtimeType, + _this.backgroundColor, + _this.foregroundColor, + _this.borderColor, + _this.overlayColor, + _this.elevation, + _this.iconSize, + ); + } +} diff --git a/packages/stream_core_flutter/lib/src/theme/components/stream_checkbox_theme.dart b/packages/stream_core_flutter/lib/src/theme/components/stream_checkbox_theme.dart new file mode 100644 index 0000000..e5dc6b1 --- /dev/null +++ b/packages/stream_core_flutter/lib/src/theme/components/stream_checkbox_theme.dart @@ -0,0 +1,216 @@ +import 'package:flutter/widgets.dart'; +import 'package:theme_extensions_builder_annotation/theme_extensions_builder_annotation.dart'; + +import '../stream_theme.dart'; + +part 'stream_checkbox_theme.g.theme.dart'; + +/// Predefined sizes for [StreamCheckbox]. +/// +/// Each size corresponds to a specific dimension in logical pixels. +/// +/// See also: +/// +/// * [StreamCheckboxStyle.size], for setting a global default size. +enum StreamCheckboxSize { + /// Small checkbox (20px). + sm(20), + + /// Medium checkbox (24px). + md(24) + ; + + /// Constructs a [StreamCheckboxSize] with the given dimension. + const StreamCheckboxSize(this.value); + + /// The dimension of the checkbox in logical pixels. + final double value; +} + +/// Applies a checkbox theme to descendant [StreamCheckbox] widgets. +/// +/// Wrap a subtree with [StreamCheckboxTheme] to override checkbox styling. +/// Access the merged theme using [BuildContext.streamCheckboxTheme]. +/// +/// {@tool snippet} +/// +/// Override checkbox styling for a specific section: +/// +/// ```dart +/// StreamCheckboxTheme( +/// data: StreamCheckboxThemeData( +/// style: StreamCheckboxStyle( +/// size: StreamCheckboxSize.sm, +/// ), +/// ), +/// child: StreamCheckbox( +/// value: true, +/// onChanged: (value) {}, +/// ), +/// ) +/// ``` +/// {@end-tool} +/// +/// See also: +/// +/// * [StreamCheckboxThemeData], which describes the checkbox theme. +/// * [StreamCheckbox], the widget affected by this theme. +class StreamCheckboxTheme extends InheritedTheme { + /// Creates a checkbox theme that controls descendant checkboxes. + const StreamCheckboxTheme({ + super.key, + required this.data, + required super.child, + }); + + /// The checkbox theme data for descendant widgets. + final StreamCheckboxThemeData data; + + /// Returns the [StreamCheckboxThemeData] merged from local and global themes. + /// + /// Local values from the nearest [StreamCheckboxTheme] ancestor take + /// precedence over global values from [StreamTheme.of]. + static StreamCheckboxThemeData of(BuildContext context) { + final localTheme = context.dependOnInheritedWidgetOfExactType(); + return StreamTheme.of(context).checkboxTheme.merge(localTheme?.data); + } + + @override + Widget wrap(BuildContext context, Widget child) { + return StreamCheckboxTheme(data: data, child: child); + } + + @override + bool updateShouldNotify(StreamCheckboxTheme oldWidget) => data != oldWidget.data; +} + +/// Theme data for customizing [StreamCheckbox] widgets. +/// +/// {@tool snippet} +/// +/// Customize checkbox appearance globally via [StreamTheme]: +/// +/// ```dart +/// StreamTheme( +/// data: StreamThemeData( +/// checkboxTheme: StreamCheckboxThemeData( +/// style: StreamCheckboxStyle( +/// size: StreamCheckboxSize.sm, +/// fillColor: WidgetStateProperty.resolveWith((states) { +/// if (states.contains(WidgetState.selected)) { +/// return Colors.green; +/// } +/// return Colors.transparent; +/// }), +/// ), +/// ), +/// ), +/// child: MyApp(), +/// ) +/// ``` +/// {@end-tool} +/// +/// See also: +/// +/// * [StreamCheckboxTheme], for overriding theme in a widget subtree. +@themeGen +@immutable +class StreamCheckboxThemeData with _$StreamCheckboxThemeData { + /// Creates checkbox theme data with optional style overrides. + const StreamCheckboxThemeData({this.style}); + + /// The visual styling for checkboxes. + /// + /// Contains size, fill color, check color, overlay color, border, and shape. + final StreamCheckboxStyle? style; + + /// Linearly interpolate between two [StreamCheckboxThemeData] objects. + static StreamCheckboxThemeData? lerp( + StreamCheckboxThemeData? a, + StreamCheckboxThemeData? b, + double t, + ) => _$StreamCheckboxThemeData.lerp(a, b, t); +} + +/// Visual styling properties for checkboxes. +/// +/// Defines the appearance of checkboxes including size, colors, border, and +/// shape. All color properties support state-based styling via +/// [WidgetStateProperty] for interactive feedback (default, hover, pressed, +/// disabled, selected). +/// +/// This follows the same pattern as Flutter's [CheckboxThemeData] where +/// `fillColor`, `checkColor`, and `overlayColor` are state-dependent. +/// +/// See also: +/// +/// * [StreamCheckboxThemeData], which wraps this style for theming. +/// * [StreamCheckbox], which uses this styling. +@themeGen +@immutable +class StreamCheckboxStyle with _$StreamCheckboxStyle { + /// Creates checkbox style properties. + const StreamCheckboxStyle({ + this.size, + this.checkSize, + this.fillColor, + this.checkColor, + this.overlayColor, + this.shape, + WidgetStateProperty? side, + }) : side = side as WidgetStateBorderSide?; + + /// The size of checkboxes. + /// + /// Falls back to [StreamCheckboxSize.md]. + final StreamCheckboxSize? size; + + /// The size of the checkmark icon inside the checkbox. + /// + /// If null, defaults to 16. + final double? checkSize; + + /// The color that fills the checkbox, resolved per [WidgetState]. + /// + /// Resolves based on: + /// * [WidgetState.selected] -- accent color when checked. + /// * [WidgetState.disabled] + [WidgetState.selected] -- disabled background. + /// + /// Transparent when not selected, giving a border-only appearance. + final WidgetStateProperty? fillColor; + + /// The color of the checkmark icon, resolved per [WidgetState]. + /// + /// Resolves based on: + /// * [WidgetState.selected] -- high-contrast color against the fill. + /// * [WidgetState.disabled] + [WidgetState.selected] -- muted color. + /// + /// Transparent when not selected so the icon is hidden. + final WidgetStateProperty? checkColor; + + /// The overlay color for interaction feedback, resolved per [WidgetState]. + /// + /// Resolves based on: + /// * [WidgetState.hovered] -- hover overlay. + /// * [WidgetState.pressed] -- pressed overlay. + final WidgetStateProperty? overlayColor; + + /// The shape of the checkbox. + /// + /// Defaults to a [RoundedRectangleBorder] with the design system's + /// small radius. + final OutlinedBorder? shape; + + /// The border of the checkbox, resolved per [WidgetState]. + /// + /// Visible when unchecked, [BorderSide.none] when checked, and uses the + /// disabled border color when disabled. + final WidgetStateBorderSide? side; + + /// Linearly interpolate between two [StreamCheckboxStyle] objects. + static StreamCheckboxStyle? lerp( + StreamCheckboxStyle? a, + StreamCheckboxStyle? b, + double t, + ) => _$StreamCheckboxStyle.lerp(a, b, t); +} diff --git a/packages/stream_core_flutter/lib/src/theme/components/stream_checkbox_theme.g.theme.dart b/packages/stream_core_flutter/lib/src/theme/components/stream_checkbox_theme.g.theme.dart new file mode 100644 index 0000000..fe589ec --- /dev/null +++ b/packages/stream_core_flutter/lib/src/theme/components/stream_checkbox_theme.g.theme.dart @@ -0,0 +1,208 @@ +// dart format width=80 +// coverage:ignore-file +// GENERATED CODE - DO NOT MODIFY BY HAND +// ignore_for_file: type=lint, unused_element + +part of 'stream_checkbox_theme.dart'; + +// ************************************************************************** +// ThemeGenGenerator +// ************************************************************************** + +mixin _$StreamCheckboxThemeData { + bool get canMerge => true; + + static StreamCheckboxThemeData? lerp( + StreamCheckboxThemeData? a, + StreamCheckboxThemeData? b, + double t, + ) { + if (identical(a, b)) { + return a; + } + + if (a == null) { + return t == 1.0 ? b : null; + } + + if (b == null) { + return t == 0.0 ? a : null; + } + + return StreamCheckboxThemeData( + style: StreamCheckboxStyle.lerp(a.style, b.style, t), + ); + } + + StreamCheckboxThemeData copyWith({StreamCheckboxStyle? style}) { + final _this = (this as StreamCheckboxThemeData); + + return StreamCheckboxThemeData(style: style ?? _this.style); + } + + StreamCheckboxThemeData merge(StreamCheckboxThemeData? other) { + final _this = (this as StreamCheckboxThemeData); + + if (other == null || identical(_this, other)) { + return _this; + } + + if (!other.canMerge) { + return other; + } + + return copyWith(style: _this.style?.merge(other.style) ?? other.style); + } + + @override + bool operator ==(Object other) { + if (identical(this, other)) { + return true; + } + + if (other.runtimeType != runtimeType) { + return false; + } + + final _this = (this as StreamCheckboxThemeData); + final _other = (other as StreamCheckboxThemeData); + + return _other.style == _this.style; + } + + @override + int get hashCode { + final _this = (this as StreamCheckboxThemeData); + + return Object.hash(runtimeType, _this.style); + } +} + +mixin _$StreamCheckboxStyle { + bool get canMerge => true; + + static StreamCheckboxStyle? lerp( + StreamCheckboxStyle? a, + StreamCheckboxStyle? b, + double t, + ) { + if (identical(a, b)) { + return a; + } + + if (a == null) { + return t == 1.0 ? b : null; + } + + if (b == null) { + return t == 0.0 ? a : null; + } + + return StreamCheckboxStyle( + size: t < 0.5 ? a.size : b.size, + checkSize: lerpDouble$(a.checkSize, b.checkSize, t), + fillColor: WidgetStateProperty.lerp( + a.fillColor, + b.fillColor, + t, + Color.lerp, + ), + checkColor: WidgetStateProperty.lerp( + a.checkColor, + b.checkColor, + t, + Color.lerp, + ), + overlayColor: WidgetStateProperty.lerp( + a.overlayColor, + b.overlayColor, + t, + Color.lerp, + ), + shape: OutlinedBorder.lerp(a.shape, b.shape, t), + side: WidgetStateBorderSide.lerp(a.side, b.side, t), + ); + } + + StreamCheckboxStyle copyWith({ + StreamCheckboxSize? size, + double? checkSize, + WidgetStateProperty? fillColor, + WidgetStateProperty? checkColor, + WidgetStateProperty? overlayColor, + OutlinedBorder? shape, + WidgetStateBorderSide? side, + }) { + final _this = (this as StreamCheckboxStyle); + + return StreamCheckboxStyle( + size: size ?? _this.size, + checkSize: checkSize ?? _this.checkSize, + fillColor: fillColor ?? _this.fillColor, + checkColor: checkColor ?? _this.checkColor, + overlayColor: overlayColor ?? _this.overlayColor, + shape: shape ?? _this.shape, + side: side ?? _this.side, + ); + } + + StreamCheckboxStyle merge(StreamCheckboxStyle? other) { + final _this = (this as StreamCheckboxStyle); + + if (other == null || identical(_this, other)) { + return _this; + } + + if (!other.canMerge) { + return other; + } + + return copyWith( + size: other.size, + checkSize: other.checkSize, + fillColor: other.fillColor, + checkColor: other.checkColor, + overlayColor: other.overlayColor, + shape: other.shape, + side: other.side, + ); + } + + @override + bool operator ==(Object other) { + if (identical(this, other)) { + return true; + } + + if (other.runtimeType != runtimeType) { + return false; + } + + final _this = (this as StreamCheckboxStyle); + final _other = (other as StreamCheckboxStyle); + + return _other.size == _this.size && + _other.checkSize == _this.checkSize && + _other.fillColor == _this.fillColor && + _other.checkColor == _this.checkColor && + _other.overlayColor == _this.overlayColor && + _other.shape == _this.shape && + _other.side == _this.side; + } + + @override + int get hashCode { + final _this = (this as StreamCheckboxStyle); + + return Object.hash( + runtimeType, + _this.size, + _this.checkSize, + _this.fillColor, + _this.checkColor, + _this.overlayColor, + _this.shape, + _this.side, + ); + } +} diff --git a/packages/stream_core_flutter/lib/src/theme/components/stream_context_menu_action_theme.dart b/packages/stream_core_flutter/lib/src/theme/components/stream_context_menu_action_theme.dart new file mode 100644 index 0000000..cfb4828 --- /dev/null +++ b/packages/stream_core_flutter/lib/src/theme/components/stream_context_menu_action_theme.dart @@ -0,0 +1,205 @@ +import 'package:flutter/widgets.dart'; +import 'package:theme_extensions_builder_annotation/theme_extensions_builder_annotation.dart'; + +import '../stream_theme.dart'; + +part 'stream_context_menu_action_theme.g.theme.dart'; + +/// Applies a context menu action theme to descendant context menu action +/// widgets. +/// +/// Wrap a subtree with [StreamContextMenuActionTheme] to override context menu +/// action styling. Access the merged theme using +/// [BuildContext.streamContextMenuActionTheme]. +/// +/// {@tool snippet} +/// +/// Override context menu action styling for a specific section: +/// +/// ```dart +/// StreamContextMenuActionTheme( +/// data: StreamContextMenuActionThemeData( +/// style: StreamContextMenuActionStyle( +/// textStyle: WidgetStatePropertyAll(TextStyle(fontSize: 16)), +/// iconSize: WidgetStatePropertyAll(18), +/// ), +/// ), +/// child: StreamContextMenu( +/// children: [ +/// StreamContextMenuAction(label: Text('Reply')), +/// ], +/// ), +/// ) +/// ``` +/// {@end-tool} +/// +/// See also: +/// +/// * [StreamContextMenuActionThemeData], which describes the action theme. +/// * [StreamContextMenuActionStyle], for action-level styling. +/// * [StreamContextMenuAction], which uses this theme. +class StreamContextMenuActionTheme extends InheritedTheme { + /// Creates a context menu action theme that controls descendant actions. + const StreamContextMenuActionTheme({ + super.key, + required this.data, + required super.child, + }); + + /// The context menu action theme data for descendant widgets. + final StreamContextMenuActionThemeData data; + + /// Returns the [StreamContextMenuActionThemeData] from the current theme + /// context. + /// + /// This merges the local theme (if any) with the global theme from + /// [StreamTheme]. + static StreamContextMenuActionThemeData of(BuildContext context) { + final localTheme = context.dependOnInheritedWidgetOfExactType(); + return StreamTheme.of(context).contextMenuActionTheme.merge(localTheme?.data); + } + + @override + Widget wrap(BuildContext context, Widget child) { + return StreamContextMenuActionTheme(data: data, child: child); + } + + @override + bool updateShouldNotify(StreamContextMenuActionTheme oldWidget) => data != oldWidget.data; +} + +/// Theme data for customizing context menu actions. +/// +/// {@tool snippet} +/// +/// Customize context menu action appearance globally: +/// +/// ```dart +/// StreamTheme( +/// contextMenuActionTheme: StreamContextMenuActionThemeData( +/// style: StreamContextMenuActionStyle( +/// textStyle: WidgetStatePropertyAll(TextStyle(fontSize: 14)), +/// iconSize: WidgetStatePropertyAll(20), +/// padding: WidgetStatePropertyAll(EdgeInsets.all(8)), +/// ), +/// ), +/// ) +/// ``` +/// {@end-tool} +/// +/// See also: +/// +/// * [StreamContextMenuActionTheme], for overriding theme in a widget subtree. +/// * [StreamContextMenuActionStyle], for action-level styling. +@themeGen +@immutable +class StreamContextMenuActionThemeData with _$StreamContextMenuActionThemeData { + /// Creates a context menu action theme with optional style overrides. + const StreamContextMenuActionThemeData({this.style}); + + /// The visual styling for context menu actions. + /// + /// Contains text style, icon size, padding, border radius, and + /// state-based color properties. + final StreamContextMenuActionStyle? style; + + /// Linearly interpolate between two [StreamContextMenuActionThemeData] + /// values. + static StreamContextMenuActionThemeData? lerp( + StreamContextMenuActionThemeData? a, + StreamContextMenuActionThemeData? b, + double t, + ) => _$StreamContextMenuActionThemeData.lerp(a, b, t); +} + +/// Visual styling properties for context menu actions. +/// +/// Defines the appearance of menu actions including layout, text style, and +/// state-based colors. All properties are [WidgetStateProperty] to support +/// interactive feedback (default, hover, pressed, disabled), consistent +/// with Flutter's [ButtonStyle] pattern. +/// +/// See also: +/// +/// * [StreamContextMenuActionThemeData], which contains this style. +/// * [StreamContextMenuAction], which uses this styling. +@themeGen +@immutable +class StreamContextMenuActionStyle with _$StreamContextMenuActionStyle { + /// Creates context menu action style properties. + const StreamContextMenuActionStyle({ + this.backgroundColor, + this.foregroundColor, + this.overlayColor, + this.iconColor, + this.textStyle, + this.iconSize, + this.minimumSize, + this.maximumSize, + this.padding, + this.shape, + }); + + /// The background color of the action. + /// + /// If null, defaults to [StreamColors.transparent]. + final WidgetStateProperty? backgroundColor; + + /// The foreground color for the action's text and icons. + /// + /// This is the default color for both text and icon descendants. To + /// override the icon color independently, use [iconColor]. + /// + /// Supports state-based colors for different interaction states + /// (default, hover, pressed, disabled). + final WidgetStateProperty? foregroundColor; + + /// The overlay color for the action's interaction feedback. + /// + /// Supports state-based colors for hover and press states. + final WidgetStateProperty? overlayColor; + + /// The icon color inside the action. + /// + /// If null, the icon color falls back to [foregroundColor]. + final WidgetStateProperty? iconColor; + + /// The text style for the action label. + /// + /// If null, defaults to [StreamTextTheme.bodyEmphasis]. + /// The text color is controlled by [foregroundColor]. + final WidgetStateProperty? textStyle; + + /// The size of icons in the action. + /// + /// If null, defaults to 20. + final WidgetStateProperty? iconSize; + + /// The minimum size of the action. + /// + /// If null, defaults to `Size(242, 40)`. + final WidgetStateProperty? minimumSize; + + /// The maximum size of the action. + /// + /// If null, defaults to [Size.infinite] (no maximum constraint). + final WidgetStateProperty? maximumSize; + + /// The padding inside the action. + /// + /// If null, defaults are derived from [StreamSpacing]. + final WidgetStateProperty? padding; + + /// The shape of the action's underlying surface. + /// + /// If null, defaults to a [RoundedRectangleBorder] with + /// [StreamRadius.md] border radius. + final WidgetStateProperty? shape; + + /// Linearly interpolate between two [StreamContextMenuActionStyle] values. + static StreamContextMenuActionStyle? lerp( + StreamContextMenuActionStyle? a, + StreamContextMenuActionStyle? b, + double t, + ) => _$StreamContextMenuActionStyle.lerp(a, b, t); +} diff --git a/packages/stream_core_flutter/lib/src/theme/components/stream_context_menu_action_theme.g.theme.dart b/packages/stream_core_flutter/lib/src/theme/components/stream_context_menu_action_theme.g.theme.dart new file mode 100644 index 0000000..fb89d20 --- /dev/null +++ b/packages/stream_core_flutter/lib/src/theme/components/stream_context_menu_action_theme.g.theme.dart @@ -0,0 +1,265 @@ +// dart format width=80 +// coverage:ignore-file +// GENERATED CODE - DO NOT MODIFY BY HAND +// ignore_for_file: type=lint, unused_element + +part of 'stream_context_menu_action_theme.dart'; + +// ************************************************************************** +// ThemeGenGenerator +// ************************************************************************** + +mixin _$StreamContextMenuActionThemeData { + bool get canMerge => true; + + static StreamContextMenuActionThemeData? lerp( + StreamContextMenuActionThemeData? a, + StreamContextMenuActionThemeData? b, + double t, + ) { + if (identical(a, b)) { + return a; + } + + if (a == null) { + return t == 1.0 ? b : null; + } + + if (b == null) { + return t == 0.0 ? a : null; + } + + return StreamContextMenuActionThemeData( + style: StreamContextMenuActionStyle.lerp(a.style, b.style, t), + ); + } + + StreamContextMenuActionThemeData copyWith({ + StreamContextMenuActionStyle? style, + }) { + final _this = (this as StreamContextMenuActionThemeData); + + return StreamContextMenuActionThemeData(style: style ?? _this.style); + } + + StreamContextMenuActionThemeData merge( + StreamContextMenuActionThemeData? other, + ) { + final _this = (this as StreamContextMenuActionThemeData); + + if (other == null || identical(_this, other)) { + return _this; + } + + if (!other.canMerge) { + return other; + } + + return copyWith(style: _this.style?.merge(other.style) ?? other.style); + } + + @override + bool operator ==(Object other) { + if (identical(this, other)) { + return true; + } + + if (other.runtimeType != runtimeType) { + return false; + } + + final _this = (this as StreamContextMenuActionThemeData); + final _other = (other as StreamContextMenuActionThemeData); + + return _other.style == _this.style; + } + + @override + int get hashCode { + final _this = (this as StreamContextMenuActionThemeData); + + return Object.hash(runtimeType, _this.style); + } +} + +mixin _$StreamContextMenuActionStyle { + bool get canMerge => true; + + static StreamContextMenuActionStyle? lerp( + StreamContextMenuActionStyle? a, + StreamContextMenuActionStyle? b, + double t, + ) { + if (identical(a, b)) { + return a; + } + + if (a == null) { + return t == 1.0 ? b : null; + } + + if (b == null) { + return t == 0.0 ? a : null; + } + + return StreamContextMenuActionStyle( + backgroundColor: WidgetStateProperty.lerp( + a.backgroundColor, + b.backgroundColor, + t, + Color.lerp, + ), + foregroundColor: WidgetStateProperty.lerp( + a.foregroundColor, + b.foregroundColor, + t, + Color.lerp, + ), + overlayColor: WidgetStateProperty.lerp( + a.overlayColor, + b.overlayColor, + t, + Color.lerp, + ), + iconColor: WidgetStateProperty.lerp( + a.iconColor, + b.iconColor, + t, + Color.lerp, + ), + textStyle: WidgetStateProperty.lerp( + a.textStyle, + b.textStyle, + t, + TextStyle.lerp, + ), + iconSize: WidgetStateProperty.lerp( + a.iconSize, + b.iconSize, + t, + lerpDouble$, + ), + minimumSize: WidgetStateProperty.lerp( + a.minimumSize, + b.minimumSize, + t, + Size.lerp, + ), + maximumSize: WidgetStateProperty.lerp( + a.maximumSize, + b.maximumSize, + t, + Size.lerp, + ), + padding: WidgetStateProperty.lerp( + a.padding, + b.padding, + t, + EdgeInsetsGeometry.lerp, + ), + shape: WidgetStateProperty.lerp( + a.shape, + b.shape, + t, + OutlinedBorder.lerp, + ), + ); + } + + StreamContextMenuActionStyle copyWith({ + WidgetStateProperty? backgroundColor, + WidgetStateProperty? foregroundColor, + WidgetStateProperty? overlayColor, + WidgetStateProperty? iconColor, + WidgetStateProperty? textStyle, + WidgetStateProperty? iconSize, + WidgetStateProperty? minimumSize, + WidgetStateProperty? maximumSize, + WidgetStateProperty? padding, + WidgetStateProperty? shape, + }) { + final _this = (this as StreamContextMenuActionStyle); + + return StreamContextMenuActionStyle( + backgroundColor: backgroundColor ?? _this.backgroundColor, + foregroundColor: foregroundColor ?? _this.foregroundColor, + overlayColor: overlayColor ?? _this.overlayColor, + iconColor: iconColor ?? _this.iconColor, + textStyle: textStyle ?? _this.textStyle, + iconSize: iconSize ?? _this.iconSize, + minimumSize: minimumSize ?? _this.minimumSize, + maximumSize: maximumSize ?? _this.maximumSize, + padding: padding ?? _this.padding, + shape: shape ?? _this.shape, + ); + } + + StreamContextMenuActionStyle merge(StreamContextMenuActionStyle? other) { + final _this = (this as StreamContextMenuActionStyle); + + if (other == null || identical(_this, other)) { + return _this; + } + + if (!other.canMerge) { + return other; + } + + return copyWith( + backgroundColor: other.backgroundColor, + foregroundColor: other.foregroundColor, + overlayColor: other.overlayColor, + iconColor: other.iconColor, + textStyle: other.textStyle, + iconSize: other.iconSize, + minimumSize: other.minimumSize, + maximumSize: other.maximumSize, + padding: other.padding, + shape: other.shape, + ); + } + + @override + bool operator ==(Object other) { + if (identical(this, other)) { + return true; + } + + if (other.runtimeType != runtimeType) { + return false; + } + + final _this = (this as StreamContextMenuActionStyle); + final _other = (other as StreamContextMenuActionStyle); + + return _other.backgroundColor == _this.backgroundColor && + _other.foregroundColor == _this.foregroundColor && + _other.overlayColor == _this.overlayColor && + _other.iconColor == _this.iconColor && + _other.textStyle == _this.textStyle && + _other.iconSize == _this.iconSize && + _other.minimumSize == _this.minimumSize && + _other.maximumSize == _this.maximumSize && + _other.padding == _this.padding && + _other.shape == _this.shape; + } + + @override + int get hashCode { + final _this = (this as StreamContextMenuActionStyle); + + return Object.hash( + runtimeType, + _this.backgroundColor, + _this.foregroundColor, + _this.overlayColor, + _this.iconColor, + _this.textStyle, + _this.iconSize, + _this.minimumSize, + _this.maximumSize, + _this.padding, + _this.shape, + ); + } +} diff --git a/packages/stream_core_flutter/lib/src/theme/components/stream_context_menu_theme.dart b/packages/stream_core_flutter/lib/src/theme/components/stream_context_menu_theme.dart new file mode 100644 index 0000000..b5c474f --- /dev/null +++ b/packages/stream_core_flutter/lib/src/theme/components/stream_context_menu_theme.dart @@ -0,0 +1,164 @@ +import 'package:flutter/widgets.dart'; +import 'package:theme_extensions_builder_annotation/theme_extensions_builder_annotation.dart'; + +import '../stream_theme.dart'; + +part 'stream_context_menu_theme.g.theme.dart'; + +/// Applies a context menu theme to descendant context menu widgets. +/// +/// Wrap a subtree with [StreamContextMenuTheme] to override context menu +/// styling. Access the merged theme using +/// [BuildContext.streamContextMenuTheme]. +/// +/// {@tool snippet} +/// +/// Override context menu styling for a specific section: +/// +/// ```dart +/// StreamContextMenuTheme( +/// data: StreamContextMenuThemeData( +/// style: StreamContextMenuStyle( +/// backgroundColor: Colors.grey.shade100, +/// shape: RoundedRectangleBorder( +/// borderRadius: BorderRadius.circular(16), +/// ), +/// side: BorderSide(color: Colors.grey.shade300), +/// ), +/// ), +/// child: StreamContextMenu( +/// children: [ +/// StreamContextMenuAction(label: Text('Reply')), +/// ], +/// ), +/// ) +/// ``` +/// {@end-tool} +/// +/// See also: +/// +/// * [StreamContextMenuThemeData], which describes the context menu theme. +/// * [StreamContextMenuStyle], for container-level styling. +/// * [StreamContextMenu], which uses this theme. +/// * [StreamContextMenuActionTheme], for customizing individual action appearance. +class StreamContextMenuTheme extends InheritedTheme { + /// Creates a context menu theme that controls descendant context menus. + const StreamContextMenuTheme({ + super.key, + required this.data, + required super.child, + }); + + /// The context menu theme data for descendant widgets. + final StreamContextMenuThemeData data; + + /// Returns the [StreamContextMenuThemeData] from the current theme context. + /// + /// This merges the local theme (if any) with the global theme from + /// [StreamTheme]. + static StreamContextMenuThemeData of(BuildContext context) { + final localTheme = context.dependOnInheritedWidgetOfExactType(); + return StreamTheme.of(context).contextMenuTheme.merge(localTheme?.data); + } + + @override + Widget wrap(BuildContext context, Widget child) { + return StreamContextMenuTheme(data: data, child: child); + } + + @override + bool updateShouldNotify(StreamContextMenuTheme oldWidget) => data != oldWidget.data; +} + +/// Theme data for customizing context menus. +/// +/// Contains a [StreamContextMenuStyle] that defines the visual properties of +/// the menu container. This follows the same pattern as Flutter's +/// [MenuThemeData] which wraps [MenuStyle]. +/// +/// See also: +/// +/// * [StreamContextMenuTheme], for overriding theme in a widget subtree. +/// * [StreamContextMenuStyle], for container-level styling. +/// * [StreamContextMenu], which uses these properties. +@themeGen +@immutable +class StreamContextMenuThemeData with _$StreamContextMenuThemeData { + /// Creates context menu theme data with optional style overrides. + const StreamContextMenuThemeData({this.style}); + + /// The visual styling for the context menu container. + /// + /// Contains shape, border radius, surface color, and elevation properties. + final StreamContextMenuStyle? style; + + /// Linearly interpolate between two [StreamContextMenuThemeData] values. + static StreamContextMenuThemeData? lerp( + StreamContextMenuThemeData? a, + StreamContextMenuThemeData? b, + double t, + ) => _$StreamContextMenuThemeData.lerp(a, b, t); +} + +/// Visual styling properties for the context menu container. +/// +/// Inspired by Flutter's [MenuStyle], this defines the appearance of the +/// menu container including its shape, border radius, surface color, and +/// material elevation. +/// +/// See also: +/// +/// * [StreamContextMenuThemeData], which wraps this style for theming. +/// * [StreamContextMenu], which uses this styling. +@themeGen +@immutable +class StreamContextMenuStyle with _$StreamContextMenuStyle { + /// Creates context menu style properties. + const StreamContextMenuStyle({ + this.backgroundColor, + this.elevation, + this.shape, + this.side, + this.padding, + }); + + /// The background color of the context menu container. + /// + /// If null, defaults to [StreamColorScheme.backgroundElevation2]. + final Color? backgroundColor; + + /// The z-coordinate at which to place the menu's [Material]. + /// + /// Higher values increase the size and intensity of the menu's drop shadow. + /// + /// If null, defaults to `3`. + final double? elevation; + + /// The shape of the menu's underlying surface. + /// + /// This shape is combined with [side] to create a shape decorated with an + /// outline. + /// + /// If null, defaults to a [RoundedRectangleBorder] with [StreamRadius.lg]. + final OutlinedBorder? shape; + + /// The color and weight of the menu's outline. + /// + /// This value is combined with [shape] to create a shape decorated with an + /// outline. + /// + /// If null, defaults to a 1px [StreamColorScheme.borderDefault] border. + final BorderSide? side; + + /// The padding between the menu's boundary and its children. + /// + /// If null, defaults to [StreamSpacing.xxs] on all sides. + final EdgeInsetsGeometry? padding; + + /// Linearly interpolate between two [StreamContextMenuStyle] values. + static StreamContextMenuStyle? lerp( + StreamContextMenuStyle? a, + StreamContextMenuStyle? b, + double t, + ) => _$StreamContextMenuStyle.lerp(a, b, t); +} diff --git a/packages/stream_core_flutter/lib/src/theme/components/stream_context_menu_theme.g.theme.dart b/packages/stream_core_flutter/lib/src/theme/components/stream_context_menu_theme.g.theme.dart new file mode 100644 index 0000000..a0f552c --- /dev/null +++ b/packages/stream_core_flutter/lib/src/theme/components/stream_context_menu_theme.g.theme.dart @@ -0,0 +1,187 @@ +// dart format width=80 +// coverage:ignore-file +// GENERATED CODE - DO NOT MODIFY BY HAND +// ignore_for_file: type=lint, unused_element + +part of 'stream_context_menu_theme.dart'; + +// ************************************************************************** +// ThemeGenGenerator +// ************************************************************************** + +mixin _$StreamContextMenuThemeData { + bool get canMerge => true; + + static StreamContextMenuThemeData? lerp( + StreamContextMenuThemeData? a, + StreamContextMenuThemeData? b, + double t, + ) { + if (identical(a, b)) { + return a; + } + + if (a == null) { + return t == 1.0 ? b : null; + } + + if (b == null) { + return t == 0.0 ? a : null; + } + + return StreamContextMenuThemeData( + style: StreamContextMenuStyle.lerp(a.style, b.style, t), + ); + } + + StreamContextMenuThemeData copyWith({StreamContextMenuStyle? style}) { + final _this = (this as StreamContextMenuThemeData); + + return StreamContextMenuThemeData(style: style ?? _this.style); + } + + StreamContextMenuThemeData merge(StreamContextMenuThemeData? other) { + final _this = (this as StreamContextMenuThemeData); + + if (other == null || identical(_this, other)) { + return _this; + } + + if (!other.canMerge) { + return other; + } + + return copyWith(style: _this.style?.merge(other.style) ?? other.style); + } + + @override + bool operator ==(Object other) { + if (identical(this, other)) { + return true; + } + + if (other.runtimeType != runtimeType) { + return false; + } + + final _this = (this as StreamContextMenuThemeData); + final _other = (other as StreamContextMenuThemeData); + + return _other.style == _this.style; + } + + @override + int get hashCode { + final _this = (this as StreamContextMenuThemeData); + + return Object.hash(runtimeType, _this.style); + } +} + +mixin _$StreamContextMenuStyle { + bool get canMerge => true; + + static StreamContextMenuStyle? lerp( + StreamContextMenuStyle? a, + StreamContextMenuStyle? b, + double t, + ) { + if (identical(a, b)) { + return a; + } + + if (a == null) { + return t == 1.0 ? b : null; + } + + if (b == null) { + return t == 0.0 ? a : null; + } + + return StreamContextMenuStyle( + backgroundColor: Color.lerp(a.backgroundColor, b.backgroundColor, t), + elevation: lerpDouble$(a.elevation, b.elevation, t), + shape: OutlinedBorder.lerp(a.shape, b.shape, t), + side: a.side == null + ? b.side + : b.side == null + ? a.side + : BorderSide.lerp(a.side!, b.side!, t), + padding: EdgeInsetsGeometry.lerp(a.padding, b.padding, t), + ); + } + + StreamContextMenuStyle copyWith({ + Color? backgroundColor, + double? elevation, + OutlinedBorder? shape, + BorderSide? side, + EdgeInsetsGeometry? padding, + }) { + final _this = (this as StreamContextMenuStyle); + + return StreamContextMenuStyle( + backgroundColor: backgroundColor ?? _this.backgroundColor, + elevation: elevation ?? _this.elevation, + shape: shape ?? _this.shape, + side: side ?? _this.side, + padding: padding ?? _this.padding, + ); + } + + StreamContextMenuStyle merge(StreamContextMenuStyle? other) { + final _this = (this as StreamContextMenuStyle); + + if (other == null || identical(_this, other)) { + return _this; + } + + if (!other.canMerge) { + return other; + } + + return copyWith( + backgroundColor: other.backgroundColor, + elevation: other.elevation, + shape: other.shape, + side: _this.side != null && other.side != null + ? BorderSide.merge(_this.side!, other.side!) + : other.side, + padding: other.padding, + ); + } + + @override + bool operator ==(Object other) { + if (identical(this, other)) { + return true; + } + + if (other.runtimeType != runtimeType) { + return false; + } + + final _this = (this as StreamContextMenuStyle); + final _other = (other as StreamContextMenuStyle); + + return _other.backgroundColor == _this.backgroundColor && + _other.elevation == _this.elevation && + _other.shape == _this.shape && + _other.side == _this.side && + _other.padding == _this.padding; + } + + @override + int get hashCode { + final _this = (this as StreamContextMenuStyle); + + return Object.hash( + runtimeType, + _this.backgroundColor, + _this.elevation, + _this.shape, + _this.side, + _this.padding, + ); + } +} diff --git a/packages/stream_core_flutter/lib/src/theme/components/stream_emoji_button_theme.dart b/packages/stream_core_flutter/lib/src/theme/components/stream_emoji_button_theme.dart new file mode 100644 index 0000000..4c90ede --- /dev/null +++ b/packages/stream_core_flutter/lib/src/theme/components/stream_emoji_button_theme.dart @@ -0,0 +1,188 @@ +import 'package:flutter/widgets.dart'; +import 'package:theme_extensions_builder_annotation/theme_extensions_builder_annotation.dart'; + +import '../stream_theme.dart'; + +part 'stream_emoji_button_theme.g.theme.dart'; + +/// Predefined sizes for the emoji button. +/// +/// Each size corresponds to a specific diameter in logical pixels. +/// +/// See also: +/// +/// * [StreamEmojiButtonThemeStyle.size], for setting a global default size. +enum StreamEmojiButtonSize { + /// Medium button (32px diameter). + md(32), + + /// Large button (40px diameter). + lg(40), + + /// Extra large button (48px diameter). + xl(48) + ; + + /// Constructs a [StreamEmojiButtonSize] with the given diameter. + const StreamEmojiButtonSize(this.value); + + /// The diameter of the button in logical pixels. + final double value; +} + +/// Applies an emoji button theme to descendant emoji button widgets. +/// +/// Wrap a subtree with [StreamEmojiButtonTheme] to override emoji button +/// styling. Access the merged theme using +/// [BuildContext.streamEmojiButtonTheme]. +/// +/// {@tool snippet} +/// +/// Override emoji button styling for a specific section: +/// +/// ```dart +/// StreamEmojiButtonTheme( +/// data: StreamEmojiButtonThemeData( +/// style: StreamEmojiButtonThemeStyle( +/// size: StreamEmojiButtonSize.lg, +/// ), +/// ), +/// child: StreamEmojiButton( +/// emoji: Text('👍'), +/// onPressed: () {}, +/// ), +/// ) +/// ``` +/// {@end-tool} +/// +/// See also: +/// +/// * [StreamEmojiButtonThemeData], which describes the emoji button theme. +class StreamEmojiButtonTheme extends InheritedTheme { + /// Creates an emoji button theme that controls descendant emoji buttons. + const StreamEmojiButtonTheme({ + super.key, + required this.data, + required super.child, + }); + + /// The emoji button theme data for descendant widgets. + final StreamEmojiButtonThemeData data; + + /// Returns the [StreamEmojiButtonThemeData] from the current theme context. + /// + /// This merges the local theme (if any) with the global theme from [StreamTheme]. + static StreamEmojiButtonThemeData of(BuildContext context) { + final localTheme = context.dependOnInheritedWidgetOfExactType(); + return StreamTheme.of(context).emojiButtonTheme.merge(localTheme?.data); + } + + @override + Widget wrap(BuildContext context, Widget child) { + return StreamEmojiButtonTheme(data: data, child: child); + } + + @override + bool updateShouldNotify(StreamEmojiButtonTheme oldWidget) => data != oldWidget.data; +} + +/// Theme data for customizing emoji button widgets. +/// +/// {@tool snippet} +/// +/// Customize emoji button appearance globally: +/// +/// ```dart +/// StreamTheme( +/// emojiButtonTheme: StreamEmojiButtonThemeData( +/// style: StreamEmojiButtonThemeStyle( +/// size: StreamEmojiButtonSize.lg, +/// backgroundColor: WidgetStateProperty.resolveWith((states) { +/// if (states.contains(WidgetState.hovered)) { +/// return Colors.grey.shade200; +/// } +/// return Colors.transparent; +/// }), +/// ), +/// ), +/// ) +/// ``` +/// {@end-tool} +/// +/// See also: +/// +/// * [StreamEmojiButtonTheme], for overriding theme in a widget subtree. +@themeGen +@immutable +class StreamEmojiButtonThemeData with _$StreamEmojiButtonThemeData { + /// Creates an emoji button theme with optional style overrides. + const StreamEmojiButtonThemeData({this.style}); + + /// The visual styling for emoji buttons. + /// + /// Contains size, background, foreground, overlay colors and border styling. + final StreamEmojiButtonThemeStyle? style; + + /// Linearly interpolate between two [StreamEmojiButtonThemeData] objects. + static StreamEmojiButtonThemeData? lerp( + StreamEmojiButtonThemeData? a, + StreamEmojiButtonThemeData? b, + double t, + ) => _$StreamEmojiButtonThemeData.lerp(a, b, t); +} + +/// Visual styling properties for emoji buttons. +/// +/// Defines the appearance of emoji buttons including size, colors, and borders. +/// All color properties support state-based styling for interactive feedback. +/// +/// See also: +/// +/// * [StreamEmojiButtonThemeData], which wraps this style for theming. +/// * [StreamEmojiButton], which uses this styling. +@themeGen +@immutable +class StreamEmojiButtonThemeStyle with _$StreamEmojiButtonThemeStyle { + /// Creates emoji button style properties. + const StreamEmojiButtonThemeStyle({ + this.size, + this.backgroundColor, + this.foregroundColor, + this.overlayColor, + WidgetStateProperty? side, + }) // TODO: Fix this or try to find something better + : side = side as WidgetStateBorderSide?; + + /// The size of emoji buttons. + /// + /// Falls back to [StreamEmojiButtonSize.xl]. + final StreamEmojiButtonSize? size; + + /// The background color for emoji buttons. + /// + /// Supports state-based colors for different interaction states + /// (default, hover, pressed, disabled, selected). + final WidgetStateProperty? backgroundColor; + + /// The foreground color for emoji/icon content. + /// + /// Supports state-based colors for different interaction states. + final WidgetStateProperty? foregroundColor; + + /// The overlay color for the button's interaction feedback. + /// + /// Supports state-based colors for hover and press states. + final WidgetStateProperty? overlayColor; + + /// The border for the button. + /// + /// Supports state-based borders for different interaction states. + final WidgetStateBorderSide? side; + + /// Linearly interpolate between two [StreamEmojiButtonThemeStyle] objects. + static StreamEmojiButtonThemeStyle? lerp( + StreamEmojiButtonThemeStyle? a, + StreamEmojiButtonThemeStyle? b, + double t, + ) => _$StreamEmojiButtonThemeStyle.lerp(a, b, t); +} diff --git a/packages/stream_core_flutter/lib/src/theme/components/stream_emoji_button_theme.g.theme.dart b/packages/stream_core_flutter/lib/src/theme/components/stream_emoji_button_theme.g.theme.dart new file mode 100644 index 0000000..aaa1978 --- /dev/null +++ b/packages/stream_core_flutter/lib/src/theme/components/stream_emoji_button_theme.g.theme.dart @@ -0,0 +1,196 @@ +// dart format width=80 +// coverage:ignore-file +// GENERATED CODE - DO NOT MODIFY BY HAND +// ignore_for_file: type=lint, unused_element + +part of 'stream_emoji_button_theme.dart'; + +// ************************************************************************** +// ThemeGenGenerator +// ************************************************************************** + +mixin _$StreamEmojiButtonThemeData { + bool get canMerge => true; + + static StreamEmojiButtonThemeData? lerp( + StreamEmojiButtonThemeData? a, + StreamEmojiButtonThemeData? b, + double t, + ) { + if (identical(a, b)) { + return a; + } + + if (a == null) { + return t == 1.0 ? b : null; + } + + if (b == null) { + return t == 0.0 ? a : null; + } + + return StreamEmojiButtonThemeData( + style: StreamEmojiButtonThemeStyle.lerp(a.style, b.style, t), + ); + } + + StreamEmojiButtonThemeData copyWith({StreamEmojiButtonThemeStyle? style}) { + final _this = (this as StreamEmojiButtonThemeData); + + return StreamEmojiButtonThemeData(style: style ?? _this.style); + } + + StreamEmojiButtonThemeData merge(StreamEmojiButtonThemeData? other) { + final _this = (this as StreamEmojiButtonThemeData); + + if (other == null || identical(_this, other)) { + return _this; + } + + if (!other.canMerge) { + return other; + } + + return copyWith(style: _this.style?.merge(other.style) ?? other.style); + } + + @override + bool operator ==(Object other) { + if (identical(this, other)) { + return true; + } + + if (other.runtimeType != runtimeType) { + return false; + } + + final _this = (this as StreamEmojiButtonThemeData); + final _other = (other as StreamEmojiButtonThemeData); + + return _other.style == _this.style; + } + + @override + int get hashCode { + final _this = (this as StreamEmojiButtonThemeData); + + return Object.hash(runtimeType, _this.style); + } +} + +mixin _$StreamEmojiButtonThemeStyle { + bool get canMerge => true; + + static StreamEmojiButtonThemeStyle? lerp( + StreamEmojiButtonThemeStyle? a, + StreamEmojiButtonThemeStyle? b, + double t, + ) { + if (identical(a, b)) { + return a; + } + + if (a == null) { + return t == 1.0 ? b : null; + } + + if (b == null) { + return t == 0.0 ? a : null; + } + + return StreamEmojiButtonThemeStyle( + size: t < 0.5 ? a.size : b.size, + backgroundColor: WidgetStateProperty.lerp( + a.backgroundColor, + b.backgroundColor, + t, + Color.lerp, + ), + foregroundColor: WidgetStateProperty.lerp( + a.foregroundColor, + b.foregroundColor, + t, + Color.lerp, + ), + overlayColor: WidgetStateProperty.lerp( + a.overlayColor, + b.overlayColor, + t, + Color.lerp, + ), + side: WidgetStateBorderSide.lerp(a.side, b.side, t), + ); + } + + StreamEmojiButtonThemeStyle copyWith({ + StreamEmojiButtonSize? size, + WidgetStateProperty? backgroundColor, + WidgetStateProperty? foregroundColor, + WidgetStateProperty? overlayColor, + WidgetStateBorderSide? side, + }) { + final _this = (this as StreamEmojiButtonThemeStyle); + + return StreamEmojiButtonThemeStyle( + size: size ?? _this.size, + backgroundColor: backgroundColor ?? _this.backgroundColor, + foregroundColor: foregroundColor ?? _this.foregroundColor, + overlayColor: overlayColor ?? _this.overlayColor, + side: side ?? _this.side, + ); + } + + StreamEmojiButtonThemeStyle merge(StreamEmojiButtonThemeStyle? other) { + final _this = (this as StreamEmojiButtonThemeStyle); + + if (other == null || identical(_this, other)) { + return _this; + } + + if (!other.canMerge) { + return other; + } + + return copyWith( + size: other.size, + backgroundColor: other.backgroundColor, + foregroundColor: other.foregroundColor, + overlayColor: other.overlayColor, + side: other.side, + ); + } + + @override + bool operator ==(Object other) { + if (identical(this, other)) { + return true; + } + + if (other.runtimeType != runtimeType) { + return false; + } + + final _this = (this as StreamEmojiButtonThemeStyle); + final _other = (other as StreamEmojiButtonThemeStyle); + + return _other.size == _this.size && + _other.backgroundColor == _this.backgroundColor && + _other.foregroundColor == _this.foregroundColor && + _other.overlayColor == _this.overlayColor && + _other.side == _this.side; + } + + @override + int get hashCode { + final _this = (this as StreamEmojiButtonThemeStyle); + + return Object.hash( + runtimeType, + _this.size, + _this.backgroundColor, + _this.foregroundColor, + _this.overlayColor, + _this.side, + ); + } +} diff --git a/packages/stream_core_flutter/lib/src/theme/components/stream_emoji_chip_theme.dart b/packages/stream_core_flutter/lib/src/theme/components/stream_emoji_chip_theme.dart new file mode 100644 index 0000000..6d13ce4 --- /dev/null +++ b/packages/stream_core_flutter/lib/src/theme/components/stream_emoji_chip_theme.dart @@ -0,0 +1,193 @@ +import 'package:flutter/material.dart'; +import 'package:theme_extensions_builder_annotation/theme_extensions_builder_annotation.dart'; + +import '../stream_theme.dart'; + +part 'stream_emoji_chip_theme.g.theme.dart'; + +/// Applies an emoji chip theme to descendant emoji chip widgets. +/// +/// Wrap a subtree with [StreamEmojiChipTheme] to override emoji chip styling. +/// Access the merged theme using [BuildContext.streamEmojiChipTheme]. +/// +/// {@tool snippet} +/// +/// Override emoji chip styling for a specific section: +/// +/// ```dart +/// StreamEmojiChipTheme( +/// data: StreamEmojiChipThemeData( +/// style: StreamEmojiChipThemeStyle( +/// foregroundColor: WidgetStateProperty.all(Colors.blue), +/// ), +/// ), +/// child: StreamEmojiChip( +/// emoji: Text('👍'), +/// count: 3, +/// onPressed: () {}, +/// ), +/// ) +/// ``` +/// {@end-tool} +/// +/// See also: +/// +/// * [StreamEmojiChipThemeData], which describes the emoji chip theme. +class StreamEmojiChipTheme extends InheritedTheme { + /// Creates an emoji chip theme that controls descendant emoji chips. + const StreamEmojiChipTheme({ + super.key, + required this.data, + required super.child, + }); + + /// The emoji chip theme data for descendant widgets. + final StreamEmojiChipThemeData data; + + /// Returns the [StreamEmojiChipThemeData] from the current theme context. + /// + /// This merges the local theme (if any) with the global theme from + /// [StreamTheme]. + static StreamEmojiChipThemeData of(BuildContext context) { + final localTheme = context.dependOnInheritedWidgetOfExactType(); + return StreamTheme.of(context).emojiChipTheme.merge(localTheme?.data); + } + + @override + Widget wrap(BuildContext context, Widget child) { + return StreamEmojiChipTheme(data: data, child: child); + } + + @override + bool updateShouldNotify(StreamEmojiChipTheme oldWidget) => data != oldWidget.data; +} + +/// Theme data for customizing emoji chip widgets. +/// +/// {@tool snippet} +/// +/// Customize emoji chip appearance globally: +/// +/// ```dart +/// StreamTheme( +/// emojiChipTheme: StreamEmojiChipThemeData( +/// style: StreamEmojiChipThemeStyle( +/// foregroundColor: WidgetStateProperty.resolveWith((states) { +/// if (states.contains(WidgetState.disabled)) return Colors.grey; +/// return Colors.black; +/// }), +/// ), +/// ), +/// ) +/// ``` +/// {@end-tool} +/// +/// See also: +/// +/// * [StreamEmojiChipTheme], for overriding theme in a widget subtree. +@themeGen +@immutable +class StreamEmojiChipThemeData with _$StreamEmojiChipThemeData { + /// Creates an emoji chip theme with optional style overrides. + const StreamEmojiChipThemeData({this.style}); + + /// The visual styling for emoji chips. + final StreamEmojiChipThemeStyle? style; + + /// Linearly interpolate between two [StreamEmojiChipThemeData] objects. + static StreamEmojiChipThemeData? lerp( + StreamEmojiChipThemeData? a, + StreamEmojiChipThemeData? b, + double t, + ) => _$StreamEmojiChipThemeData.lerp(a, b, t); +} + +/// Visual styling properties for emoji chips. +/// +/// Defines the appearance of emoji chips including background, foreground, +/// overlay colors, size, padding, and border styling. All color properties +/// support state-based styling for interactive feedback. +/// +/// See also: +/// +/// * [StreamEmojiChipThemeData], which wraps this style for theming. +/// * [StreamEmojiChip], which uses this styling. +@themeGen +@immutable +class StreamEmojiChipThemeStyle with _$StreamEmojiChipThemeStyle { + /// Creates emoji chip style properties. + const StreamEmojiChipThemeStyle({ + this.backgroundColor, + this.foregroundColor, + this.overlayColor, + this.textStyle, + this.emojiSize, + this.minimumSize, + this.maximumSize, + this.padding, + this.shape, + WidgetStateProperty? side, + }) + // TODO: Fix this or try to find something better + : side = side as WidgetStateBorderSide?; + + /// The background color for emoji chips. + /// + /// Supports state-based colors for different interaction states + /// (default, hover, pressed, disabled, selected). + final WidgetStateProperty? backgroundColor; + + /// The foreground color for emoji/icon and count text content. + /// + /// Supports state-based colors for different interaction states. + final WidgetStateProperty? foregroundColor; + + /// The overlay color for interaction feedback (hover, press). + /// + /// Supports state-based colors for hover and press states. + final WidgetStateProperty? overlayColor; + + /// The text style for the reaction count label. + /// + /// The color of [textStyle] is typically not used directly — use + /// [foregroundColor] to control text and icon color instead. + final WidgetStateProperty? textStyle; + + /// The display size of the emoji/icon in logical pixels. + /// + /// Falls back to [StreamEmojiSize.sm] (16px). + final double? emojiSize; + + /// The minimum size of the chip. + /// + /// Falls back to `Size(64, 32)`. + final Size? minimumSize; + + /// The maximum size of the chip. + /// + /// Falls back to `Size.fromHeight(32)` — unconstrained width, fixed 32px height. + final Size? maximumSize; + + /// The internal padding of the chip. + /// + /// Falls back to horizontal `StreamSpacing.sm` and vertical + /// `StreamSpacing.xxs + StreamSpacing.xxxs`. + final EdgeInsetsGeometry? padding; + + /// The shape of the chip's container. + /// + /// Falls back to a [RoundedRectangleBorder] with `StreamRadius.max`. + final OutlinedBorder? shape; + + /// The border for the chip. + /// + /// Supports state-based borders for different interaction states. + final WidgetStateBorderSide? side; + + /// Linearly interpolate between two [StreamEmojiChipThemeStyle] objects. + static StreamEmojiChipThemeStyle? lerp( + StreamEmojiChipThemeStyle? a, + StreamEmojiChipThemeStyle? b, + double t, + ) => _$StreamEmojiChipThemeStyle.lerp(a, b, t); +} diff --git a/packages/stream_core_flutter/lib/src/theme/components/stream_emoji_chip_theme.g.theme.dart b/packages/stream_core_flutter/lib/src/theme/components/stream_emoji_chip_theme.g.theme.dart new file mode 100644 index 0000000..806d716 --- /dev/null +++ b/packages/stream_core_flutter/lib/src/theme/components/stream_emoji_chip_theme.g.theme.dart @@ -0,0 +1,231 @@ +// dart format width=80 +// coverage:ignore-file +// GENERATED CODE - DO NOT MODIFY BY HAND +// ignore_for_file: type=lint, unused_element + +part of 'stream_emoji_chip_theme.dart'; + +// ************************************************************************** +// ThemeGenGenerator +// ************************************************************************** + +mixin _$StreamEmojiChipThemeData { + bool get canMerge => true; + + static StreamEmojiChipThemeData? lerp( + StreamEmojiChipThemeData? a, + StreamEmojiChipThemeData? b, + double t, + ) { + if (identical(a, b)) { + return a; + } + + if (a == null) { + return t == 1.0 ? b : null; + } + + if (b == null) { + return t == 0.0 ? a : null; + } + + return StreamEmojiChipThemeData( + style: StreamEmojiChipThemeStyle.lerp(a.style, b.style, t), + ); + } + + StreamEmojiChipThemeData copyWith({StreamEmojiChipThemeStyle? style}) { + final _this = (this as StreamEmojiChipThemeData); + + return StreamEmojiChipThemeData(style: style ?? _this.style); + } + + StreamEmojiChipThemeData merge(StreamEmojiChipThemeData? other) { + final _this = (this as StreamEmojiChipThemeData); + + if (other == null || identical(_this, other)) { + return _this; + } + + if (!other.canMerge) { + return other; + } + + return copyWith(style: _this.style?.merge(other.style) ?? other.style); + } + + @override + bool operator ==(Object other) { + if (identical(this, other)) { + return true; + } + + if (other.runtimeType != runtimeType) { + return false; + } + + final _this = (this as StreamEmojiChipThemeData); + final _other = (other as StreamEmojiChipThemeData); + + return _other.style == _this.style; + } + + @override + int get hashCode { + final _this = (this as StreamEmojiChipThemeData); + + return Object.hash(runtimeType, _this.style); + } +} + +mixin _$StreamEmojiChipThemeStyle { + bool get canMerge => true; + + static StreamEmojiChipThemeStyle? lerp( + StreamEmojiChipThemeStyle? a, + StreamEmojiChipThemeStyle? b, + double t, + ) { + if (identical(a, b)) { + return a; + } + + if (a == null) { + return t == 1.0 ? b : null; + } + + if (b == null) { + return t == 0.0 ? a : null; + } + + return StreamEmojiChipThemeStyle( + backgroundColor: WidgetStateProperty.lerp( + a.backgroundColor, + b.backgroundColor, + t, + Color.lerp, + ), + foregroundColor: WidgetStateProperty.lerp( + a.foregroundColor, + b.foregroundColor, + t, + Color.lerp, + ), + overlayColor: WidgetStateProperty.lerp( + a.overlayColor, + b.overlayColor, + t, + Color.lerp, + ), + textStyle: WidgetStateProperty.lerp( + a.textStyle, + b.textStyle, + t, + TextStyle.lerp, + ), + emojiSize: lerpDouble$(a.emojiSize, b.emojiSize, t), + minimumSize: Size.lerp(a.minimumSize, b.minimumSize, t), + maximumSize: Size.lerp(a.maximumSize, b.maximumSize, t), + padding: EdgeInsetsGeometry.lerp(a.padding, b.padding, t), + shape: OutlinedBorder.lerp(a.shape, b.shape, t), + side: WidgetStateBorderSide.lerp(a.side, b.side, t), + ); + } + + StreamEmojiChipThemeStyle copyWith({ + WidgetStateProperty? backgroundColor, + WidgetStateProperty? foregroundColor, + WidgetStateProperty? overlayColor, + WidgetStateProperty? textStyle, + double? emojiSize, + Size? minimumSize, + Size? maximumSize, + EdgeInsetsGeometry? padding, + OutlinedBorder? shape, + WidgetStateBorderSide? side, + }) { + final _this = (this as StreamEmojiChipThemeStyle); + + return StreamEmojiChipThemeStyle( + backgroundColor: backgroundColor ?? _this.backgroundColor, + foregroundColor: foregroundColor ?? _this.foregroundColor, + overlayColor: overlayColor ?? _this.overlayColor, + textStyle: textStyle ?? _this.textStyle, + emojiSize: emojiSize ?? _this.emojiSize, + minimumSize: minimumSize ?? _this.minimumSize, + maximumSize: maximumSize ?? _this.maximumSize, + padding: padding ?? _this.padding, + shape: shape ?? _this.shape, + side: side ?? _this.side, + ); + } + + StreamEmojiChipThemeStyle merge(StreamEmojiChipThemeStyle? other) { + final _this = (this as StreamEmojiChipThemeStyle); + + if (other == null || identical(_this, other)) { + return _this; + } + + if (!other.canMerge) { + return other; + } + + return copyWith( + backgroundColor: other.backgroundColor, + foregroundColor: other.foregroundColor, + overlayColor: other.overlayColor, + textStyle: other.textStyle, + emojiSize: other.emojiSize, + minimumSize: other.minimumSize, + maximumSize: other.maximumSize, + padding: other.padding, + shape: other.shape, + side: other.side, + ); + } + + @override + bool operator ==(Object other) { + if (identical(this, other)) { + return true; + } + + if (other.runtimeType != runtimeType) { + return false; + } + + final _this = (this as StreamEmojiChipThemeStyle); + final _other = (other as StreamEmojiChipThemeStyle); + + return _other.backgroundColor == _this.backgroundColor && + _other.foregroundColor == _this.foregroundColor && + _other.overlayColor == _this.overlayColor && + _other.textStyle == _this.textStyle && + _other.emojiSize == _this.emojiSize && + _other.minimumSize == _this.minimumSize && + _other.maximumSize == _this.maximumSize && + _other.padding == _this.padding && + _other.shape == _this.shape && + _other.side == _this.side; + } + + @override + int get hashCode { + final _this = (this as StreamEmojiChipThemeStyle); + + return Object.hash( + runtimeType, + _this.backgroundColor, + _this.foregroundColor, + _this.overlayColor, + _this.textStyle, + _this.emojiSize, + _this.minimumSize, + _this.maximumSize, + _this.padding, + _this.shape, + _this.side, + ); + } +} diff --git a/packages/stream_core_flutter/lib/src/theme/components/stream_input_theme.dart b/packages/stream_core_flutter/lib/src/theme/components/stream_input_theme.dart new file mode 100644 index 0000000..caa5aa4 --- /dev/null +++ b/packages/stream_core_flutter/lib/src/theme/components/stream_input_theme.dart @@ -0,0 +1,48 @@ +import 'package:flutter/widgets.dart'; +import 'package:theme_extensions_builder_annotation/theme_extensions_builder_annotation.dart'; + +import '../../../stream_core_flutter.dart'; + +part 'stream_input_theme.g.theme.dart'; + +class StreamInputTheme extends InheritedTheme { + const StreamInputTheme({ + super.key, + required this.data, + required super.child, + }); + + final StreamInputThemeData data; + + static StreamInputThemeData of(BuildContext context) { + final localTheme = context.dependOnInheritedWidgetOfExactType(); + return StreamTheme.of(context).inputTheme.merge(localTheme?.data); + } + + @override + Widget wrap(BuildContext context, Widget child) { + return StreamInputTheme(data: data, child: child); + } + + @override + bool updateShouldNotify(StreamInputTheme oldWidget) => data != oldWidget.data; +} + +@themeGen +@immutable +class StreamInputThemeData with _$StreamInputThemeData { + const StreamInputThemeData({ + this.textColor, + this.placeholderColor, + this.disabledColor, + this.iconColor, + this.borderColor, + }); + + final Color? textColor; + final Color? placeholderColor; + final Color? disabledColor; + final Color? iconColor; + + final Color? borderColor; +} diff --git a/packages/stream_core_flutter/lib/src/theme/components/stream_input_theme.g.theme.dart b/packages/stream_core_flutter/lib/src/theme/components/stream_input_theme.g.theme.dart new file mode 100644 index 0000000..70110b0 --- /dev/null +++ b/packages/stream_core_flutter/lib/src/theme/components/stream_input_theme.g.theme.dart @@ -0,0 +1,112 @@ +// dart format width=80 +// coverage:ignore-file +// GENERATED CODE - DO NOT MODIFY BY HAND +// ignore_for_file: type=lint, unused_element + +part of 'stream_input_theme.dart'; + +// ************************************************************************** +// ThemeGenGenerator +// ************************************************************************** + +mixin _$StreamInputThemeData { + bool get canMerge => true; + + static StreamInputThemeData? lerp( + StreamInputThemeData? a, + StreamInputThemeData? b, + double t, + ) { + if (identical(a, b)) { + return a; + } + + if (a == null) { + return t == 1.0 ? b : null; + } + + if (b == null) { + return t == 0.0 ? a : null; + } + + return StreamInputThemeData( + textColor: Color.lerp(a.textColor, b.textColor, t), + placeholderColor: Color.lerp(a.placeholderColor, b.placeholderColor, t), + disabledColor: Color.lerp(a.disabledColor, b.disabledColor, t), + iconColor: Color.lerp(a.iconColor, b.iconColor, t), + borderColor: Color.lerp(a.borderColor, b.borderColor, t), + ); + } + + StreamInputThemeData copyWith({ + Color? textColor, + Color? placeholderColor, + Color? disabledColor, + Color? iconColor, + Color? borderColor, + }) { + final _this = (this as StreamInputThemeData); + + return StreamInputThemeData( + textColor: textColor ?? _this.textColor, + placeholderColor: placeholderColor ?? _this.placeholderColor, + disabledColor: disabledColor ?? _this.disabledColor, + iconColor: iconColor ?? _this.iconColor, + borderColor: borderColor ?? _this.borderColor, + ); + } + + StreamInputThemeData merge(StreamInputThemeData? other) { + final _this = (this as StreamInputThemeData); + + if (other == null || identical(_this, other)) { + return _this; + } + + if (!other.canMerge) { + return other; + } + + return copyWith( + textColor: other.textColor, + placeholderColor: other.placeholderColor, + disabledColor: other.disabledColor, + iconColor: other.iconColor, + borderColor: other.borderColor, + ); + } + + @override + bool operator ==(Object other) { + if (identical(this, other)) { + return true; + } + + if (other.runtimeType != runtimeType) { + return false; + } + + final _this = (this as StreamInputThemeData); + final _other = (other as StreamInputThemeData); + + return _other.textColor == _this.textColor && + _other.placeholderColor == _this.placeholderColor && + _other.disabledColor == _this.disabledColor && + _other.iconColor == _this.iconColor && + _other.borderColor == _this.borderColor; + } + + @override + int get hashCode { + final _this = (this as StreamInputThemeData); + + return Object.hash( + runtimeType, + _this.textColor, + _this.placeholderColor, + _this.disabledColor, + _this.iconColor, + _this.borderColor, + ); + } +} diff --git a/packages/stream_core_flutter/lib/src/theme/components/stream_list_tile_theme.dart b/packages/stream_core_flutter/lib/src/theme/components/stream_list_tile_theme.dart new file mode 100644 index 0000000..99c5e3f --- /dev/null +++ b/packages/stream_core_flutter/lib/src/theme/components/stream_list_tile_theme.dart @@ -0,0 +1,173 @@ +import 'package:flutter/widgets.dart'; +import 'package:theme_extensions_builder_annotation/theme_extensions_builder_annotation.dart'; + +import '../stream_theme.dart'; + +part 'stream_list_tile_theme.g.theme.dart'; + +/// Applies a list tile theme to descendant [StreamListTile] widgets. +/// +/// Wrap a subtree with [StreamListTileTheme] to override list tile styling. +/// Access the merged theme using [BuildContext.streamListTileTheme]. +/// +/// {@tool snippet} +/// +/// Override list tile styling for a specific section: +/// +/// ```dart +/// StreamListTileTheme( +/// data: StreamListTileThemeData( +/// shape: RoundedRectangleBorder( +/// borderRadius: BorderRadius.circular(8), +/// ), +/// ), +/// child: StreamListTile( +/// title: Text('Hello'), +/// onTap: () {}, +/// ), +/// ) +/// ``` +/// {@end-tool} +/// +/// See also: +/// +/// * [StreamListTileThemeData], which describes the list tile theme. +/// * [StreamListTile], the widget affected by this theme. +class StreamListTileTheme extends InheritedTheme { + /// Creates a list tile theme that controls descendant list tiles. + const StreamListTileTheme({super.key, required this.data, required super.child}); + + /// The list tile theme data for descendant widgets. + final StreamListTileThemeData data; + + /// Returns the [StreamListTileThemeData] merged from local and global themes. + /// + /// Local values from the nearest [StreamListTileTheme] ancestor take + /// precedence over global values from [StreamTheme.of]. + /// + /// This allows partial overrides — for example, overriding only + /// [StreamListTileThemeData.contentPadding] while inheriting colors from + /// the global theme. + static StreamListTileThemeData of(BuildContext context) { + final localTheme = context.dependOnInheritedWidgetOfExactType(); + return StreamTheme.of(context).listTileTheme.merge(localTheme?.data); + } + + @override + Widget wrap(BuildContext context, Widget child) { + return StreamListTileTheme(data: data, child: child); + } + + @override + bool updateShouldNotify(StreamListTileTheme oldWidget) => data != oldWidget.data; +} + +/// Theme data for customizing [StreamListTile] widgets. +/// +/// Descendant widgets obtain their values from [StreamListTileTheme.of]. +/// All properties are null by default, with fallback values applied by +/// [DefaultStreamListTile]. +/// +/// {@tool snippet} +/// +/// Customize list tile appearance globally via [StreamTheme]: +/// +/// ```dart +/// StreamTheme( +/// data: StreamThemeData( +/// listTileTheme: StreamListTileThemeData( +/// contentPadding: EdgeInsets.symmetric(horizontal: 16, vertical: 12), +/// shape: RoundedRectangleBorder( +/// borderRadius: BorderRadius.circular(8), +/// ), +/// ), +/// ), +/// ) +/// ``` +/// {@end-tool} +/// +/// See also: +/// +/// * [StreamListTileTheme], for overriding the theme in a widget subtree. +/// * [StreamListTile], the widget that uses this theme data. +@themeGen +@immutable +class StreamListTileThemeData with _$StreamListTileThemeData { + /// Creates a list tile theme data with optional property overrides. + const StreamListTileThemeData({ + this.titleTextStyle, + this.subtitleTextStyle, + this.descriptionTextStyle, + this.titleColor, + this.subtitleColor, + this.descriptionColor, + this.iconColor, + this.backgroundColor, + this.shape, + this.contentPadding, + this.minTileHeight, + this.overlayColor, + }); + + /// Defines the default text style for [StreamListTile.title]. + /// + /// This only controls typography. Color comes from [titleColor]. + final TextStyle? titleTextStyle; + + /// Defines the default text style for [StreamListTile.subtitle]. + /// + /// This only controls typography. Color comes from [subtitleColor]. + final TextStyle? subtitleTextStyle; + + /// Defines the default text style for [StreamListTile.description]. + /// + /// This only controls typography. Color comes from [descriptionColor]. + final TextStyle? descriptionTextStyle; + + /// Defines the default color for [StreamListTile.title]. + /// + /// This color is resolved from [WidgetState]s. + final WidgetStateProperty? titleColor; + + /// Defines the default color for [StreamListTile.subtitle]. + /// + /// This color is resolved from [WidgetState]s. + final WidgetStateProperty? subtitleColor; + + /// Defines the default color for [StreamListTile.description]. + /// + /// This color is resolved from [WidgetState]s. + final WidgetStateProperty? descriptionColor; + + /// Defines the default color for [StreamListTile.leading] and + /// [StreamListTile.trailing]. + /// + /// This color is resolved from [WidgetState]s. + final WidgetStateProperty? iconColor; + + /// Defines the default background color of the tile. + /// + /// This color is resolved from [WidgetState]s. + final WidgetStateProperty? backgroundColor; + + /// Defines the default shape for the tile. + final ShapeBorder? shape; + + /// Defines the default internal padding of the tile's content. + final EdgeInsetsGeometry? contentPadding; + + /// Defines the default minimum height of the tile. + final double? minTileHeight; + + /// Defines the default overlay color for tile interactions. + /// + /// This color is resolved from [WidgetState]s. + final WidgetStateProperty? overlayColor; + + /// Linearly interpolate between two [StreamListTileThemeData] objects. + static StreamListTileThemeData? lerp( + StreamListTileThemeData? a, + StreamListTileThemeData? b, + double t, + ) => _$StreamListTileThemeData.lerp(a, b, t); +} diff --git a/packages/stream_core_flutter/lib/src/theme/components/stream_list_tile_theme.g.theme.dart b/packages/stream_core_flutter/lib/src/theme/components/stream_list_tile_theme.g.theme.dart new file mode 100644 index 0000000..01dc224 --- /dev/null +++ b/packages/stream_core_flutter/lib/src/theme/components/stream_list_tile_theme.g.theme.dart @@ -0,0 +1,202 @@ +// dart format width=80 +// coverage:ignore-file +// GENERATED CODE - DO NOT MODIFY BY HAND +// ignore_for_file: type=lint, unused_element + +part of 'stream_list_tile_theme.dart'; + +// ************************************************************************** +// ThemeGenGenerator +// ************************************************************************** + +mixin _$StreamListTileThemeData { + bool get canMerge => true; + + static StreamListTileThemeData? lerp( + StreamListTileThemeData? a, + StreamListTileThemeData? b, + double t, + ) { + if (identical(a, b)) { + return a; + } + + if (a == null) { + return t == 1.0 ? b : null; + } + + if (b == null) { + return t == 0.0 ? a : null; + } + + return StreamListTileThemeData( + titleTextStyle: TextStyle.lerp(a.titleTextStyle, b.titleTextStyle, t), + subtitleTextStyle: TextStyle.lerp( + a.subtitleTextStyle, + b.subtitleTextStyle, + t, + ), + descriptionTextStyle: TextStyle.lerp( + a.descriptionTextStyle, + b.descriptionTextStyle, + t, + ), + titleColor: WidgetStateProperty.lerp( + a.titleColor, + b.titleColor, + t, + Color.lerp, + ), + subtitleColor: WidgetStateProperty.lerp( + a.subtitleColor, + b.subtitleColor, + t, + Color.lerp, + ), + descriptionColor: WidgetStateProperty.lerp( + a.descriptionColor, + b.descriptionColor, + t, + Color.lerp, + ), + iconColor: WidgetStateProperty.lerp( + a.iconColor, + b.iconColor, + t, + Color.lerp, + ), + backgroundColor: WidgetStateProperty.lerp( + a.backgroundColor, + b.backgroundColor, + t, + Color.lerp, + ), + shape: ShapeBorder.lerp(a.shape, b.shape, t), + contentPadding: EdgeInsetsGeometry.lerp( + a.contentPadding, + b.contentPadding, + t, + ), + minTileHeight: lerpDouble$(a.minTileHeight, b.minTileHeight, t), + overlayColor: WidgetStateProperty.lerp( + a.overlayColor, + b.overlayColor, + t, + Color.lerp, + ), + ); + } + + StreamListTileThemeData copyWith({ + TextStyle? titleTextStyle, + TextStyle? subtitleTextStyle, + TextStyle? descriptionTextStyle, + WidgetStateProperty? titleColor, + WidgetStateProperty? subtitleColor, + WidgetStateProperty? descriptionColor, + WidgetStateProperty? iconColor, + WidgetStateProperty? backgroundColor, + ShapeBorder? shape, + EdgeInsetsGeometry? contentPadding, + double? minTileHeight, + WidgetStateProperty? overlayColor, + }) { + final _this = (this as StreamListTileThemeData); + + return StreamListTileThemeData( + titleTextStyle: titleTextStyle ?? _this.titleTextStyle, + subtitleTextStyle: subtitleTextStyle ?? _this.subtitleTextStyle, + descriptionTextStyle: descriptionTextStyle ?? _this.descriptionTextStyle, + titleColor: titleColor ?? _this.titleColor, + subtitleColor: subtitleColor ?? _this.subtitleColor, + descriptionColor: descriptionColor ?? _this.descriptionColor, + iconColor: iconColor ?? _this.iconColor, + backgroundColor: backgroundColor ?? _this.backgroundColor, + shape: shape ?? _this.shape, + contentPadding: contentPadding ?? _this.contentPadding, + minTileHeight: minTileHeight ?? _this.minTileHeight, + overlayColor: overlayColor ?? _this.overlayColor, + ); + } + + StreamListTileThemeData merge(StreamListTileThemeData? other) { + final _this = (this as StreamListTileThemeData); + + if (other == null || identical(_this, other)) { + return _this; + } + + if (!other.canMerge) { + return other; + } + + return copyWith( + titleTextStyle: + _this.titleTextStyle?.merge(other.titleTextStyle) ?? + other.titleTextStyle, + subtitleTextStyle: + _this.subtitleTextStyle?.merge(other.subtitleTextStyle) ?? + other.subtitleTextStyle, + descriptionTextStyle: + _this.descriptionTextStyle?.merge(other.descriptionTextStyle) ?? + other.descriptionTextStyle, + titleColor: other.titleColor, + subtitleColor: other.subtitleColor, + descriptionColor: other.descriptionColor, + iconColor: other.iconColor, + backgroundColor: other.backgroundColor, + shape: other.shape, + contentPadding: other.contentPadding, + minTileHeight: other.minTileHeight, + overlayColor: other.overlayColor, + ); + } + + @override + bool operator ==(Object other) { + if (identical(this, other)) { + return true; + } + + if (other.runtimeType != runtimeType) { + return false; + } + + final _this = (this as StreamListTileThemeData); + final _other = (other as StreamListTileThemeData); + + return _other.titleTextStyle == _this.titleTextStyle && + _other.subtitleTextStyle == _this.subtitleTextStyle && + _other.descriptionTextStyle == _this.descriptionTextStyle && + _other.titleColor == _this.titleColor && + _other.subtitleColor == _this.subtitleColor && + _other.descriptionColor == _this.descriptionColor && + _other.iconColor == _this.iconColor && + _other.backgroundColor == _this.backgroundColor && + _other.shape == _this.shape && + _other.contentPadding == _this.contentPadding && + _other.minTileHeight == _this.minTileHeight && + _other.overlayColor == _this.overlayColor; + } + + @override + int get hashCode { + final _this = (this as StreamListTileThemeData); + + return Object.hash( + runtimeType, + _this.titleTextStyle, + _this.subtitleTextStyle, + _this.descriptionTextStyle, + _this.titleColor, + _this.subtitleColor, + _this.descriptionColor, + _this.iconColor, + _this.backgroundColor, + _this.shape, + _this.contentPadding, + _this.minTileHeight, + _this.overlayColor, + ); + } +} diff --git a/packages/stream_core_flutter/lib/src/theme/components/stream_message_theme.dart b/packages/stream_core_flutter/lib/src/theme/components/stream_message_theme.dart new file mode 100644 index 0000000..5446156 --- /dev/null +++ b/packages/stream_core_flutter/lib/src/theme/components/stream_message_theme.dart @@ -0,0 +1,135 @@ +import 'package:flutter/widgets.dart'; +import 'package:theme_extensions_builder_annotation/theme_extensions_builder_annotation.dart'; + +import '../../../stream_core_flutter.dart'; + +part 'stream_message_theme.g.theme.dart'; + +class StreamMessageTheme extends InheritedTheme { + const StreamMessageTheme({ + super.key, + required this.data, + required super.child, + }); + + final StreamMessageThemeData data; + + static StreamMessageThemeData of(BuildContext context) { + final localTheme = context.dependOnInheritedWidgetOfExactType(); + return StreamTheme.of(context).messageTheme.merge(localTheme?.data); + } + + @override + Widget wrap(BuildContext context, Widget child) { + return StreamMessageTheme(data: data, child: child); + } + + @override + bool updateShouldNotify(StreamMessageTheme oldWidget) => data != oldWidget.data; +} + +@themeGen +@immutable +class StreamMessageThemeData with _$StreamMessageThemeData { + const StreamMessageThemeData({ + this.incoming, + this.outgoing, + }); + + final StreamMessageStyle? incoming; + final StreamMessageStyle? outgoing; + + StreamMessageThemeData mergeWithDefaults(BuildContext context) { + final defaults = _MessageThemeDefaults(context: context); + return StreamMessageThemeData(incoming: defaults.incoming, outgoing: defaults.outgoing).merge(this); + } +} + +@themeGen +@immutable +class StreamMessageStyle with _$StreamMessageStyle { + const StreamMessageStyle({ + this.backgroundColor, + this.backgroundAttachmentColor, + this.backgroundTypingIndicatorColor, + this.textColor, + this.textUsernameColor, + this.textTimestampColor, + this.textMentionColor, + this.textLinkColor, + this.textReactionColor, + this.textSystemColor, + this.borderColor, + this.borderOnChatColor, + this.threadConnectorColor, + this.progressTrackColor, + this.progressFillColor, + this.replyIndicatorColor, + this.waveFormBarColor, + this.waveFormBarPlayingColor, + }); + + final Color? backgroundColor; + final Color? backgroundAttachmentColor; + final Color? backgroundTypingIndicatorColor; + + final Color? textColor; + final Color? textUsernameColor; + final Color? textTimestampColor; + final Color? textMentionColor; + final Color? textLinkColor; + final Color? textReactionColor; + final Color? textSystemColor; + + final Color? borderColor; + final Color? borderOnChatColor; + + final Color? threadConnectorColor; + + final Color? progressTrackColor; + final Color? progressFillColor; + + final Color? replyIndicatorColor; + + final Color? waveFormBarColor; + final Color? waveFormBarPlayingColor; +} + +class _MessageThemeDefaults { + _MessageThemeDefaults({required this.context}) : _colorScheme = context.streamColorScheme; + + final BuildContext context; + final StreamColorScheme _colorScheme; + + StreamMessageStyle get incoming => StreamMessageStyle( + backgroundColor: _colorScheme.backgroundSurface, + backgroundAttachmentColor: _colorScheme.backgroundSurfaceStrong, + backgroundTypingIndicatorColor: _colorScheme.accentNeutral, + textColor: _colorScheme.textPrimary, + textUsernameColor: _colorScheme.textSecondary, + textTimestampColor: _colorScheme.textTertiary, + textMentionColor: _colorScheme.textLink, + textLinkColor: _colorScheme.textLink, + textReactionColor: _colorScheme.textSecondary, + textSystemColor: _colorScheme.textSecondary, + borderColor: _colorScheme.borderSubtle, + borderOnChatColor: _colorScheme.borderOnSurface, + replyIndicatorColor: _colorScheme.borderOnSurface, + ); + + StreamMessageStyle get outgoing => StreamMessageStyle( + backgroundColor: _colorScheme.brand.shade100, + backgroundAttachmentColor: _colorScheme.brand.shade150, + backgroundTypingIndicatorColor: _colorScheme.accentNeutral, + textColor: _colorScheme.brand.shade900, + textUsernameColor: _colorScheme.textSecondary, + textTimestampColor: _colorScheme.textTertiary, + textMentionColor: _colorScheme.textLink, + textLinkColor: _colorScheme.textLink, + textReactionColor: _colorScheme.textSecondary, + textSystemColor: _colorScheme.textSecondary, + borderColor: _colorScheme.brand.shade100, + borderOnChatColor: _colorScheme.brand.shade300, + replyIndicatorColor: _colorScheme.brand.shade400, + ); +} diff --git a/packages/stream_core_flutter/lib/src/theme/components/stream_message_theme.g.theme.dart b/packages/stream_core_flutter/lib/src/theme/components/stream_message_theme.g.theme.dart new file mode 100644 index 0000000..28b89d4 --- /dev/null +++ b/packages/stream_core_flutter/lib/src/theme/components/stream_message_theme.g.theme.dart @@ -0,0 +1,319 @@ +// dart format width=80 +// coverage:ignore-file +// GENERATED CODE - DO NOT MODIFY BY HAND +// ignore_for_file: type=lint, unused_element + +part of 'stream_message_theme.dart'; + +// ************************************************************************** +// ThemeGenGenerator +// ************************************************************************** + +mixin _$StreamMessageThemeData { + bool get canMerge => true; + + static StreamMessageThemeData? lerp( + StreamMessageThemeData? a, + StreamMessageThemeData? b, + double t, + ) { + if (identical(a, b)) { + return a; + } + + if (a == null) { + return t == 1.0 ? b : null; + } + + if (b == null) { + return t == 0.0 ? a : null; + } + + return StreamMessageThemeData( + incoming: t < 0.5 ? a.incoming : b.incoming, + outgoing: t < 0.5 ? a.outgoing : b.outgoing, + ); + } + + StreamMessageThemeData copyWith({ + StreamMessageStyle? incoming, + StreamMessageStyle? outgoing, + }) { + final _this = (this as StreamMessageThemeData); + + return StreamMessageThemeData( + incoming: incoming ?? _this.incoming, + outgoing: outgoing ?? _this.outgoing, + ); + } + + StreamMessageThemeData merge(StreamMessageThemeData? other) { + final _this = (this as StreamMessageThemeData); + + if (other == null || identical(_this, other)) { + return _this; + } + + if (!other.canMerge) { + return other; + } + + return copyWith( + incoming: _this.incoming?.merge(other.incoming) ?? other.incoming, + outgoing: _this.outgoing?.merge(other.outgoing) ?? other.outgoing, + ); + } + + @override + bool operator ==(Object other) { + if (identical(this, other)) { + return true; + } + + if (other.runtimeType != runtimeType) { + return false; + } + + final _this = (this as StreamMessageThemeData); + final _other = (other as StreamMessageThemeData); + + return _other.incoming == _this.incoming && + _other.outgoing == _this.outgoing; + } + + @override + int get hashCode { + final _this = (this as StreamMessageThemeData); + + return Object.hash(runtimeType, _this.incoming, _this.outgoing); + } +} + +mixin _$StreamMessageStyle { + bool get canMerge => true; + + static StreamMessageStyle? lerp( + StreamMessageStyle? a, + StreamMessageStyle? b, + double t, + ) { + if (identical(a, b)) { + return a; + } + + if (a == null) { + return t == 1.0 ? b : null; + } + + if (b == null) { + return t == 0.0 ? a : null; + } + + return StreamMessageStyle( + backgroundColor: Color.lerp(a.backgroundColor, b.backgroundColor, t), + backgroundAttachmentColor: Color.lerp( + a.backgroundAttachmentColor, + b.backgroundAttachmentColor, + t, + ), + backgroundTypingIndicatorColor: Color.lerp( + a.backgroundTypingIndicatorColor, + b.backgroundTypingIndicatorColor, + t, + ), + textColor: Color.lerp(a.textColor, b.textColor, t), + textUsernameColor: Color.lerp( + a.textUsernameColor, + b.textUsernameColor, + t, + ), + textTimestampColor: Color.lerp( + a.textTimestampColor, + b.textTimestampColor, + t, + ), + textMentionColor: Color.lerp(a.textMentionColor, b.textMentionColor, t), + textLinkColor: Color.lerp(a.textLinkColor, b.textLinkColor, t), + textReactionColor: Color.lerp( + a.textReactionColor, + b.textReactionColor, + t, + ), + textSystemColor: Color.lerp(a.textSystemColor, b.textSystemColor, t), + borderColor: Color.lerp(a.borderColor, b.borderColor, t), + borderOnChatColor: Color.lerp( + a.borderOnChatColor, + b.borderOnChatColor, + t, + ), + threadConnectorColor: Color.lerp( + a.threadConnectorColor, + b.threadConnectorColor, + t, + ), + progressTrackColor: Color.lerp( + a.progressTrackColor, + b.progressTrackColor, + t, + ), + progressFillColor: Color.lerp( + a.progressFillColor, + b.progressFillColor, + t, + ), + replyIndicatorColor: Color.lerp( + a.replyIndicatorColor, + b.replyIndicatorColor, + t, + ), + waveFormBarColor: Color.lerp(a.waveFormBarColor, b.waveFormBarColor, t), + waveFormBarPlayingColor: Color.lerp( + a.waveFormBarPlayingColor, + b.waveFormBarPlayingColor, + t, + ), + ); + } + + StreamMessageStyle copyWith({ + Color? backgroundColor, + Color? backgroundAttachmentColor, + Color? backgroundTypingIndicatorColor, + Color? textColor, + Color? textUsernameColor, + Color? textTimestampColor, + Color? textMentionColor, + Color? textLinkColor, + Color? textReactionColor, + Color? textSystemColor, + Color? borderColor, + Color? borderOnChatColor, + Color? threadConnectorColor, + Color? progressTrackColor, + Color? progressFillColor, + Color? replyIndicatorColor, + Color? waveFormBarColor, + Color? waveFormBarPlayingColor, + }) { + final _this = (this as StreamMessageStyle); + + return StreamMessageStyle( + backgroundColor: backgroundColor ?? _this.backgroundColor, + backgroundAttachmentColor: + backgroundAttachmentColor ?? _this.backgroundAttachmentColor, + backgroundTypingIndicatorColor: + backgroundTypingIndicatorColor ?? + _this.backgroundTypingIndicatorColor, + textColor: textColor ?? _this.textColor, + textUsernameColor: textUsernameColor ?? _this.textUsernameColor, + textTimestampColor: textTimestampColor ?? _this.textTimestampColor, + textMentionColor: textMentionColor ?? _this.textMentionColor, + textLinkColor: textLinkColor ?? _this.textLinkColor, + textReactionColor: textReactionColor ?? _this.textReactionColor, + textSystemColor: textSystemColor ?? _this.textSystemColor, + borderColor: borderColor ?? _this.borderColor, + borderOnChatColor: borderOnChatColor ?? _this.borderOnChatColor, + threadConnectorColor: threadConnectorColor ?? _this.threadConnectorColor, + progressTrackColor: progressTrackColor ?? _this.progressTrackColor, + progressFillColor: progressFillColor ?? _this.progressFillColor, + replyIndicatorColor: replyIndicatorColor ?? _this.replyIndicatorColor, + waveFormBarColor: waveFormBarColor ?? _this.waveFormBarColor, + waveFormBarPlayingColor: + waveFormBarPlayingColor ?? _this.waveFormBarPlayingColor, + ); + } + + StreamMessageStyle merge(StreamMessageStyle? other) { + final _this = (this as StreamMessageStyle); + + if (other == null || identical(_this, other)) { + return _this; + } + + if (!other.canMerge) { + return other; + } + + return copyWith( + backgroundColor: other.backgroundColor, + backgroundAttachmentColor: other.backgroundAttachmentColor, + backgroundTypingIndicatorColor: other.backgroundTypingIndicatorColor, + textColor: other.textColor, + textUsernameColor: other.textUsernameColor, + textTimestampColor: other.textTimestampColor, + textMentionColor: other.textMentionColor, + textLinkColor: other.textLinkColor, + textReactionColor: other.textReactionColor, + textSystemColor: other.textSystemColor, + borderColor: other.borderColor, + borderOnChatColor: other.borderOnChatColor, + threadConnectorColor: other.threadConnectorColor, + progressTrackColor: other.progressTrackColor, + progressFillColor: other.progressFillColor, + replyIndicatorColor: other.replyIndicatorColor, + waveFormBarColor: other.waveFormBarColor, + waveFormBarPlayingColor: other.waveFormBarPlayingColor, + ); + } + + @override + bool operator ==(Object other) { + if (identical(this, other)) { + return true; + } + + if (other.runtimeType != runtimeType) { + return false; + } + + final _this = (this as StreamMessageStyle); + final _other = (other as StreamMessageStyle); + + return _other.backgroundColor == _this.backgroundColor && + _other.backgroundAttachmentColor == _this.backgroundAttachmentColor && + _other.backgroundTypingIndicatorColor == + _this.backgroundTypingIndicatorColor && + _other.textColor == _this.textColor && + _other.textUsernameColor == _this.textUsernameColor && + _other.textTimestampColor == _this.textTimestampColor && + _other.textMentionColor == _this.textMentionColor && + _other.textLinkColor == _this.textLinkColor && + _other.textReactionColor == _this.textReactionColor && + _other.textSystemColor == _this.textSystemColor && + _other.borderColor == _this.borderColor && + _other.borderOnChatColor == _this.borderOnChatColor && + _other.threadConnectorColor == _this.threadConnectorColor && + _other.progressTrackColor == _this.progressTrackColor && + _other.progressFillColor == _this.progressFillColor && + _other.replyIndicatorColor == _this.replyIndicatorColor && + _other.waveFormBarColor == _this.waveFormBarColor && + _other.waveFormBarPlayingColor == _this.waveFormBarPlayingColor; + } + + @override + int get hashCode { + final _this = (this as StreamMessageStyle); + + return Object.hash( + runtimeType, + _this.backgroundColor, + _this.backgroundAttachmentColor, + _this.backgroundTypingIndicatorColor, + _this.textColor, + _this.textUsernameColor, + _this.textTimestampColor, + _this.textMentionColor, + _this.textLinkColor, + _this.textReactionColor, + _this.textSystemColor, + _this.borderColor, + _this.borderOnChatColor, + _this.threadConnectorColor, + _this.progressTrackColor, + _this.progressFillColor, + _this.replyIndicatorColor, + _this.waveFormBarColor, + _this.waveFormBarPlayingColor, + ); + } +} diff --git a/packages/stream_core_flutter/lib/src/theme/components/stream_online_indicator_theme.dart b/packages/stream_core_flutter/lib/src/theme/components/stream_online_indicator_theme.dart new file mode 100644 index 0000000..b273e9c --- /dev/null +++ b/packages/stream_core_flutter/lib/src/theme/components/stream_online_indicator_theme.dart @@ -0,0 +1,173 @@ +import 'package:flutter/widgets.dart'; +import 'package:theme_extensions_builder_annotation/theme_extensions_builder_annotation.dart'; + +import '../stream_theme.dart'; + +part 'stream_online_indicator_theme.g.theme.dart'; + +/// Predefined sizes for the online indicator. +/// +/// Each size corresponds to a specific diameter in logical pixels. +/// +/// See also: +/// +/// * [StreamOnlineIndicator], which uses these size variants. +/// * [StreamOnlineIndicatorThemeData.size], for setting a global default size. +enum StreamOnlineIndicatorSize { + /// Small indicator (8px diameter). + sm(8), + + /// Medium indicator (12px diameter). + md(12), + + /// Large indicator (14px diameter). + lg(14), + + /// Extra large indicator (16px diameter). + xl(16) + ; + + /// Constructs a [StreamOnlineIndicatorSize] with the given diameter. + const StreamOnlineIndicatorSize(this.value); + + /// The diameter of the indicator in logical pixels. + final double value; +} + +/// Applies an online indicator theme to descendant [StreamOnlineIndicator] +/// widgets. +/// +/// Wrap a subtree with [StreamOnlineIndicatorTheme] to override indicator +/// styling. Access the merged theme using [BuildContext.streamOnlineIndicatorTheme]. +/// +/// {@tool snippet} +/// +/// Override indicator colors for a specific section: +/// +/// ```dart +/// StreamOnlineIndicatorTheme( +/// data: StreamOnlineIndicatorThemeData( +/// backgroundOnline: Colors.green, +/// backgroundOffline: Colors.grey, +/// ), +/// child: Row( +/// children: [ +/// StreamOnlineIndicator(state: StreamPresenceState.online), +/// StreamOnlineIndicator(state: StreamPresenceState.offline), +/// ], +/// ), +/// ) +/// ``` +/// {@end-tool} +/// +/// See also: +/// +/// * [StreamOnlineIndicatorThemeData], which describes the indicator theme. +/// * [StreamOnlineIndicator], the widget affected by this theme. +class StreamOnlineIndicatorTheme extends InheritedTheme { + /// Creates an online indicator theme that controls descendant indicators. + const StreamOnlineIndicatorTheme({ + super.key, + required this.data, + required super.child, + }); + + /// The online indicator theme data for descendant widgets. + final StreamOnlineIndicatorThemeData data; + + /// Returns the [StreamOnlineIndicatorThemeData] merged from local and global + /// themes. + /// + /// Local values from the nearest [StreamOnlineIndicatorTheme] ancestor take + /// precedence over global values from [StreamTheme.of]. + /// + /// This allows partial overrides - for example, overriding only + /// [backgroundOnline] while inheriting other properties from the global theme. + static StreamOnlineIndicatorThemeData of(BuildContext context) { + final localTheme = context.dependOnInheritedWidgetOfExactType(); + return StreamTheme.of(context).onlineIndicatorTheme.merge(localTheme?.data); + } + + @override + Widget wrap(BuildContext context, Widget child) { + return StreamOnlineIndicatorTheme(data: data, child: child); + } + + @override + bool updateShouldNotify(StreamOnlineIndicatorTheme oldWidget) => data != oldWidget.data; +} + +/// Theme data for customizing [StreamOnlineIndicator] widgets. +/// +/// {@tool snippet} +/// +/// Customize indicator appearance globally: +/// +/// ```dart +/// StreamTheme( +/// onlineIndicatorTheme: StreamOnlineIndicatorThemeData( +/// backgroundOnline: Colors.green, +/// backgroundOffline: Colors.grey, +/// borderColor: Colors.white, +/// ), +/// ) +/// ``` +/// {@end-tool} +/// +/// See also: +/// +/// * [StreamOnlineIndicator], the widget that uses this theme data. +/// * [StreamOnlineIndicatorTheme], for overriding theme in a widget subtree. +@themeGen +@immutable +class StreamOnlineIndicatorThemeData with _$StreamOnlineIndicatorThemeData { + /// Creates an online indicator theme with optional style overrides. + const StreamOnlineIndicatorThemeData({ + this.size, + this.backgroundOnline, + this.backgroundOffline, + this.borderColor, + this.alignment, + this.offset, + }); + + /// The default size for online indicators. + /// + /// Falls back to [StreamOnlineIndicatorSize.lg]. + final StreamOnlineIndicatorSize? size; + + /// The background color for online presence indicators. + /// + /// Displayed when the user is currently online. + final Color? backgroundOnline; + + /// The background color for offline presence indicators. + /// + /// Displayed when the user is offline or away. + final Color? backgroundOffline; + + /// The border color for the indicator. + /// + /// A thin outline around the presence dot that matches the surface behind + /// the avatar. + final Color? borderColor; + + /// The alignment of the indicator relative to the child widget. + /// + /// Only used when [StreamOnlineIndicator.child] is provided. + /// Falls back to [AlignmentDirectional.topEnd]. + final AlignmentGeometry? alignment; + + /// The offset for fine-tuning indicator position. + /// + /// Applied after alignment to adjust the indicator's final position. + /// Falls back to [Offset.zero]. + final Offset? offset; + + /// Linearly interpolate between two [StreamOnlineIndicatorThemeData] objects. + static StreamOnlineIndicatorThemeData? lerp( + StreamOnlineIndicatorThemeData? a, + StreamOnlineIndicatorThemeData? b, + double t, + ) => _$StreamOnlineIndicatorThemeData.lerp(a, b, t); +} diff --git a/packages/stream_core_flutter/lib/src/theme/components/stream_online_indicator_theme.g.theme.dart b/packages/stream_core_flutter/lib/src/theme/components/stream_online_indicator_theme.g.theme.dart new file mode 100644 index 0000000..a2b96d9 --- /dev/null +++ b/packages/stream_core_flutter/lib/src/theme/components/stream_online_indicator_theme.g.theme.dart @@ -0,0 +1,122 @@ +// dart format width=80 +// coverage:ignore-file +// GENERATED CODE - DO NOT MODIFY BY HAND +// ignore_for_file: type=lint, unused_element + +part of 'stream_online_indicator_theme.dart'; + +// ************************************************************************** +// ThemeGenGenerator +// ************************************************************************** + +mixin _$StreamOnlineIndicatorThemeData { + bool get canMerge => true; + + static StreamOnlineIndicatorThemeData? lerp( + StreamOnlineIndicatorThemeData? a, + StreamOnlineIndicatorThemeData? b, + double t, + ) { + if (identical(a, b)) { + return a; + } + + if (a == null) { + return t == 1.0 ? b : null; + } + + if (b == null) { + return t == 0.0 ? a : null; + } + + return StreamOnlineIndicatorThemeData( + size: t < 0.5 ? a.size : b.size, + backgroundOnline: Color.lerp(a.backgroundOnline, b.backgroundOnline, t), + backgroundOffline: Color.lerp( + a.backgroundOffline, + b.backgroundOffline, + t, + ), + borderColor: Color.lerp(a.borderColor, b.borderColor, t), + alignment: AlignmentGeometry.lerp(a.alignment, b.alignment, t), + offset: Offset.lerp(a.offset, b.offset, t), + ); + } + + StreamOnlineIndicatorThemeData copyWith({ + StreamOnlineIndicatorSize? size, + Color? backgroundOnline, + Color? backgroundOffline, + Color? borderColor, + AlignmentGeometry? alignment, + Offset? offset, + }) { + final _this = (this as StreamOnlineIndicatorThemeData); + + return StreamOnlineIndicatorThemeData( + size: size ?? _this.size, + backgroundOnline: backgroundOnline ?? _this.backgroundOnline, + backgroundOffline: backgroundOffline ?? _this.backgroundOffline, + borderColor: borderColor ?? _this.borderColor, + alignment: alignment ?? _this.alignment, + offset: offset ?? _this.offset, + ); + } + + StreamOnlineIndicatorThemeData merge(StreamOnlineIndicatorThemeData? other) { + final _this = (this as StreamOnlineIndicatorThemeData); + + if (other == null || identical(_this, other)) { + return _this; + } + + if (!other.canMerge) { + return other; + } + + return copyWith( + size: other.size, + backgroundOnline: other.backgroundOnline, + backgroundOffline: other.backgroundOffline, + borderColor: other.borderColor, + alignment: other.alignment, + offset: other.offset, + ); + } + + @override + bool operator ==(Object other) { + if (identical(this, other)) { + return true; + } + + if (other.runtimeType != runtimeType) { + return false; + } + + final _this = (this as StreamOnlineIndicatorThemeData); + final _other = (other as StreamOnlineIndicatorThemeData); + + return _other.size == _this.size && + _other.backgroundOnline == _this.backgroundOnline && + _other.backgroundOffline == _this.backgroundOffline && + _other.borderColor == _this.borderColor && + _other.alignment == _this.alignment && + _other.offset == _this.offset; + } + + @override + int get hashCode { + final _this = (this as StreamOnlineIndicatorThemeData); + + return Object.hash( + runtimeType, + _this.size, + _this.backgroundOnline, + _this.backgroundOffline, + _this.borderColor, + _this.alignment, + _this.offset, + ); + } +} diff --git a/packages/stream_core_flutter/lib/src/theme/components/stream_progress_bar_theme.dart b/packages/stream_core_flutter/lib/src/theme/components/stream_progress_bar_theme.dart new file mode 100644 index 0000000..1ed80c3 --- /dev/null +++ b/packages/stream_core_flutter/lib/src/theme/components/stream_progress_bar_theme.dart @@ -0,0 +1,130 @@ +import 'package:flutter/widgets.dart'; +import 'package:theme_extensions_builder_annotation/theme_extensions_builder_annotation.dart'; + +import '../stream_theme.dart'; + +part 'stream_progress_bar_theme.g.theme.dart'; + +/// Applies a progress bar theme to descendant [StreamProgressBar] widgets. +/// +/// Wrap a subtree with [StreamProgressBarTheme] to override progress bar +/// styling. Access the merged theme using +/// [BuildContext.streamProgressBarTheme]. +/// +/// {@tool snippet} +/// +/// Override progress bar colors for a specific section: +/// +/// ```dart +/// StreamProgressBarTheme( +/// data: StreamProgressBarThemeData( +/// trackColor: Colors.grey.shade200, +/// fillColor: Colors.green, +/// ), +/// child: Column( +/// children: [ +/// StreamProgressBar(value: 0.3), +/// StreamProgressBar(value: 0.7), +/// ], +/// ), +/// ) +/// ``` +/// {@end-tool} +/// +/// See also: +/// +/// * [StreamProgressBarThemeData], which describes the progress bar theme. +/// * [StreamProgressBar], the widget affected by this theme. +class StreamProgressBarTheme extends InheritedTheme { + /// Creates a progress bar theme that controls descendant progress bars. + const StreamProgressBarTheme({ + super.key, + required this.data, + required super.child, + }); + + /// The progress bar theme data for descendant widgets. + final StreamProgressBarThemeData data; + + /// Returns the [StreamProgressBarThemeData] merged from local and global + /// themes. + /// + /// Local values from the nearest [StreamProgressBarTheme] ancestor take + /// precedence over global values from [StreamTheme.of]. + /// + /// This allows partial overrides - for example, overriding only + /// [StreamProgressBarThemeData.fillColor] while inheriting other properties + /// from the global theme. + static StreamProgressBarThemeData of(BuildContext context) { + final localTheme = context.dependOnInheritedWidgetOfExactType(); + return StreamTheme.of(context).progressBarTheme.merge(localTheme?.data); + } + + @override + Widget wrap(BuildContext context, Widget child) { + return StreamProgressBarTheme(data: data, child: child); + } + + @override + bool updateShouldNotify(StreamProgressBarTheme oldWidget) => data != oldWidget.data; +} + +/// Theme data for customizing [StreamProgressBar] widgets. +/// +/// {@tool snippet} +/// +/// Customize progress bar appearance globally: +/// +/// ```dart +/// StreamTheme( +/// progressBarTheme: StreamProgressBarThemeData( +/// trackColor: Colors.grey.shade200, +/// fillColor: Colors.blue, +/// minHeight: 6, +/// ), +/// ) +/// ``` +/// {@end-tool} +/// +/// See also: +/// +/// * [StreamProgressBar], the widget that uses this theme data. +/// * [StreamProgressBarTheme], for overriding theme in a widget subtree. +@themeGen +@immutable +class StreamProgressBarThemeData with _$StreamProgressBarThemeData { + /// Creates progress bar theme data with optional style overrides. + const StreamProgressBarThemeData({ + this.trackColor, + this.fillColor, + this.minHeight, + this.borderRadius, + }); + + /// The background track color of the progress bar. + /// + /// The track is the unfilled portion behind the indicator. + final Color? trackColor; + + /// The filled portion color of the progress bar. + /// + /// This color fills from the leading edge to indicate progress. + final Color? fillColor; + + /// The minimum height of the progress bar. + /// + /// Falls back to 8 logical pixels. + final double? minHeight; + + /// The border radius applied to both track and fill. + /// + /// Falls back to the design system's max radius. + final BorderRadiusGeometry? borderRadius; + + /// Linearly interpolate between two [StreamProgressBarThemeData] objects. + static StreamProgressBarThemeData? lerp( + StreamProgressBarThemeData? a, + StreamProgressBarThemeData? b, + double t, + ) => _$StreamProgressBarThemeData.lerp(a, b, t); +} diff --git a/packages/stream_core_flutter/lib/src/theme/components/stream_progress_bar_theme.g.theme.dart b/packages/stream_core_flutter/lib/src/theme/components/stream_progress_bar_theme.g.theme.dart new file mode 100644 index 0000000..a2d17ea --- /dev/null +++ b/packages/stream_core_flutter/lib/src/theme/components/stream_progress_bar_theme.g.theme.dart @@ -0,0 +1,110 @@ +// dart format width=80 +// coverage:ignore-file +// GENERATED CODE - DO NOT MODIFY BY HAND +// ignore_for_file: type=lint, unused_element + +part of 'stream_progress_bar_theme.dart'; + +// ************************************************************************** +// ThemeGenGenerator +// ************************************************************************** + +mixin _$StreamProgressBarThemeData { + bool get canMerge => true; + + static StreamProgressBarThemeData? lerp( + StreamProgressBarThemeData? a, + StreamProgressBarThemeData? b, + double t, + ) { + if (identical(a, b)) { + return a; + } + + if (a == null) { + return t == 1.0 ? b : null; + } + + if (b == null) { + return t == 0.0 ? a : null; + } + + return StreamProgressBarThemeData( + trackColor: Color.lerp(a.trackColor, b.trackColor, t), + fillColor: Color.lerp(a.fillColor, b.fillColor, t), + minHeight: lerpDouble$(a.minHeight, b.minHeight, t), + borderRadius: BorderRadiusGeometry.lerp( + a.borderRadius, + b.borderRadius, + t, + ), + ); + } + + StreamProgressBarThemeData copyWith({ + Color? trackColor, + Color? fillColor, + double? minHeight, + BorderRadiusGeometry? borderRadius, + }) { + final _this = (this as StreamProgressBarThemeData); + + return StreamProgressBarThemeData( + trackColor: trackColor ?? _this.trackColor, + fillColor: fillColor ?? _this.fillColor, + minHeight: minHeight ?? _this.minHeight, + borderRadius: borderRadius ?? _this.borderRadius, + ); + } + + StreamProgressBarThemeData merge(StreamProgressBarThemeData? other) { + final _this = (this as StreamProgressBarThemeData); + + if (other == null || identical(_this, other)) { + return _this; + } + + if (!other.canMerge) { + return other; + } + + return copyWith( + trackColor: other.trackColor, + fillColor: other.fillColor, + minHeight: other.minHeight, + borderRadius: other.borderRadius, + ); + } + + @override + bool operator ==(Object other) { + if (identical(this, other)) { + return true; + } + + if (other.runtimeType != runtimeType) { + return false; + } + + final _this = (this as StreamProgressBarThemeData); + final _other = (other as StreamProgressBarThemeData); + + return _other.trackColor == _this.trackColor && + _other.fillColor == _this.fillColor && + _other.minHeight == _this.minHeight && + _other.borderRadius == _this.borderRadius; + } + + @override + int get hashCode { + final _this = (this as StreamProgressBarThemeData); + + return Object.hash( + runtimeType, + _this.trackColor, + _this.fillColor, + _this.minHeight, + _this.borderRadius, + ); + } +} diff --git a/packages/stream_core_flutter/lib/src/theme/components/stream_reactions_theme.dart b/packages/stream_core_flutter/lib/src/theme/components/stream_reactions_theme.dart new file mode 100644 index 0000000..f8bcddd --- /dev/null +++ b/packages/stream_core_flutter/lib/src/theme/components/stream_reactions_theme.dart @@ -0,0 +1,161 @@ +import 'package:flutter/widgets.dart'; +import 'package:theme_extensions_builder_annotation/theme_extensions_builder_annotation.dart'; + +import '../stream_theme.dart'; + +part 'stream_reactions_theme.g.theme.dart'; + +/// The visual presentation style of [StreamReactions]. +/// +/// Determines whether reactions are shown as individual chips or as a single +/// grouped chip. +enum StreamReactionsType { + /// Shows each reaction type as an individual chip. + segmented, + + /// Groups multiple reaction types into a single chip. + clustered, +} + +/// The vertical position of [StreamReactions] relative to the child. +enum StreamReactionsPosition { + /// Places reactions above the child. + header, + + /// Places reactions below the child. + footer, +} + +/// The horizontal alignment of [StreamReactions] relative to the child. +enum StreamReactionsAlignment { + /// Aligns reactions to the leading edge of the child. + start, + + /// Aligns reactions to the trailing edge of the child. + end, +} + +/// Applies a reactions theme to descendant [StreamReactions] widgets. +/// +/// Wrap a subtree with [StreamReactionsTheme] to override reaction layout. +/// Access the merged theme using [BuildContext.streamReactionsTheme]. +/// +/// {@tool snippet} +/// +/// Override reaction layout for a specific section: +/// +/// ```dart +/// StreamReactionsTheme( +/// data: StreamReactionsThemeData( +/// spacing: 4, +/// gap: 6, +/// overlapExtent: 8, +/// indent: 4, +/// ), +/// child: StreamReactions.segmented( +/// items: [ +/// StreamReactionsItem(emoji: Text('👍'), count: 3), +/// StreamReactionsItem(emoji: Text('❤️'), count: 2), +/// ], +/// child: Container( +/// padding: EdgeInsets.all(12), +/// child: Text('Looks good'), +/// ), +/// ), +/// ) +/// ``` +/// {@end-tool} +/// +/// See also: +/// +/// * [StreamReactionsThemeData], which describes the reactions theme. +/// * [StreamReactions], the widget affected by this theme. +class StreamReactionsTheme extends InheritedTheme { + /// Creates a reactions theme that controls descendant reactions. + const StreamReactionsTheme({ + super.key, + required this.data, + required super.child, + }); + + /// The reaction theme data for descendant widgets. + final StreamReactionsThemeData data; + + /// Returns the [StreamReactionsThemeData] merged from local and global themes. + /// + /// Local values from the nearest [StreamReactionsTheme] ancestor take + /// precedence over global values from [StreamTheme.of]. + static StreamReactionsThemeData of(BuildContext context) { + final localTheme = context.dependOnInheritedWidgetOfExactType(); + return StreamTheme.of(context).reactionsTheme.merge(localTheme?.data); + } + + @override + Widget wrap(BuildContext context, Widget child) { + return StreamReactionsTheme(data: data, child: child); + } + + @override + bool updateShouldNotify(StreamReactionsTheme oldWidget) => data != oldWidget.data; +} + +/// Theme data for customizing [StreamReactions] layout. +/// +/// {@tool snippet} +/// +/// Customize reaction layout globally: +/// +/// ```dart +/// StreamTheme( +/// reactionsTheme: StreamReactionsThemeData( +/// spacing: 4, +/// gap: 6, +/// overlapExtent: 8, +/// indent: 4, +/// ), +/// ) +/// ``` +/// {@end-tool} +/// +/// See also: +/// +/// * [StreamReactions], the widget that uses this theme data. +/// * [StreamReactionsTheme], for overriding theme in a widget subtree. +/// * [StreamEmojiChipTheme], for customizing chip appearance. +@themeGen +@immutable +class StreamReactionsThemeData with _$StreamReactionsThemeData { + /// Creates reaction theme data with optional overrides. + const StreamReactionsThemeData({ + this.spacing, + this.gap, + this.overlapExtent, + this.indent, + }); + + /// The gap between adjacent reaction chips. + final double? spacing; + + /// The gap between the reaction strip and the child. + /// + /// Applied when reactions do not overlap the child. + final double? gap; + + /// How much the reaction strip overlaps the child. + /// + /// Higher values move the reactions further into the child. + final double? overlapExtent; + + /// The horizontal offset applied to the reaction strip. + /// + /// Positive values move reactions toward the trailing side, while negative + /// values move them toward the leading side. + final double? indent; + + /// Linearly interpolate between two [StreamReactionsThemeData] objects. + static StreamReactionsThemeData? lerp( + StreamReactionsThemeData? a, + StreamReactionsThemeData? b, + double t, + ) => _$StreamReactionsThemeData.lerp(a, b, t); +} diff --git a/packages/stream_core_flutter/lib/src/theme/components/stream_reactions_theme.g.theme.dart b/packages/stream_core_flutter/lib/src/theme/components/stream_reactions_theme.g.theme.dart new file mode 100644 index 0000000..7b3d87c --- /dev/null +++ b/packages/stream_core_flutter/lib/src/theme/components/stream_reactions_theme.g.theme.dart @@ -0,0 +1,106 @@ +// dart format width=80 +// coverage:ignore-file +// GENERATED CODE - DO NOT MODIFY BY HAND +// ignore_for_file: type=lint, unused_element + +part of 'stream_reactions_theme.dart'; + +// ************************************************************************** +// ThemeGenGenerator +// ************************************************************************** + +mixin _$StreamReactionsThemeData { + bool get canMerge => true; + + static StreamReactionsThemeData? lerp( + StreamReactionsThemeData? a, + StreamReactionsThemeData? b, + double t, + ) { + if (identical(a, b)) { + return a; + } + + if (a == null) { + return t == 1.0 ? b : null; + } + + if (b == null) { + return t == 0.0 ? a : null; + } + + return StreamReactionsThemeData( + spacing: lerpDouble$(a.spacing, b.spacing, t), + gap: lerpDouble$(a.gap, b.gap, t), + overlapExtent: lerpDouble$(a.overlapExtent, b.overlapExtent, t), + indent: lerpDouble$(a.indent, b.indent, t), + ); + } + + StreamReactionsThemeData copyWith({ + double? spacing, + double? gap, + double? overlapExtent, + double? indent, + }) { + final _this = (this as StreamReactionsThemeData); + + return StreamReactionsThemeData( + spacing: spacing ?? _this.spacing, + gap: gap ?? _this.gap, + overlapExtent: overlapExtent ?? _this.overlapExtent, + indent: indent ?? _this.indent, + ); + } + + StreamReactionsThemeData merge(StreamReactionsThemeData? other) { + final _this = (this as StreamReactionsThemeData); + + if (other == null || identical(_this, other)) { + return _this; + } + + if (!other.canMerge) { + return other; + } + + return copyWith( + spacing: other.spacing, + gap: other.gap, + overlapExtent: other.overlapExtent, + indent: other.indent, + ); + } + + @override + bool operator ==(Object other) { + if (identical(this, other)) { + return true; + } + + if (other.runtimeType != runtimeType) { + return false; + } + + final _this = (this as StreamReactionsThemeData); + final _other = (other as StreamReactionsThemeData); + + return _other.spacing == _this.spacing && + _other.gap == _this.gap && + _other.overlapExtent == _this.overlapExtent && + _other.indent == _this.indent; + } + + @override + int get hashCode { + final _this = (this as StreamReactionsThemeData); + + return Object.hash( + runtimeType, + _this.spacing, + _this.gap, + _this.overlapExtent, + _this.indent, + ); + } +} diff --git a/packages/stream_core_flutter/lib/src/theme/primitives/stream_color_swatch_helper.dart b/packages/stream_core_flutter/lib/src/theme/primitives/stream_color_swatch_helper.dart new file mode 100644 index 0000000..d62a6c4 --- /dev/null +++ b/packages/stream_core_flutter/lib/src/theme/primitives/stream_color_swatch_helper.dart @@ -0,0 +1,85 @@ +import 'package:flutter/foundation.dart'; +import 'package:flutter/painting.dart'; + +class StreamColorSwatchHelper { + const StreamColorSwatchHelper._(); + + /// Generates a map of color shades based on the provided base colors. + /// + /// This internal method creates the shade variations using HSL color space + /// for more natural color transitions. The center shade (500) uses the original + /// color's lightness, and other shades are calculated proportionally. + /// + /// When [brightness] is [Brightness.dark], the lightness values are inverted + /// so that lower shade numbers (e.g., 50) are darker and higher shade numbers + /// (e.g., 900) are lighter. + static Map generateShadeMap( + Color baseColor, { + Brightness brightness = Brightness.light, + }) { + final hslBase = HSLColor.fromColor(baseColor); + final centerLightness = hslBase.lightness; + + final shades = [50, 100, 150, 200, 300, 400, 500, 600, 700, 800, 900]; + + return { + for (final shade in shades) + shade: _adjustLightness( + hslBase, + _calculateLightness(shade, centerLightness, brightness: brightness), + ), + }; + } + + /// Calculates the target lightness for a given shade number based on the center lightness. + /// + /// The formula maps shade numbers (50-900) to lightness values where: + /// - For [Brightness.light]: + /// - 50 is the lightest (0.95) + /// - 500 uses the center lightness (original color's lightness) + /// - 900 is the darkest (0.12) + /// - For [Brightness.dark]: + /// - 50 is the darkest (0.12) + /// - 500 uses the center lightness (original color's lightness) + /// - 900 is the lightest (0.95) + /// + /// For shades lighter than 500: lightness increases proportionally from center to 0.95 (light mode) + /// For shades darker than 500: lightness decreases proportionally from center to 0.12 (light mode) + /// In dark mode, these mappings are inverted. + static double _calculateLightness( + int shade, + double centerLightness, { + Brightness brightness = Brightness.light, + }) { + const minLightness = 0.12; // Darkest shade + const maxLightness = 0.95; // Lightest shade + const centerShade = 500; + + if (shade == centerShade) { + return centerLightness; + } + + final isDark = brightness == Brightness.dark; + + if (shade < centerShade) { + // For light mode: lighter shades (toward maxLightness) + // For dark mode: darker shades (toward minLightness) + final targetLightness = isDark ? minLightness : maxLightness; + final t = (shade - 50) / (centerShade - 50); + return targetLightness - (targetLightness - centerLightness) * t; + } else { + // For light mode: darker shades (toward minLightness) + // For dark mode: lighter shades (toward maxLightness) + final targetLightness = isDark ? maxLightness : minLightness; + final t = (shade - centerShade) / (900 - centerShade); + return centerLightness - (centerLightness - targetLightness) * t; + } + } + + /// Adjusts the lightness of an HSL color while maintaining its hue and saturation. + /// + /// [lightness] should be between 0.0 and 1.0. + static Color _adjustLightness(HSLColor hslColor, double lightness) { + return hslColor.withLightness(lightness.clamp(0.0, 1.0)).toColor(); + } +} diff --git a/packages/stream_core_flutter/lib/src/theme/primitives/stream_colors.dart b/packages/stream_core_flutter/lib/src/theme/primitives/stream_colors.dart new file mode 100644 index 0000000..45eadc5 --- /dev/null +++ b/packages/stream_core_flutter/lib/src/theme/primitives/stream_colors.dart @@ -0,0 +1,308 @@ +import 'package:flutter/foundation.dart'; +import 'package:flutter/painting.dart'; + +import 'stream_color_swatch_helper.dart'; +import 'tokens/light/stream_tokens.dart' as tokens; + +/// [Color] and [ColorSwatch] constants for the Stream design system. +/// +/// Most swatches have colors from 50 to 900. The smaller the number, the more +/// pale the color. The greater the number, the darker the color. Shades 50-450 +/// are incremented by 50, and shades 500-900 are incremented by 100. +/// +/// In addition, a series of blacks and whites with common opacities are +/// available. For example, [white70] is a pure white with 70% opacity. +/// +/// {@tool snippet} +/// +/// To select a specific color from one of the swatches, index into the swatch +/// using an integer for the specific color desired, as follows: +/// +/// ```dart +/// Color selection = StreamColors.blue[400]!; // Selects a mid-range blue. +/// ``` +/// {@end-tool} +/// {@tool snippet} +/// +/// Each [ColorSwatch] constant is a color and can used directly. For example: +/// +/// ```dart +/// Container( +/// // same as StreamColors.blue[500] or StreamColors.blue.shade500 +/// color: StreamColors.blue, +/// ) +/// ``` +/// {@end-tool} +abstract final class StreamColors { + const StreamColors._(); + + /// The fully transparent color. + static const transparent = tokens.StreamTokens.baseTransparent0; + + /// The pure white color. + static const white = tokens.StreamTokens.baseWhite; + + /// The white color with 10% opacity. + static const white10 = tokens.StreamTokens.baseTransparentWhite10; + + /// The white color with 20% opacity. + static const white20 = tokens.StreamTokens.baseTransparentWhite20; + + /// The white color with 50% opacity. + static const white50 = Color(0x80FFFFFF); + + /// The white color with 70% opacity. + static const white70 = tokens.StreamTokens.baseTransparentWhite70; + + /// The pure black color. + static const black = tokens.StreamTokens.baseBlack; + + /// The black color with 5% opacity. + static const black5 = tokens.StreamTokens.baseTransparentBlack5; + + /// The black color with 10% opacity. + static const black10 = tokens.StreamTokens.baseTransparentBlack10; + + /// The black color with 50% opacity. + static const black50 = Color(0x80000000); + + /// The slate color swatch. + static final slate = StreamColorSwatch( + _slatePrimaryValue.toARGB32(), + const { + 50: tokens.StreamTokens.slate50, + 100: tokens.StreamTokens.slate100, + 150: tokens.StreamTokens.slate150, + 200: tokens.StreamTokens.slate200, + 300: tokens.StreamTokens.slate300, + 400: tokens.StreamTokens.slate400, + 500: tokens.StreamTokens.slate500, + 600: tokens.StreamTokens.slate600, + 700: tokens.StreamTokens.slate700, + 800: tokens.StreamTokens.slate800, + 900: tokens.StreamTokens.slate900, + }, + ); + static const _slatePrimaryValue = tokens.StreamTokens.slate500; + + /// The neutral color swatch. + static final neutral = StreamColorSwatch( + _neutralPrimaryValue.toARGB32(), + const { + 50: tokens.StreamTokens.neutral50, + 100: tokens.StreamTokens.neutral100, + 150: tokens.StreamTokens.neutral150, + 200: tokens.StreamTokens.neutral200, + 300: tokens.StreamTokens.neutral300, + 400: tokens.StreamTokens.neutral400, + 500: tokens.StreamTokens.neutral500, + 600: tokens.StreamTokens.neutral600, + 700: tokens.StreamTokens.neutral700, + 800: tokens.StreamTokens.neutral800, + 900: tokens.StreamTokens.neutral900, + }, + ); + static const _neutralPrimaryValue = tokens.StreamTokens.neutral500; + + /// The blue color swatch. + static final blue = StreamColorSwatch( + _bluePrimaryValue.toARGB32(), + const { + 50: tokens.StreamTokens.blue50, + 100: tokens.StreamTokens.blue100, + 150: tokens.StreamTokens.blue150, + 200: tokens.StreamTokens.blue200, + 300: tokens.StreamTokens.blue300, + 400: tokens.StreamTokens.blue400, + 500: tokens.StreamTokens.blue500, + 600: tokens.StreamTokens.blue600, + 700: tokens.StreamTokens.blue700, + 800: tokens.StreamTokens.blue800, + 900: tokens.StreamTokens.blue900, + }, + ); + static const _bluePrimaryValue = tokens.StreamTokens.blue500; + + /// The cyan color swatch. + static final cyan = StreamColorSwatch( + _cyanPrimaryValue.toARGB32(), + const { + 50: tokens.StreamTokens.cyan50, + 100: tokens.StreamTokens.cyan100, + 150: tokens.StreamTokens.cyan150, + 200: tokens.StreamTokens.cyan200, + 300: tokens.StreamTokens.cyan300, + 400: tokens.StreamTokens.cyan400, + 500: tokens.StreamTokens.cyan500, + 600: tokens.StreamTokens.cyan600, + 700: tokens.StreamTokens.cyan700, + 800: tokens.StreamTokens.cyan800, + 900: tokens.StreamTokens.cyan900, + }, + ); + static const _cyanPrimaryValue = tokens.StreamTokens.cyan500; + + /// The green color swatch. + static final green = StreamColorSwatch( + _greenPrimaryValue.toARGB32(), + const { + 50: tokens.StreamTokens.green50, + 100: tokens.StreamTokens.green100, + 150: tokens.StreamTokens.green150, + 200: tokens.StreamTokens.green200, + 300: tokens.StreamTokens.green300, + 400: tokens.StreamTokens.green400, + 500: tokens.StreamTokens.green500, + 600: tokens.StreamTokens.green600, + 700: tokens.StreamTokens.green700, + 800: tokens.StreamTokens.green800, + 900: tokens.StreamTokens.green900, + }, + ); + static const _greenPrimaryValue = tokens.StreamTokens.green500; + + /// The purple color swatch. + static final purple = StreamColorSwatch( + _purplePrimaryValue.toARGB32(), + const { + 50: tokens.StreamTokens.purple50, + 100: tokens.StreamTokens.purple100, + 150: tokens.StreamTokens.purple150, + 200: tokens.StreamTokens.purple200, + 300: tokens.StreamTokens.purple300, + 400: tokens.StreamTokens.purple400, + 500: tokens.StreamTokens.purple500, + 600: tokens.StreamTokens.purple600, + 700: tokens.StreamTokens.purple700, + 800: tokens.StreamTokens.purple800, + 900: tokens.StreamTokens.purple900, + }, + ); + static const _purplePrimaryValue = tokens.StreamTokens.purple500; + + /// The yellow color swatch. + static final yellow = StreamColorSwatch( + _yellowPrimaryValue.toARGB32(), + const { + 50: tokens.StreamTokens.yellow50, + 100: tokens.StreamTokens.yellow100, + 150: tokens.StreamTokens.yellow150, + 200: tokens.StreamTokens.yellow200, + 300: tokens.StreamTokens.yellow300, + 400: tokens.StreamTokens.yellow400, + 500: tokens.StreamTokens.yellow500, + 600: tokens.StreamTokens.yellow600, + 700: tokens.StreamTokens.yellow700, + 800: tokens.StreamTokens.yellow800, + 900: tokens.StreamTokens.yellow900, + }, + ); + static const _yellowPrimaryValue = tokens.StreamTokens.yellow500; + + /// The red color swatch. + static final red = StreamColorSwatch( + _redPrimaryValue.toARGB32(), + const { + 50: tokens.StreamTokens.red50, + 100: tokens.StreamTokens.red100, + 150: tokens.StreamTokens.red150, + 200: tokens.StreamTokens.red200, + 300: tokens.StreamTokens.red300, + 400: tokens.StreamTokens.red400, + 500: tokens.StreamTokens.red500, + 600: tokens.StreamTokens.red600, + 700: tokens.StreamTokens.red700, + 800: tokens.StreamTokens.red800, + 900: tokens.StreamTokens.red900, + }, + ); + static const _redPrimaryValue = tokens.StreamTokens.red500; + + /// The violet color swatch. + static final violet = StreamColorSwatch( + _violetPrimaryValue.toARGB32(), + const { + 50: tokens.StreamTokens.violet50, + 100: tokens.StreamTokens.violet100, + 150: tokens.StreamTokens.violet150, + 200: tokens.StreamTokens.violet200, + 300: tokens.StreamTokens.violet300, + 400: tokens.StreamTokens.violet400, + 500: tokens.StreamTokens.violet500, + 600: tokens.StreamTokens.violet600, + 700: tokens.StreamTokens.violet700, + 800: tokens.StreamTokens.violet800, + 900: tokens.StreamTokens.violet900, + }, + ); + static const _violetPrimaryValue = tokens.StreamTokens.violet500; + + /// The lime color swatch. + static final lime = StreamColorSwatch( + _limePrimaryValue.toARGB32(), + const { + 50: tokens.StreamTokens.lime50, + 100: tokens.StreamTokens.lime100, + 150: tokens.StreamTokens.lime150, + 200: tokens.StreamTokens.lime200, + 300: tokens.StreamTokens.lime300, + 400: tokens.StreamTokens.lime400, + 500: tokens.StreamTokens.lime500, + 600: tokens.StreamTokens.lime600, + 700: tokens.StreamTokens.lime700, + 800: tokens.StreamTokens.lime800, + 900: tokens.StreamTokens.lime900, + }, + ); + static const _limePrimaryValue = tokens.StreamTokens.lime500; +} + +/// A color swatch with multiple shades of a single color. +/// +/// See also: +/// +/// * [StreamColors], which defines all of the standard swatch colors. +@immutable +class StreamColorSwatch extends ColorSwatch { + const StreamColorSwatch(super.primary, super._swatch); + + factory StreamColorSwatch.fromColor(Color color, {Brightness brightness = Brightness.light}) { + return StreamColorSwatch( + color.toARGB32(), + StreamColorSwatchHelper.generateShadeMap(color, brightness: brightness), + ); + } + + /// The lightest shade. + Color get shade50 => this[50]!; + + /// The second lightest shade. + Color get shade100 => this[100]!; + + /// The shade between 100 and 200. + Color get shade150 => this[150]!; + + /// The third lightest shade. + Color get shade200 => this[200]!; + + /// The fourth lightest shade. + Color get shade300 => this[300]!; + + /// The fifth lightest shade. + Color get shade400 => this[400]!; + + /// The default shade. + Color get shade500 => this[500]!; + + /// The fourth darkest shade. + Color get shade600 => this[600]!; + + /// The third darkest shade. + Color get shade700 => this[700]!; + + /// The second darkest shade. + Color get shade800 => this[800]!; + + /// The second shade. + Color get shade900 => this[900]!; +} diff --git a/packages/stream_core_flutter/lib/src/theme/primitives/stream_icons.dart b/packages/stream_core_flutter/lib/src/theme/primitives/stream_icons.dart new file mode 100644 index 0000000..0d65a6e --- /dev/null +++ b/packages/stream_core_flutter/lib/src/theme/primitives/stream_icons.dart @@ -0,0 +1,823 @@ +// GENERATED CODE - DO NOT MODIFY BY HAND +// Generated by scripts/generate_icons.dart +// +// To regenerate: melos run generate:icons + +import 'package:flutter/widgets.dart'; +import 'package:theme_extensions_builder_annotation/theme_extensions_builder_annotation.dart'; +part 'stream_icons.g.theme.dart'; +part 'stream_icons.g.dart'; + +/// Provides customizable icons for the Stream design system. +/// +/// [StreamIcons] allows customization of icons used throughout Stream widgets. +/// Each icon is exposed as a field that defaults to the corresponding +/// [StreamIconData] constant. +/// +/// {@tool snippet} +/// +/// Access icons via context: +/// +/// ```dart +/// final icon = context.streamIcons.settingsGear2; +/// ``` +/// {@end-tool} +/// +/// {@tool snippet} +/// +/// Override specific icons in [StreamTheme]: +/// +/// ```dart +/// StreamTheme( +/// icons: StreamIcons( +/// settingsGear2: Icons.settings_outlined, +/// lock: Icons.lock_outline, +/// ), +/// ) +/// ``` +/// {@end-tool} +/// +/// {@tool snippet} +/// +/// Use copyWith for partial overrides: +/// +/// ```dart +/// final customIcons = const StreamIcons().copyWith( +/// settingsGear2: Icons.settings_outlined, +/// ); +/// ``` +/// {@end-tool} +/// +/// See also: +/// +/// * [StreamIconData], which contains the raw icon data constants. +/// * [StreamTheme], which accepts custom icons via the [icons] parameter. +@themeGen +@immutable +class StreamIcons with _$StreamIcons { + /// Creates an icon set with optional overrides. + const StreamIcons({ + this.apiAggregate = StreamIconData.iconApiAggregate, + this.apples = StreamIconData.iconApples, + this.archive1 = StreamIconData.iconArchive1, + this.arrowBoxLeft = StreamIconData.iconArrowBoxLeft, + this.arrowDown = StreamIconData.iconArrowDown, + this.arrowLeft = StreamIconData.iconArrowLeft, + this.arrowRight = StreamIconData.iconArrowRight, + this.arrowRotateClockwise = StreamIconData.iconArrowRotateClockwise, + this.arrowRotateRightLeftRepeatRefresh = StreamIconData.iconArrowRotateRightLeftRepeatRefresh, + this.arrowShareLeft = StreamIconData.iconArrowShareLeft, + this.arrowUp = StreamIconData.iconArrowUp, + this.arrowsRepeatLeftRight = StreamIconData.iconArrowsRepeatLeftRight, + this.at = StreamIconData.iconAt, + this.atSolid = StreamIconData.iconAtSolid, + this.bellNotification = StreamIconData.iconBellNotification, + this.bellOff = StreamIconData.iconBellOff, + this.bookmark = StreamIconData.iconBookmark, + this.bookmarkRemove = StreamIconData.iconBookmarkRemove, + this.browserAISparkle = StreamIconData.iconBrowserAISparkle, + this.bubble3ChatMessage = StreamIconData.iconBubble3ChatMessage, + this.bubble3Solid = StreamIconData.iconBubble3Solid, + this.bubbleAnnotation2ChatMessage = StreamIconData.iconBubbleAnnotation2ChatMessage, + this.bubbleText6ChatMessage = StreamIconData.iconBubbleText6ChatMessage, + this.bubbleText6Solid = StreamIconData.iconBubbleText6Solid, + this.bubbleWideNotificationChatMessage = StreamIconData.iconBubbleWideNotificationChatMessage, + this.bubbleWideSparkleChatMessage = StreamIconData.iconBubbleWideSparkleChatMessage, + this.calendar1 = StreamIconData.iconCalendar1, + this.callCancel = StreamIconData.iconCallCancel, + this.camera1 = StreamIconData.iconCamera1, + this.car1 = StreamIconData.iconCar1, + this.cat = StreamIconData.iconCat, + this.chainLink3 = StreamIconData.iconChainLink3, + this.chart5 = StreamIconData.iconChart5, + this.checkmark1Small = StreamIconData.iconCheckmark1Small, + this.checkmark2 = StreamIconData.iconCheckmark2, + this.checkmark2Small = StreamIconData.iconCheckmark2Small, + this.chevronDown = StreamIconData.iconChevronDown, + this.chevronGrabberVerticalSelector = StreamIconData.iconChevronGrabberVerticalSelector, + this.chevronLeft = StreamIconData.iconChevronLeft, + this.chevronRight = StreamIconData.iconChevronRight, + this.chevronTop = StreamIconData.iconChevronTop, + this.circleBanSign = StreamIconData.iconCircleBanSign, + this.circleCheck = StreamIconData.iconCircleCheck, + this.circleInfoTooltip = StreamIconData.iconCircleInfoTooltip, + this.circleMinus = StreamIconData.iconCircleMinus, + this.circleQuestionmark = StreamIconData.iconCircleQuestionmark, + this.circleQuestionmarkFilled = StreamIconData.iconCircleQuestionmarkFilled, + this.circleX = StreamIconData.iconCircleX, + this.clock = StreamIconData.iconClock, + this.clockSolid = StreamIconData.iconClockSolid, + this.closeQuote2 = StreamIconData.iconCloseQuote2, + this.code = StreamIconData.iconCode, + this.codeBrackets = StreamIconData.iconCodeBrackets, + this.codeEditorInsert = StreamIconData.iconCodeEditorInsert, + this.compass = StreamIconData.iconCompass, + this.creditCard2Billing = StreamIconData.iconCreditCard2Billing, + this.crossMedium = StreamIconData.iconCrossMedium, + this.crossSmall = StreamIconData.iconCrossSmall, + this.dotGrid1x3Horizontal = StreamIconData.iconDotGrid1x3Horizontal, + this.dotGrid2x3 = StreamIconData.iconDotGrid2x3, + this.dotsGrid1x3Vertical = StreamIconData.iconDotsGrid1x3Vertical, + this.doupleCheckmark1Small = StreamIconData.iconDoupleCheckmark1Small, + this.editBig = StreamIconData.iconEditBig, + this.editBigSolid = StreamIconData.iconEditBigSolid, + this.emojiAddReaction = StreamIconData.iconEmojiAddReaction, + this.emojiSad = StreamIconData.iconEmojiSad, + this.emojiSmile = StreamIconData.iconEmojiSmile, + this.exclamationCircle = StreamIconData.iconExclamationCircle, + this.exclamationCircle1 = StreamIconData.iconExclamationCircle1, + this.exclamationTriangle = StreamIconData.iconExclamationTriangle, + this.exclamationTriangle1 = StreamIconData.iconExclamationTriangle1, + this.eyeOpen = StreamIconData.iconEyeOpen, + this.fileArrowLeftIn = StreamIconData.iconFileArrowLeftIn, + this.fileBend = StreamIconData.iconFileBend, + this.filledCircleInfoTooltip = StreamIconData.iconFilledCircleInfoTooltip, + this.filter1 = StreamIconData.iconFilter1, + this.flag2 = StreamIconData.iconFlag2, + this.gauge = StreamIconData.iconGauge, + this.google = StreamIconData.iconGoogle, + this.hashtagChannel = StreamIconData.iconHashtagChannel, + this.heart2 = StreamIconData.iconHeart2, + this.history = StreamIconData.iconHistory, + this.images1Alt = StreamIconData.iconImages1Alt, + this.invite = StreamIconData.iconInvite, + this.layersBehind = StreamIconData.iconLayersBehind, + this.layoutAlignLeft = StreamIconData.iconLayoutAlignLeft, + this.layoutGrid1 = StreamIconData.iconLayoutGrid1, + this.layoutLeft = StreamIconData.iconLayoutLeft, + this.lightBulbSimple = StreamIconData.iconLightBulbSimple, + this.limits = StreamIconData.iconLimits, + this.lineChart3 = StreamIconData.iconLineChart3, + this.lock = StreamIconData.iconLock, + this.magnifyingGlassSearch = StreamIconData.iconMagnifyingGlassSearch, + this.mapPin = StreamIconData.iconMapPin, + this.microphone = StreamIconData.iconMicrophone, + this.microphoneSolid = StreamIconData.iconMicrophoneSolid, + this.minusLarge = StreamIconData.iconMinusLarge, + this.minusSmall = StreamIconData.iconMinusSmall, + this.mute = StreamIconData.iconMute, + this.newspaper2 = StreamIconData.iconNewspaper2, + this.organization = StreamIconData.iconOrganization, + this.paperPlane = StreamIconData.iconPaperPlane, + this.paperPlaneTopRight = StreamIconData.iconPaperPlaneTopRight, + this.paperclip1 = StreamIconData.iconPaperclip1, + this.paragraphsText = StreamIconData.iconParagraphsText, + this.pause = StreamIconData.iconPause, + this.pencil = StreamIconData.iconPencil, + this.people = StreamIconData.iconPeople, + this.people2 = StreamIconData.iconPeople2, + this.peopleAdd = StreamIconData.iconPeopleAdd, + this.peopleAdded = StreamIconData.iconPeopleAdded, + this.peopleCircle = StreamIconData.iconPeopleCircle, + this.peopleCopy = StreamIconData.iconPeopleCopy, + this.peopleEditUserRights = StreamIconData.iconPeopleEditUserRights, + this.peopleRemove = StreamIconData.iconPeopleRemove, + this.persona = StreamIconData.iconPersona, + this.pin = StreamIconData.iconPin, + this.playSolid = StreamIconData.iconPlaySolid, + this.plusLarge = StreamIconData.iconPlusLarge, + this.plusSmall = StreamIconData.iconPlusSmall, + this.runShortcut = StreamIconData.iconRunShortcut, + this.searchText = StreamIconData.iconSearchText, + this.settingsGear2 = StreamIconData.iconSettingsGear2, + this.settingsSliderVer = StreamIconData.iconSettingsSliderVer, + this.shapesPlusCloseSquareCircle = StreamIconData.iconShapesPlusCloseSquareCircle, + this.shapesTriangleSquareCircle = StreamIconData.iconShapesTriangleSquareCircle, + this.shareOs = StreamIconData.iconShareOs, + this.shareRedirectLink = StreamIconData.iconShareRedirectLink, + this.shield = StreamIconData.iconShield, + this.squareBehindSquare2Copy = StreamIconData.iconSquareBehindSquare2Copy, + this.squareCircleTopRightFeeds = StreamIconData.iconSquareCircleTopRightFeeds, + this.stop = StreamIconData.iconStop, + this.table = StreamIconData.iconTable, + this.team = StreamIconData.iconTeam, + this.tennis = StreamIconData.iconTennis, + this.textToImageURLEnrichment = StreamIconData.iconTextToImageURLEnrichment, + this.thunder = StreamIconData.iconThunder, + this.trashBin = StreamIconData.iconTrashBin, + this.trending4 = StreamIconData.iconTrending4, + this.trophy = StreamIconData.iconTrophy, + this.unlocked = StreamIconData.iconUnlocked, + this.unpin = StreamIconData.iconUnpin, + this.users = StreamIconData.iconUsers, + this.video = StreamIconData.iconVideo, + this.videoSolid = StreamIconData.iconVideoSolid, + this.voiceAndVideo = StreamIconData.iconVoiceAndVideo, + this.voiceHigh = StreamIconData.iconVoiceHigh, + this.volumeFull = StreamIconData.iconVolumeFull, + this.webhook = StreamIconData.iconWebhook, + }); + + /// The api aggregate icon. + final IconData apiAggregate; + + /// The apples icon. + final IconData apples; + + /// The archive1 icon. + final IconData archive1; + + /// The arrow box left icon. + final IconData arrowBoxLeft; + + /// The arrow down icon. + final IconData arrowDown; + + /// The arrow left icon. + final IconData arrowLeft; + + /// The arrow right icon. + final IconData arrowRight; + + /// The arrow rotate clockwise icon. + final IconData arrowRotateClockwise; + + /// The arrow rotate right left repeat refresh icon. + final IconData arrowRotateRightLeftRepeatRefresh; + + /// The arrow share left icon. + final IconData arrowShareLeft; + + /// The arrow up icon. + final IconData arrowUp; + + /// The arrows repeat left right icon. + final IconData arrowsRepeatLeftRight; + + /// The at icon. + final IconData at; + + /// The at solid icon. + final IconData atSolid; + + /// The bell notification icon. + final IconData bellNotification; + + /// The bell off icon. + final IconData bellOff; + + /// The bookmark icon. + final IconData bookmark; + + /// The bookmark remove icon. + final IconData bookmarkRemove; + + /// The browser a i sparkle icon. + final IconData browserAISparkle; + + /// The bubble3 chat message icon. + final IconData bubble3ChatMessage; + + /// The bubble3 solid icon. + final IconData bubble3Solid; + + /// The bubble annotation2 chat message icon. + final IconData bubbleAnnotation2ChatMessage; + + /// The bubble text6 chat message icon. + final IconData bubbleText6ChatMessage; + + /// The bubble text6 solid icon. + final IconData bubbleText6Solid; + + /// The bubble wide notification chat message icon. + final IconData bubbleWideNotificationChatMessage; + + /// The bubble wide sparkle chat message icon. + final IconData bubbleWideSparkleChatMessage; + + /// The calendar1 icon. + final IconData calendar1; + + /// The call cancel icon. + final IconData callCancel; + + /// The camera1 icon. + final IconData camera1; + + /// The car1 icon. + final IconData car1; + + /// The cat icon. + final IconData cat; + + /// The chain link3 icon. + final IconData chainLink3; + + /// The chart5 icon. + final IconData chart5; + + /// The checkmark1 small icon. + final IconData checkmark1Small; + + /// The checkmark2 icon. + final IconData checkmark2; + + /// The checkmark2 small icon. + final IconData checkmark2Small; + + /// The chevron down icon. + final IconData chevronDown; + + /// The chevron grabber vertical selector icon. + final IconData chevronGrabberVerticalSelector; + + /// The chevron left icon. + final IconData chevronLeft; + + /// The chevron right icon. + final IconData chevronRight; + + /// The chevron top icon. + final IconData chevronTop; + + /// The circle ban sign icon. + final IconData circleBanSign; + + /// The circle check icon. + final IconData circleCheck; + + /// The circle info tooltip icon. + final IconData circleInfoTooltip; + + /// The circle minus icon. + final IconData circleMinus; + + /// The circle questionmark icon. + final IconData circleQuestionmark; + + /// The circle questionmark filled icon. + final IconData circleQuestionmarkFilled; + + /// The circle x icon. + final IconData circleX; + + /// The clock icon. + final IconData clock; + + /// The clock solid icon. + final IconData clockSolid; + + /// The close quote2 icon. + final IconData closeQuote2; + + /// The code icon. + final IconData code; + + /// The code brackets icon. + final IconData codeBrackets; + + /// The code editor insert icon. + final IconData codeEditorInsert; + + /// The compass icon. + final IconData compass; + + /// The credit card2 billing icon. + final IconData creditCard2Billing; + + /// The cross medium icon. + final IconData crossMedium; + + /// The cross small icon. + final IconData crossSmall; + + /// The dot grid1x3 horizontal icon. + final IconData dotGrid1x3Horizontal; + + /// The dot grid2x3 icon. + final IconData dotGrid2x3; + + /// The dots grid1x3 vertical icon. + final IconData dotsGrid1x3Vertical; + + /// The douple checkmark1 small icon. + final IconData doupleCheckmark1Small; + + /// The edit big icon. + final IconData editBig; + + /// The edit big solid icon. + final IconData editBigSolid; + + /// The emoji add reaction icon. + final IconData emojiAddReaction; + + /// The emoji sad icon. + final IconData emojiSad; + + /// The emoji smile icon. + final IconData emojiSmile; + + /// The exclamation circle icon. + final IconData exclamationCircle; + + /// The exclamation circle1 icon. + final IconData exclamationCircle1; + + /// The exclamation triangle icon. + final IconData exclamationTriangle; + + /// The exclamation triangle1 icon. + final IconData exclamationTriangle1; + + /// The eye open icon. + final IconData eyeOpen; + + /// The file arrow left in icon. + final IconData fileArrowLeftIn; + + /// The file bend icon. + final IconData fileBend; + + /// The filled circle info tooltip icon. + final IconData filledCircleInfoTooltip; + + /// The filter1 icon. + final IconData filter1; + + /// The flag2 icon. + final IconData flag2; + + /// The gauge icon. + final IconData gauge; + + /// The google icon. + final IconData google; + + /// The hashtag channel icon. + final IconData hashtagChannel; + + /// The heart2 icon. + final IconData heart2; + + /// The history icon. + final IconData history; + + /// The images1 alt icon. + final IconData images1Alt; + + /// The invite icon. + final IconData invite; + + /// The layers behind icon. + final IconData layersBehind; + + /// The layout align left icon. + final IconData layoutAlignLeft; + + /// The layout grid1 icon. + final IconData layoutGrid1; + + /// The layout left icon. + final IconData layoutLeft; + + /// The light bulb simple icon. + final IconData lightBulbSimple; + + /// The limits icon. + final IconData limits; + + /// The line chart3 icon. + final IconData lineChart3; + + /// The lock icon. + final IconData lock; + + /// The magnifying glass search icon. + final IconData magnifyingGlassSearch; + + /// The map pin icon. + final IconData mapPin; + + /// The microphone icon. + final IconData microphone; + + /// The microphone solid icon. + final IconData microphoneSolid; + + /// The minus large icon. + final IconData minusLarge; + + /// The minus small icon. + final IconData minusSmall; + + /// The mute icon. + final IconData mute; + + /// The newspaper2 icon. + final IconData newspaper2; + + /// The organization icon. + final IconData organization; + + /// The paper plane icon. + final IconData paperPlane; + + /// The paper plane top right icon. + final IconData paperPlaneTopRight; + + /// The paperclip1 icon. + final IconData paperclip1; + + /// The paragraphs text icon. + final IconData paragraphsText; + + /// The pause icon. + final IconData pause; + + /// The pencil icon. + final IconData pencil; + + /// The people icon. + final IconData people; + + /// The people2 icon. + final IconData people2; + + /// The people add icon. + final IconData peopleAdd; + + /// The people added icon. + final IconData peopleAdded; + + /// The people circle icon. + final IconData peopleCircle; + + /// The people copy icon. + final IconData peopleCopy; + + /// The people edit user rights icon. + final IconData peopleEditUserRights; + + /// The people remove icon. + final IconData peopleRemove; + + /// The persona icon. + final IconData persona; + + /// The pin icon. + final IconData pin; + + /// The play solid icon. + final IconData playSolid; + + /// The plus large icon. + final IconData plusLarge; + + /// The plus small icon. + final IconData plusSmall; + + /// The run shortcut icon. + final IconData runShortcut; + + /// The search text icon. + final IconData searchText; + + /// The settings gear2 icon. + final IconData settingsGear2; + + /// The settings slider ver icon. + final IconData settingsSliderVer; + + /// The shapes plus close square circle icon. + final IconData shapesPlusCloseSquareCircle; + + /// The shapes triangle square circle icon. + final IconData shapesTriangleSquareCircle; + + /// The share os icon. + final IconData shareOs; + + /// The share redirect link icon. + final IconData shareRedirectLink; + + /// The shield icon. + final IconData shield; + + /// The square behind square2 copy icon. + final IconData squareBehindSquare2Copy; + + /// The square circle top right feeds icon. + final IconData squareCircleTopRightFeeds; + + /// The stop icon. + final IconData stop; + + /// The table icon. + final IconData table; + + /// The team icon. + final IconData team; + + /// The tennis icon. + final IconData tennis; + + /// The text to image u r l enrichment icon. + final IconData textToImageURLEnrichment; + + /// The thunder icon. + final IconData thunder; + + /// The trash bin icon. + final IconData trashBin; + + /// The trending4 icon. + final IconData trending4; + + /// The trophy icon. + final IconData trophy; + + /// The unlocked icon. + final IconData unlocked; + + /// The unpin icon. + final IconData unpin; + + /// The users icon. + final IconData users; + + /// The video icon. + final IconData video; + + /// The video solid icon. + final IconData videoSolid; + + /// The voice and video icon. + final IconData voiceAndVideo; + + /// The voice high icon. + final IconData voiceHigh; + + /// The volume full icon. + final IconData volumeFull; + + /// The webhook icon. + final IconData webhook; + + /// A map of all available icons keyed by their field name. + /// + /// Useful for dynamic icon lookup by string name. + /// + /// ```dart + /// final icon = context.streamIcons.allIcons['settingsGear2']; + /// ``` + Map get allIcons => { + 'apiAggregate': apiAggregate, + 'apples': apples, + 'archive1': archive1, + 'arrowBoxLeft': arrowBoxLeft, + 'arrowDown': arrowDown, + 'arrowLeft': arrowLeft, + 'arrowRight': arrowRight, + 'arrowRotateClockwise': arrowRotateClockwise, + 'arrowRotateRightLeftRepeatRefresh': arrowRotateRightLeftRepeatRefresh, + 'arrowShareLeft': arrowShareLeft, + 'arrowUp': arrowUp, + 'arrowsRepeatLeftRight': arrowsRepeatLeftRight, + 'at': at, + 'atSolid': atSolid, + 'bellNotification': bellNotification, + 'bellOff': bellOff, + 'bookmark': bookmark, + 'bookmarkRemove': bookmarkRemove, + 'browserAISparkle': browserAISparkle, + 'bubble3ChatMessage': bubble3ChatMessage, + 'bubble3Solid': bubble3Solid, + 'bubbleAnnotation2ChatMessage': bubbleAnnotation2ChatMessage, + 'bubbleText6ChatMessage': bubbleText6ChatMessage, + 'bubbleText6Solid': bubbleText6Solid, + 'bubbleWideNotificationChatMessage': bubbleWideNotificationChatMessage, + 'bubbleWideSparkleChatMessage': bubbleWideSparkleChatMessage, + 'calendar1': calendar1, + 'callCancel': callCancel, + 'camera1': camera1, + 'car1': car1, + 'cat': cat, + 'chainLink3': chainLink3, + 'chart5': chart5, + 'checkmark1Small': checkmark1Small, + 'checkmark2': checkmark2, + 'checkmark2Small': checkmark2Small, + 'chevronDown': chevronDown, + 'chevronGrabberVerticalSelector': chevronGrabberVerticalSelector, + 'chevronLeft': chevronLeft, + 'chevronRight': chevronRight, + 'chevronTop': chevronTop, + 'circleBanSign': circleBanSign, + 'circleCheck': circleCheck, + 'circleInfoTooltip': circleInfoTooltip, + 'circleMinus': circleMinus, + 'circleQuestionmark': circleQuestionmark, + 'circleQuestionmarkFilled': circleQuestionmarkFilled, + 'circleX': circleX, + 'clock': clock, + 'clockSolid': clockSolid, + 'closeQuote2': closeQuote2, + 'code': code, + 'codeBrackets': codeBrackets, + 'codeEditorInsert': codeEditorInsert, + 'compass': compass, + 'creditCard2Billing': creditCard2Billing, + 'crossMedium': crossMedium, + 'crossSmall': crossSmall, + 'dotGrid1x3Horizontal': dotGrid1x3Horizontal, + 'dotGrid2x3': dotGrid2x3, + 'dotsGrid1x3Vertical': dotsGrid1x3Vertical, + 'doupleCheckmark1Small': doupleCheckmark1Small, + 'editBig': editBig, + 'editBigSolid': editBigSolid, + 'emojiAddReaction': emojiAddReaction, + 'emojiSad': emojiSad, + 'emojiSmile': emojiSmile, + 'exclamationCircle': exclamationCircle, + 'exclamationCircle1': exclamationCircle1, + 'exclamationTriangle': exclamationTriangle, + 'exclamationTriangle1': exclamationTriangle1, + 'eyeOpen': eyeOpen, + 'fileArrowLeftIn': fileArrowLeftIn, + 'fileBend': fileBend, + 'filledCircleInfoTooltip': filledCircleInfoTooltip, + 'filter1': filter1, + 'flag2': flag2, + 'gauge': gauge, + 'google': google, + 'hashtagChannel': hashtagChannel, + 'heart2': heart2, + 'history': history, + 'images1Alt': images1Alt, + 'invite': invite, + 'layersBehind': layersBehind, + 'layoutAlignLeft': layoutAlignLeft, + 'layoutGrid1': layoutGrid1, + 'layoutLeft': layoutLeft, + 'lightBulbSimple': lightBulbSimple, + 'limits': limits, + 'lineChart3': lineChart3, + 'lock': lock, + 'magnifyingGlassSearch': magnifyingGlassSearch, + 'mapPin': mapPin, + 'microphone': microphone, + 'microphoneSolid': microphoneSolid, + 'minusLarge': minusLarge, + 'minusSmall': minusSmall, + 'mute': mute, + 'newspaper2': newspaper2, + 'organization': organization, + 'paperPlane': paperPlane, + 'paperPlaneTopRight': paperPlaneTopRight, + 'paperclip1': paperclip1, + 'paragraphsText': paragraphsText, + 'pause': pause, + 'pencil': pencil, + 'people': people, + 'people2': people2, + 'peopleAdd': peopleAdd, + 'peopleAdded': peopleAdded, + 'peopleCircle': peopleCircle, + 'peopleCopy': peopleCopy, + 'peopleEditUserRights': peopleEditUserRights, + 'peopleRemove': peopleRemove, + 'persona': persona, + 'pin': pin, + 'playSolid': playSolid, + 'plusLarge': plusLarge, + 'plusSmall': plusSmall, + 'runShortcut': runShortcut, + 'searchText': searchText, + 'settingsGear2': settingsGear2, + 'settingsSliderVer': settingsSliderVer, + 'shapesPlusCloseSquareCircle': shapesPlusCloseSquareCircle, + 'shapesTriangleSquareCircle': shapesTriangleSquareCircle, + 'shareOs': shareOs, + 'shareRedirectLink': shareRedirectLink, + 'shield': shield, + 'squareBehindSquare2Copy': squareBehindSquare2Copy, + 'squareCircleTopRightFeeds': squareCircleTopRightFeeds, + 'stop': stop, + 'table': table, + 'team': team, + 'tennis': tennis, + 'textToImageURLEnrichment': textToImageURLEnrichment, + 'thunder': thunder, + 'trashBin': trashBin, + 'trending4': trending4, + 'trophy': trophy, + 'unlocked': unlocked, + 'unpin': unpin, + 'users': users, + 'video': video, + 'videoSolid': videoSolid, + 'voiceAndVideo': voiceAndVideo, + 'voiceHigh': voiceHigh, + 'volumeFull': volumeFull, + 'webhook': webhook, + }; + + /// Linearly interpolate between two [StreamIcons] objects. + static StreamIcons? lerp( + StreamIcons? a, + StreamIcons? b, + double t, + ) => _$StreamIcons.lerp(a, b, t); +} diff --git a/packages/stream_core_flutter/lib/src/theme/primitives/stream_icons.g.dart b/packages/stream_core_flutter/lib/src/theme/primitives/stream_icons.g.dart new file mode 100644 index 0000000..5dd0dff --- /dev/null +++ b/packages/stream_core_flutter/lib/src/theme/primitives/stream_icons.g.dart @@ -0,0 +1,944 @@ +// Generated code: do not hand-edit. + +// Generated using icon_font_generator. +// Copyright © 2026 icon_font_generator (https://pub.dev/packages/icon_font_generator). + +part of 'stream_icons.dart'; + +/// Identifiers for the icons. +/// +/// Use with the [Icon] class to show specific icons. +/// +/// Icons are identified by their name as listed below. +/// +/// To use this class, make sure you declare the font in your +/// project's `pubspec.yaml` file in the `fonts` section. This ensures that +/// the "Stream Icons" font is included in your application. This font is used to +/// display the icons. For example: +/// +/// ```yaml +/// flutter: +/// fonts: +/// - family: Stream Icons +/// fonts: +/// - asset: fonts/stream_icons_font.otf +/// ``` +class StreamIconData { + const StreamIconData._(); + + static const iconFontFamily = 'Stream Icons'; + static const iconFontPackage = 'stream_core_flutter'; + + /// Font icon named "__IconApiAggregate__" + /// + /// + static const IconData iconApiAggregate = IconData(0xe000, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconApples__" + /// + /// + static const IconData iconApples = IconData(0xe001, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconArchive1__" + /// + /// + static const IconData iconArchive1 = IconData(0xe002, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconArrowBoxLeft__" + /// + /// + static const IconData iconArrowBoxLeft = IconData(0xe003, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconArrowDown__" + /// + /// + static const IconData iconArrowDown = IconData(0xe004, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconArrowLeft__" + /// + /// + static const IconData iconArrowLeft = IconData(0xe005, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconArrowRight__" + /// + /// + static const IconData iconArrowRight = IconData(0xe006, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconArrowRotateClockwise__" + /// + /// + static const IconData iconArrowRotateClockwise = IconData( + 0xe007, + fontFamily: iconFontFamily, + fontPackage: iconFontPackage, + ); + + /// Font icon named "__IconArrowRotateRightLeftRepeatRefresh__" + /// + /// + static const IconData iconArrowRotateRightLeftRepeatRefresh = IconData( + 0xe008, + fontFamily: iconFontFamily, + fontPackage: iconFontPackage, + ); + + /// Font icon named "__IconArrowShareLeft__" + /// + /// + static const IconData iconArrowShareLeft = IconData(0xe009, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconArrowUp__" + /// + /// + static const IconData iconArrowUp = IconData(0xe00a, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconArrowsRepeatLeftRight__" + /// + /// + static const IconData iconArrowsRepeatLeftRight = IconData( + 0xe00b, + fontFamily: iconFontFamily, + fontPackage: iconFontPackage, + ); + + /// Font icon named "__IconAt__" + /// + /// + static const IconData iconAt = IconData(0xe00c, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconAtSolid__" + /// + /// + static const IconData iconAtSolid = IconData(0xe00d, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconBellNotification__" + /// + /// + static const IconData iconBellNotification = IconData( + 0xe00e, + fontFamily: iconFontFamily, + fontPackage: iconFontPackage, + ); + + /// Font icon named "__IconBellOff__" + /// + /// + static const IconData iconBellOff = IconData(0xe00f, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconBookmark__" + /// + /// + static const IconData iconBookmark = IconData(0xe010, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconBookmarkRemove__" + /// + /// + static const IconData iconBookmarkRemove = IconData(0xe011, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconBrowserAISparkle__" + /// + /// + static const IconData iconBrowserAISparkle = IconData( + 0xe012, + fontFamily: iconFontFamily, + fontPackage: iconFontPackage, + ); + + /// Font icon named "__IconBubble3ChatMessage__" + /// + /// + static const IconData iconBubble3ChatMessage = IconData( + 0xe013, + fontFamily: iconFontFamily, + fontPackage: iconFontPackage, + ); + + /// Font icon named "__IconBubble3Solid__" + /// + /// + static const IconData iconBubble3Solid = IconData(0xe014, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconBubbleAnnotation2ChatMessage__" + /// + /// + static const IconData iconBubbleAnnotation2ChatMessage = IconData( + 0xe015, + fontFamily: iconFontFamily, + fontPackage: iconFontPackage, + ); + + /// Font icon named "__IconBubbleText6ChatMessage__" + /// + /// + static const IconData iconBubbleText6ChatMessage = IconData( + 0xe016, + fontFamily: iconFontFamily, + fontPackage: iconFontPackage, + ); + + /// Font icon named "__IconBubbleText6Solid__" + /// + /// + static const IconData iconBubbleText6Solid = IconData( + 0xe017, + fontFamily: iconFontFamily, + fontPackage: iconFontPackage, + ); + + /// Font icon named "__IconBubbleWideNotificationChatMessage__" + /// + /// + static const IconData iconBubbleWideNotificationChatMessage = IconData( + 0xe018, + fontFamily: iconFontFamily, + fontPackage: iconFontPackage, + ); + + /// Font icon named "__IconBubbleWideSparkleChatMessage__" + /// + /// + static const IconData iconBubbleWideSparkleChatMessage = IconData( + 0xe019, + fontFamily: iconFontFamily, + fontPackage: iconFontPackage, + ); + + /// Font icon named "__IconCalendar1__" + /// + /// + static const IconData iconCalendar1 = IconData(0xe01a, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconCallCancel__" + /// + /// + static const IconData iconCallCancel = IconData(0xe01b, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconCamera1__" + /// + /// + static const IconData iconCamera1 = IconData(0xe01c, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconCar1__" + /// + /// + static const IconData iconCar1 = IconData(0xe01d, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconCat__" + /// + /// + static const IconData iconCat = IconData(0xe01e, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconChainLink3__" + /// + /// + static const IconData iconChainLink3 = IconData(0xe01f, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconChart5__" + /// + /// + static const IconData iconChart5 = IconData(0xe020, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconCheckmark1Small__" + /// + /// + static const IconData iconCheckmark1Small = IconData( + 0xe021, + fontFamily: iconFontFamily, + fontPackage: iconFontPackage, + ); + + /// Font icon named "__IconCheckmark2__" + /// + /// + static const IconData iconCheckmark2 = IconData(0xe022, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconCheckmark2Small__" + /// + /// + static const IconData iconCheckmark2Small = IconData( + 0xe023, + fontFamily: iconFontFamily, + fontPackage: iconFontPackage, + ); + + /// Font icon named "__IconChevronDown__" + /// + /// + static const IconData iconChevronDown = IconData(0xe024, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconChevronGrabberVerticalSelector__" + /// + /// + static const IconData iconChevronGrabberVerticalSelector = IconData( + 0xe025, + fontFamily: iconFontFamily, + fontPackage: iconFontPackage, + ); + + /// Font icon named "__IconChevronLeft__" + /// + /// + static const IconData iconChevronLeft = IconData(0xe026, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconChevronRight__" + /// + /// + static const IconData iconChevronRight = IconData(0xe027, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconChevronTop__" + /// + /// + static const IconData iconChevronTop = IconData(0xe028, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconCircleBanSign__" + /// + /// + static const IconData iconCircleBanSign = IconData(0xe029, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconCircleCheck__" + /// + /// + static const IconData iconCircleCheck = IconData(0xe02a, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconCircleInfoTooltip__" + /// + /// + static const IconData iconCircleInfoTooltip = IconData( + 0xe02b, + fontFamily: iconFontFamily, + fontPackage: iconFontPackage, + ); + + /// Font icon named "__IconCircleMinus__" + /// + /// + static const IconData iconCircleMinus = IconData(0xe02c, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconCircleQuestionmark__" + /// + /// + static const IconData iconCircleQuestionmark = IconData( + 0xe02d, + fontFamily: iconFontFamily, + fontPackage: iconFontPackage, + ); + + /// Font icon named "__IconCircleQuestionmarkFilled__" + /// + /// + static const IconData iconCircleQuestionmarkFilled = IconData( + 0xe02e, + fontFamily: iconFontFamily, + fontPackage: iconFontPackage, + ); + + /// Font icon named "__IconCircleX__" + /// + /// + static const IconData iconCircleX = IconData(0xe02f, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconClock__" + /// + /// + static const IconData iconClock = IconData(0xe030, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconClockSolid__" + /// + /// + static const IconData iconClockSolid = IconData(0xe031, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconCloseQuote2__" + /// + /// + static const IconData iconCloseQuote2 = IconData(0xe032, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconCode__" + /// + /// + static const IconData iconCode = IconData(0xe033, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconCodeBrackets__" + /// + /// + static const IconData iconCodeBrackets = IconData(0xe034, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconCodeEditorInsert__" + /// + /// + static const IconData iconCodeEditorInsert = IconData( + 0xe035, + fontFamily: iconFontFamily, + fontPackage: iconFontPackage, + ); + + /// Font icon named "__IconCompass__" + /// + /// + static const IconData iconCompass = IconData(0xe036, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconCreditCard2Billing__" + /// + /// + static const IconData iconCreditCard2Billing = IconData( + 0xe037, + fontFamily: iconFontFamily, + fontPackage: iconFontPackage, + ); + + /// Font icon named "__IconCrossMedium__" + /// + /// + static const IconData iconCrossMedium = IconData(0xe038, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconCrossSmall__" + /// + /// + static const IconData iconCrossSmall = IconData(0xe039, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconDotGrid1x3Horizontal__" + /// + /// + static const IconData iconDotGrid1x3Horizontal = IconData( + 0xe03a, + fontFamily: iconFontFamily, + fontPackage: iconFontPackage, + ); + + /// Font icon named "__IconDotGrid2x3__" + /// + /// + static const IconData iconDotGrid2x3 = IconData(0xe03b, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconDotsGrid1x3Vertical__" + /// + /// + static const IconData iconDotsGrid1x3Vertical = IconData( + 0xe03c, + fontFamily: iconFontFamily, + fontPackage: iconFontPackage, + ); + + /// Font icon named "__IconDoupleCheckmark1Small__" + /// + /// + static const IconData iconDoupleCheckmark1Small = IconData( + 0xe03d, + fontFamily: iconFontFamily, + fontPackage: iconFontPackage, + ); + + /// Font icon named "__IconEditBig__" + /// + /// + static const IconData iconEditBig = IconData(0xe03e, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconEditBigSolid__" + /// + /// + static const IconData iconEditBigSolid = IconData(0xe03f, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconEmojiAddReaction__" + /// + /// + static const IconData iconEmojiAddReaction = IconData( + 0xe040, + fontFamily: iconFontFamily, + fontPackage: iconFontPackage, + ); + + /// Font icon named "__IconEmojiSad__" + /// + /// + static const IconData iconEmojiSad = IconData(0xe041, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconEmojiSmile__" + /// + /// + static const IconData iconEmojiSmile = IconData(0xe042, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconExclamationCircle-1__" + /// + /// + static const IconData iconExclamationCircle1 = IconData( + 0xe043, + fontFamily: iconFontFamily, + fontPackage: iconFontPackage, + ); + + /// Font icon named "__IconExclamationCircle__" + /// + /// + static const IconData iconExclamationCircle = IconData( + 0xe044, + fontFamily: iconFontFamily, + fontPackage: iconFontPackage, + ); + + /// Font icon named "__IconExclamationTriangle-1__" + /// + /// + static const IconData iconExclamationTriangle1 = IconData( + 0xe045, + fontFamily: iconFontFamily, + fontPackage: iconFontPackage, + ); + + /// Font icon named "__IconExclamationTriangle__" + /// + /// + static const IconData iconExclamationTriangle = IconData( + 0xe046, + fontFamily: iconFontFamily, + fontPackage: iconFontPackage, + ); + + /// Font icon named "__IconEyeOpen__" + /// + /// + static const IconData iconEyeOpen = IconData(0xe047, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconFileArrowLeftIn__" + /// + /// + static const IconData iconFileArrowLeftIn = IconData( + 0xe048, + fontFamily: iconFontFamily, + fontPackage: iconFontPackage, + ); + + /// Font icon named "__IconFileBend__" + /// + /// + static const IconData iconFileBend = IconData(0xe049, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconFilledCircleInfoTooltip__" + /// + /// + static const IconData iconFilledCircleInfoTooltip = IconData( + 0xe04a, + fontFamily: iconFontFamily, + fontPackage: iconFontPackage, + ); + + /// Font icon named "__IconFilter1__" + /// + /// + static const IconData iconFilter1 = IconData(0xe04b, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconFlag2__" + /// + /// + static const IconData iconFlag2 = IconData(0xe04c, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconGauge__" + /// + /// + static const IconData iconGauge = IconData(0xe04d, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconGoogle__" + /// + /// + static const IconData iconGoogle = IconData(0xe04e, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconHashtagChannel__" + /// + /// + static const IconData iconHashtagChannel = IconData(0xe04f, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconHeart2__" + /// + /// + static const IconData iconHeart2 = IconData(0xe050, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconHistory__" + /// + /// + static const IconData iconHistory = IconData(0xe051, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconImages1Alt__" + /// + /// + static const IconData iconImages1Alt = IconData(0xe052, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconInvite__" + /// + /// + static const IconData iconInvite = IconData(0xe053, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconLayersBehind__" + /// + /// + static const IconData iconLayersBehind = IconData(0xe054, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconLayoutAlignLeft__" + /// + /// + static const IconData iconLayoutAlignLeft = IconData( + 0xe055, + fontFamily: iconFontFamily, + fontPackage: iconFontPackage, + ); + + /// Font icon named "__IconLayoutGrid1__" + /// + /// + static const IconData iconLayoutGrid1 = IconData(0xe056, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconLayoutLeft__" + /// + /// + static const IconData iconLayoutLeft = IconData(0xe057, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconLightBulbSimple__" + /// + /// + static const IconData iconLightBulbSimple = IconData( + 0xe058, + fontFamily: iconFontFamily, + fontPackage: iconFontPackage, + ); + + /// Font icon named "__IconLimits__" + /// + /// + static const IconData iconLimits = IconData(0xe059, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconLineChart3__" + /// + /// + static const IconData iconLineChart3 = IconData(0xe05a, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconLock__" + /// + /// + static const IconData iconLock = IconData(0xe05b, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconMagnifyingGlassSearch__" + /// + /// + static const IconData iconMagnifyingGlassSearch = IconData( + 0xe05c, + fontFamily: iconFontFamily, + fontPackage: iconFontPackage, + ); + + /// Font icon named "__IconMapPin__" + /// + /// + static const IconData iconMapPin = IconData(0xe05d, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconMicrophone__" + /// + /// + static const IconData iconMicrophone = IconData(0xe05e, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconMicrophoneSolid__" + /// + /// + static const IconData iconMicrophoneSolid = IconData( + 0xe05f, + fontFamily: iconFontFamily, + fontPackage: iconFontPackage, + ); + + /// Font icon named "__IconMinusLarge__" + /// + /// + static const IconData iconMinusLarge = IconData(0xe060, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconMinusSmall__" + /// + /// + static const IconData iconMinusSmall = IconData(0xe061, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconMute__" + /// + /// + static const IconData iconMute = IconData(0xe062, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconNewspaper2__" + /// + /// + static const IconData iconNewspaper2 = IconData(0xe063, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconOrganization__" + /// + /// + static const IconData iconOrganization = IconData(0xe064, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconPaperPlane__" + /// + /// + static const IconData iconPaperPlane = IconData(0xe065, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconPaperPlaneTopRight__" + /// + /// + static const IconData iconPaperPlaneTopRight = IconData( + 0xe066, + fontFamily: iconFontFamily, + fontPackage: iconFontPackage, + ); + + /// Font icon named "__IconPaperclip1__" + /// + /// + static const IconData iconPaperclip1 = IconData(0xe067, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconParagraphsText__" + /// + /// + static const IconData iconParagraphsText = IconData(0xe068, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconPause__" + /// + /// + static const IconData iconPause = IconData(0xe069, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconPencil__" + /// + /// + static const IconData iconPencil = IconData(0xe06a, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconPeople__" + /// + /// + static const IconData iconPeople = IconData(0xe06b, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconPeople2__" + /// + /// + static const IconData iconPeople2 = IconData(0xe06c, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconPeopleAdd__" + /// + /// + static const IconData iconPeopleAdd = IconData(0xe06d, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconPeopleAdded__" + /// + /// + static const IconData iconPeopleAdded = IconData(0xe06e, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconPeopleCircle__" + /// + /// + static const IconData iconPeopleCircle = IconData(0xe06f, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconPeopleCopy__" + /// + /// + static const IconData iconPeopleCopy = IconData(0xe070, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconPeopleEditUserRights__" + /// + /// + static const IconData iconPeopleEditUserRights = IconData( + 0xe071, + fontFamily: iconFontFamily, + fontPackage: iconFontPackage, + ); + + /// Font icon named "__IconPeopleRemove__" + /// + /// + static const IconData iconPeopleRemove = IconData(0xe072, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconPersona__" + /// + /// + static const IconData iconPersona = IconData(0xe073, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconPin__" + /// + /// + static const IconData iconPin = IconData(0xe074, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconPlaySolid__" + /// + /// + static const IconData iconPlaySolid = IconData(0xe075, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconPlusLarge__" + /// + /// + static const IconData iconPlusLarge = IconData(0xe076, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconPlusSmall__" + /// + /// + static const IconData iconPlusSmall = IconData(0xe077, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconRunShortcut__" + /// + /// + static const IconData iconRunShortcut = IconData(0xe078, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconSearchText__" + /// + /// + static const IconData iconSearchText = IconData(0xe079, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconSettingsGear2__" + /// + /// + static const IconData iconSettingsGear2 = IconData(0xe07a, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconSettingsSliderVer__" + /// + /// + static const IconData iconSettingsSliderVer = IconData( + 0xe07b, + fontFamily: iconFontFamily, + fontPackage: iconFontPackage, + ); + + /// Font icon named "__IconShapesPlusCloseSquareCircle__" + /// + /// + static const IconData iconShapesPlusCloseSquareCircle = IconData( + 0xe07c, + fontFamily: iconFontFamily, + fontPackage: iconFontPackage, + ); + + /// Font icon named "__IconShapesTriangleSquareCircle__" + /// + /// + static const IconData iconShapesTriangleSquareCircle = IconData( + 0xe07d, + fontFamily: iconFontFamily, + fontPackage: iconFontPackage, + ); + + /// Font icon named "__IconShareOs__" + /// + /// + static const IconData iconShareOs = IconData(0xe07e, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconShareRedirectLink__" + /// + /// + static const IconData iconShareRedirectLink = IconData( + 0xe07f, + fontFamily: iconFontFamily, + fontPackage: iconFontPackage, + ); + + /// Font icon named "__IconShield__" + /// + /// + static const IconData iconShield = IconData(0xe080, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconSquareBehindSquare2_Copy__" + /// + /// + static const IconData iconSquareBehindSquare2Copy = IconData( + 0xe081, + fontFamily: iconFontFamily, + fontPackage: iconFontPackage, + ); + + /// Font icon named "__IconSquareCircleTopRightFeeds__" + /// + /// + static const IconData iconSquareCircleTopRightFeeds = IconData( + 0xe082, + fontFamily: iconFontFamily, + fontPackage: iconFontPackage, + ); + + /// Font icon named "__IconStop__" + /// + /// + static const IconData iconStop = IconData(0xe083, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconTable__" + /// + /// + static const IconData iconTable = IconData(0xe084, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconTeam__" + /// + /// + static const IconData iconTeam = IconData(0xe085, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconTennis__" + /// + /// + static const IconData iconTennis = IconData(0xe086, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconTextToImageURLEnrichment__" + /// + /// + static const IconData iconTextToImageURLEnrichment = IconData( + 0xe087, + fontFamily: iconFontFamily, + fontPackage: iconFontPackage, + ); + + /// Font icon named "__IconThunder__" + /// + /// + static const IconData iconThunder = IconData(0xe088, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconTrashBin__" + /// + /// + static const IconData iconTrashBin = IconData(0xe089, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconTrending4__" + /// + /// + static const IconData iconTrending4 = IconData(0xe08a, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconTrophy__" + /// + /// + static const IconData iconTrophy = IconData(0xe08b, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconUnlocked__" + /// + /// + static const IconData iconUnlocked = IconData(0xe08c, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconUnpin__" + /// + /// + static const IconData iconUnpin = IconData(0xe08d, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconUsers__" + /// + /// + static const IconData iconUsers = IconData(0xe08e, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconVideo__" + /// + /// + static const IconData iconVideo = IconData(0xe08f, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconVideoSolid__" + /// + /// + static const IconData iconVideoSolid = IconData(0xe090, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconVoiceAndVideo__" + /// + /// + static const IconData iconVoiceAndVideo = IconData(0xe091, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconVoiceHigh__" + /// + /// + static const IconData iconVoiceHigh = IconData(0xe092, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconVolumeFull__" + /// + /// + static const IconData iconVolumeFull = IconData(0xe093, fontFamily: iconFontFamily, fontPackage: iconFontPackage); + + /// Font icon named "__IconWebhook__" + /// + /// + static const IconData iconWebhook = IconData(0xe094, fontFamily: iconFontFamily, fontPackage: iconFontPackage); +} diff --git a/packages/stream_core_flutter/lib/src/theme/primitives/stream_icons.g.theme.dart b/packages/stream_core_flutter/lib/src/theme/primitives/stream_icons.g.theme.dart new file mode 100644 index 0000000..3578a41 --- /dev/null +++ b/packages/stream_core_flutter/lib/src/theme/primitives/stream_icons.g.theme.dart @@ -0,0 +1,1043 @@ +// dart format width=80 +// coverage:ignore-file +// GENERATED CODE - DO NOT MODIFY BY HAND +// ignore_for_file: type=lint, unused_element + +part of 'stream_icons.dart'; + +// ************************************************************************** +// ThemeGenGenerator +// ************************************************************************** + +mixin _$StreamIcons { + bool get canMerge => true; + + static StreamIcons? lerp(StreamIcons? a, StreamIcons? b, double t) { + if (identical(a, b)) { + return a; + } + + if (a == null) { + return t == 1.0 ? b : null; + } + + if (b == null) { + return t == 0.0 ? a : null; + } + + return StreamIcons( + apiAggregate: t < 0.5 ? a.apiAggregate : b.apiAggregate, + apples: t < 0.5 ? a.apples : b.apples, + archive1: t < 0.5 ? a.archive1 : b.archive1, + arrowBoxLeft: t < 0.5 ? a.arrowBoxLeft : b.arrowBoxLeft, + arrowDown: t < 0.5 ? a.arrowDown : b.arrowDown, + arrowLeft: t < 0.5 ? a.arrowLeft : b.arrowLeft, + arrowRight: t < 0.5 ? a.arrowRight : b.arrowRight, + arrowRotateClockwise: t < 0.5 + ? a.arrowRotateClockwise + : b.arrowRotateClockwise, + arrowRotateRightLeftRepeatRefresh: t < 0.5 + ? a.arrowRotateRightLeftRepeatRefresh + : b.arrowRotateRightLeftRepeatRefresh, + arrowShareLeft: t < 0.5 ? a.arrowShareLeft : b.arrowShareLeft, + arrowUp: t < 0.5 ? a.arrowUp : b.arrowUp, + arrowsRepeatLeftRight: t < 0.5 + ? a.arrowsRepeatLeftRight + : b.arrowsRepeatLeftRight, + at: t < 0.5 ? a.at : b.at, + atSolid: t < 0.5 ? a.atSolid : b.atSolid, + bellNotification: t < 0.5 ? a.bellNotification : b.bellNotification, + bellOff: t < 0.5 ? a.bellOff : b.bellOff, + bookmark: t < 0.5 ? a.bookmark : b.bookmark, + bookmarkRemove: t < 0.5 ? a.bookmarkRemove : b.bookmarkRemove, + browserAISparkle: t < 0.5 ? a.browserAISparkle : b.browserAISparkle, + bubble3ChatMessage: t < 0.5 ? a.bubble3ChatMessage : b.bubble3ChatMessage, + bubble3Solid: t < 0.5 ? a.bubble3Solid : b.bubble3Solid, + bubbleAnnotation2ChatMessage: t < 0.5 + ? a.bubbleAnnotation2ChatMessage + : b.bubbleAnnotation2ChatMessage, + bubbleText6ChatMessage: t < 0.5 + ? a.bubbleText6ChatMessage + : b.bubbleText6ChatMessage, + bubbleText6Solid: t < 0.5 ? a.bubbleText6Solid : b.bubbleText6Solid, + bubbleWideNotificationChatMessage: t < 0.5 + ? a.bubbleWideNotificationChatMessage + : b.bubbleWideNotificationChatMessage, + bubbleWideSparkleChatMessage: t < 0.5 + ? a.bubbleWideSparkleChatMessage + : b.bubbleWideSparkleChatMessage, + calendar1: t < 0.5 ? a.calendar1 : b.calendar1, + callCancel: t < 0.5 ? a.callCancel : b.callCancel, + camera1: t < 0.5 ? a.camera1 : b.camera1, + car1: t < 0.5 ? a.car1 : b.car1, + cat: t < 0.5 ? a.cat : b.cat, + chainLink3: t < 0.5 ? a.chainLink3 : b.chainLink3, + chart5: t < 0.5 ? a.chart5 : b.chart5, + checkmark1Small: t < 0.5 ? a.checkmark1Small : b.checkmark1Small, + checkmark2: t < 0.5 ? a.checkmark2 : b.checkmark2, + checkmark2Small: t < 0.5 ? a.checkmark2Small : b.checkmark2Small, + chevronDown: t < 0.5 ? a.chevronDown : b.chevronDown, + chevronGrabberVerticalSelector: t < 0.5 + ? a.chevronGrabberVerticalSelector + : b.chevronGrabberVerticalSelector, + chevronLeft: t < 0.5 ? a.chevronLeft : b.chevronLeft, + chevronRight: t < 0.5 ? a.chevronRight : b.chevronRight, + chevronTop: t < 0.5 ? a.chevronTop : b.chevronTop, + circleBanSign: t < 0.5 ? a.circleBanSign : b.circleBanSign, + circleCheck: t < 0.5 ? a.circleCheck : b.circleCheck, + circleInfoTooltip: t < 0.5 ? a.circleInfoTooltip : b.circleInfoTooltip, + circleMinus: t < 0.5 ? a.circleMinus : b.circleMinus, + circleQuestionmark: t < 0.5 ? a.circleQuestionmark : b.circleQuestionmark, + circleQuestionmarkFilled: t < 0.5 + ? a.circleQuestionmarkFilled + : b.circleQuestionmarkFilled, + circleX: t < 0.5 ? a.circleX : b.circleX, + clock: t < 0.5 ? a.clock : b.clock, + clockSolid: t < 0.5 ? a.clockSolid : b.clockSolid, + closeQuote2: t < 0.5 ? a.closeQuote2 : b.closeQuote2, + code: t < 0.5 ? a.code : b.code, + codeBrackets: t < 0.5 ? a.codeBrackets : b.codeBrackets, + codeEditorInsert: t < 0.5 ? a.codeEditorInsert : b.codeEditorInsert, + compass: t < 0.5 ? a.compass : b.compass, + creditCard2Billing: t < 0.5 ? a.creditCard2Billing : b.creditCard2Billing, + crossMedium: t < 0.5 ? a.crossMedium : b.crossMedium, + crossSmall: t < 0.5 ? a.crossSmall : b.crossSmall, + dotGrid1x3Horizontal: t < 0.5 + ? a.dotGrid1x3Horizontal + : b.dotGrid1x3Horizontal, + dotGrid2x3: t < 0.5 ? a.dotGrid2x3 : b.dotGrid2x3, + dotsGrid1x3Vertical: t < 0.5 + ? a.dotsGrid1x3Vertical + : b.dotsGrid1x3Vertical, + doupleCheckmark1Small: t < 0.5 + ? a.doupleCheckmark1Small + : b.doupleCheckmark1Small, + editBig: t < 0.5 ? a.editBig : b.editBig, + editBigSolid: t < 0.5 ? a.editBigSolid : b.editBigSolid, + emojiAddReaction: t < 0.5 ? a.emojiAddReaction : b.emojiAddReaction, + emojiSad: t < 0.5 ? a.emojiSad : b.emojiSad, + emojiSmile: t < 0.5 ? a.emojiSmile : b.emojiSmile, + exclamationCircle: t < 0.5 ? a.exclamationCircle : b.exclamationCircle, + exclamationCircle1: t < 0.5 ? a.exclamationCircle1 : b.exclamationCircle1, + exclamationTriangle: t < 0.5 + ? a.exclamationTriangle + : b.exclamationTriangle, + exclamationTriangle1: t < 0.5 + ? a.exclamationTriangle1 + : b.exclamationTriangle1, + eyeOpen: t < 0.5 ? a.eyeOpen : b.eyeOpen, + fileArrowLeftIn: t < 0.5 ? a.fileArrowLeftIn : b.fileArrowLeftIn, + fileBend: t < 0.5 ? a.fileBend : b.fileBend, + filledCircleInfoTooltip: t < 0.5 + ? a.filledCircleInfoTooltip + : b.filledCircleInfoTooltip, + filter1: t < 0.5 ? a.filter1 : b.filter1, + flag2: t < 0.5 ? a.flag2 : b.flag2, + gauge: t < 0.5 ? a.gauge : b.gauge, + google: t < 0.5 ? a.google : b.google, + hashtagChannel: t < 0.5 ? a.hashtagChannel : b.hashtagChannel, + heart2: t < 0.5 ? a.heart2 : b.heart2, + history: t < 0.5 ? a.history : b.history, + images1Alt: t < 0.5 ? a.images1Alt : b.images1Alt, + invite: t < 0.5 ? a.invite : b.invite, + layersBehind: t < 0.5 ? a.layersBehind : b.layersBehind, + layoutAlignLeft: t < 0.5 ? a.layoutAlignLeft : b.layoutAlignLeft, + layoutGrid1: t < 0.5 ? a.layoutGrid1 : b.layoutGrid1, + layoutLeft: t < 0.5 ? a.layoutLeft : b.layoutLeft, + lightBulbSimple: t < 0.5 ? a.lightBulbSimple : b.lightBulbSimple, + limits: t < 0.5 ? a.limits : b.limits, + lineChart3: t < 0.5 ? a.lineChart3 : b.lineChart3, + lock: t < 0.5 ? a.lock : b.lock, + magnifyingGlassSearch: t < 0.5 + ? a.magnifyingGlassSearch + : b.magnifyingGlassSearch, + mapPin: t < 0.5 ? a.mapPin : b.mapPin, + microphone: t < 0.5 ? a.microphone : b.microphone, + microphoneSolid: t < 0.5 ? a.microphoneSolid : b.microphoneSolid, + minusLarge: t < 0.5 ? a.minusLarge : b.minusLarge, + minusSmall: t < 0.5 ? a.minusSmall : b.minusSmall, + mute: t < 0.5 ? a.mute : b.mute, + newspaper2: t < 0.5 ? a.newspaper2 : b.newspaper2, + organization: t < 0.5 ? a.organization : b.organization, + paperPlane: t < 0.5 ? a.paperPlane : b.paperPlane, + paperPlaneTopRight: t < 0.5 ? a.paperPlaneTopRight : b.paperPlaneTopRight, + paperclip1: t < 0.5 ? a.paperclip1 : b.paperclip1, + paragraphsText: t < 0.5 ? a.paragraphsText : b.paragraphsText, + pause: t < 0.5 ? a.pause : b.pause, + pencil: t < 0.5 ? a.pencil : b.pencil, + people: t < 0.5 ? a.people : b.people, + people2: t < 0.5 ? a.people2 : b.people2, + peopleAdd: t < 0.5 ? a.peopleAdd : b.peopleAdd, + peopleAdded: t < 0.5 ? a.peopleAdded : b.peopleAdded, + peopleCircle: t < 0.5 ? a.peopleCircle : b.peopleCircle, + peopleCopy: t < 0.5 ? a.peopleCopy : b.peopleCopy, + peopleEditUserRights: t < 0.5 + ? a.peopleEditUserRights + : b.peopleEditUserRights, + peopleRemove: t < 0.5 ? a.peopleRemove : b.peopleRemove, + persona: t < 0.5 ? a.persona : b.persona, + pin: t < 0.5 ? a.pin : b.pin, + playSolid: t < 0.5 ? a.playSolid : b.playSolid, + plusLarge: t < 0.5 ? a.plusLarge : b.plusLarge, + plusSmall: t < 0.5 ? a.plusSmall : b.plusSmall, + runShortcut: t < 0.5 ? a.runShortcut : b.runShortcut, + searchText: t < 0.5 ? a.searchText : b.searchText, + settingsGear2: t < 0.5 ? a.settingsGear2 : b.settingsGear2, + settingsSliderVer: t < 0.5 ? a.settingsSliderVer : b.settingsSliderVer, + shapesPlusCloseSquareCircle: t < 0.5 + ? a.shapesPlusCloseSquareCircle + : b.shapesPlusCloseSquareCircle, + shapesTriangleSquareCircle: t < 0.5 + ? a.shapesTriangleSquareCircle + : b.shapesTriangleSquareCircle, + shareOs: t < 0.5 ? a.shareOs : b.shareOs, + shareRedirectLink: t < 0.5 ? a.shareRedirectLink : b.shareRedirectLink, + shield: t < 0.5 ? a.shield : b.shield, + squareBehindSquare2Copy: t < 0.5 + ? a.squareBehindSquare2Copy + : b.squareBehindSquare2Copy, + squareCircleTopRightFeeds: t < 0.5 + ? a.squareCircleTopRightFeeds + : b.squareCircleTopRightFeeds, + stop: t < 0.5 ? a.stop : b.stop, + table: t < 0.5 ? a.table : b.table, + team: t < 0.5 ? a.team : b.team, + tennis: t < 0.5 ? a.tennis : b.tennis, + textToImageURLEnrichment: t < 0.5 + ? a.textToImageURLEnrichment + : b.textToImageURLEnrichment, + thunder: t < 0.5 ? a.thunder : b.thunder, + trashBin: t < 0.5 ? a.trashBin : b.trashBin, + trending4: t < 0.5 ? a.trending4 : b.trending4, + trophy: t < 0.5 ? a.trophy : b.trophy, + unlocked: t < 0.5 ? a.unlocked : b.unlocked, + unpin: t < 0.5 ? a.unpin : b.unpin, + users: t < 0.5 ? a.users : b.users, + video: t < 0.5 ? a.video : b.video, + videoSolid: t < 0.5 ? a.videoSolid : b.videoSolid, + voiceAndVideo: t < 0.5 ? a.voiceAndVideo : b.voiceAndVideo, + voiceHigh: t < 0.5 ? a.voiceHigh : b.voiceHigh, + volumeFull: t < 0.5 ? a.volumeFull : b.volumeFull, + webhook: t < 0.5 ? a.webhook : b.webhook, + ); + } + + StreamIcons copyWith({ + IconData? apiAggregate, + IconData? apples, + IconData? archive1, + IconData? arrowBoxLeft, + IconData? arrowDown, + IconData? arrowLeft, + IconData? arrowRight, + IconData? arrowRotateClockwise, + IconData? arrowRotateRightLeftRepeatRefresh, + IconData? arrowShareLeft, + IconData? arrowUp, + IconData? arrowsRepeatLeftRight, + IconData? at, + IconData? atSolid, + IconData? bellNotification, + IconData? bellOff, + IconData? bookmark, + IconData? bookmarkRemove, + IconData? browserAISparkle, + IconData? bubble3ChatMessage, + IconData? bubble3Solid, + IconData? bubbleAnnotation2ChatMessage, + IconData? bubbleText6ChatMessage, + IconData? bubbleText6Solid, + IconData? bubbleWideNotificationChatMessage, + IconData? bubbleWideSparkleChatMessage, + IconData? calendar1, + IconData? callCancel, + IconData? camera1, + IconData? car1, + IconData? cat, + IconData? chainLink3, + IconData? chart5, + IconData? checkmark1Small, + IconData? checkmark2, + IconData? checkmark2Small, + IconData? chevronDown, + IconData? chevronGrabberVerticalSelector, + IconData? chevronLeft, + IconData? chevronRight, + IconData? chevronTop, + IconData? circleBanSign, + IconData? circleCheck, + IconData? circleInfoTooltip, + IconData? circleMinus, + IconData? circleQuestionmark, + IconData? circleQuestionmarkFilled, + IconData? circleX, + IconData? clock, + IconData? clockSolid, + IconData? closeQuote2, + IconData? code, + IconData? codeBrackets, + IconData? codeEditorInsert, + IconData? compass, + IconData? creditCard2Billing, + IconData? crossMedium, + IconData? crossSmall, + IconData? dotGrid1x3Horizontal, + IconData? dotGrid2x3, + IconData? dotsGrid1x3Vertical, + IconData? doupleCheckmark1Small, + IconData? editBig, + IconData? editBigSolid, + IconData? emojiAddReaction, + IconData? emojiSad, + IconData? emojiSmile, + IconData? exclamationCircle, + IconData? exclamationCircle1, + IconData? exclamationTriangle, + IconData? exclamationTriangle1, + IconData? eyeOpen, + IconData? fileArrowLeftIn, + IconData? fileBend, + IconData? filledCircleInfoTooltip, + IconData? filter1, + IconData? flag2, + IconData? gauge, + IconData? google, + IconData? hashtagChannel, + IconData? heart2, + IconData? history, + IconData? images1Alt, + IconData? invite, + IconData? layersBehind, + IconData? layoutAlignLeft, + IconData? layoutGrid1, + IconData? layoutLeft, + IconData? lightBulbSimple, + IconData? limits, + IconData? lineChart3, + IconData? lock, + IconData? magnifyingGlassSearch, + IconData? mapPin, + IconData? microphone, + IconData? microphoneSolid, + IconData? minusLarge, + IconData? minusSmall, + IconData? mute, + IconData? newspaper2, + IconData? organization, + IconData? paperPlane, + IconData? paperPlaneTopRight, + IconData? paperclip1, + IconData? paragraphsText, + IconData? pause, + IconData? pencil, + IconData? people, + IconData? people2, + IconData? peopleAdd, + IconData? peopleAdded, + IconData? peopleCircle, + IconData? peopleCopy, + IconData? peopleEditUserRights, + IconData? peopleRemove, + IconData? persona, + IconData? pin, + IconData? playSolid, + IconData? plusLarge, + IconData? plusSmall, + IconData? runShortcut, + IconData? searchText, + IconData? settingsGear2, + IconData? settingsSliderVer, + IconData? shapesPlusCloseSquareCircle, + IconData? shapesTriangleSquareCircle, + IconData? shareOs, + IconData? shareRedirectLink, + IconData? shield, + IconData? squareBehindSquare2Copy, + IconData? squareCircleTopRightFeeds, + IconData? stop, + IconData? table, + IconData? team, + IconData? tennis, + IconData? textToImageURLEnrichment, + IconData? thunder, + IconData? trashBin, + IconData? trending4, + IconData? trophy, + IconData? unlocked, + IconData? unpin, + IconData? users, + IconData? video, + IconData? videoSolid, + IconData? voiceAndVideo, + IconData? voiceHigh, + IconData? volumeFull, + IconData? webhook, + }) { + final _this = (this as StreamIcons); + + return StreamIcons( + apiAggregate: apiAggregate ?? _this.apiAggregate, + apples: apples ?? _this.apples, + archive1: archive1 ?? _this.archive1, + arrowBoxLeft: arrowBoxLeft ?? _this.arrowBoxLeft, + arrowDown: arrowDown ?? _this.arrowDown, + arrowLeft: arrowLeft ?? _this.arrowLeft, + arrowRight: arrowRight ?? _this.arrowRight, + arrowRotateClockwise: arrowRotateClockwise ?? _this.arrowRotateClockwise, + arrowRotateRightLeftRepeatRefresh: + arrowRotateRightLeftRepeatRefresh ?? + _this.arrowRotateRightLeftRepeatRefresh, + arrowShareLeft: arrowShareLeft ?? _this.arrowShareLeft, + arrowUp: arrowUp ?? _this.arrowUp, + arrowsRepeatLeftRight: + arrowsRepeatLeftRight ?? _this.arrowsRepeatLeftRight, + at: at ?? _this.at, + atSolid: atSolid ?? _this.atSolid, + bellNotification: bellNotification ?? _this.bellNotification, + bellOff: bellOff ?? _this.bellOff, + bookmark: bookmark ?? _this.bookmark, + bookmarkRemove: bookmarkRemove ?? _this.bookmarkRemove, + browserAISparkle: browserAISparkle ?? _this.browserAISparkle, + bubble3ChatMessage: bubble3ChatMessage ?? _this.bubble3ChatMessage, + bubble3Solid: bubble3Solid ?? _this.bubble3Solid, + bubbleAnnotation2ChatMessage: + bubbleAnnotation2ChatMessage ?? _this.bubbleAnnotation2ChatMessage, + bubbleText6ChatMessage: + bubbleText6ChatMessage ?? _this.bubbleText6ChatMessage, + bubbleText6Solid: bubbleText6Solid ?? _this.bubbleText6Solid, + bubbleWideNotificationChatMessage: + bubbleWideNotificationChatMessage ?? + _this.bubbleWideNotificationChatMessage, + bubbleWideSparkleChatMessage: + bubbleWideSparkleChatMessage ?? _this.bubbleWideSparkleChatMessage, + calendar1: calendar1 ?? _this.calendar1, + callCancel: callCancel ?? _this.callCancel, + camera1: camera1 ?? _this.camera1, + car1: car1 ?? _this.car1, + cat: cat ?? _this.cat, + chainLink3: chainLink3 ?? _this.chainLink3, + chart5: chart5 ?? _this.chart5, + checkmark1Small: checkmark1Small ?? _this.checkmark1Small, + checkmark2: checkmark2 ?? _this.checkmark2, + checkmark2Small: checkmark2Small ?? _this.checkmark2Small, + chevronDown: chevronDown ?? _this.chevronDown, + chevronGrabberVerticalSelector: + chevronGrabberVerticalSelector ?? + _this.chevronGrabberVerticalSelector, + chevronLeft: chevronLeft ?? _this.chevronLeft, + chevronRight: chevronRight ?? _this.chevronRight, + chevronTop: chevronTop ?? _this.chevronTop, + circleBanSign: circleBanSign ?? _this.circleBanSign, + circleCheck: circleCheck ?? _this.circleCheck, + circleInfoTooltip: circleInfoTooltip ?? _this.circleInfoTooltip, + circleMinus: circleMinus ?? _this.circleMinus, + circleQuestionmark: circleQuestionmark ?? _this.circleQuestionmark, + circleQuestionmarkFilled: + circleQuestionmarkFilled ?? _this.circleQuestionmarkFilled, + circleX: circleX ?? _this.circleX, + clock: clock ?? _this.clock, + clockSolid: clockSolid ?? _this.clockSolid, + closeQuote2: closeQuote2 ?? _this.closeQuote2, + code: code ?? _this.code, + codeBrackets: codeBrackets ?? _this.codeBrackets, + codeEditorInsert: codeEditorInsert ?? _this.codeEditorInsert, + compass: compass ?? _this.compass, + creditCard2Billing: creditCard2Billing ?? _this.creditCard2Billing, + crossMedium: crossMedium ?? _this.crossMedium, + crossSmall: crossSmall ?? _this.crossSmall, + dotGrid1x3Horizontal: dotGrid1x3Horizontal ?? _this.dotGrid1x3Horizontal, + dotGrid2x3: dotGrid2x3 ?? _this.dotGrid2x3, + dotsGrid1x3Vertical: dotsGrid1x3Vertical ?? _this.dotsGrid1x3Vertical, + doupleCheckmark1Small: + doupleCheckmark1Small ?? _this.doupleCheckmark1Small, + editBig: editBig ?? _this.editBig, + editBigSolid: editBigSolid ?? _this.editBigSolid, + emojiAddReaction: emojiAddReaction ?? _this.emojiAddReaction, + emojiSad: emojiSad ?? _this.emojiSad, + emojiSmile: emojiSmile ?? _this.emojiSmile, + exclamationCircle: exclamationCircle ?? _this.exclamationCircle, + exclamationCircle1: exclamationCircle1 ?? _this.exclamationCircle1, + exclamationTriangle: exclamationTriangle ?? _this.exclamationTriangle, + exclamationTriangle1: exclamationTriangle1 ?? _this.exclamationTriangle1, + eyeOpen: eyeOpen ?? _this.eyeOpen, + fileArrowLeftIn: fileArrowLeftIn ?? _this.fileArrowLeftIn, + fileBend: fileBend ?? _this.fileBend, + filledCircleInfoTooltip: + filledCircleInfoTooltip ?? _this.filledCircleInfoTooltip, + filter1: filter1 ?? _this.filter1, + flag2: flag2 ?? _this.flag2, + gauge: gauge ?? _this.gauge, + google: google ?? _this.google, + hashtagChannel: hashtagChannel ?? _this.hashtagChannel, + heart2: heart2 ?? _this.heart2, + history: history ?? _this.history, + images1Alt: images1Alt ?? _this.images1Alt, + invite: invite ?? _this.invite, + layersBehind: layersBehind ?? _this.layersBehind, + layoutAlignLeft: layoutAlignLeft ?? _this.layoutAlignLeft, + layoutGrid1: layoutGrid1 ?? _this.layoutGrid1, + layoutLeft: layoutLeft ?? _this.layoutLeft, + lightBulbSimple: lightBulbSimple ?? _this.lightBulbSimple, + limits: limits ?? _this.limits, + lineChart3: lineChart3 ?? _this.lineChart3, + lock: lock ?? _this.lock, + magnifyingGlassSearch: + magnifyingGlassSearch ?? _this.magnifyingGlassSearch, + mapPin: mapPin ?? _this.mapPin, + microphone: microphone ?? _this.microphone, + microphoneSolid: microphoneSolid ?? _this.microphoneSolid, + minusLarge: minusLarge ?? _this.minusLarge, + minusSmall: minusSmall ?? _this.minusSmall, + mute: mute ?? _this.mute, + newspaper2: newspaper2 ?? _this.newspaper2, + organization: organization ?? _this.organization, + paperPlane: paperPlane ?? _this.paperPlane, + paperPlaneTopRight: paperPlaneTopRight ?? _this.paperPlaneTopRight, + paperclip1: paperclip1 ?? _this.paperclip1, + paragraphsText: paragraphsText ?? _this.paragraphsText, + pause: pause ?? _this.pause, + pencil: pencil ?? _this.pencil, + people: people ?? _this.people, + people2: people2 ?? _this.people2, + peopleAdd: peopleAdd ?? _this.peopleAdd, + peopleAdded: peopleAdded ?? _this.peopleAdded, + peopleCircle: peopleCircle ?? _this.peopleCircle, + peopleCopy: peopleCopy ?? _this.peopleCopy, + peopleEditUserRights: peopleEditUserRights ?? _this.peopleEditUserRights, + peopleRemove: peopleRemove ?? _this.peopleRemove, + persona: persona ?? _this.persona, + pin: pin ?? _this.pin, + playSolid: playSolid ?? _this.playSolid, + plusLarge: plusLarge ?? _this.plusLarge, + plusSmall: plusSmall ?? _this.plusSmall, + runShortcut: runShortcut ?? _this.runShortcut, + searchText: searchText ?? _this.searchText, + settingsGear2: settingsGear2 ?? _this.settingsGear2, + settingsSliderVer: settingsSliderVer ?? _this.settingsSliderVer, + shapesPlusCloseSquareCircle: + shapesPlusCloseSquareCircle ?? _this.shapesPlusCloseSquareCircle, + shapesTriangleSquareCircle: + shapesTriangleSquareCircle ?? _this.shapesTriangleSquareCircle, + shareOs: shareOs ?? _this.shareOs, + shareRedirectLink: shareRedirectLink ?? _this.shareRedirectLink, + shield: shield ?? _this.shield, + squareBehindSquare2Copy: + squareBehindSquare2Copy ?? _this.squareBehindSquare2Copy, + squareCircleTopRightFeeds: + squareCircleTopRightFeeds ?? _this.squareCircleTopRightFeeds, + stop: stop ?? _this.stop, + table: table ?? _this.table, + team: team ?? _this.team, + tennis: tennis ?? _this.tennis, + textToImageURLEnrichment: + textToImageURLEnrichment ?? _this.textToImageURLEnrichment, + thunder: thunder ?? _this.thunder, + trashBin: trashBin ?? _this.trashBin, + trending4: trending4 ?? _this.trending4, + trophy: trophy ?? _this.trophy, + unlocked: unlocked ?? _this.unlocked, + unpin: unpin ?? _this.unpin, + users: users ?? _this.users, + video: video ?? _this.video, + videoSolid: videoSolid ?? _this.videoSolid, + voiceAndVideo: voiceAndVideo ?? _this.voiceAndVideo, + voiceHigh: voiceHigh ?? _this.voiceHigh, + volumeFull: volumeFull ?? _this.volumeFull, + webhook: webhook ?? _this.webhook, + ); + } + + StreamIcons merge(StreamIcons? other) { + final _this = (this as StreamIcons); + + if (other == null || identical(_this, other)) { + return _this; + } + + if (!other.canMerge) { + return other; + } + + return copyWith( + apiAggregate: other.apiAggregate, + apples: other.apples, + archive1: other.archive1, + arrowBoxLeft: other.arrowBoxLeft, + arrowDown: other.arrowDown, + arrowLeft: other.arrowLeft, + arrowRight: other.arrowRight, + arrowRotateClockwise: other.arrowRotateClockwise, + arrowRotateRightLeftRepeatRefresh: + other.arrowRotateRightLeftRepeatRefresh, + arrowShareLeft: other.arrowShareLeft, + arrowUp: other.arrowUp, + arrowsRepeatLeftRight: other.arrowsRepeatLeftRight, + at: other.at, + atSolid: other.atSolid, + bellNotification: other.bellNotification, + bellOff: other.bellOff, + bookmark: other.bookmark, + bookmarkRemove: other.bookmarkRemove, + browserAISparkle: other.browserAISparkle, + bubble3ChatMessage: other.bubble3ChatMessage, + bubble3Solid: other.bubble3Solid, + bubbleAnnotation2ChatMessage: other.bubbleAnnotation2ChatMessage, + bubbleText6ChatMessage: other.bubbleText6ChatMessage, + bubbleText6Solid: other.bubbleText6Solid, + bubbleWideNotificationChatMessage: + other.bubbleWideNotificationChatMessage, + bubbleWideSparkleChatMessage: other.bubbleWideSparkleChatMessage, + calendar1: other.calendar1, + callCancel: other.callCancel, + camera1: other.camera1, + car1: other.car1, + cat: other.cat, + chainLink3: other.chainLink3, + chart5: other.chart5, + checkmark1Small: other.checkmark1Small, + checkmark2: other.checkmark2, + checkmark2Small: other.checkmark2Small, + chevronDown: other.chevronDown, + chevronGrabberVerticalSelector: other.chevronGrabberVerticalSelector, + chevronLeft: other.chevronLeft, + chevronRight: other.chevronRight, + chevronTop: other.chevronTop, + circleBanSign: other.circleBanSign, + circleCheck: other.circleCheck, + circleInfoTooltip: other.circleInfoTooltip, + circleMinus: other.circleMinus, + circleQuestionmark: other.circleQuestionmark, + circleQuestionmarkFilled: other.circleQuestionmarkFilled, + circleX: other.circleX, + clock: other.clock, + clockSolid: other.clockSolid, + closeQuote2: other.closeQuote2, + code: other.code, + codeBrackets: other.codeBrackets, + codeEditorInsert: other.codeEditorInsert, + compass: other.compass, + creditCard2Billing: other.creditCard2Billing, + crossMedium: other.crossMedium, + crossSmall: other.crossSmall, + dotGrid1x3Horizontal: other.dotGrid1x3Horizontal, + dotGrid2x3: other.dotGrid2x3, + dotsGrid1x3Vertical: other.dotsGrid1x3Vertical, + doupleCheckmark1Small: other.doupleCheckmark1Small, + editBig: other.editBig, + editBigSolid: other.editBigSolid, + emojiAddReaction: other.emojiAddReaction, + emojiSad: other.emojiSad, + emojiSmile: other.emojiSmile, + exclamationCircle: other.exclamationCircle, + exclamationCircle1: other.exclamationCircle1, + exclamationTriangle: other.exclamationTriangle, + exclamationTriangle1: other.exclamationTriangle1, + eyeOpen: other.eyeOpen, + fileArrowLeftIn: other.fileArrowLeftIn, + fileBend: other.fileBend, + filledCircleInfoTooltip: other.filledCircleInfoTooltip, + filter1: other.filter1, + flag2: other.flag2, + gauge: other.gauge, + google: other.google, + hashtagChannel: other.hashtagChannel, + heart2: other.heart2, + history: other.history, + images1Alt: other.images1Alt, + invite: other.invite, + layersBehind: other.layersBehind, + layoutAlignLeft: other.layoutAlignLeft, + layoutGrid1: other.layoutGrid1, + layoutLeft: other.layoutLeft, + lightBulbSimple: other.lightBulbSimple, + limits: other.limits, + lineChart3: other.lineChart3, + lock: other.lock, + magnifyingGlassSearch: other.magnifyingGlassSearch, + mapPin: other.mapPin, + microphone: other.microphone, + microphoneSolid: other.microphoneSolid, + minusLarge: other.minusLarge, + minusSmall: other.minusSmall, + mute: other.mute, + newspaper2: other.newspaper2, + organization: other.organization, + paperPlane: other.paperPlane, + paperPlaneTopRight: other.paperPlaneTopRight, + paperclip1: other.paperclip1, + paragraphsText: other.paragraphsText, + pause: other.pause, + pencil: other.pencil, + people: other.people, + people2: other.people2, + peopleAdd: other.peopleAdd, + peopleAdded: other.peopleAdded, + peopleCircle: other.peopleCircle, + peopleCopy: other.peopleCopy, + peopleEditUserRights: other.peopleEditUserRights, + peopleRemove: other.peopleRemove, + persona: other.persona, + pin: other.pin, + playSolid: other.playSolid, + plusLarge: other.plusLarge, + plusSmall: other.plusSmall, + runShortcut: other.runShortcut, + searchText: other.searchText, + settingsGear2: other.settingsGear2, + settingsSliderVer: other.settingsSliderVer, + shapesPlusCloseSquareCircle: other.shapesPlusCloseSquareCircle, + shapesTriangleSquareCircle: other.shapesTriangleSquareCircle, + shareOs: other.shareOs, + shareRedirectLink: other.shareRedirectLink, + shield: other.shield, + squareBehindSquare2Copy: other.squareBehindSquare2Copy, + squareCircleTopRightFeeds: other.squareCircleTopRightFeeds, + stop: other.stop, + table: other.table, + team: other.team, + tennis: other.tennis, + textToImageURLEnrichment: other.textToImageURLEnrichment, + thunder: other.thunder, + trashBin: other.trashBin, + trending4: other.trending4, + trophy: other.trophy, + unlocked: other.unlocked, + unpin: other.unpin, + users: other.users, + video: other.video, + videoSolid: other.videoSolid, + voiceAndVideo: other.voiceAndVideo, + voiceHigh: other.voiceHigh, + volumeFull: other.volumeFull, + webhook: other.webhook, + ); + } + + @override + bool operator ==(Object other) { + if (identical(this, other)) { + return true; + } + + if (other.runtimeType != runtimeType) { + return false; + } + + final _this = (this as StreamIcons); + final _other = (other as StreamIcons); + + return _other.apiAggregate == _this.apiAggregate && + _other.apples == _this.apples && + _other.archive1 == _this.archive1 && + _other.arrowBoxLeft == _this.arrowBoxLeft && + _other.arrowDown == _this.arrowDown && + _other.arrowLeft == _this.arrowLeft && + _other.arrowRight == _this.arrowRight && + _other.arrowRotateClockwise == _this.arrowRotateClockwise && + _other.arrowRotateRightLeftRepeatRefresh == + _this.arrowRotateRightLeftRepeatRefresh && + _other.arrowShareLeft == _this.arrowShareLeft && + _other.arrowUp == _this.arrowUp && + _other.arrowsRepeatLeftRight == _this.arrowsRepeatLeftRight && + _other.at == _this.at && + _other.atSolid == _this.atSolid && + _other.bellNotification == _this.bellNotification && + _other.bellOff == _this.bellOff && + _other.bookmark == _this.bookmark && + _other.bookmarkRemove == _this.bookmarkRemove && + _other.browserAISparkle == _this.browserAISparkle && + _other.bubble3ChatMessage == _this.bubble3ChatMessage && + _other.bubble3Solid == _this.bubble3Solid && + _other.bubbleAnnotation2ChatMessage == + _this.bubbleAnnotation2ChatMessage && + _other.bubbleText6ChatMessage == _this.bubbleText6ChatMessage && + _other.bubbleText6Solid == _this.bubbleText6Solid && + _other.bubbleWideNotificationChatMessage == + _this.bubbleWideNotificationChatMessage && + _other.bubbleWideSparkleChatMessage == + _this.bubbleWideSparkleChatMessage && + _other.calendar1 == _this.calendar1 && + _other.callCancel == _this.callCancel && + _other.camera1 == _this.camera1 && + _other.car1 == _this.car1 && + _other.cat == _this.cat && + _other.chainLink3 == _this.chainLink3 && + _other.chart5 == _this.chart5 && + _other.checkmark1Small == _this.checkmark1Small && + _other.checkmark2 == _this.checkmark2 && + _other.checkmark2Small == _this.checkmark2Small && + _other.chevronDown == _this.chevronDown && + _other.chevronGrabberVerticalSelector == + _this.chevronGrabberVerticalSelector && + _other.chevronLeft == _this.chevronLeft && + _other.chevronRight == _this.chevronRight && + _other.chevronTop == _this.chevronTop && + _other.circleBanSign == _this.circleBanSign && + _other.circleCheck == _this.circleCheck && + _other.circleInfoTooltip == _this.circleInfoTooltip && + _other.circleMinus == _this.circleMinus && + _other.circleQuestionmark == _this.circleQuestionmark && + _other.circleQuestionmarkFilled == _this.circleQuestionmarkFilled && + _other.circleX == _this.circleX && + _other.clock == _this.clock && + _other.clockSolid == _this.clockSolid && + _other.closeQuote2 == _this.closeQuote2 && + _other.code == _this.code && + _other.codeBrackets == _this.codeBrackets && + _other.codeEditorInsert == _this.codeEditorInsert && + _other.compass == _this.compass && + _other.creditCard2Billing == _this.creditCard2Billing && + _other.crossMedium == _this.crossMedium && + _other.crossSmall == _this.crossSmall && + _other.dotGrid1x3Horizontal == _this.dotGrid1x3Horizontal && + _other.dotGrid2x3 == _this.dotGrid2x3 && + _other.dotsGrid1x3Vertical == _this.dotsGrid1x3Vertical && + _other.doupleCheckmark1Small == _this.doupleCheckmark1Small && + _other.editBig == _this.editBig && + _other.editBigSolid == _this.editBigSolid && + _other.emojiAddReaction == _this.emojiAddReaction && + _other.emojiSad == _this.emojiSad && + _other.emojiSmile == _this.emojiSmile && + _other.exclamationCircle == _this.exclamationCircle && + _other.exclamationCircle1 == _this.exclamationCircle1 && + _other.exclamationTriangle == _this.exclamationTriangle && + _other.exclamationTriangle1 == _this.exclamationTriangle1 && + _other.eyeOpen == _this.eyeOpen && + _other.fileArrowLeftIn == _this.fileArrowLeftIn && + _other.fileBend == _this.fileBend && + _other.filledCircleInfoTooltip == _this.filledCircleInfoTooltip && + _other.filter1 == _this.filter1 && + _other.flag2 == _this.flag2 && + _other.gauge == _this.gauge && + _other.google == _this.google && + _other.hashtagChannel == _this.hashtagChannel && + _other.heart2 == _this.heart2 && + _other.history == _this.history && + _other.images1Alt == _this.images1Alt && + _other.invite == _this.invite && + _other.layersBehind == _this.layersBehind && + _other.layoutAlignLeft == _this.layoutAlignLeft && + _other.layoutGrid1 == _this.layoutGrid1 && + _other.layoutLeft == _this.layoutLeft && + _other.lightBulbSimple == _this.lightBulbSimple && + _other.limits == _this.limits && + _other.lineChart3 == _this.lineChart3 && + _other.lock == _this.lock && + _other.magnifyingGlassSearch == _this.magnifyingGlassSearch && + _other.mapPin == _this.mapPin && + _other.microphone == _this.microphone && + _other.microphoneSolid == _this.microphoneSolid && + _other.minusLarge == _this.minusLarge && + _other.minusSmall == _this.minusSmall && + _other.mute == _this.mute && + _other.newspaper2 == _this.newspaper2 && + _other.organization == _this.organization && + _other.paperPlane == _this.paperPlane && + _other.paperPlaneTopRight == _this.paperPlaneTopRight && + _other.paperclip1 == _this.paperclip1 && + _other.paragraphsText == _this.paragraphsText && + _other.pause == _this.pause && + _other.pencil == _this.pencil && + _other.people == _this.people && + _other.people2 == _this.people2 && + _other.peopleAdd == _this.peopleAdd && + _other.peopleAdded == _this.peopleAdded && + _other.peopleCircle == _this.peopleCircle && + _other.peopleCopy == _this.peopleCopy && + _other.peopleEditUserRights == _this.peopleEditUserRights && + _other.peopleRemove == _this.peopleRemove && + _other.persona == _this.persona && + _other.pin == _this.pin && + _other.playSolid == _this.playSolid && + _other.plusLarge == _this.plusLarge && + _other.plusSmall == _this.plusSmall && + _other.runShortcut == _this.runShortcut && + _other.searchText == _this.searchText && + _other.settingsGear2 == _this.settingsGear2 && + _other.settingsSliderVer == _this.settingsSliderVer && + _other.shapesPlusCloseSquareCircle == + _this.shapesPlusCloseSquareCircle && + _other.shapesTriangleSquareCircle == _this.shapesTriangleSquareCircle && + _other.shareOs == _this.shareOs && + _other.shareRedirectLink == _this.shareRedirectLink && + _other.shield == _this.shield && + _other.squareBehindSquare2Copy == _this.squareBehindSquare2Copy && + _other.squareCircleTopRightFeeds == _this.squareCircleTopRightFeeds && + _other.stop == _this.stop && + _other.table == _this.table && + _other.team == _this.team && + _other.tennis == _this.tennis && + _other.textToImageURLEnrichment == _this.textToImageURLEnrichment && + _other.thunder == _this.thunder && + _other.trashBin == _this.trashBin && + _other.trending4 == _this.trending4 && + _other.trophy == _this.trophy && + _other.unlocked == _this.unlocked && + _other.unpin == _this.unpin && + _other.users == _this.users && + _other.video == _this.video && + _other.videoSolid == _this.videoSolid && + _other.voiceAndVideo == _this.voiceAndVideo && + _other.voiceHigh == _this.voiceHigh && + _other.volumeFull == _this.volumeFull && + _other.webhook == _this.webhook; + } + + @override + int get hashCode { + final _this = (this as StreamIcons); + + return Object.hashAll([ + runtimeType, + _this.apiAggregate, + _this.apples, + _this.archive1, + _this.arrowBoxLeft, + _this.arrowDown, + _this.arrowLeft, + _this.arrowRight, + _this.arrowRotateClockwise, + _this.arrowRotateRightLeftRepeatRefresh, + _this.arrowShareLeft, + _this.arrowUp, + _this.arrowsRepeatLeftRight, + _this.at, + _this.atSolid, + _this.bellNotification, + _this.bellOff, + _this.bookmark, + _this.bookmarkRemove, + _this.browserAISparkle, + _this.bubble3ChatMessage, + _this.bubble3Solid, + _this.bubbleAnnotation2ChatMessage, + _this.bubbleText6ChatMessage, + _this.bubbleText6Solid, + _this.bubbleWideNotificationChatMessage, + _this.bubbleWideSparkleChatMessage, + _this.calendar1, + _this.callCancel, + _this.camera1, + _this.car1, + _this.cat, + _this.chainLink3, + _this.chart5, + _this.checkmark1Small, + _this.checkmark2, + _this.checkmark2Small, + _this.chevronDown, + _this.chevronGrabberVerticalSelector, + _this.chevronLeft, + _this.chevronRight, + _this.chevronTop, + _this.circleBanSign, + _this.circleCheck, + _this.circleInfoTooltip, + _this.circleMinus, + _this.circleQuestionmark, + _this.circleQuestionmarkFilled, + _this.circleX, + _this.clock, + _this.clockSolid, + _this.closeQuote2, + _this.code, + _this.codeBrackets, + _this.codeEditorInsert, + _this.compass, + _this.creditCard2Billing, + _this.crossMedium, + _this.crossSmall, + _this.dotGrid1x3Horizontal, + _this.dotGrid2x3, + _this.dotsGrid1x3Vertical, + _this.doupleCheckmark1Small, + _this.editBig, + _this.editBigSolid, + _this.emojiAddReaction, + _this.emojiSad, + _this.emojiSmile, + _this.exclamationCircle, + _this.exclamationCircle1, + _this.exclamationTriangle, + _this.exclamationTriangle1, + _this.eyeOpen, + _this.fileArrowLeftIn, + _this.fileBend, + _this.filledCircleInfoTooltip, + _this.filter1, + _this.flag2, + _this.gauge, + _this.google, + _this.hashtagChannel, + _this.heart2, + _this.history, + _this.images1Alt, + _this.invite, + _this.layersBehind, + _this.layoutAlignLeft, + _this.layoutGrid1, + _this.layoutLeft, + _this.lightBulbSimple, + _this.limits, + _this.lineChart3, + _this.lock, + _this.magnifyingGlassSearch, + _this.mapPin, + _this.microphone, + _this.microphoneSolid, + _this.minusLarge, + _this.minusSmall, + _this.mute, + _this.newspaper2, + _this.organization, + _this.paperPlane, + _this.paperPlaneTopRight, + _this.paperclip1, + _this.paragraphsText, + _this.pause, + _this.pencil, + _this.people, + _this.people2, + _this.peopleAdd, + _this.peopleAdded, + _this.peopleCircle, + _this.peopleCopy, + _this.peopleEditUserRights, + _this.peopleRemove, + _this.persona, + _this.pin, + _this.playSolid, + _this.plusLarge, + _this.plusSmall, + _this.runShortcut, + _this.searchText, + _this.settingsGear2, + _this.settingsSliderVer, + _this.shapesPlusCloseSquareCircle, + _this.shapesTriangleSquareCircle, + _this.shareOs, + _this.shareRedirectLink, + _this.shield, + _this.squareBehindSquare2Copy, + _this.squareCircleTopRightFeeds, + _this.stop, + _this.table, + _this.team, + _this.tennis, + _this.textToImageURLEnrichment, + _this.thunder, + _this.trashBin, + _this.trending4, + _this.trophy, + _this.unlocked, + _this.unpin, + _this.users, + _this.video, + _this.videoSolid, + _this.voiceAndVideo, + _this.voiceHigh, + _this.volumeFull, + _this.webhook, + ]); + } +} diff --git a/packages/stream_core_flutter/lib/src/theme/primitives/stream_radius.dart b/packages/stream_core_flutter/lib/src/theme/primitives/stream_radius.dart new file mode 100644 index 0000000..e18adcc --- /dev/null +++ b/packages/stream_core_flutter/lib/src/theme/primitives/stream_radius.dart @@ -0,0 +1,159 @@ +import 'dart:ui'; + +import 'package:flutter/foundation.dart'; +import 'package:theme_extensions_builder_annotation/theme_extensions_builder_annotation.dart'; + +part 'stream_radius.g.theme.dart'; + +/// Border radius primitives for the Stream design system. +/// +/// Provides platform-aware border radius values for consistent rounded corners +/// across iOS, Android, and other platforms. iOS typically uses larger corner +/// radius values following iOS design guidelines, while Android uses Material +/// Design conventions. +/// +/// {@tool snippet} +/// +/// To use border radius values: +/// +/// ```dart +/// final radius = StreamRadius(); +/// Container( +/// decoration: BoxDecoration( +/// borderRadius: BorderRadius.all(radius.md), +/// ), +/// ); +/// ``` +/// {@end-tool} +@immutable +@ThemeGen(constructor: 'raw') +class StreamRadius with _$StreamRadius { + /// Creates a [StreamRadius] with platform-specific or custom values. + /// + /// If [platform] is null, uses [defaultTargetPlatform]. Individual radius + /// values can be overridden with custom values. + factory StreamRadius({ + TargetPlatform? platform, + Radius? none, + Radius? xxs, + Radius? xs, + Radius? sm, + Radius? md, + Radius? lg, + Radius? xl, + Radius? xxl, + Radius? xxxl, + Radius? xxxxl, + Radius? max, + }) { + platform ??= defaultTargetPlatform; + final defaultRadius = switch (platform) { + .iOS || .macOS => ios, + _ => android, + }; + + return .raw( + none: none ?? defaultRadius.none, + xxs: xxs ?? defaultRadius.xxs, + xs: xs ?? defaultRadius.xs, + sm: sm ?? defaultRadius.sm, + md: md ?? defaultRadius.md, + lg: lg ?? defaultRadius.lg, + xl: xl ?? defaultRadius.xl, + xxl: xxl ?? defaultRadius.xxl, + xxxl: xxxl ?? defaultRadius.xxxl, + xxxxl: xxxxl ?? defaultRadius.xxxxl, + max: max ?? defaultRadius.max, + ); + } + + const StreamRadius.raw({ + required this.none, + required this.xxs, + required this.xs, + required this.sm, + required this.md, + required this.lg, + required this.xl, + required this.xxl, + required this.xxxl, + required this.xxxxl, + required this.max, + }); + + /// The iOS/macOS border radius scale. + /// + /// Uses iOS design guidelines with generally larger radius values. + static const StreamRadius ios = .raw( + none: .zero, + xxs: .circular(2), + xs: .circular(4), + sm: .circular(6), + md: .circular(8), + lg: .circular(12), + xl: .circular(16), + xxl: .circular(20), + xxxl: .circular(24), + xxxxl: .circular(32), + max: .circular(9999), + ); + + /// The Android border radius scale. + /// + /// Uses Material Design guidelines with more conservative radius values. + static const StreamRadius android = .raw( + none: .zero, + xxs: .zero, + xs: .circular(2), + sm: .circular(4), + md: .circular(6), + lg: .circular(8), + xl: .circular(12), + xxl: .circular(16), + xxxl: .circular(20), + xxxxl: .circular(24), + max: .circular(9999), + ); + + /// No border radius. + final Radius none; + + /// The extra extra small border radius. + final Radius xxs; + + /// The extra small border radius. + final Radius xs; + + /// The small border radius. + final Radius sm; + + /// The medium border radius. + final Radius md; + + /// The large border radius. + final Radius lg; + + /// The extra large border radius. + final Radius xl; + + /// The extra extra large border radius. + final Radius xxl; + + /// The extra extra extra large border radius. + final Radius xxxl; + + /// The extra extra extra extra large border radius. + final Radius xxxxl; + + /// The maximum border radius. + /// + /// Use for fully rounded elements like pills or circular buttons. + final Radius max; + + /// Linearly interpolates between two [StreamRadius] instances. + static StreamRadius? lerp( + StreamRadius? a, + StreamRadius? b, + double t, + ) => _$StreamRadius.lerp(a, b, t); +} diff --git a/packages/stream_core_flutter/lib/src/theme/primitives/stream_radius.g.theme.dart b/packages/stream_core_flutter/lib/src/theme/primitives/stream_radius.g.theme.dart new file mode 100644 index 0000000..0ab524c --- /dev/null +++ b/packages/stream_core_flutter/lib/src/theme/primitives/stream_radius.g.theme.dart @@ -0,0 +1,144 @@ +// dart format width=80 +// coverage:ignore-file +// GENERATED CODE - DO NOT MODIFY BY HAND +// ignore_for_file: type=lint, unused_element + +part of 'stream_radius.dart'; + +// ************************************************************************** +// ThemeGenGenerator +// ************************************************************************** + +mixin _$StreamRadius { + bool get canMerge => true; + + static StreamRadius? lerp(StreamRadius? a, StreamRadius? b, double t) { + if (identical(a, b)) { + return a; + } + + if (a == null) { + return t == 1.0 ? b : null; + } + + if (b == null) { + return t == 0.0 ? a : null; + } + + return StreamRadius.raw( + none: Radius.lerp(a.none, b.none, t)!, + xxs: Radius.lerp(a.xxs, b.xxs, t)!, + xs: Radius.lerp(a.xs, b.xs, t)!, + sm: Radius.lerp(a.sm, b.sm, t)!, + md: Radius.lerp(a.md, b.md, t)!, + lg: Radius.lerp(a.lg, b.lg, t)!, + xl: Radius.lerp(a.xl, b.xl, t)!, + xxl: Radius.lerp(a.xxl, b.xxl, t)!, + xxxl: Radius.lerp(a.xxxl, b.xxxl, t)!, + xxxxl: Radius.lerp(a.xxxxl, b.xxxxl, t)!, + max: Radius.lerp(a.max, b.max, t)!, + ); + } + + StreamRadius copyWith({ + Radius? none, + Radius? xxs, + Radius? xs, + Radius? sm, + Radius? md, + Radius? lg, + Radius? xl, + Radius? xxl, + Radius? xxxl, + Radius? xxxxl, + Radius? max, + }) { + final _this = (this as StreamRadius); + + return StreamRadius.raw( + none: none ?? _this.none, + xxs: xxs ?? _this.xxs, + xs: xs ?? _this.xs, + sm: sm ?? _this.sm, + md: md ?? _this.md, + lg: lg ?? _this.lg, + xl: xl ?? _this.xl, + xxl: xxl ?? _this.xxl, + xxxl: xxxl ?? _this.xxxl, + xxxxl: xxxxl ?? _this.xxxxl, + max: max ?? _this.max, + ); + } + + StreamRadius merge(StreamRadius? other) { + final _this = (this as StreamRadius); + + if (other == null || identical(_this, other)) { + return _this; + } + + if (!other.canMerge) { + return other; + } + + return copyWith( + none: other.none, + xxs: other.xxs, + xs: other.xs, + sm: other.sm, + md: other.md, + lg: other.lg, + xl: other.xl, + xxl: other.xxl, + xxxl: other.xxxl, + xxxxl: other.xxxxl, + max: other.max, + ); + } + + @override + bool operator ==(Object other) { + if (identical(this, other)) { + return true; + } + + if (other.runtimeType != runtimeType) { + return false; + } + + final _this = (this as StreamRadius); + final _other = (other as StreamRadius); + + return _other.none == _this.none && + _other.xxs == _this.xxs && + _other.xs == _this.xs && + _other.sm == _this.sm && + _other.md == _this.md && + _other.lg == _this.lg && + _other.xl == _this.xl && + _other.xxl == _this.xxl && + _other.xxxl == _this.xxxl && + _other.xxxxl == _this.xxxxl && + _other.max == _this.max; + } + + @override + int get hashCode { + final _this = (this as StreamRadius); + + return Object.hash( + runtimeType, + _this.none, + _this.xxs, + _this.xs, + _this.sm, + _this.md, + _this.lg, + _this.xl, + _this.xxl, + _this.xxxl, + _this.xxxxl, + _this.max, + ); + } +} diff --git a/packages/stream_core_flutter/lib/src/theme/primitives/stream_spacing.dart b/packages/stream_core_flutter/lib/src/theme/primitives/stream_spacing.dart new file mode 100644 index 0000000..b56d5a3 --- /dev/null +++ b/packages/stream_core_flutter/lib/src/theme/primitives/stream_spacing.dart @@ -0,0 +1,99 @@ +import 'package:flutter/foundation.dart'; +import 'package:theme_extensions_builder_annotation/theme_extensions_builder_annotation.dart'; + +part 'stream_spacing.g.theme.dart'; + +/// Spacing primitives for the Stream design system. +/// +/// Provides consistent spacing values for padding, margins, and gaps between +/// UI elements. Spacing values are the same across all platforms. +/// +/// {@tool snippet} +/// +/// To use spacing values: +/// +/// ```dart +/// const spacing = StreamSpacing(); +/// Container( +/// padding: EdgeInsets.all(spacing.md), +/// child: Column( +/// spacing: spacing.xs, +/// children: [...], +/// ), +/// ); +/// ``` +/// {@end-tool} +@immutable +@ThemeGen() +class StreamSpacing with _$StreamSpacing { + /// Creates a [StreamSpacing] with the default values. + const StreamSpacing({ + this.none = 0, + this.xxxs = 2, + this.xxs = 4, + this.xs = 8, + this.sm = 12, + this.md = 16, + this.lg = 20, + this.xl = 24, + this.xxl = 32, + this.xxxl = 40, + }); + + /// No spacing. + /// + /// Used for tight component joins. + final double none; + + /// Extra extra extra small spacing. + /// + /// Used for very tight spacing between closely related elements. + final double xxxs; + + /// Base unit spacing. + /// + /// Used for minimal padding and tight gaps. + final double xxs; + + /// Extra small spacing. + /// + /// Used for small padding and default vertical gaps. + final double xs; + + /// Small spacing. + /// + /// Used for common internal spacing in inputs and buttons. + final double sm; + + /// Medium spacing. + /// + /// Used for default large padding for sections and cards. + final double md; + + /// Large spacing. + /// + /// Used for medium spacing for grouping elements and section breaks. + final double lg; + + /// Extra large spacing. + /// + /// Used for comfortable spacing for chat bubbles and list items. + final double xl; + + /// Extra extra large spacing. + /// + /// Used for larger spacing for panels, modals, and gutters. + final double xxl; + + /// Extra extra extra large spacing. + /// + /// Used for wide layout spacing and breathing room. + final double xxxl; + + /// Linearly interpolates between two [StreamSpacing] instances. + static StreamSpacing? lerp( + StreamSpacing? a, + StreamSpacing? b, + double t, + ) => _$StreamSpacing.lerp(a, b, t); +} diff --git a/packages/stream_core_flutter/lib/src/theme/primitives/stream_spacing.g.theme.dart b/packages/stream_core_flutter/lib/src/theme/primitives/stream_spacing.g.theme.dart new file mode 100644 index 0000000..a2bfcdc --- /dev/null +++ b/packages/stream_core_flutter/lib/src/theme/primitives/stream_spacing.g.theme.dart @@ -0,0 +1,138 @@ +// dart format width=80 +// coverage:ignore-file +// GENERATED CODE - DO NOT MODIFY BY HAND +// ignore_for_file: type=lint, unused_element + +part of 'stream_spacing.dart'; + +// ************************************************************************** +// ThemeGenGenerator +// ************************************************************************** + +mixin _$StreamSpacing { + bool get canMerge => true; + + static StreamSpacing? lerp(StreamSpacing? a, StreamSpacing? b, double t) { + if (identical(a, b)) { + return a; + } + + if (a == null) { + return t == 1.0 ? b : null; + } + + if (b == null) { + return t == 0.0 ? a : null; + } + + return StreamSpacing( + none: lerpDouble$(a.none, b.none, t)!, + xxxs: lerpDouble$(a.xxxs, b.xxxs, t)!, + xxs: lerpDouble$(a.xxs, b.xxs, t)!, + xs: lerpDouble$(a.xs, b.xs, t)!, + sm: lerpDouble$(a.sm, b.sm, t)!, + md: lerpDouble$(a.md, b.md, t)!, + lg: lerpDouble$(a.lg, b.lg, t)!, + xl: lerpDouble$(a.xl, b.xl, t)!, + xxl: lerpDouble$(a.xxl, b.xxl, t)!, + xxxl: lerpDouble$(a.xxxl, b.xxxl, t)!, + ); + } + + StreamSpacing copyWith({ + double? none, + double? xxxs, + double? xxs, + double? xs, + double? sm, + double? md, + double? lg, + double? xl, + double? xxl, + double? xxxl, + }) { + final _this = (this as StreamSpacing); + + return StreamSpacing( + none: none ?? _this.none, + xxxs: xxxs ?? _this.xxxs, + xxs: xxs ?? _this.xxs, + xs: xs ?? _this.xs, + sm: sm ?? _this.sm, + md: md ?? _this.md, + lg: lg ?? _this.lg, + xl: xl ?? _this.xl, + xxl: xxl ?? _this.xxl, + xxxl: xxxl ?? _this.xxxl, + ); + } + + StreamSpacing merge(StreamSpacing? other) { + final _this = (this as StreamSpacing); + + if (other == null || identical(_this, other)) { + return _this; + } + + if (!other.canMerge) { + return other; + } + + return copyWith( + none: other.none, + xxxs: other.xxxs, + xxs: other.xxs, + xs: other.xs, + sm: other.sm, + md: other.md, + lg: other.lg, + xl: other.xl, + xxl: other.xxl, + xxxl: other.xxxl, + ); + } + + @override + bool operator ==(Object other) { + if (identical(this, other)) { + return true; + } + + if (other.runtimeType != runtimeType) { + return false; + } + + final _this = (this as StreamSpacing); + final _other = (other as StreamSpacing); + + return _other.none == _this.none && + _other.xxxs == _this.xxxs && + _other.xxs == _this.xxs && + _other.xs == _this.xs && + _other.sm == _this.sm && + _other.md == _this.md && + _other.lg == _this.lg && + _other.xl == _this.xl && + _other.xxl == _this.xxl && + _other.xxxl == _this.xxxl; + } + + @override + int get hashCode { + final _this = (this as StreamSpacing); + + return Object.hash( + runtimeType, + _this.none, + _this.xxxs, + _this.xxs, + _this.xs, + _this.sm, + _this.md, + _this.lg, + _this.xl, + _this.xxl, + _this.xxxl, + ); + } +} diff --git a/packages/stream_core_flutter/lib/src/theme/primitives/stream_typography.dart b/packages/stream_core_flutter/lib/src/theme/primitives/stream_typography.dart new file mode 100644 index 0000000..4b44eec --- /dev/null +++ b/packages/stream_core_flutter/lib/src/theme/primitives/stream_typography.dart @@ -0,0 +1,263 @@ +import 'dart:ui'; + +import 'package:flutter/foundation.dart'; +import 'package:theme_extensions_builder_annotation/theme_extensions_builder_annotation.dart'; + +part 'stream_typography.g.theme.dart'; + +/// Typography primitives for the Stream design system. +/// +/// Provides platform-aware font sizes, line heights, and font weights for +/// consistent text styling across iOS, Android, and other platforms. +/// +/// {@tool snippet} +/// +/// To create a typography configuration: +/// +/// ```dart +/// final typography = StreamTypography(); +/// final fontSize = typography.fontSize.md; // 15.0 on iOS, 16.0 on Android +/// ``` +/// {@end-tool} +/// +/// See also: +/// +/// * [StreamTextTheme], which provides semantic text styles using these primitives. +@immutable +@ThemeGen(constructor: 'raw') +class StreamTypography with _$StreamTypography { + /// Creates a [StreamTypography] with optional custom values. + /// + /// If [platform] is null, uses [defaultTargetPlatform]. Font sizes + /// automatically adjust based on the platform. + factory StreamTypography({ + TargetPlatform? platform, + StreamFontSize? fontSize, + StreamLineHeight? lineHeight, + StreamFontWeight? fontWeight, + }) { + platform ??= defaultTargetPlatform; + fontSize ??= StreamFontSize(platform: platform); + lineHeight ??= const StreamLineHeight(); + fontWeight ??= const StreamFontWeight(); + + return .raw( + fontSize: fontSize, + lineHeight: lineHeight, + fontWeight: fontWeight, + ); + } + + const StreamTypography.raw({ + required this.fontSize, + required this.lineHeight, + required this.fontWeight, + }); + + /// The font size scale. + final StreamFontSize fontSize; + + /// The line height values. + final StreamLineHeight lineHeight; + + /// The font weight values. + final StreamFontWeight fontWeight; + + /// Linearly interpolates between two [StreamTypography] instances. + static StreamTypography? lerp( + StreamTypography? a, + StreamTypography? b, + double t, + ) => _$StreamTypography.lerp(a, b, t); +} + +/// Line height values for text. +/// +/// Provides three standard line heights for different text densities. +@immutable +@ThemeGen() +class StreamLineHeight with _$StreamLineHeight { + /// Creates a [StreamLineHeight] with the given values. + const StreamLineHeight({ + this.tight = 16, + this.normal = 20, + this.relaxed = 24, + }); + + /// The tight line height. + /// + /// Use for compact text layouts. + final double tight; + + /// The normal line height. + /// + /// Use for standard body text. + final double normal; + + /// The relaxed line height. + /// + /// Use for improved readability in long-form content. + final double relaxed; + + /// Linearly interpolates between two [StreamLineHeight] instances. + static StreamLineHeight? lerp( + StreamLineHeight? a, + StreamLineHeight? b, + double t, + ) => _$StreamLineHeight.lerp(a, b, t); +} + +/// Platform-aware font size scale. +/// +/// Provides eight font sizes that automatically adjust based on the platform. +/// iOS uses the San Francisco font sizing, while Android uses Roboto sizing. +/// +/// {@tool snippet} +/// +/// To use platform-specific font sizes: +/// +/// ```dart +/// final fontSize = StreamFontSize(); +/// Text('Hello', style: TextStyle(fontSize: fontSize.md)); // 15.0 on iOS, 16.0 on Android +/// ``` +/// {@end-tool} +@immutable +@ThemeGen(constructor: 'raw') +class StreamFontSize with _$StreamFontSize { + /// Creates a [StreamFontSize] with platform-specific or custom values. + /// + /// If [platform] is null, uses [defaultTargetPlatform]. Individual sizes + /// can be overridden with custom values. + factory StreamFontSize({ + TargetPlatform? platform, + double? micro, + double? xxs, + double? xs, + double? sm, + double? md, + double? lg, + double? xl, + double? xxl, + }) { + platform ??= defaultTargetPlatform; + final defaultFontSize = switch (platform) { + .iOS || .macOS => ios, + _ => android, + }; + + return .raw( + micro: micro ?? defaultFontSize.micro, + xxs: xxs ?? defaultFontSize.xxs, + xs: xs ?? defaultFontSize.xs, + sm: sm ?? defaultFontSize.sm, + md: md ?? defaultFontSize.md, + lg: lg ?? defaultFontSize.lg, + xl: xl ?? defaultFontSize.xl, + xxl: xxl ?? defaultFontSize.xxl, + ); + } + + const StreamFontSize.raw({ + required this.micro, + required this.xxs, + required this.xs, + required this.sm, + required this.md, + required this.lg, + required this.xl, + required this.xxl, + }); + + /// The iOS/macOS font size scale. + /// + /// Uses San Francisco font sizing conventions. + static const StreamFontSize ios = .raw( + micro: 8, + xxs: 10, + xs: 12, + sm: 13, + md: 15, + lg: 17, + xl: 20, + xxl: 24, + ); + + /// The Android font size scale. + /// + /// Uses Roboto font sizing conventions. + static const StreamFontSize android = .raw( + micro: 8, + xxs: 10, + xs: 12, + sm: 14, + md: 16, + lg: 18, + xl: 20, + xxl: 24, + ); + + /// The micro font size. + final double micro; + + /// The extra extra small font size. + final double xxs; + + /// The extra small font size. + final double xs; + + /// The small font size. + final double sm; + + /// The medium font size. + final double md; + + /// The large font size. + final double lg; + + /// The extra large font size. + final double xl; + + /// The extra extra large font size. + final double xxl; + + /// Linearly interpolates between two [StreamFontSize] instances. + static StreamFontSize? lerp( + StreamFontSize? a, + StreamFontSize? b, + double t, + ) => _$StreamFontSize.lerp(a, b, t); +} + +/// Font weight values for text. +/// +/// Provides four standard font weights for text hierarchy. +@immutable +@ThemeGen() +class StreamFontWeight with _$StreamFontWeight { + /// Creates a [StreamFontWeight] with the given values. + const StreamFontWeight({ + this.regular = .w400, + this.medium = .w500, + this.semibold = .w600, + this.bold = .w700, + }); + + /// The regular font weight. + final FontWeight regular; + + /// The medium font weight. + final FontWeight medium; + + /// The semibold font weight. + final FontWeight semibold; + + /// The bold font weight. + final FontWeight bold; + + /// Linearly interpolates between two [StreamFontWeight] instances. + static StreamFontWeight? lerp( + StreamFontWeight? a, + StreamFontWeight? b, + double t, + ) => _$StreamFontWeight.lerp(a, b, t); +} diff --git a/packages/stream_core_flutter/lib/src/theme/primitives/stream_typography.g.theme.dart b/packages/stream_core_flutter/lib/src/theme/primitives/stream_typography.g.theme.dart new file mode 100644 index 0000000..aec983a --- /dev/null +++ b/packages/stream_core_flutter/lib/src/theme/primitives/stream_typography.g.theme.dart @@ -0,0 +1,393 @@ +// dart format width=80 +// coverage:ignore-file +// GENERATED CODE - DO NOT MODIFY BY HAND +// ignore_for_file: type=lint, unused_element + +part of 'stream_typography.dart'; + +// ************************************************************************** +// ThemeGenGenerator +// ************************************************************************** + +mixin _$StreamTypography { + bool get canMerge => true; + + static StreamTypography? lerp( + StreamTypography? a, + StreamTypography? b, + double t, + ) { + if (identical(a, b)) { + return a; + } + + if (a == null) { + return t == 1.0 ? b : null; + } + + if (b == null) { + return t == 0.0 ? a : null; + } + + return StreamTypography.raw( + fontSize: StreamFontSize.lerp(a.fontSize, b.fontSize, t)!, + lineHeight: StreamLineHeight.lerp(a.lineHeight, b.lineHeight, t)!, + fontWeight: StreamFontWeight.lerp(a.fontWeight, b.fontWeight, t)!, + ); + } + + StreamTypography copyWith({ + StreamFontSize? fontSize, + StreamLineHeight? lineHeight, + StreamFontWeight? fontWeight, + }) { + final _this = (this as StreamTypography); + + return StreamTypography.raw( + fontSize: fontSize ?? _this.fontSize, + lineHeight: lineHeight ?? _this.lineHeight, + fontWeight: fontWeight ?? _this.fontWeight, + ); + } + + StreamTypography merge(StreamTypography? other) { + final _this = (this as StreamTypography); + + if (other == null || identical(_this, other)) { + return _this; + } + + if (!other.canMerge) { + return other; + } + + return copyWith( + fontSize: _this.fontSize.merge(other.fontSize), + lineHeight: _this.lineHeight.merge(other.lineHeight), + fontWeight: _this.fontWeight.merge(other.fontWeight), + ); + } + + @override + bool operator ==(Object other) { + if (identical(this, other)) { + return true; + } + + if (other.runtimeType != runtimeType) { + return false; + } + + final _this = (this as StreamTypography); + final _other = (other as StreamTypography); + + return _other.fontSize == _this.fontSize && + _other.lineHeight == _this.lineHeight && + _other.fontWeight == _this.fontWeight; + } + + @override + int get hashCode { + final _this = (this as StreamTypography); + + return Object.hash( + runtimeType, + _this.fontSize, + _this.lineHeight, + _this.fontWeight, + ); + } +} + +mixin _$StreamLineHeight { + bool get canMerge => true; + + static StreamLineHeight? lerp( + StreamLineHeight? a, + StreamLineHeight? b, + double t, + ) { + if (identical(a, b)) { + return a; + } + + if (a == null) { + return t == 1.0 ? b : null; + } + + if (b == null) { + return t == 0.0 ? a : null; + } + + return StreamLineHeight( + tight: lerpDouble$(a.tight, b.tight, t)!, + normal: lerpDouble$(a.normal, b.normal, t)!, + relaxed: lerpDouble$(a.relaxed, b.relaxed, t)!, + ); + } + + StreamLineHeight copyWith({double? tight, double? normal, double? relaxed}) { + final _this = (this as StreamLineHeight); + + return StreamLineHeight( + tight: tight ?? _this.tight, + normal: normal ?? _this.normal, + relaxed: relaxed ?? _this.relaxed, + ); + } + + StreamLineHeight merge(StreamLineHeight? other) { + final _this = (this as StreamLineHeight); + + if (other == null || identical(_this, other)) { + return _this; + } + + if (!other.canMerge) { + return other; + } + + return copyWith( + tight: other.tight, + normal: other.normal, + relaxed: other.relaxed, + ); + } + + @override + bool operator ==(Object other) { + if (identical(this, other)) { + return true; + } + + if (other.runtimeType != runtimeType) { + return false; + } + + final _this = (this as StreamLineHeight); + final _other = (other as StreamLineHeight); + + return _other.tight == _this.tight && + _other.normal == _this.normal && + _other.relaxed == _this.relaxed; + } + + @override + int get hashCode { + final _this = (this as StreamLineHeight); + + return Object.hash(runtimeType, _this.tight, _this.normal, _this.relaxed); + } +} + +mixin _$StreamFontSize { + bool get canMerge => true; + + static StreamFontSize? lerp(StreamFontSize? a, StreamFontSize? b, double t) { + if (identical(a, b)) { + return a; + } + + if (a == null) { + return t == 1.0 ? b : null; + } + + if (b == null) { + return t == 0.0 ? a : null; + } + + return StreamFontSize.raw( + micro: lerpDouble$(a.micro, b.micro, t)!, + xxs: lerpDouble$(a.xxs, b.xxs, t)!, + xs: lerpDouble$(a.xs, b.xs, t)!, + sm: lerpDouble$(a.sm, b.sm, t)!, + md: lerpDouble$(a.md, b.md, t)!, + lg: lerpDouble$(a.lg, b.lg, t)!, + xl: lerpDouble$(a.xl, b.xl, t)!, + xxl: lerpDouble$(a.xxl, b.xxl, t)!, + ); + } + + StreamFontSize copyWith({ + double? micro, + double? xxs, + double? xs, + double? sm, + double? md, + double? lg, + double? xl, + double? xxl, + }) { + final _this = (this as StreamFontSize); + + return StreamFontSize.raw( + micro: micro ?? _this.micro, + xxs: xxs ?? _this.xxs, + xs: xs ?? _this.xs, + sm: sm ?? _this.sm, + md: md ?? _this.md, + lg: lg ?? _this.lg, + xl: xl ?? _this.xl, + xxl: xxl ?? _this.xxl, + ); + } + + StreamFontSize merge(StreamFontSize? other) { + final _this = (this as StreamFontSize); + + if (other == null || identical(_this, other)) { + return _this; + } + + if (!other.canMerge) { + return other; + } + + return copyWith( + micro: other.micro, + xxs: other.xxs, + xs: other.xs, + sm: other.sm, + md: other.md, + lg: other.lg, + xl: other.xl, + xxl: other.xxl, + ); + } + + @override + bool operator ==(Object other) { + if (identical(this, other)) { + return true; + } + + if (other.runtimeType != runtimeType) { + return false; + } + + final _this = (this as StreamFontSize); + final _other = (other as StreamFontSize); + + return _other.micro == _this.micro && + _other.xxs == _this.xxs && + _other.xs == _this.xs && + _other.sm == _this.sm && + _other.md == _this.md && + _other.lg == _this.lg && + _other.xl == _this.xl && + _other.xxl == _this.xxl; + } + + @override + int get hashCode { + final _this = (this as StreamFontSize); + + return Object.hash( + runtimeType, + _this.micro, + _this.xxs, + _this.xs, + _this.sm, + _this.md, + _this.lg, + _this.xl, + _this.xxl, + ); + } +} + +mixin _$StreamFontWeight { + bool get canMerge => true; + + static StreamFontWeight? lerp( + StreamFontWeight? a, + StreamFontWeight? b, + double t, + ) { + if (identical(a, b)) { + return a; + } + + if (a == null) { + return t == 1.0 ? b : null; + } + + if (b == null) { + return t == 0.0 ? a : null; + } + + return StreamFontWeight( + regular: FontWeight.lerp(a.regular, b.regular, t)!, + medium: FontWeight.lerp(a.medium, b.medium, t)!, + semibold: FontWeight.lerp(a.semibold, b.semibold, t)!, + bold: FontWeight.lerp(a.bold, b.bold, t)!, + ); + } + + StreamFontWeight copyWith({ + FontWeight? regular, + FontWeight? medium, + FontWeight? semibold, + FontWeight? bold, + }) { + final _this = (this as StreamFontWeight); + + return StreamFontWeight( + regular: regular ?? _this.regular, + medium: medium ?? _this.medium, + semibold: semibold ?? _this.semibold, + bold: bold ?? _this.bold, + ); + } + + StreamFontWeight merge(StreamFontWeight? other) { + final _this = (this as StreamFontWeight); + + if (other == null || identical(_this, other)) { + return _this; + } + + if (!other.canMerge) { + return other; + } + + return copyWith( + regular: other.regular, + medium: other.medium, + semibold: other.semibold, + bold: other.bold, + ); + } + + @override + bool operator ==(Object other) { + if (identical(this, other)) { + return true; + } + + if (other.runtimeType != runtimeType) { + return false; + } + + final _this = (this as StreamFontWeight); + final _other = (other as StreamFontWeight); + + return _other.regular == _this.regular && + _other.medium == _this.medium && + _other.semibold == _this.semibold && + _other.bold == _this.bold; + } + + @override + int get hashCode { + final _this = (this as StreamFontWeight); + + return Object.hash( + runtimeType, + _this.regular, + _this.medium, + _this.semibold, + _this.bold, + ); + } +} diff --git a/packages/stream_core_flutter/lib/src/theme/primitives/tokens/dark/stream_tokens.dart b/packages/stream_core_flutter/lib/src/theme/primitives/tokens/dark/stream_tokens.dart new file mode 100644 index 0000000..8e163aa --- /dev/null +++ b/packages/stream_core_flutter/lib/src/theme/primitives/tokens/dark/stream_tokens.dart @@ -0,0 +1,595 @@ +import 'package:flutter/widgets.dart'; + +class StreamTokens { + StreamTokens._(); + + static const baseTransparent0 = Color(0x00FFFFFF); + static const baseTransparentBlack5 = Color(0x0D000000); + static const baseTransparentBlack10 = Color(0x1A000000); + static const baseTransparentWhite70 = Color(0xB3FFFFFF); + static const baseTransparentWhite10 = Color(0x1AFFFFFF); + static const baseTransparentWhite20 = Color(0x33FFFFFF); + static const baseTransparentBlack70 = Color(0xB3000000); + static const baseBlack = Color(0xFF000000); + static const baseWhite = Color(0xFFFFFFFF); + static const slate50 = Color(0xFFF6F8FA); + static const slate100 = Color(0xFFEBEEF1); + static const slate150 = Color(0xFFD5DBE1); + static const slate200 = Color(0xFFC0C8D2); + static const slate300 = Color(0xFFA3ACBA); + static const slate400 = Color(0xFF87909F); + static const slate500 = Color(0xFF687385); + static const slate600 = Color(0xFF545969); + static const slate700 = Color(0xFF414552); + static const slate800 = Color(0xFF30313D); + static const slate900 = Color(0xFF1A1B25); + static const neutral50 = Color(0xFFF8F8F8); + static const neutral100 = Color(0xFFEFEFEF); + static const neutral150 = Color(0xFFD8D8D8); + static const neutral200 = Color(0xFFC4C4C4); + static const neutral300 = Color(0xFFABABAB); + static const neutral400 = Color(0xFF8F8F8F); + static const neutral500 = Color(0xFF6A6A6A); + static const neutral600 = Color(0xFF565656); + static const neutral700 = Color(0xFF464646); + static const neutral800 = Color(0xFF323232); + static const neutral900 = Color(0xFF1C1C1C); + static const blue50 = Color(0xFFF3F7FF); + static const blue100 = Color(0xFFE3EDFF); + static const blue150 = Color(0xFFC3D9FF); + static const blue200 = Color(0xFFA5C5FF); + static const blue300 = Color(0xFF78A8FF); + static const blue400 = Color(0xFF4586FF); + static const blue500 = Color(0xFF005FFF); + static const blue600 = Color(0xFF1B53BD); + static const blue700 = Color(0xFF19418D); + static const blue800 = Color(0xFF142F63); + static const blue900 = Color(0xFF091A3B); + static const cyan50 = Color(0xFFF1FBFC); + static const cyan100 = Color(0xFFD1F3F6); + static const cyan150 = Color(0xFFA9E4EA); + static const cyan200 = Color(0xFF72D7E0); + static const cyan300 = Color(0xFF45BCC7); + static const cyan400 = Color(0xFF1E9EA9); + static const cyan500 = Color(0xFF248088); + static const cyan600 = Color(0xFF006970); + static const cyan700 = Color(0xFF065056); + static const cyan800 = Color(0xFF003A3F); + static const cyan900 = Color(0xFF002124); + static const green50 = Color(0xFFE1FFEE); + static const green100 = Color(0xFFBDFCDB); + static const green150 = Color(0xFF8FEBBD); + static const green200 = Color(0xFF59DEA3); + static const green300 = Color(0xFF00C384); + static const green400 = Color(0xFF00A46E); + static const green500 = Color(0xFF277E59); + static const green600 = Color(0xFF006643); + static const green700 = Color(0xFF004F33); + static const green800 = Color(0xFF003A25); + static const green900 = Color(0xFF002213); + static const purple50 = Color(0xFFF7F8FF); + static const purple100 = Color(0xFFECEDFF); + static const purple150 = Color(0xFFD4D7FF); + static const purple200 = Color(0xFFC1C5FF); + static const purple300 = Color(0xFFA1A3FF); + static const purple400 = Color(0xFF8482FC); + static const purple500 = Color(0xFF644AF9); + static const purple600 = Color(0xFF553BD8); + static const purple700 = Color(0xFF4032A1); + static const purple800 = Color(0xFF2E2576); + static const purple900 = Color(0xFF1A114D); + static const yellow50 = Color(0xFFFEF9DA); + static const yellow100 = Color(0xFFFCEDB9); + static const yellow150 = Color(0xFFFCD579); + static const yellow200 = Color(0xFFF6BF57); + static const yellow300 = Color(0xFFFA922B); + static const yellow400 = Color(0xFFF26D10); + static const yellow500 = Color(0xFFC84801); + static const yellow600 = Color(0xFFA82C00); + static const yellow700 = Color(0xFF842106); + static const yellow800 = Color(0xFF5F1A05); + static const yellow900 = Color(0xFF331302); + static const red50 = Color(0xFFFFF5FA); + static const red100 = Color(0xFFFFE7F2); + static const red150 = Color(0xFFFFCCDF); + static const red200 = Color(0xFFFFB1CD); + static const red300 = Color(0xFFFE87A1); + static const red400 = Color(0xFFFC526A); + static const red500 = Color(0xFFD90D10); + static const red600 = Color(0xFFB3093C); + static const red700 = Color(0xFF890D37); + static const red800 = Color(0xFF68052B); + static const red900 = Color(0xFF3E021A); + static const violet50 = Color(0xFFFEF4FF); + static const violet100 = Color(0xFFFBE8FE); + static const violet150 = Color(0xFFF7CFFC); + static const violet200 = Color(0xFFEEB5F4); + static const violet300 = Color(0xFFE68BEC); + static const violet400 = Color(0xFFD75FE7); + static const violet500 = Color(0xFFB716CA); + static const violet600 = Color(0xFF9D00AE); + static const violet700 = Color(0xFF7C0089); + static const violet800 = Color(0xFF5C0066); + static const violet900 = Color(0xFF36003D); + static const lime50 = Color(0xFFF1FDE8); + static const lime100 = Color(0xFFD4FFB0); + static const lime150 = Color(0xFFB1EE79); + static const lime200 = Color(0xFF9CDA5D); + static const lime300 = Color(0xFF78C100); + static const lime400 = Color(0xFF639E11); + static const lime500 = Color(0xFF4B7A0A); + static const lime600 = Color(0xFF3E6213); + static const lime700 = Color(0xFF355315); + static const lime800 = Color(0xFF203A00); + static const lime900 = Color(0xFF112100); + static const size2 = 2; + static const size4 = 4; + static const size6 = 6; + static const size8 = 8; + static const size12 = 12; + static const size16 = 16; + static const size20 = 20; + static const size24 = 24; + static const size32 = 32; + static const size40 = 40; + static const size48 = 48; + static const size64 = 64; + static const size28 = 28; + static const size80 = 80; + static const size128 = 128; + static const size240 = 240; + static const size320 = 320; + static const size480 = 480; + static const size560 = 560; + static const size640 = 640; + static const radius0 = 0; + static const radius2 = 2; + static const radius4 = 4; + static const radius6 = 6; + static const radius8 = 8; + static const radius12 = 12; + static const radius16 = 16; + static const radius20 = 20; + static const radius24 = 24; + static const radius32 = 32; + static const radiusFull = 9999; + static const space0 = 0; + static const space2 = 2; + static const space4 = 4; + static const space8 = 8; + static const space12 = 12; + static const space16 = 16; + static const space20 = 20; + static const space24 = 24; + static const space32 = 32; + static const space40 = 40; + static const space48 = 48; + static const space64 = 64; + static const space80 = 80; + static const w100 = 1; + static const w150 = 1.5; + static const w200 = 2; + static const w300 = 3; + static const w400 = 4; + static const w120 = 1.2; + static const fontFamilyGeist = 'Geist'; + static const fontFamilyGeistMono = 'Geist Mono'; + static const fontFamilySfPro = 'SF Pro'; + static const fontFamilySfMono = 'SF Mono'; + static const fontFamilyRoboto = 'Roboto'; + static const fontFamilyRobotoMono = 'Roboto Mono'; + static const fontWeightW400 = 400; + static const fontWeightW500 = 500; + static const fontWeightW600 = 600; + static const fontWeightW700 = 700; + static const fontSizeSize10 = 10; + static const fontSizeSize12 = 12; + static const fontSizeSize14 = 14; + static const fontSizeSize16 = 16; + static const fontSizeSize15 = 15; + static const fontSizeSize17 = 17; + static const fontSizeSize18 = 18; + static const fontSizeSize20 = 20; + static const fontSizeSize24 = 24; + static const fontSizeSize28 = 28; + static const fontSizeSize32 = 32; + static const fontSizeSize40 = 40; + static const fontSizeSize48 = 48; + static const fontSizeSize13 = 13; + static const fontSizeSize8 = 8; + static const lineHeightLineHeight8 = 8; + static const lineHeightLineHeight10 = 10; + static const lineHeightLineHeight12 = 12; + static const lineHeightLineHeight14 = 14; + static const lineHeightLineHeight15 = 15; + static const lineHeightLineHeight16 = 16; + static const lineHeightLineHeight17 = 17; + static const lineHeightLineHeight18 = 18; + static const lineHeightLineHeight20 = 20; + static const lineHeightLineHeight24 = 24; + static const lineHeightLineHeight28 = 28; + static const lineHeightLineHeight32 = 32; + static const lineHeightLineHeight40 = 40; + static const lineHeightLineHeight48 = 48; + static const typographyFontFamilySans = 'Geist'; + static const typographyFontFamilyMono = 'Geist Mono'; + static const typographyFontWeightRegular = 400; + static const typographyFontWeightMedium = 500; + static const typographyFontWeightSemiBold = 600; + static const typographyFontWeightBold = 700; + static const typographyFontSizeXxs = 10; + static const typographyFontSizeXs = 12; + static const typographyFontSizeSm = 14; + static const typographyFontSizeMd = 16; + static const typographyFontSizeLg = 18; + static const typographyFontSizeXl = 20; + static const typographyFontSize2xl = 24; + static const typographyFontSizeMicro = 8; + static const typographyLineHeightTight = 16; + static const typographyLineHeightNormal = 20; + static const typographyLineHeightRelaxed = 24; + static final lightElevation0 = [ + const BoxShadow( + color: Color.fromRGBO(0, 0, 0, 0), + ), + ]; + static final lightElevation1 = [ + const BoxShadow( + color: Color.fromRGBO(0, 0, 0, 0.05), + ), + const BoxShadow( + color: Color.fromRGBO(0, 0, 0, 0.1), + blurRadius: 2, + offset: Offset(0, 1), + ), + const BoxShadow( + color: Color.fromRGBO(0, 0, 0, 0.06), + blurRadius: 8, + offset: Offset(0, 4), + ), + ]; + static final lightElevation2 = [ + const BoxShadow( + color: Color.fromRGBO(0, 0, 0, 0.05), + ), + const BoxShadow( + color: Color.fromRGBO(0, 0, 0, 0.12), + blurRadius: 4, + offset: Offset(0, 2), + ), + const BoxShadow( + color: Color.fromRGBO(0, 0, 0, 0.06), + blurRadius: 16, + offset: Offset(0, 6), + ), + ]; + static final lightElevation3 = [ + const BoxShadow( + color: Color.fromRGBO(0, 0, 0, 0.05), + ), + const BoxShadow( + color: Color.fromRGBO(0, 0, 0, 0.14), + blurRadius: 8, + offset: Offset(0, 4), + ), + const BoxShadow( + color: Color.fromRGBO(0, 0, 0, 0.1), + blurRadius: 24, + offset: Offset(0, 12), + ), + ]; + static final lightElevation4 = [ + const BoxShadow( + color: Color.fromRGBO(0, 0, 0, 0.05), + ), + const BoxShadow( + color: Color.fromRGBO(0, 0, 0, 0.16), + blurRadius: 12, + offset: Offset(0, 6), + ), + const BoxShadow( + color: Color.fromRGBO(0, 0, 0, 0.12), + blurRadius: 32, + offset: Offset(0, 20), + ), + ]; + static final darkElevation0 = [ + const BoxShadow( + color: Color.fromRGBO(0, 0, 0, 0), + ), + ]; + static final darkElevation1 = [ + const BoxShadow( + color: Color.fromRGBO(255, 255, 255, 0.15), + ), + const BoxShadow( + color: Color.fromRGBO(0, 0, 0, 0.2), + blurRadius: 2, + offset: Offset(0, 1), + ), + const BoxShadow( + color: Color.fromRGBO(0, 0, 0, 0.1), + blurRadius: 8, + offset: Offset(0, 4), + ), + ]; + static final darkElevation2 = [ + const BoxShadow( + color: Color.fromRGBO(255, 255, 255, 0.15), + ), + const BoxShadow( + color: Color.fromRGBO(0, 0, 0, 0.22), + blurRadius: 4, + offset: Offset(0, 2), + ), + const BoxShadow( + color: Color.fromRGBO(0, 0, 0, 0.12), + blurRadius: 16, + offset: Offset(0, 6), + ), + ]; + static final darkElevation3 = [ + const BoxShadow( + color: Color.fromRGBO(255, 255, 255, 0.15), + ), + const BoxShadow( + color: Color.fromRGBO(0, 0, 0, 0.24), + blurRadius: 8, + offset: Offset(0, 4), + ), + const BoxShadow( + color: Color.fromRGBO(0, 0, 0, 0.14), + blurRadius: 24, + offset: Offset(0, 12), + ), + ]; + static final darkElevation4 = [ + const BoxShadow( + color: Color.fromRGBO(255, 255, 255, 0.15), + ), + const BoxShadow( + color: Color.fromRGBO(0, 0, 0, 0.28), + blurRadius: 12, + offset: Offset(0, 6), + ), + const BoxShadow( + color: Color.fromRGBO(0, 0, 0, 0.16), + blurRadius: 32, + offset: Offset(0, 20), + ), + ]; + static const radiusNone = 0; + static const radiusXxs = 2; + static const radiusXs = 4; + static const radiusSm = 6; + static const radiusMd = 8; + static const radiusLg = 12; + static const radiusXl = 16; + static const radius2xl = 20; + static const radiusMax = 9999; + static const radius3xl = 24; + static const radius4xl = 32; + static const spacingNone = 0; + static const spacingXxs = 4; + static const spacingXs = 8; + static const spacingSm = 12; + static const spacingMd = 16; + static const spacingXl = 24; + static const spacing2xl = 32; + static const spacing3xl = 40; + static const spacingLg = 20; + static const spacingXxxs = 2; + static const deviceRadius = 8; + static const deviceSafeAreaBottom = 0; + static const deviceSafeAreaTop = 0; + static const messageBubbleRadiusGroupTop = 20; + static const messageBubbleRadiusGroupMiddle = 20; + static const messageBubbleRadiusGroupBottom = 20; + static const messageBubbleRadiusTail = 0; + static const messageBubbleRadiusAttachment = 12; + static const messageBubbleRadiusAttachmentInline = 8; + static const composerRadiusFixed = 24; + static const composerRadiusFloating = 24; + static const composerBg = Color(0xFF1C1C1C); + static const buttonRadiusLg = 9999; + static const buttonRadiusMd = 9999; + static const buttonRadiusSm = 9999; + static const buttonRadiusFull = 9999; + static const buttonVisualHeightSm = 32; + static const buttonVisualHeightMd = 40; + static const buttonVisualHeightLg = 48; + static const buttonVisualHeightXs = 24; + static const buttonHitTargetMinHeight = 48; + static const buttonHitTargetMinWidth = 48; + static const buttonPaddingYLg = 14; + static const buttonPaddingYMd = 10; + static const buttonPaddingYSm = 6; + static const buttonPaddingYXs = 4; + static const buttonPaddingXIconOnlyLg = 14; + static const buttonPaddingXIconOnlyMd = 10; + static const buttonPaddingXIconOnlySm = 6; + static const buttonPaddingXIconOnlyXs = 4; + static const buttonPaddingXWithLabelLg = 16; + static const buttonPaddingXWithLabelMd = 16; + static const buttonPaddingXWithLabelSm = 16; + static const buttonPaddingXWithLabelXs = 12; + static const buttonPrimaryBg = Color(0xFF78A8FF); + static const buttonPrimaryTextOnAccent = Color(0xFFFFFFFF); + static const buttonPrimaryText = Color(0xFF78A8FF); + static const buttonPrimaryBgLiquidGlass = Color(0x00FFFFFF); + static const buttonPrimaryBorder = Color(0xFF1B53BD); + static const buttonPrimaryTextOnDark = Color(0xFF1C1C1C); + static const buttonPrimaryBorderOnDark = Color(0xFF1C1C1C); + static const buttonSecondaryText = Color(0xFFFFFFFF); + static const buttonSecondaryBgLiquidGlass = Color(0xFF000000); + static const buttonSecondaryBorder = Color(0xFF565656); + static const buttonSecondaryBg = Color(0xFF464646); + static const buttonSecondaryTextOnAccent = Color(0xFFFFFFFF); + static const buttonSecondaryTextOnDark = Color(0xFF1C1C1C); + static const buttonSecondaryBorderOnDark = Color(0xFF1C1C1C); + static const buttonDestructiveText = Color(0xFFFC526A); + static const buttonDestructiveBg = Color(0xFFFC526A); + static const buttonDestructiveTextOnAccent = Color(0xFFFFFFFF); + static const buttonDestructiveBgLiquidGlass = Color(0xFF000000); + static const buttonDestructiveBorder = Color(0xFFFC526A); + static const buttonDestructiveTextOnDark = Color(0xFF1C1C1C); + static const buttonDestructiveBorderOnDark = Color(0xFF1C1C1C); + static const iconSizeXs = 12; + static const iconSizeSm = 16; + static const iconSizeMd = 20; + static const iconSizeLg = 32; + static const iconStrokeSubtle = 1.2; + static const iconStrokeDefault = 1.5; + static const iconStrokeEmphasis = 2; + static const backgroundCoreHover = Color(0x1AFFFFFF); + static const backgroundCorePressed = Color(0x33FFFFFF); + static const backgroundCoreSelected = Color(0x40FFFFFF); + static const backgroundCoreDisabled = Color(0xFF323232); + static const backgroundCoreApp = Color(0xFF000000); + static const backgroundCoreScrim = Color(0xBF000000); + static const backgroundCoreSurface = Color(0xFF464646); + static const backgroundCoreSurfaceSubtle = Color(0xFF323232); + static const backgroundCoreSurfaceStrong = Color(0xFF565656); + static const backgroundCoreOverlay = Color(0xBF000000); + static const backgroundCoreInverse = Color(0xFFF8F8F8); + static const backgroundCoreOverlayLight = Color(0xBF000000); + static const backgroundCoreOverlayDark = Color(0x80000000); + static const backgroundElevationElevation0 = Color(0xFF000000); + static const backgroundElevationElevation1 = Color(0xFF1C1C1C); + static const backgroundElevationElevation2 = Color(0xFF323232); + static const backgroundElevationElevation3 = Color(0xFF464646); + static const backgroundElevationElevation4 = Color(0xFF565656); + static const borderUtilityFocus = Color(0xFFC3D9FF); + static const borderUtilityError = Color(0xFFFC526A); + static const borderUtilityWarning = Color(0xFFF26D10); + static const borderUtilitySuccess = Color(0xFF00A46E); + static const borderUtilitySelected = Color(0xFF78A8FF); + static const borderUtilityDisabled = Color(0xFF464646); + static const borderCoreDefault = Color(0xFF565656); + static const borderCoreSubtle = Color(0xFF464646); + static const borderCoreStrong = Color(0xFF6A6A6A); + static const borderCoreOnDark = Color(0xFF1C1C1C); + static const borderCoreOnAccent = Color(0xFFFFFFFF); + static const borderCoreOpacity10 = Color(0x33FFFFFF); + static const borderCoreOpacity25 = Color(0x40FFFFFF); + static const borderCoreOnSurface = Color(0xFF6A6A6A); + static const chatBgIncoming = Color(0xFF323232); + static const chatBgOutgoing = Color(0xFF142F63); + static const chatBgAttachmentIncoming = Color(0xFF464646); + static const chatBgAttachmentOutgoing = Color(0xFF19418D); + static const chatBgTypingIndicator = Color(0xFF565656); + static const chatTextTimestamp = Color(0xFFABABAB); + static const chatTextUsername = Color(0xFFEFEFEF); + static const chatTextMention = Color(0xFFFFFFFF); + static const chatTextLink = Color(0xFFFFFFFF); + static const chatTextReaction = Color(0xFFEFEFEF); + static const chatTextSystem = Color(0xFFEFEFEF); + static const chatTextIncoming = Color(0xFFFFFFFF); + static const chatTextOutgoing = Color(0xFFF3F7FF); + static const chatBorderOutgoing = Color(0xFF142F63); + static const chatBorderIncoming = Color(0xFF323232); + static const chatBorderOnChatOutgoing = Color(0xFF005FFF); + static const chatBorderOnChatIncoming = Color(0xFF6A6A6A); + static const chatReplyIndicatorIncoming = Color(0xFF6A6A6A); + static const chatReplyIndicatorOutgoing = Color(0xFFC3D9FF); + static const chatWaveformBar = Color(0x40FFFFFF); + static const chatWaveformBarPlaying = Color(0xFF78A8FF); + static const chatPollProgressTrackIncoming = Color(0xFF565656); + static const chatPollProgressTrackOutgoing = Color(0xFF1B53BD); + static const chatPollProgressFillIncoming = Color(0xFFF8F8F8); + static const chatPollProgressFillOutgoing = Color(0xFFFFFFFF); + static const chatThreadConnectorIncoming = Color(0xFF323232); + static const chatThreadConnectorOutgoing = Color(0xFF142F63); + static const inputBorderDefault = Color(0xFF565656); + static const inputBorderHover = Color(0xFF6A6A6A); + static const inputBorderFocus = Color(0xFF78A8FF); + static const inputTextDefault = Color(0xFFFFFFFF); + static const inputTextPlaceholder = Color(0xFFABABAB); + static const inputTextIcon = Color(0xFFABABAB); + static const inputTextDisabled = Color(0xFF6A6A6A); + static const inputSendIcon = Color(0xFF78A8FF); + static const inputSendIconDisabled = Color(0xFF6A6A6A); + static const reactionBg = Color(0xFF464646); + static const reactionBorder = Color(0xFF6A6A6A); + static const reactionText = Color(0xFFFFFFFF); + static const reactionEmoji = Color(0xFFFFFFFF); + static const presenceBgOnline = Color(0xFF00A46E); + static const presenceBorder = Color(0xFF1C1C1C); + static const presenceBgOffline = Color(0xFF565656); + static const systemText = Color(0xFFFFFFFF); + static const systemBgBlur = Color(0x03000000); + static const systemScrollbar = Color(0x80FFFFFF); + static const systemCaret = Color(0xFFFFFFFF); + static const badgeBgPrimary = Color(0xFF78A8FF); + static const badgeBorder = Color(0xFF1C1C1C); + static const badgeBgError = Color(0xFFFC526A); + static const badgeBgNeutral = Color(0xFF565656); + static const badgeText = Color(0xFFFFFFFF); + static const badgeTextInverse = Color(0xFF1C1C1C); + static const badgeBgDefault = Color(0xFF1C1C1C); + static const badgeBgInverse = Color(0xFFF8F8F8); + static const badgeTextOnAccent = Color(0xFFFFFFFF); + static const badgeBgOverlay = Color(0xBF000000); + static const controlRadiocheckBg = Color(0x00FFFFFF); + static const controlRadiocheckBorder = Color(0xFF565656); + static const controlRadiocheckBgSelected = Color(0xFFFFFFFF); + static const controlRadiocheckIconSelected = Color(0xFF1C1C1C); + static const controlRemoveControlBg = Color(0xFF000000); + static const controlRemoveControlIcon = Color(0xFFFFFFFF); + static const controlRemoveControlBorder = Color(0xFF1C1C1C); + static const controlProgressBarTrack = Color(0xFF565656); + static const controlProgressBarFill = Color(0xFFF8F8F8); + static const controlPlayControlBg = Color(0xFF000000); + static const controlPlayControlIcon = Color(0xFFFFFFFF); + static const controlToggleSwitchBgSelected = Color(0xFF78A8FF); + static const controlToggleSwitchKnob = Color(0xFF565656); + static const controlToggleSwitchBg = Color(0xFF565656); + static const controlToggleSwitchBgDisabled = Color(0xFF323232); + static const controlPlaybackToggleBorder = Color(0xFF565656); + static const controlPlaybackToggleText = Color(0xFFFFFFFF); + static const textPrimary = Color(0xFFFFFFFF); + static const textSecondary = Color(0xFFEFEFEF); + static const textTertiary = Color(0xFFABABAB); + static const textInverse = Color(0xFF000000); + static const textDisabled = Color(0xFF6A6A6A); + static const textLink = Color(0xFFFFFFFF); + static const textOnAccent = Color(0xFFFFFFFF); + static const textOnDark = Color(0xFF1C1C1C); + static const avatarPaletteBg1 = Color(0xFF142F63); + static const avatarPaletteBg2 = Color(0xFF003A3F); + static const avatarPaletteBg3 = Color(0xFF003A25); + static const avatarPaletteBg4 = Color(0xFF2E2576); + static const avatarPaletteBg5 = Color(0xFF5F1A05); + static const avatarPaletteText1 = Color(0xFFE3EDFF); + static const avatarPaletteText2 = Color(0xFFD1F3F6); + static const avatarPaletteText3 = Color(0xFFBDFCDB); + static const avatarPaletteText4 = Color(0xFFECEDFF); + static const avatarPaletteText5 = Color(0xFFFCEDB9); + static const avatarBgDefault = Color(0xFF142F63); + static const avatarBgPlaceholder = Color(0xFF464646); + static const avatarTextDefault = Color(0xFFE3EDFF); + static const avatarTextPlaceholder = Color(0xFF8F8F8F); + static const accentPrimary = Color(0xFF78A8FF); + static const accentSuccess = Color(0xFF00A46E); + static const accentWarning = Color(0xFFF26D10); + static const accentError = Color(0xFFFC526A); + static const accentNeutral = Color(0xFFABABAB); + static const accentBlack = Color(0xFF000000); + static const brand50 = Color(0xFF091A3B); + static const brand100 = Color(0xFF142F63); + static const brand150 = Color(0xFF19418D); + static const brand200 = Color(0xFF1B53BD); + static const brand300 = Color(0xFF005FFF); + static const brand400 = Color(0xFF4586FF); + static const brand500 = Color(0xFF78A8FF); + static const brand600 = Color(0xFFA5C5FF); + static const brand700 = Color(0xFFC3D9FF); + static const brand800 = Color(0xFFE3EDFF); + static const brand900 = Color(0xFFF3F7FF); + static const chipBg = Color(0xFF1B53BD); + static const chipText = Color(0xFFF3F7FF); + static const skeletonGradientDefaultBase = Color(0xFF323232); + static const skeletonGradientDefaultHighlight = Color(0xFF565656); + static const skeletonGradientAccentBase = Color(0xFF19418D); + static const skeletonGradientAccentHighlight = Color(0xFF1B53BD); +} diff --git a/packages/stream_core_flutter/lib/src/theme/primitives/tokens/light/stream_tokens.dart b/packages/stream_core_flutter/lib/src/theme/primitives/tokens/light/stream_tokens.dart new file mode 100644 index 0000000..9f987fe --- /dev/null +++ b/packages/stream_core_flutter/lib/src/theme/primitives/tokens/light/stream_tokens.dart @@ -0,0 +1,595 @@ +import 'package:flutter/widgets.dart'; + +class StreamTokens { + StreamTokens._(); + + static const baseTransparent0 = Color(0x00FFFFFF); + static const baseTransparentBlack5 = Color(0x0D000000); + static const baseTransparentBlack10 = Color(0x1A000000); + static const baseTransparentWhite70 = Color(0xB3FFFFFF); + static const baseTransparentWhite10 = Color(0x1AFFFFFF); + static const baseTransparentWhite20 = Color(0x33FFFFFF); + static const baseTransparentBlack70 = Color(0xB3000000); + static const baseBlack = Color(0xFF000000); + static const baseWhite = Color(0xFFFFFFFF); + static const slate50 = Color(0xFFF6F8FA); + static const slate100 = Color(0xFFEBEEF1); + static const slate150 = Color(0xFFD5DBE1); + static const slate200 = Color(0xFFC0C8D2); + static const slate300 = Color(0xFFA3ACBA); + static const slate400 = Color(0xFF87909F); + static const slate500 = Color(0xFF687385); + static const slate600 = Color(0xFF545969); + static const slate700 = Color(0xFF414552); + static const slate800 = Color(0xFF30313D); + static const slate900 = Color(0xFF1A1B25); + static const neutral50 = Color(0xFFF8F8F8); + static const neutral100 = Color(0xFFEFEFEF); + static const neutral150 = Color(0xFFD8D8D8); + static const neutral200 = Color(0xFFC4C4C4); + static const neutral300 = Color(0xFFABABAB); + static const neutral400 = Color(0xFF8F8F8F); + static const neutral500 = Color(0xFF6A6A6A); + static const neutral600 = Color(0xFF565656); + static const neutral700 = Color(0xFF464646); + static const neutral800 = Color(0xFF323232); + static const neutral900 = Color(0xFF1C1C1C); + static const blue50 = Color(0xFFF3F7FF); + static const blue100 = Color(0xFFE3EDFF); + static const blue150 = Color(0xFFC3D9FF); + static const blue200 = Color(0xFFA5C5FF); + static const blue300 = Color(0xFF78A8FF); + static const blue400 = Color(0xFF4586FF); + static const blue500 = Color(0xFF005FFF); + static const blue600 = Color(0xFF1B53BD); + static const blue700 = Color(0xFF19418D); + static const blue800 = Color(0xFF142F63); + static const blue900 = Color(0xFF091A3B); + static const cyan50 = Color(0xFFF1FBFC); + static const cyan100 = Color(0xFFD1F3F6); + static const cyan150 = Color(0xFFA9E4EA); + static const cyan200 = Color(0xFF72D7E0); + static const cyan300 = Color(0xFF45BCC7); + static const cyan400 = Color(0xFF1E9EA9); + static const cyan500 = Color(0xFF248088); + static const cyan600 = Color(0xFF006970); + static const cyan700 = Color(0xFF065056); + static const cyan800 = Color(0xFF003A3F); + static const cyan900 = Color(0xFF002124); + static const green50 = Color(0xFFE1FFEE); + static const green100 = Color(0xFFBDFCDB); + static const green150 = Color(0xFF8FEBBD); + static const green200 = Color(0xFF59DEA3); + static const green300 = Color(0xFF00C384); + static const green400 = Color(0xFF00A46E); + static const green500 = Color(0xFF277E59); + static const green600 = Color(0xFF006643); + static const green700 = Color(0xFF004F33); + static const green800 = Color(0xFF003A25); + static const green900 = Color(0xFF002213); + static const purple50 = Color(0xFFF7F8FF); + static const purple100 = Color(0xFFECEDFF); + static const purple150 = Color(0xFFD4D7FF); + static const purple200 = Color(0xFFC1C5FF); + static const purple300 = Color(0xFFA1A3FF); + static const purple400 = Color(0xFF8482FC); + static const purple500 = Color(0xFF644AF9); + static const purple600 = Color(0xFF553BD8); + static const purple700 = Color(0xFF4032A1); + static const purple800 = Color(0xFF2E2576); + static const purple900 = Color(0xFF1A114D); + static const yellow50 = Color(0xFFFEF9DA); + static const yellow100 = Color(0xFFFCEDB9); + static const yellow150 = Color(0xFFFCD579); + static const yellow200 = Color(0xFFF6BF57); + static const yellow300 = Color(0xFFFA922B); + static const yellow400 = Color(0xFFF26D10); + static const yellow500 = Color(0xFFC84801); + static const yellow600 = Color(0xFFA82C00); + static const yellow700 = Color(0xFF842106); + static const yellow800 = Color(0xFF5F1A05); + static const yellow900 = Color(0xFF331302); + static const red50 = Color(0xFFFFF5FA); + static const red100 = Color(0xFFFFE7F2); + static const red150 = Color(0xFFFFCCDF); + static const red200 = Color(0xFFFFB1CD); + static const red300 = Color(0xFFFE87A1); + static const red400 = Color(0xFFFC526A); + static const red500 = Color(0xFFD90D10); + static const red600 = Color(0xFFB3093C); + static const red700 = Color(0xFF890D37); + static const red800 = Color(0xFF68052B); + static const red900 = Color(0xFF3E021A); + static const violet50 = Color(0xFFFEF4FF); + static const violet100 = Color(0xFFFBE8FE); + static const violet150 = Color(0xFFF7CFFC); + static const violet200 = Color(0xFFEEB5F4); + static const violet300 = Color(0xFFE68BEC); + static const violet400 = Color(0xFFD75FE7); + static const violet500 = Color(0xFFB716CA); + static const violet600 = Color(0xFF9D00AE); + static const violet700 = Color(0xFF7C0089); + static const violet800 = Color(0xFF5C0066); + static const violet900 = Color(0xFF36003D); + static const lime50 = Color(0xFFF1FDE8); + static const lime100 = Color(0xFFD4FFB0); + static const lime150 = Color(0xFFB1EE79); + static const lime200 = Color(0xFF9CDA5D); + static const lime300 = Color(0xFF78C100); + static const lime400 = Color(0xFF639E11); + static const lime500 = Color(0xFF4B7A0A); + static const lime600 = Color(0xFF3E6213); + static const lime700 = Color(0xFF355315); + static const lime800 = Color(0xFF203A00); + static const lime900 = Color(0xFF112100); + static const size2 = 2; + static const size4 = 4; + static const size6 = 6; + static const size8 = 8; + static const size12 = 12; + static const size16 = 16; + static const size20 = 20; + static const size24 = 24; + static const size32 = 32; + static const size40 = 40; + static const size48 = 48; + static const size64 = 64; + static const size28 = 28; + static const size80 = 80; + static const size128 = 128; + static const size240 = 240; + static const size320 = 320; + static const size480 = 480; + static const size560 = 560; + static const size640 = 640; + static const radius0 = 0; + static const radius2 = 2; + static const radius4 = 4; + static const radius6 = 6; + static const radius8 = 8; + static const radius12 = 12; + static const radius16 = 16; + static const radius20 = 20; + static const radius24 = 24; + static const radius32 = 32; + static const radiusFull = 9999; + static const space0 = 0; + static const space2 = 2; + static const space4 = 4; + static const space8 = 8; + static const space12 = 12; + static const space16 = 16; + static const space20 = 20; + static const space24 = 24; + static const space32 = 32; + static const space40 = 40; + static const space48 = 48; + static const space64 = 64; + static const space80 = 80; + static const w100 = 1; + static const w150 = 1.5; + static const w200 = 2; + static const w300 = 3; + static const w400 = 4; + static const w120 = 1.2; + static const fontFamilyGeist = 'Geist'; + static const fontFamilyGeistMono = 'Geist Mono'; + static const fontFamilySfPro = 'SF Pro'; + static const fontFamilySfMono = 'SF Mono'; + static const fontFamilyRoboto = 'Roboto'; + static const fontFamilyRobotoMono = 'Roboto Mono'; + static const fontWeightW400 = 400; + static const fontWeightW500 = 500; + static const fontWeightW600 = 600; + static const fontWeightW700 = 700; + static const fontSizeSize10 = 10; + static const fontSizeSize12 = 12; + static const fontSizeSize14 = 14; + static const fontSizeSize16 = 16; + static const fontSizeSize15 = 15; + static const fontSizeSize17 = 17; + static const fontSizeSize18 = 18; + static const fontSizeSize20 = 20; + static const fontSizeSize24 = 24; + static const fontSizeSize28 = 28; + static const fontSizeSize32 = 32; + static const fontSizeSize40 = 40; + static const fontSizeSize48 = 48; + static const fontSizeSize13 = 13; + static const fontSizeSize8 = 8; + static const lineHeightLineHeight8 = 8; + static const lineHeightLineHeight10 = 10; + static const lineHeightLineHeight12 = 12; + static const lineHeightLineHeight14 = 14; + static const lineHeightLineHeight15 = 15; + static const lineHeightLineHeight16 = 16; + static const lineHeightLineHeight17 = 17; + static const lineHeightLineHeight18 = 18; + static const lineHeightLineHeight20 = 20; + static const lineHeightLineHeight24 = 24; + static const lineHeightLineHeight28 = 28; + static const lineHeightLineHeight32 = 32; + static const lineHeightLineHeight40 = 40; + static const lineHeightLineHeight48 = 48; + static const typographyFontFamilySans = 'Geist'; + static const typographyFontFamilyMono = 'Geist Mono'; + static const typographyFontWeightRegular = 400; + static const typographyFontWeightMedium = 500; + static const typographyFontWeightSemiBold = 600; + static const typographyFontWeightBold = 700; + static const typographyFontSizeXxs = 10; + static const typographyFontSizeXs = 12; + static const typographyFontSizeSm = 14; + static const typographyFontSizeMd = 16; + static const typographyFontSizeLg = 18; + static const typographyFontSizeXl = 20; + static const typographyFontSize2xl = 24; + static const typographyFontSizeMicro = 8; + static const typographyLineHeightTight = 16; + static const typographyLineHeightNormal = 20; + static const typographyLineHeightRelaxed = 24; + static final lightElevation0 = [ + const BoxShadow( + color: Color.fromRGBO(0, 0, 0, 0), + ), + ]; + static final lightElevation1 = [ + const BoxShadow( + color: Color.fromRGBO(0, 0, 0, 0.05), + ), + const BoxShadow( + color: Color.fromRGBO(0, 0, 0, 0.1), + blurRadius: 2, + offset: Offset(0, 1), + ), + const BoxShadow( + color: Color.fromRGBO(0, 0, 0, 0.06), + blurRadius: 8, + offset: Offset(0, 4), + ), + ]; + static final lightElevation2 = [ + const BoxShadow( + color: Color.fromRGBO(0, 0, 0, 0.05), + ), + const BoxShadow( + color: Color.fromRGBO(0, 0, 0, 0.12), + blurRadius: 4, + offset: Offset(0, 2), + ), + const BoxShadow( + color: Color.fromRGBO(0, 0, 0, 0.06), + blurRadius: 16, + offset: Offset(0, 6), + ), + ]; + static final lightElevation3 = [ + const BoxShadow( + color: Color.fromRGBO(0, 0, 0, 0.05), + ), + const BoxShadow( + color: Color.fromRGBO(0, 0, 0, 0.14), + blurRadius: 8, + offset: Offset(0, 4), + ), + const BoxShadow( + color: Color.fromRGBO(0, 0, 0, 0.1), + blurRadius: 24, + offset: Offset(0, 12), + ), + ]; + static final lightElevation4 = [ + const BoxShadow( + color: Color.fromRGBO(0, 0, 0, 0.05), + ), + const BoxShadow( + color: Color.fromRGBO(0, 0, 0, 0.16), + blurRadius: 12, + offset: Offset(0, 6), + ), + const BoxShadow( + color: Color.fromRGBO(0, 0, 0, 0.12), + blurRadius: 32, + offset: Offset(0, 20), + ), + ]; + static final darkElevation0 = [ + const BoxShadow( + color: Color.fromRGBO(0, 0, 0, 0), + ), + ]; + static final darkElevation1 = [ + const BoxShadow( + color: Color.fromRGBO(255, 255, 255, 0.15), + ), + const BoxShadow( + color: Color.fromRGBO(0, 0, 0, 0.2), + blurRadius: 2, + offset: Offset(0, 1), + ), + const BoxShadow( + color: Color.fromRGBO(0, 0, 0, 0.1), + blurRadius: 8, + offset: Offset(0, 4), + ), + ]; + static final darkElevation2 = [ + const BoxShadow( + color: Color.fromRGBO(255, 255, 255, 0.15), + ), + const BoxShadow( + color: Color.fromRGBO(0, 0, 0, 0.22), + blurRadius: 4, + offset: Offset(0, 2), + ), + const BoxShadow( + color: Color.fromRGBO(0, 0, 0, 0.12), + blurRadius: 16, + offset: Offset(0, 6), + ), + ]; + static final darkElevation3 = [ + const BoxShadow( + color: Color.fromRGBO(255, 255, 255, 0.15), + ), + const BoxShadow( + color: Color.fromRGBO(0, 0, 0, 0.24), + blurRadius: 8, + offset: Offset(0, 4), + ), + const BoxShadow( + color: Color.fromRGBO(0, 0, 0, 0.14), + blurRadius: 24, + offset: Offset(0, 12), + ), + ]; + static final darkElevation4 = [ + const BoxShadow( + color: Color.fromRGBO(255, 255, 255, 0.15), + ), + const BoxShadow( + color: Color.fromRGBO(0, 0, 0, 0.28), + blurRadius: 12, + offset: Offset(0, 6), + ), + const BoxShadow( + color: Color.fromRGBO(0, 0, 0, 0.16), + blurRadius: 32, + offset: Offset(0, 20), + ), + ]; + static const radiusNone = 0; + static const radiusXxs = 2; + static const radiusXs = 4; + static const radiusSm = 6; + static const radiusMd = 8; + static const radiusLg = 12; + static const radiusXl = 16; + static const radius2xl = 20; + static const radiusMax = 9999; + static const radius3xl = 24; + static const radius4xl = 32; + static const spacingNone = 0; + static const spacingXxs = 4; + static const spacingXs = 8; + static const spacingSm = 12; + static const spacingMd = 16; + static const spacingXl = 24; + static const spacing2xl = 32; + static const spacing3xl = 40; + static const spacingLg = 20; + static const spacingXxxs = 2; + static const deviceRadius = 8; + static const deviceSafeAreaBottom = 0; + static const deviceSafeAreaTop = 0; + static const messageBubbleRadiusGroupTop = 20; + static const messageBubbleRadiusGroupMiddle = 20; + static const messageBubbleRadiusGroupBottom = 20; + static const messageBubbleRadiusTail = 0; + static const messageBubbleRadiusAttachment = 12; + static const messageBubbleRadiusAttachmentInline = 8; + static const composerRadiusFixed = 24; + static const composerRadiusFloating = 24; + static const composerBg = Color(0xFFFFFFFF); + static const buttonRadiusLg = 9999; + static const buttonRadiusMd = 9999; + static const buttonRadiusSm = 9999; + static const buttonRadiusFull = 9999; + static const buttonVisualHeightSm = 32; + static const buttonVisualHeightMd = 40; + static const buttonVisualHeightLg = 48; + static const buttonVisualHeightXs = 24; + static const buttonHitTargetMinHeight = 48; + static const buttonHitTargetMinWidth = 48; + static const buttonPaddingYLg = 14; + static const buttonPaddingYMd = 10; + static const buttonPaddingYSm = 6; + static const buttonPaddingYXs = 4; + static const buttonPaddingXIconOnlyLg = 14; + static const buttonPaddingXIconOnlyMd = 10; + static const buttonPaddingXIconOnlySm = 6; + static const buttonPaddingXIconOnlyXs = 4; + static const buttonPaddingXWithLabelLg = 16; + static const buttonPaddingXWithLabelMd = 16; + static const buttonPaddingXWithLabelSm = 16; + static const buttonPaddingXWithLabelXs = 12; + static const buttonPrimaryBg = Color(0xFF005FFF); + static const buttonPrimaryTextOnAccent = Color(0xFFFFFFFF); + static const buttonPrimaryText = Color(0xFF005FFF); + static const buttonPrimaryBgLiquidGlass = Color(0x00FFFFFF); + static const buttonPrimaryBorder = Color(0xFFA5C5FF); + static const buttonPrimaryTextOnDark = Color(0xFFFFFFFF); + static const buttonPrimaryBorderOnDark = Color(0xFFFFFFFF); + static const buttonSecondaryText = Color(0xFF1A1B25); + static const buttonSecondaryBgLiquidGlass = Color(0xFFFFFFFF); + static const buttonSecondaryBorder = Color(0xFFD5DBE1); + static const buttonSecondaryBg = Color(0xFFEBEEF1); + static const buttonSecondaryTextOnAccent = Color(0xFF1A1B25); + static const buttonSecondaryTextOnDark = Color(0xFFFFFFFF); + static const buttonSecondaryBorderOnDark = Color(0xFFFFFFFF); + static const buttonDestructiveText = Color(0xFFD90D10); + static const buttonDestructiveBg = Color(0xFFD90D10); + static const buttonDestructiveTextOnAccent = Color(0xFFFFFFFF); + static const buttonDestructiveBgLiquidGlass = Color(0xFFFFFFFF); + static const buttonDestructiveBorder = Color(0xFFD90D10); + static const buttonDestructiveTextOnDark = Color(0xFFFFFFFF); + static const buttonDestructiveBorderOnDark = Color(0xFFFFFFFF); + static const iconSizeXs = 12; + static const iconSizeSm = 16; + static const iconSizeMd = 20; + static const iconSizeLg = 32; + static const iconStrokeSubtle = 1.2; + static const iconStrokeDefault = 1.5; + static const iconStrokeEmphasis = 2; + static const backgroundCoreHover = Color(0x0D1E252B); + static const backgroundCorePressed = Color(0x1A1E252B); + static const backgroundCoreSelected = Color(0x261E252B); + static const backgroundCoreDisabled = Color(0xFFEBEEF1); + static const backgroundCoreApp = Color(0xFFFFFFFF); + static const backgroundCoreScrim = Color(0x40000000); + static const backgroundCoreSurface = Color(0xFFEBEEF1); + static const backgroundCoreSurfaceSubtle = Color(0xFFF6F8FA); + static const backgroundCoreSurfaceStrong = Color(0xFFC0C8D2); + static const backgroundCoreOverlay = Color(0xBFFFFFFF); + static const backgroundCoreInverse = Color(0xFF1A1B25); + static const backgroundCoreOverlayLight = Color(0xBFFFFFFF); + static const backgroundCoreOverlayDark = Color(0x40000000); + static const backgroundElevationElevation0 = Color(0xFFFFFFFF); + static const backgroundElevationElevation1 = Color(0xFFFFFFFF); + static const backgroundElevationElevation2 = Color(0xFFFFFFFF); + static const backgroundElevationElevation3 = Color(0xFFFFFFFF); + static const backgroundElevationElevation4 = Color(0xFFFFFFFF); + static const borderUtilityFocus = Color(0xFF78A8FF); + static const borderUtilityError = Color(0xFFD90D10); + static const borderUtilityWarning = Color(0xFFC84801); + static const borderUtilitySuccess = Color(0xFF277E59); + static const borderUtilitySelected = Color(0xFF005FFF); + static const borderUtilityDisabled = Color(0xFFEBEEF1); + static const borderCoreDefault = Color(0xFFD5DBE1); + static const borderCoreSubtle = Color(0xFFEBEEF1); + static const borderCoreStrong = Color(0xFFC0C8D2); + static const borderCoreOnDark = Color(0xFFFFFFFF); + static const borderCoreOnAccent = Color(0xFFFFFFFF); + static const borderCoreOpacity10 = Color(0x1A000000); + static const borderCoreOpacity25 = Color(0x40000000); + static const borderCoreOnSurface = Color(0xFFC0C8D2); + static const chatBgIncoming = Color(0xFFEBEEF1); + static const chatBgOutgoing = Color(0xFFE3EDFF); + static const chatBgAttachmentIncoming = Color(0xFFD5DBE1); + static const chatBgAttachmentOutgoing = Color(0xFFC3D9FF); + static const chatBgTypingIndicator = Color(0xFF687385); + static const chatTextTimestamp = Color(0xFF687385); + static const chatTextUsername = Color(0xFF414552); + static const chatTextMention = Color(0xFF005FFF); + static const chatTextLink = Color(0xFF005FFF); + static const chatTextReaction = Color(0xFF414552); + static const chatTextSystem = Color(0xFF414552); + static const chatTextIncoming = Color(0xFF1A1B25); + static const chatTextOutgoing = Color(0xFF091A3B); + static const chatBorderOutgoing = Color(0xFFE3EDFF); + static const chatBorderIncoming = Color(0xFFEBEEF1); + static const chatBorderOnChatOutgoing = Color(0xFF78A8FF); + static const chatBorderOnChatIncoming = Color(0xFFA3ACBA); + static const chatReplyIndicatorIncoming = Color(0xFF87909F); + static const chatReplyIndicatorOutgoing = Color(0xFF4586FF); + static const chatWaveformBar = Color(0x40000000); + static const chatWaveformBarPlaying = Color(0xFF005FFF); + static const chatPollProgressTrackIncoming = Color(0xFFC0C8D2); + static const chatPollProgressTrackOutgoing = Color(0xFFA5C5FF); + static const chatPollProgressFillIncoming = Color(0xFF687385); + static const chatPollProgressFillOutgoing = Color(0xFF005FFF); + static const chatThreadConnectorIncoming = Color(0xFFC0C8D2); + static const chatThreadConnectorOutgoing = Color(0xFFC3D9FF); + static const inputBorderDefault = Color(0xFFD5DBE1); + static const inputBorderHover = Color(0xFFC0C8D2); + static const inputBorderFocus = Color(0xFF005FFF); + static const inputTextDefault = Color(0xFF1A1B25); + static const inputTextPlaceholder = Color(0xFF687385); + static const inputTextIcon = Color(0xFF687385); + static const inputTextDisabled = Color(0xFFA3ACBA); + static const inputSendIcon = Color(0xFF005FFF); + static const inputSendIconDisabled = Color(0xFFA3ACBA); + static const reactionBg = Color(0xFFFFFFFF); + static const reactionBorder = Color(0xFFEBEEF1); + static const reactionText = Color(0xFF1A1B25); + static const reactionEmoji = Color(0xFF1A1B25); + static const presenceBgOnline = Color(0xFF277E59); + static const presenceBorder = Color(0xFFFFFFFF); + static const presenceBgOffline = Color(0xFF687385); + static const systemText = Color(0xFF000000); + static const systemBgBlur = Color(0x03FFFFFF); + static const systemScrollbar = Color(0x80000000); + static const systemCaret = Color(0xFF005FFF); + static const badgeBgPrimary = Color(0xFF005FFF); + static const badgeBorder = Color(0xFFFFFFFF); + static const badgeBgError = Color(0xFFD90D10); + static const badgeBgNeutral = Color(0xFF687385); + static const badgeText = Color(0xFF1A1B25); + static const badgeTextInverse = Color(0xFFFFFFFF); + static const badgeBgDefault = Color(0xFFFFFFFF); + static const badgeBgInverse = Color(0xFF1A1B25); + static const badgeTextOnAccent = Color(0xFFFFFFFF); + static const badgeBgOverlay = Color(0xBF000000); + static const controlRadiocheckBg = Color(0x00FFFFFF); + static const controlRadiocheckBorder = Color(0xFFD5DBE1); + static const controlRadiocheckBgSelected = Color(0xFF005FFF); + static const controlRadiocheckIconSelected = Color(0xFFFFFFFF); + static const controlRemoveControlBg = Color(0xFF000000); + static const controlRemoveControlIcon = Color(0xFFFFFFFF); + static const controlRemoveControlBorder = Color(0xFFFFFFFF); + static const controlProgressBarTrack = Color(0xFFC0C8D2); + static const controlProgressBarFill = Color(0xFF687385); + static const controlPlayControlBg = Color(0xFF000000); + static const controlPlayControlIcon = Color(0xFFFFFFFF); + static const controlToggleSwitchBgSelected = Color(0xFF005FFF); + static const controlToggleSwitchKnob = Color(0xFFFFFFFF); + static const controlToggleSwitchBg = Color(0xFFD5DBE1); + static const controlToggleSwitchBgDisabled = Color(0xFFEBEEF1); + static const controlPlaybackToggleBorder = Color(0xFFD5DBE1); + static const controlPlaybackToggleText = Color(0xFF1A1B25); + static const textPrimary = Color(0xFF1A1B25); + static const textSecondary = Color(0xFF414552); + static const textTertiary = Color(0xFF687385); + static const textInverse = Color(0xFFFFFFFF); + static const textDisabled = Color(0xFFA3ACBA); + static const textLink = Color(0xFF005FFF); + static const textOnAccent = Color(0xFFFFFFFF); + static const textOnDark = Color(0xFFFFFFFF); + static const avatarPaletteBg1 = Color(0xFFE3EDFF); + static const avatarPaletteBg2 = Color(0xFFD1F3F6); + static const avatarPaletteBg3 = Color(0xFFBDFCDB); + static const avatarPaletteBg4 = Color(0xFFECEDFF); + static const avatarPaletteBg5 = Color(0xFFFCEDB9); + static const avatarPaletteText1 = Color(0xFF142F63); + static const avatarPaletteText2 = Color(0xFF003A3F); + static const avatarPaletteText3 = Color(0xFF003A25); + static const avatarPaletteText4 = Color(0xFF2E2576); + static const avatarPaletteText5 = Color(0xFF5F1A05); + static const avatarBgDefault = Color(0xFFE3EDFF); + static const avatarBgPlaceholder = Color(0xFFEBEEF1); + static const avatarTextDefault = Color(0xFF142F63); + static const avatarTextPlaceholder = Color(0xFF687385); + static const accentPrimary = Color(0xFF005FFF); + static const accentSuccess = Color(0xFF277E59); + static const accentWarning = Color(0xFFC84801); + static const accentError = Color(0xFFD90D10); + static const accentNeutral = Color(0xFF687385); + static const accentBlack = Color(0xFF000000); + static const brand50 = Color(0xFFF3F7FF); + static const brand100 = Color(0xFFE3EDFF); + static const brand150 = Color(0xFFC3D9FF); + static const brand200 = Color(0xFFA5C5FF); + static const brand300 = Color(0xFF78A8FF); + static const brand400 = Color(0xFF4586FF); + static const brand500 = Color(0xFF005FFF); + static const brand600 = Color(0xFF1B53BD); + static const brand700 = Color(0xFF19418D); + static const brand800 = Color(0xFF142F63); + static const brand900 = Color(0xFF091A3B); + static const chipBg = Color(0xFFE3EDFF); + static const chipText = Color(0xFF091A3B); + static const skeletonGradientDefaultBase = Color(0xFFF6F8FA); + static const skeletonGradientDefaultHighlight = Color(0xFFFFFFFF); + static const skeletonGradientAccentBase = Color(0xFFF3F7FF); + static const skeletonGradientAccentHighlight = Color(0xFFFFFFFF); +} diff --git a/packages/stream_core_flutter/lib/src/theme/primitives/tokens/stream_tokens_typography.dart b/packages/stream_core_flutter/lib/src/theme/primitives/tokens/stream_tokens_typography.dart new file mode 100644 index 0000000..ce24527 --- /dev/null +++ b/packages/stream_core_flutter/lib/src/theme/primitives/tokens/stream_tokens_typography.dart @@ -0,0 +1,126 @@ +import 'package:flutter/widgets.dart'; + +class StreamTokensTypography { + StreamTokensTypography._(); + + static const headingLg = TextStyle( + fontFamily: 'Geist', + fontSize: 20, + fontWeight: FontWeight.w600, + height: 1.2, + ); + static const headingMd = TextStyle( + fontFamily: 'Geist', + fontSize: 18, + fontWeight: FontWeight.w600, + height: 1.1111111111111112, + ); + static const headingSm = TextStyle( + fontFamily: 'Geist', + fontSize: 16, + fontWeight: FontWeight.w600, + height: 1, + ); + static const headingXs = TextStyle( + fontFamily: 'Geist', + fontSize: 12, + fontWeight: FontWeight.w600, + height: 1.3333333333333333, + ); + static const bodyDefault = TextStyle( + fontFamily: 'Geist', + fontSize: 16, + fontWeight: FontWeight.w400, + height: 1.25, + ); + static const bodyEmphasis = TextStyle( + fontFamily: 'Geist', + fontSize: 16, + fontWeight: FontWeight.w600, + height: 1.25, + ); + static const bodyLink = TextStyle( + fontFamily: 'Geist', + fontSize: 16, + fontWeight: FontWeight.w400, + height: 1.25, + ); + static const bodyLinkEmphasis = TextStyle( + fontFamily: 'Geist', + fontSize: 16, + fontWeight: FontWeight.w600, + height: 1.25, + ); + static const captionDefault = TextStyle( + fontFamily: 'Geist', + fontSize: 14, + fontWeight: FontWeight.w400, + height: 1.1428571428571428, + ); + static const captionEmphasis = TextStyle( + fontFamily: 'Geist', + fontSize: 14, + fontWeight: FontWeight.w600, + height: 1.1428571428571428, + ); + static const captionLink = TextStyle( + fontFamily: 'Geist', + fontSize: 14, + fontWeight: FontWeight.w400, + height: 1.1428571428571428, + ); + static const captionLinkEmphasis = TextStyle( + fontFamily: 'Geist', + fontSize: 14, + fontWeight: FontWeight.w600, + height: 1.1428571428571428, + ); + static const metadataDefault = TextStyle( + fontFamily: 'Geist', + fontSize: 12, + fontWeight: FontWeight.w400, + height: 1.3333333333333333, + ); + static const metadataEmphasis = TextStyle( + fontFamily: 'Geist', + fontSize: 12, + fontWeight: FontWeight.w600, + height: 1.3333333333333333, + ); + static const metadataLink = TextStyle( + fontFamily: 'Geist', + fontSize: 12, + fontWeight: FontWeight.w400, + height: 1.3333333333333333, + ); + static const metadataLinkEmphasis = TextStyle( + fontFamily: 'Geist', + fontSize: 12, + fontWeight: FontWeight.w600, + height: 1.3333333333333333, + ); + static const numericXl = TextStyle( + fontFamily: 'Geist', + fontSize: 14, + fontWeight: FontWeight.w700, + height: 1, + ); + static const numericLg = TextStyle( + fontFamily: 'Geist', + fontSize: 12, + fontWeight: FontWeight.w700, + height: 1, + ); + static const numericMd = TextStyle( + fontFamily: 'Geist', + fontSize: 10, + fontWeight: FontWeight.w700, + height: 1, + ); + static const numericSm = TextStyle( + fontFamily: 'Geist', + fontSize: 8, + fontWeight: FontWeight.w700, + height: 1, + ); +} diff --git a/packages/stream_core_flutter/lib/src/theme/semantics/stream_box_shadow.dart b/packages/stream_core_flutter/lib/src/theme/semantics/stream_box_shadow.dart new file mode 100644 index 0000000..a9ede64 --- /dev/null +++ b/packages/stream_core_flutter/lib/src/theme/semantics/stream_box_shadow.dart @@ -0,0 +1,222 @@ +// ignore_for_file: avoid_redundant_argument_values + +import 'package:flutter/foundation.dart'; +import 'package:flutter/painting.dart'; +import 'package:theme_extensions_builder_annotation/theme_extensions_builder_annotation.dart'; + +part 'stream_box_shadow.g.theme.dart'; + +/// Box shadow tokens for the Stream design system. +/// +/// [StreamBoxShadow] provides consistent box shadow values for creating +/// depth and visual hierarchy. Each elevation level represents a different +/// degree of surface separation. +/// +/// - [elevation1]: Low elevation for subtle separation +/// - [elevation2]: Medium-low elevation +/// - [elevation3]: Medium-high elevation +/// - [elevation4]: High elevation for prominent elements +/// +/// For no shadow (elevation 0), simply don't apply any box shadow. +/// +/// {@tool snippet} +/// +/// Create a light theme box shadow and apply to a container: +/// +/// ```dart +/// final boxShadow = StreamBoxShadow.light(); +/// Container( +/// decoration: BoxDecoration( +/// boxShadow: boxShadow.elevation2, +/// ), +/// ); +/// ``` +/// {@end-tool} +@immutable +@ThemeGen(constructor: 'raw') +class StreamBoxShadow with _$StreamBoxShadow { + /// Creates a light theme box shadow configuration. + /// + /// Light theme shadows use lower opacity values for a softer appearance + /// on light backgrounds. + factory StreamBoxShadow.light({ + List? elevation1, + List? elevation2, + List? elevation3, + List? elevation4, + }) { + elevation1 ??= [ + const BoxShadow( + offset: Offset(0, 1), + blurRadius: 2, + spreadRadius: 0, + color: Color.fromRGBO(0, 0, 0, 0.1), + ), + const BoxShadow( + offset: Offset(0, 4), + blurRadius: 8, + spreadRadius: 0, + color: Color.fromRGBO(0, 0, 0, 0.06), + ), + ]; + elevation2 ??= [ + const BoxShadow( + offset: Offset(0, 2), + blurRadius: 4, + spreadRadius: 0, + color: Color.fromRGBO(0, 0, 0, 0.12), + ), + const BoxShadow( + offset: Offset(0, 6), + blurRadius: 16, + spreadRadius: 0, + color: Color.fromRGBO(0, 0, 0, 0.06), + ), + ]; + elevation3 ??= [ + const BoxShadow( + offset: Offset(0, 4), + blurRadius: 8, + spreadRadius: 0, + color: Color.fromRGBO(0, 0, 0, 0.14), + ), + const BoxShadow( + offset: Offset(0, 12), + blurRadius: 24, + spreadRadius: 0, + color: Color.fromRGBO(0, 0, 0, 0.1), + ), + ]; + elevation4 ??= [ + const BoxShadow( + offset: Offset(0, 6), + blurRadius: 12, + spreadRadius: 0, + color: Color.fromRGBO(0, 0, 0, 0.16), + ), + const BoxShadow( + offset: Offset(0, 20), + blurRadius: 32, + spreadRadius: 0, + color: Color.fromRGBO(0, 0, 0, 0.12), + ), + ]; + + return .raw( + elevation1: elevation1, + elevation2: elevation2, + elevation3: elevation3, + elevation4: elevation4, + ); + } + + /// Creates a dark theme box shadow configuration. + /// + /// Dark theme shadows use higher opacity values for visibility + /// on dark backgrounds. + factory StreamBoxShadow.dark({ + List? elevation1, + List? elevation2, + List? elevation3, + List? elevation4, + }) { + elevation1 ??= [ + const BoxShadow( + offset: Offset(0, 1), + blurRadius: 2, + spreadRadius: 0, + color: Color.fromRGBO(0, 0, 0, 0.2), + ), + const BoxShadow( + offset: Offset(0, 4), + blurRadius: 8, + spreadRadius: 0, + color: Color.fromRGBO(0, 0, 0, 0.1), + ), + ]; + elevation2 ??= [ + const BoxShadow( + offset: Offset(0, 2), + blurRadius: 4, + spreadRadius: 0, + color: Color.fromRGBO(0, 0, 0, 0.22), + ), + const BoxShadow( + offset: Offset(0, 6), + blurRadius: 16, + spreadRadius: 0, + color: Color.fromRGBO(0, 0, 0, 0.12), + ), + ]; + elevation3 ??= [ + const BoxShadow( + offset: Offset(0, 4), + blurRadius: 8, + spreadRadius: 0, + color: Color.fromRGBO(0, 0, 0, 0.24), + ), + const BoxShadow( + offset: Offset(0, 12), + blurRadius: 24, + spreadRadius: 0, + color: Color.fromRGBO(0, 0, 0, 0.14), + ), + ]; + elevation4 ??= [ + const BoxShadow( + offset: Offset(0, 6), + blurRadius: 12, + spreadRadius: 0, + color: Color.fromRGBO(0, 0, 0, 0.28), + ), + const BoxShadow( + offset: Offset(0, 20), + blurRadius: 32, + spreadRadius: 0, + color: Color.fromRGBO(0, 0, 0, 0.16), + ), + ]; + + return .raw( + elevation1: elevation1, + elevation2: elevation2, + elevation3: elevation3, + elevation4: elevation4, + ); + } + + /// Creates a [StreamBoxShadow] with the given values. + const StreamBoxShadow.raw({ + required this.elevation1, + required this.elevation2, + required this.elevation3, + required this.elevation4, + }); + + /// Low elevation level for subtle separation. + /// + /// Used for cards, list items, and subtle surface distinctions. + final List elevation1; + + /// Medium-low elevation level. + /// + /// Used for raised buttons, search bars, and interactive elements. + final List elevation2; + + /// Medium-high elevation level. + /// + /// Used for navigation drawers, bottom sheets, and menus. + final List elevation3; + + /// High elevation level for prominent elements. + /// + /// Used for dialogs, modals, and floating action buttons. + final List elevation4; + + /// Linearly interpolates between two [StreamBoxShadow] instances. + static StreamBoxShadow? lerp( + StreamBoxShadow? a, + StreamBoxShadow? b, + double t, + ) => _$StreamBoxShadow.lerp(a, b, t); +} diff --git a/packages/stream_core_flutter/lib/src/theme/semantics/stream_box_shadow.g.theme.dart b/packages/stream_core_flutter/lib/src/theme/semantics/stream_box_shadow.g.theme.dart new file mode 100644 index 0000000..b3f5a5a --- /dev/null +++ b/packages/stream_core_flutter/lib/src/theme/semantics/stream_box_shadow.g.theme.dart @@ -0,0 +1,106 @@ +// dart format width=80 +// coverage:ignore-file +// GENERATED CODE - DO NOT MODIFY BY HAND +// ignore_for_file: type=lint, unused_element + +part of 'stream_box_shadow.dart'; + +// ************************************************************************** +// ThemeGenGenerator +// ************************************************************************** + +mixin _$StreamBoxShadow { + bool get canMerge => true; + + static StreamBoxShadow? lerp( + StreamBoxShadow? a, + StreamBoxShadow? b, + double t, + ) { + if (identical(a, b)) { + return a; + } + + if (a == null) { + return t == 1.0 ? b : null; + } + + if (b == null) { + return t == 0.0 ? a : null; + } + + return StreamBoxShadow.raw( + elevation1: t < 0.5 ? a.elevation1 : b.elevation1, + elevation2: t < 0.5 ? a.elevation2 : b.elevation2, + elevation3: t < 0.5 ? a.elevation3 : b.elevation3, + elevation4: t < 0.5 ? a.elevation4 : b.elevation4, + ); + } + + StreamBoxShadow copyWith({ + List? elevation1, + List? elevation2, + List? elevation3, + List? elevation4, + }) { + final _this = (this as StreamBoxShadow); + + return StreamBoxShadow.raw( + elevation1: elevation1 ?? _this.elevation1, + elevation2: elevation2 ?? _this.elevation2, + elevation3: elevation3 ?? _this.elevation3, + elevation4: elevation4 ?? _this.elevation4, + ); + } + + StreamBoxShadow merge(StreamBoxShadow? other) { + final _this = (this as StreamBoxShadow); + + if (other == null || identical(_this, other)) { + return _this; + } + + if (!other.canMerge) { + return other; + } + + return copyWith( + elevation1: other.elevation1, + elevation2: other.elevation2, + elevation3: other.elevation3, + elevation4: other.elevation4, + ); + } + + @override + bool operator ==(Object other) { + if (identical(this, other)) { + return true; + } + + if (other.runtimeType != runtimeType) { + return false; + } + + final _this = (this as StreamBoxShadow); + final _other = (other as StreamBoxShadow); + + return _other.elevation1 == _this.elevation1 && + _other.elevation2 == _this.elevation2 && + _other.elevation3 == _this.elevation3 && + _other.elevation4 == _this.elevation4; + } + + @override + int get hashCode { + final _this = (this as StreamBoxShadow); + + return Object.hash( + runtimeType, + _this.elevation1, + _this.elevation2, + _this.elevation3, + _this.elevation4, + ); + } +} diff --git a/packages/stream_core_flutter/lib/src/theme/semantics/stream_color_scheme.dart b/packages/stream_core_flutter/lib/src/theme/semantics/stream_color_scheme.dart new file mode 100644 index 0000000..1cbcbbe --- /dev/null +++ b/packages/stream_core_flutter/lib/src/theme/semantics/stream_color_scheme.dart @@ -0,0 +1,814 @@ +import 'package:flutter/material.dart'; +import 'package:theme_extensions_builder_annotation/theme_extensions_builder_annotation.dart'; + +import '../../theme/primitives/stream_colors.dart'; +import '../primitives/tokens/dark/stream_tokens.dart' as dark_tokens; +import '../primitives/tokens/light/stream_tokens.dart' as light_tokens; + +part 'stream_color_scheme.g.theme.dart'; + +/// A color scheme for the Stream design system. +/// +/// [StreamColorScheme] defines the semantic color palette for the Stream design +/// system, including brand colors, accent colors, text colors, background colors, +/// border colors, and state colors. It supports light and dark themes. +/// +/// {@tool snippet} +/// +/// Create a light color scheme: +/// +/// ```dart +/// final colorScheme = StreamColorScheme.light(); +/// final primary = colorScheme.accentPrimary; +/// final surface = colorScheme.backgroundSurface; +/// ``` +/// {@end-tool} +/// +/// {@tool snippet} +/// +/// Create a dark color scheme with custom brand color: +/// +/// ```dart +/// final colorScheme = StreamColorScheme.dark( +/// brand: StreamBrandColor.dark(), +/// ); +/// ``` +/// {@end-tool} +/// +/// See also: +/// +/// * [StreamBrandColor], which provides brand color shades. +/// * [StreamColors], which defines the primitive color palette. +@immutable +@ThemeGen(constructor: 'raw') +class StreamColorScheme with _$StreamColorScheme { + /// Creates a light color scheme. + factory StreamColorScheme.light({ + // Brand + StreamColorSwatch? brand, + // Accent + Color? accentPrimary, + Color? accentSuccess, + Color? accentWarning, + Color? accentError, + Color? accentNeutral, + Color? accentBlack, + // Text + Color? textPrimary, + Color? textSecondary, + Color? textTertiary, + Color? textDisabled, + Color? textInverse, + Color? textLink, + Color? textOnAccent, + Color? textOnDark, + // Background + Color? backgroundApp, + Color? backgroundSurface, + Color? backgroundSurfaceSubtle, + Color? backgroundSurfaceStrong, + Color? backgroundOverlay, + Color? backgroundOverlayLight, + Color? backgroundOverlayDark, + Color? backgroundDisabled, + Color? backgroundInverse, + + // Background - Elevation + Color? backgroundElevation0, + Color? backgroundElevation1, + Color? backgroundElevation2, + Color? backgroundElevation3, + Color? backgroundElevation4, + // Border - Core + Color? borderDefault, + Color? borderSubtle, + Color? borderStrong, + Color? borderOnDark, + Color? borderOnAccent, + Color? borderOnSurface, + Color? borderOpacity10, + Color? borderOpacity25, + // Border - Utility + Color? borderFocus, + Color? borderDisabled, + Color? borderError, + Color? borderWarning, + Color? borderSuccess, + Color? borderSelected, + // State + Color? stateHover, + Color? statePressed, + Color? stateSelected, + Color? stateFocused, + Color? stateDisabled, + // System + Color? systemText, + Color? systemScrollbar, + // Avatar + List? avatarPalette, + }) { + // Brand + brand ??= StreamBrandColor.light(); + + // Accent + accentPrimary ??= brand.shade500; + accentSuccess ??= light_tokens.StreamTokens.accentSuccess; + accentWarning ??= light_tokens.StreamTokens.accentWarning; + accentError ??= light_tokens.StreamTokens.accentError; + accentNeutral ??= light_tokens.StreamTokens.accentNeutral; + accentBlack ??= light_tokens.StreamTokens.accentBlack; + + // Text + textPrimary ??= light_tokens.StreamTokens.textPrimary; + textSecondary ??= light_tokens.StreamTokens.textSecondary; + textTertiary ??= light_tokens.StreamTokens.textTertiary; + textDisabled ??= light_tokens.StreamTokens.textDisabled; + textInverse ??= light_tokens.StreamTokens.textInverse; + textLink ??= accentPrimary; + textOnAccent ??= light_tokens.StreamTokens.textOnAccent; + textOnDark ??= light_tokens.StreamTokens.textOnDark; + + // Background + + backgroundApp ??= light_tokens.StreamTokens.backgroundCoreApp; + backgroundSurface ??= light_tokens.StreamTokens.backgroundCoreSurface; + backgroundSurfaceSubtle ??= light_tokens.StreamTokens.backgroundCoreSurfaceSubtle; + backgroundSurfaceStrong ??= light_tokens.StreamTokens.backgroundCoreSurfaceStrong; + backgroundOverlay ??= light_tokens.StreamTokens.backgroundCoreOverlay; + backgroundOverlayLight ??= light_tokens.StreamTokens.backgroundCoreOverlayLight; + backgroundOverlayDark ??= light_tokens.StreamTokens.backgroundCoreOverlayDark; + backgroundDisabled ??= light_tokens.StreamTokens.backgroundCoreDisabled; + backgroundInverse ??= light_tokens.StreamTokens.backgroundCoreInverse; + + backgroundElevation0 ??= light_tokens.StreamTokens.backgroundElevationElevation0; + backgroundElevation1 ??= light_tokens.StreamTokens.backgroundElevationElevation1; + backgroundElevation2 ??= light_tokens.StreamTokens.backgroundElevationElevation2; + backgroundElevation3 ??= light_tokens.StreamTokens.backgroundElevationElevation3; + backgroundElevation4 ??= light_tokens.StreamTokens.backgroundElevationElevation4; + + // Border - Core + borderDefault ??= light_tokens.StreamTokens.borderCoreDefault; + borderSubtle ??= light_tokens.StreamTokens.borderCoreSubtle; + borderStrong ??= light_tokens.StreamTokens.borderCoreStrong; + borderOnDark ??= light_tokens.StreamTokens.borderCoreOnDark; + borderOnAccent ??= light_tokens.StreamTokens.borderCoreOnAccent; + borderOnSurface ??= light_tokens.StreamTokens.borderCoreOnSurface; + borderOpacity10 ??= light_tokens.StreamTokens.borderCoreOpacity10; + borderOpacity25 ??= light_tokens.StreamTokens.borderCoreOpacity25; + + // Border - Utility + borderFocus ??= brand.shade300; + borderDisabled ??= light_tokens.StreamTokens.borderUtilityDisabled; + borderError ??= accentError; + borderWarning ??= accentWarning; + borderSuccess ??= accentSuccess; + borderSelected ??= accentPrimary; + + // State + stateHover ??= light_tokens.StreamTokens.backgroundCoreHover; + statePressed ??= light_tokens.StreamTokens.backgroundCorePressed; + stateSelected ??= light_tokens.StreamTokens.backgroundCoreSelected; + stateFocused ??= brand.shade100; + stateDisabled ??= light_tokens.StreamTokens.backgroundCoreDisabled; + + // System + systemText ??= light_tokens.StreamTokens.systemText; + systemScrollbar ??= light_tokens.StreamTokens.systemScrollbar; + + // Avatar + avatarPalette ??= [ + StreamAvatarColorPair( + backgroundColor: StreamColors.blue.shade100, + foregroundColor: StreamColors.blue.shade800, + ), + StreamAvatarColorPair( + backgroundColor: StreamColors.cyan.shade100, + foregroundColor: StreamColors.cyan.shade800, + ), + StreamAvatarColorPair( + backgroundColor: StreamColors.green.shade100, + foregroundColor: StreamColors.green.shade800, + ), + StreamAvatarColorPair( + backgroundColor: StreamColors.purple.shade100, + foregroundColor: StreamColors.purple.shade800, + ), + StreamAvatarColorPair( + backgroundColor: StreamColors.yellow.shade100, + foregroundColor: StreamColors.yellow.shade800, + ), + ]; + + return .raw( + brand: brand, + accentPrimary: accentPrimary, + accentSuccess: accentSuccess, + accentWarning: accentWarning, + accentError: accentError, + accentNeutral: accentNeutral, + accentBlack: accentBlack, + textPrimary: textPrimary, + textSecondary: textSecondary, + textTertiary: textTertiary, + textDisabled: textDisabled, + textInverse: textInverse, + textLink: textLink, + textOnAccent: textOnAccent, + textOnDark: textOnDark, + backgroundApp: backgroundApp, + backgroundSurface: backgroundSurface, + backgroundSurfaceSubtle: backgroundSurfaceSubtle, + backgroundSurfaceStrong: backgroundSurfaceStrong, + backgroundOverlay: backgroundOverlay, + backgroundOverlayLight: backgroundOverlayLight, + backgroundOverlayDark: backgroundOverlayDark, + backgroundDisabled: backgroundDisabled, + backgroundInverse: backgroundInverse, + backgroundElevation0: backgroundElevation0, + backgroundElevation1: backgroundElevation1, + backgroundElevation2: backgroundElevation2, + backgroundElevation3: backgroundElevation3, + backgroundElevation4: backgroundElevation4, + borderDefault: borderDefault, + borderOnDark: borderOnDark, + borderOnAccent: borderOnAccent, + borderOnSurface: borderOnSurface, + borderSubtle: borderSubtle, + borderStrong: borderStrong, + borderOpacity10: borderOpacity10, + borderOpacity25: borderOpacity25, + borderFocus: borderFocus, + borderDisabled: borderDisabled, + borderError: borderError, + borderWarning: borderWarning, + borderSuccess: borderSuccess, + borderSelected: borderSelected, + stateHover: stateHover, + statePressed: statePressed, + stateSelected: stateSelected, + stateFocused: stateFocused, + stateDisabled: stateDisabled, + systemText: systemText, + systemScrollbar: systemScrollbar, + avatarPalette: avatarPalette, + ); + } + + /// Creates a dark color scheme. + factory StreamColorScheme.dark({ + // Brand + StreamColorSwatch? brand, + // Accent + Color? accentPrimary, + Color? accentSuccess, + Color? accentWarning, + Color? accentError, + Color? accentNeutral, + Color? accentBlack, + // Text + Color? textPrimary, + Color? textSecondary, + Color? textTertiary, + Color? textDisabled, + Color? textInverse, + Color? textLink, + Color? textOnAccent, + Color? textOnDark, + // Background + Color? backgroundApp, + Color? backgroundSurface, + Color? backgroundSurfaceSubtle, + Color? backgroundSurfaceStrong, + Color? backgroundOverlay, + Color? backgroundOverlayLight, + Color? backgroundOverlayDark, + Color? backgroundDisabled, + Color? backgroundInverse, + // Background - Elevation + Color? backgroundElevation0, + Color? backgroundElevation1, + Color? backgroundElevation2, + Color? backgroundElevation3, + Color? backgroundElevation4, + // Border - Core + Color? borderDefault, + Color? borderSubtle, + Color? borderStrong, + Color? borderOpacity10, + Color? borderOpacity25, + Color? borderOnDark, + Color? borderOnAccent, + Color? borderOnSurface, + // Border - Utility + Color? borderFocus, + Color? borderDisabled, + Color? borderError, + Color? borderWarning, + Color? borderSuccess, + Color? borderSelected, + // State + Color? stateHover, + Color? statePressed, + Color? stateSelected, + Color? stateFocused, + Color? stateDisabled, + // System + Color? systemText, + Color? systemScrollbar, + // Avatar + List? avatarPalette, + }) { + // Brand + brand ??= StreamBrandColor.dark(); + + // Accent + accentPrimary ??= brand.shade500; + accentSuccess ??= dark_tokens.StreamTokens.accentSuccess; + accentWarning ??= dark_tokens.StreamTokens.accentWarning; + accentError ??= dark_tokens.StreamTokens.accentError; + accentNeutral ??= dark_tokens.StreamTokens.accentNeutral; + accentBlack ??= dark_tokens.StreamTokens.accentBlack; + + // Text + textPrimary ??= dark_tokens.StreamTokens.textPrimary; + textSecondary ??= dark_tokens.StreamTokens.textSecondary; + textTertiary ??= dark_tokens.StreamTokens.textTertiary; + textDisabled ??= dark_tokens.StreamTokens.textDisabled; + textInverse ??= dark_tokens.StreamTokens.textInverse; + textLink ??= accentPrimary; + textOnAccent ??= dark_tokens.StreamTokens.textOnAccent; + textOnDark ??= dark_tokens.StreamTokens.textOnDark; + + // Background + backgroundApp ??= dark_tokens.StreamTokens.backgroundCoreApp; + backgroundSurface ??= dark_tokens.StreamTokens.backgroundCoreSurface; + backgroundSurfaceSubtle ??= dark_tokens.StreamTokens.backgroundCoreSurfaceSubtle; + backgroundSurfaceStrong ??= dark_tokens.StreamTokens.backgroundCoreSurfaceStrong; + backgroundOverlay ??= dark_tokens.StreamTokens.backgroundCoreOverlay; + backgroundOverlayLight ??= dark_tokens.StreamTokens.backgroundCoreOverlayLight; + backgroundOverlayDark ??= dark_tokens.StreamTokens.backgroundCoreOverlayDark; + backgroundDisabled ??= dark_tokens.StreamTokens.backgroundCoreDisabled; + backgroundInverse ??= dark_tokens.StreamTokens.backgroundCoreInverse; + + backgroundElevation0 ??= dark_tokens.StreamTokens.backgroundElevationElevation0; + backgroundElevation1 ??= dark_tokens.StreamTokens.backgroundElevationElevation1; + backgroundElevation2 ??= dark_tokens.StreamTokens.backgroundElevationElevation2; + backgroundElevation3 ??= dark_tokens.StreamTokens.backgroundElevationElevation3; + backgroundElevation4 ??= dark_tokens.StreamTokens.backgroundElevationElevation4; + + // Border - Core + borderDefault ??= dark_tokens.StreamTokens.borderCoreDefault; + borderSubtle ??= dark_tokens.StreamTokens.borderCoreSubtle; + borderStrong ??= dark_tokens.StreamTokens.borderCoreStrong; + borderOpacity10 ??= dark_tokens.StreamTokens.borderCoreOpacity10; + borderOpacity25 ??= dark_tokens.StreamTokens.borderCoreOpacity25; + borderOnDark ??= dark_tokens.StreamTokens.borderCoreOnDark; + borderOnAccent ??= dark_tokens.StreamTokens.borderCoreOnAccent; + borderOnSurface ??= dark_tokens.StreamTokens.borderCoreOnSurface; + + // Border - Utility + borderFocus ??= brand.shade300; + borderDisabled ??= dark_tokens.StreamTokens.borderUtilityDisabled; + borderError ??= accentError; + borderWarning ??= accentWarning; + borderSuccess ??= accentSuccess; + borderSelected ??= accentPrimary; + + // State + stateHover ??= dark_tokens.StreamTokens.backgroundCoreHover; + statePressed ??= dark_tokens.StreamTokens.backgroundCorePressed; + stateSelected ??= dark_tokens.StreamTokens.backgroundCoreSelected; + stateFocused ??= brand.shade100; + stateDisabled ??= dark_tokens.StreamTokens.backgroundCoreDisabled; + + // System + systemText ??= dark_tokens.StreamTokens.systemText; + systemScrollbar ??= dark_tokens.StreamTokens.systemScrollbar; + + // Avatar + avatarPalette ??= [ + StreamAvatarColorPair( + backgroundColor: StreamColors.blue.shade800, + foregroundColor: StreamColors.blue.shade100, + ), + StreamAvatarColorPair( + backgroundColor: StreamColors.cyan.shade800, + foregroundColor: StreamColors.cyan.shade100, + ), + StreamAvatarColorPair( + backgroundColor: StreamColors.green.shade800, + foregroundColor: StreamColors.green.shade100, + ), + StreamAvatarColorPair( + backgroundColor: StreamColors.purple.shade800, + foregroundColor: StreamColors.purple.shade100, + ), + StreamAvatarColorPair( + backgroundColor: StreamColors.yellow.shade800, + foregroundColor: StreamColors.yellow.shade100, + ), + ]; + + return .raw( + brand: brand, + accentPrimary: accentPrimary, + accentSuccess: accentSuccess, + accentWarning: accentWarning, + accentError: accentError, + accentNeutral: accentNeutral, + accentBlack: accentBlack, + textPrimary: textPrimary, + textSecondary: textSecondary, + textTertiary: textTertiary, + textDisabled: textDisabled, + textInverse: textInverse, + textLink: textLink, + textOnAccent: textOnAccent, + textOnDark: textOnDark, + backgroundApp: backgroundApp, + backgroundSurface: backgroundSurface, + backgroundSurfaceSubtle: backgroundSurfaceSubtle, + backgroundSurfaceStrong: backgroundSurfaceStrong, + backgroundOverlay: backgroundOverlay, + backgroundOverlayLight: backgroundOverlayLight, + backgroundOverlayDark: backgroundOverlayDark, + backgroundDisabled: backgroundDisabled, + backgroundInverse: backgroundInverse, + backgroundElevation0: backgroundElevation0, + backgroundElevation1: backgroundElevation1, + backgroundElevation2: backgroundElevation2, + backgroundElevation3: backgroundElevation3, + backgroundElevation4: backgroundElevation4, + borderDefault: borderDefault, + borderStrong: borderStrong, + borderOpacity10: borderOpacity10, + borderOpacity25: borderOpacity25, + borderOnDark: borderOnDark, + borderOnAccent: borderOnAccent, + borderOnSurface: borderOnSurface, + borderSubtle: borderSubtle, + borderFocus: borderFocus, + borderDisabled: borderDisabled, + borderError: borderError, + borderWarning: borderWarning, + borderSuccess: borderSuccess, + borderSelected: borderSelected, + stateHover: stateHover, + statePressed: statePressed, + stateSelected: stateSelected, + stateFocused: stateFocused, + stateDisabled: stateDisabled, + systemText: systemText, + systemScrollbar: systemScrollbar, + avatarPalette: avatarPalette, + ); + } + + const StreamColorScheme.raw({ + required this.brand, + // Accent + required this.accentPrimary, + required this.accentSuccess, + required this.accentWarning, + required this.accentError, + required this.accentNeutral, + required this.accentBlack, + // Text + required this.textPrimary, + required this.textSecondary, + required this.textTertiary, + required this.textDisabled, + required this.textInverse, + required this.textLink, + required this.textOnAccent, + required this.textOnDark, + // Background + required this.backgroundApp, + required this.backgroundSurface, + required this.backgroundSurfaceSubtle, + required this.backgroundSurfaceStrong, + required this.backgroundOverlay, + required this.backgroundOverlayLight, + required this.backgroundOverlayDark, + required this.backgroundDisabled, + required this.backgroundInverse, + // Background - Elevation + required this.backgroundElevation0, + required this.backgroundElevation1, + required this.backgroundElevation2, + required this.backgroundElevation3, + required this.backgroundElevation4, + // Border - Core + required this.borderDefault, + required this.borderSubtle, + required this.borderStrong, + required this.borderOnDark, + required this.borderOnAccent, + required this.borderOnSurface, + required this.borderOpacity10, + required this.borderOpacity25, + // Border - Utility + required this.borderFocus, + required this.borderDisabled, + required this.borderError, + required this.borderWarning, + required this.borderSuccess, + required this.borderSelected, + // State + required this.stateHover, + required this.statePressed, + required this.stateSelected, + required this.stateFocused, + required this.stateDisabled, + // System + required this.systemText, + required this.systemScrollbar, + // Avatar + required this.avatarPalette, + }); + + // ---- Brand ---- + + /// The brand color swatch with shades from 50 to 950. + final StreamColorSwatch brand; + + // ---- Accent colors ---- + + /// The primary accent color. + final Color accentPrimary; + + /// The success accent color. + final Color accentSuccess; + + /// The warning accent color. + final Color accentWarning; + + /// The error accent color. + final Color accentError; + + /// The neutral accent color. + final Color accentNeutral; + + /// The black accent color. + final Color accentBlack; + + // ---- Text colors ---- + + /// The primary text color. + final Color textPrimary; + + /// The secondary text color. + final Color textSecondary; + + /// The tertiary text color. + final Color textTertiary; + + /// The disabled text color. + final Color textDisabled; + + /// The inverse text color. + final Color textInverse; + + /// The link text color. + final Color textLink; + + /// The text color on accent backgrounds. + final Color textOnAccent; + + /// The text color on dark backgrounds. + final Color textOnDark; + + // ---- Background colors ---- + + /// The main app background color. + final Color backgroundApp; + + /// The surface background color. + final Color backgroundSurface; + + /// The subtle surface background color. + final Color backgroundSurfaceSubtle; + + /// The strong surface background color. + final Color backgroundSurfaceStrong; + + /// The overlay background color. + final Color backgroundOverlay; + + /// The light overlay background color. + final Color backgroundOverlayLight; + + /// The dark overlay background color. + final Color backgroundOverlayDark; + + /// Disabled background for inputs, buttons, or chips. + final Color backgroundDisabled; + + /// The inverse background color. + final Color backgroundInverse; + + // ---- Background - Elevation ---- + + /// The elevation 0 background color. + final Color backgroundElevation0; + + /// The elevation 1 background color. + final Color backgroundElevation1; + + /// The elevation 2 background color. + final Color backgroundElevation2; + + /// The elevation 3 background color. + final Color backgroundElevation3; + + /// The elevation 4 background color. + final Color backgroundElevation4; + + // ---- Border colors - Core ---- + + /// Standard surface border + final Color borderDefault; + + /// The subtle surface border color for separators. + final Color borderSubtle; + + /// The strong surface border color. + final Color borderStrong; + + /// The border color on dark backgrounds. + final Color borderOnDark; + + /// The border color on accent backgrounds. + final Color borderOnAccent; + + /// The border color on surface backgrounds. + final Color borderOnSurface; + + /// The 10% opacity border color. + final Color borderOpacity10; + + /// The 25% opacity border color. + final Color borderOpacity25; + + // ---- Border colors - Utility ---- + + /// The focus ring border color. + final Color borderFocus; + + /// The disabled state border color. + final Color borderDisabled; + + /// The error state border color. + final Color borderError; + + /// The warning state border color. + final Color borderWarning; + + /// The success state border color. + final Color borderSuccess; + + /// The selected state border color. + final Color borderSelected; + + // ---- State colors ---- + + /// The hover state overlay color. + final Color stateHover; + + /// The pressed state overlay color. + final Color statePressed; + + /// The selected state overlay color. + final Color stateSelected; + + /// The focused state overlay color. + final Color stateFocused; + + /// The disabled state color. + final Color stateDisabled; + + // ---- System colors ---- + + /// The system text color. + final Color systemText; + + /// The system scrollbar color. + final Color systemScrollbar; + + // ---- Avatar colors ---- + + /// The color palette for generating avatar colors based on user identity. + /// + /// Used by domain widgets like `UserAvatar` to deterministically + /// select colors based on user name or ID. + final List avatarPalette; + + /// Linearly interpolates between this and another [StreamColorScheme]. + StreamColorScheme lerp(StreamColorScheme? other, double t) { + return _$StreamColorScheme.lerp(this, other, t)!; + } +} + +/// The brand color swatch for the Stream design system. +/// +/// [StreamBrandColor] extends [StreamColorSwatch] and provides the primary +/// brand color palette with shades from 50 to 950. The default brand color +/// is blue, but it can be customized to match your brand identity. +/// +/// Note: This class extends [ColorSwatch] and cannot implement [ThemeExtension]. +/// Color interpolation is handled via [Color.lerp] on the primary value. +/// +/// {@tool snippet} +/// +/// Use brand colors from a color scheme: +/// +/// ```dart +/// final colorScheme = StreamColorScheme.light(); +/// final brandColor = colorScheme.brand; // Uses shade500 by default +/// final lightBrand = colorScheme.brand.shade300; +/// ``` +/// {@end-tool} +/// +/// See also: +/// +/// * [StreamColorScheme], which contains the brand color. +/// * [StreamColorSwatch], the base class for color swatches. +@immutable +class StreamBrandColor extends StreamColorSwatch { + const StreamBrandColor._(super.primary, super._swatch); + + /// Creates a light theme brand color swatch. + /// + /// Defaults to blue with shade500 as the primary color. + factory StreamBrandColor.light() { + final primaryColorValue = light_tokens.StreamTokens.brand500.toARGB32(); + return ._( + primaryColorValue, + { + 50: light_tokens.StreamTokens.brand50, + 100: light_tokens.StreamTokens.brand100, + 150: light_tokens.StreamTokens.brand150, + 200: light_tokens.StreamTokens.brand200, + 300: light_tokens.StreamTokens.brand300, + 400: light_tokens.StreamTokens.brand400, + 500: Color(primaryColorValue), + 600: light_tokens.StreamTokens.brand600, + 700: light_tokens.StreamTokens.brand700, + 800: light_tokens.StreamTokens.brand800, + 900: light_tokens.StreamTokens.brand900, + }, + ); + } + + /// Creates a dark theme brand color swatch. + /// + /// Defaults to blue with shade400 as the primary color. The shade values + /// are inverted for dark mode, with lighter shades becoming darker and + /// vice versa. + factory StreamBrandColor.dark() { + final primaryColorValue = dark_tokens.StreamTokens.brand500.toARGB32(); + return ._( + primaryColorValue, + { + 50: dark_tokens.StreamTokens.brand50, + 100: dark_tokens.StreamTokens.brand100, + 150: dark_tokens.StreamTokens.brand150, + 200: dark_tokens.StreamTokens.brand200, + 300: dark_tokens.StreamTokens.brand300, + 400: dark_tokens.StreamTokens.brand400, + 500: Color(primaryColorValue), + 600: dark_tokens.StreamTokens.brand600, + 700: dark_tokens.StreamTokens.brand700, + 800: dark_tokens.StreamTokens.brand800, + 900: dark_tokens.StreamTokens.brand900, + }, + ); + } +} + +/// A background/foreground color pair for avatars. +/// +/// Used for deterministic color selection based on user identity. +/// The palette is part of [StreamColorScheme] to support light/dark themes. +@themeGen +@immutable +class StreamAvatarColorPair with _$StreamAvatarColorPair { + /// Creates an avatar color pair with the given values. + const StreamAvatarColorPair({ + required this.backgroundColor, + required this.foregroundColor, + }); + + /// The background color for the avatar. + final Color backgroundColor; + + /// The foreground color for the avatar initials. + final Color foregroundColor; + + /// Linearly interpolates between two [StreamAvatarColorPair] instances. + static StreamAvatarColorPair? lerp( + StreamAvatarColorPair? a, + StreamAvatarColorPair? b, + double t, + ) => _$StreamAvatarColorPair.lerp(a, b, t); +} diff --git a/packages/stream_core_flutter/lib/src/theme/semantics/stream_color_scheme.g.theme.dart b/packages/stream_core_flutter/lib/src/theme/semantics/stream_color_scheme.g.theme.dart new file mode 100644 index 0000000..262e994 --- /dev/null +++ b/packages/stream_core_flutter/lib/src/theme/semantics/stream_color_scheme.g.theme.dart @@ -0,0 +1,528 @@ +// dart format width=80 +// coverage:ignore-file +// GENERATED CODE - DO NOT MODIFY BY HAND +// ignore_for_file: type=lint, unused_element + +part of 'stream_color_scheme.dart'; + +// ************************************************************************** +// ThemeGenGenerator +// ************************************************************************** + +mixin _$StreamColorScheme { + bool get canMerge => true; + + static StreamColorScheme? lerp( + StreamColorScheme? a, + StreamColorScheme? b, + double t, + ) { + if (identical(a, b)) { + return a; + } + + if (a == null) { + return t == 1.0 ? b : null; + } + + if (b == null) { + return t == 0.0 ? a : null; + } + + return StreamColorScheme.raw( + brand: t < 0.5 ? a.brand : b.brand, + accentPrimary: Color.lerp(a.accentPrimary, b.accentPrimary, t)!, + accentSuccess: Color.lerp(a.accentSuccess, b.accentSuccess, t)!, + accentWarning: Color.lerp(a.accentWarning, b.accentWarning, t)!, + accentError: Color.lerp(a.accentError, b.accentError, t)!, + accentNeutral: Color.lerp(a.accentNeutral, b.accentNeutral, t)!, + accentBlack: Color.lerp(a.accentBlack, b.accentBlack, t)!, + textPrimary: Color.lerp(a.textPrimary, b.textPrimary, t)!, + textSecondary: Color.lerp(a.textSecondary, b.textSecondary, t)!, + textTertiary: Color.lerp(a.textTertiary, b.textTertiary, t)!, + textDisabled: Color.lerp(a.textDisabled, b.textDisabled, t)!, + textInverse: Color.lerp(a.textInverse, b.textInverse, t)!, + textLink: Color.lerp(a.textLink, b.textLink, t)!, + textOnAccent: Color.lerp(a.textOnAccent, b.textOnAccent, t)!, + textOnDark: Color.lerp(a.textOnDark, b.textOnDark, t)!, + backgroundApp: Color.lerp(a.backgroundApp, b.backgroundApp, t)!, + backgroundSurface: Color.lerp( + a.backgroundSurface, + b.backgroundSurface, + t, + )!, + backgroundSurfaceSubtle: Color.lerp( + a.backgroundSurfaceSubtle, + b.backgroundSurfaceSubtle, + t, + )!, + backgroundSurfaceStrong: Color.lerp( + a.backgroundSurfaceStrong, + b.backgroundSurfaceStrong, + t, + )!, + backgroundOverlay: Color.lerp( + a.backgroundOverlay, + b.backgroundOverlay, + t, + )!, + backgroundOverlayLight: Color.lerp( + a.backgroundOverlayLight, + b.backgroundOverlayLight, + t, + )!, + backgroundOverlayDark: Color.lerp( + a.backgroundOverlayDark, + b.backgroundOverlayDark, + t, + )!, + backgroundDisabled: Color.lerp( + a.backgroundDisabled, + b.backgroundDisabled, + t, + )!, + backgroundInverse: Color.lerp( + a.backgroundInverse, + b.backgroundInverse, + t, + )!, + backgroundElevation0: Color.lerp( + a.backgroundElevation0, + b.backgroundElevation0, + t, + )!, + backgroundElevation1: Color.lerp( + a.backgroundElevation1, + b.backgroundElevation1, + t, + )!, + backgroundElevation2: Color.lerp( + a.backgroundElevation2, + b.backgroundElevation2, + t, + )!, + backgroundElevation3: Color.lerp( + a.backgroundElevation3, + b.backgroundElevation3, + t, + )!, + backgroundElevation4: Color.lerp( + a.backgroundElevation4, + b.backgroundElevation4, + t, + )!, + borderDefault: Color.lerp(a.borderDefault, b.borderDefault, t)!, + borderSubtle: Color.lerp(a.borderSubtle, b.borderSubtle, t)!, + borderStrong: Color.lerp(a.borderStrong, b.borderStrong, t)!, + borderOnDark: Color.lerp(a.borderOnDark, b.borderOnDark, t)!, + borderOnAccent: Color.lerp(a.borderOnAccent, b.borderOnAccent, t)!, + borderOnSurface: Color.lerp(a.borderOnSurface, b.borderOnSurface, t)!, + borderOpacity10: Color.lerp(a.borderOpacity10, b.borderOpacity10, t)!, + borderOpacity25: Color.lerp(a.borderOpacity25, b.borderOpacity25, t)!, + borderFocus: Color.lerp(a.borderFocus, b.borderFocus, t)!, + borderDisabled: Color.lerp(a.borderDisabled, b.borderDisabled, t)!, + borderError: Color.lerp(a.borderError, b.borderError, t)!, + borderWarning: Color.lerp(a.borderWarning, b.borderWarning, t)!, + borderSuccess: Color.lerp(a.borderSuccess, b.borderSuccess, t)!, + borderSelected: Color.lerp(a.borderSelected, b.borderSelected, t)!, + stateHover: Color.lerp(a.stateHover, b.stateHover, t)!, + statePressed: Color.lerp(a.statePressed, b.statePressed, t)!, + stateSelected: Color.lerp(a.stateSelected, b.stateSelected, t)!, + stateFocused: Color.lerp(a.stateFocused, b.stateFocused, t)!, + stateDisabled: Color.lerp(a.stateDisabled, b.stateDisabled, t)!, + systemText: Color.lerp(a.systemText, b.systemText, t)!, + systemScrollbar: Color.lerp(a.systemScrollbar, b.systemScrollbar, t)!, + avatarPalette: t < 0.5 ? a.avatarPalette : b.avatarPalette, + ); + } + + StreamColorScheme copyWith({ + StreamColorSwatch? brand, + Color? accentPrimary, + Color? accentSuccess, + Color? accentWarning, + Color? accentError, + Color? accentNeutral, + Color? accentBlack, + Color? textPrimary, + Color? textSecondary, + Color? textTertiary, + Color? textDisabled, + Color? textInverse, + Color? textLink, + Color? textOnAccent, + Color? textOnDark, + Color? backgroundApp, + Color? backgroundSurface, + Color? backgroundSurfaceSubtle, + Color? backgroundSurfaceStrong, + Color? backgroundOverlay, + Color? backgroundOverlayLight, + Color? backgroundOverlayDark, + Color? backgroundDisabled, + Color? backgroundInverse, + Color? backgroundElevation0, + Color? backgroundElevation1, + Color? backgroundElevation2, + Color? backgroundElevation3, + Color? backgroundElevation4, + Color? borderDefault, + Color? borderSubtle, + Color? borderStrong, + Color? borderOnDark, + Color? borderOnAccent, + Color? borderOnSurface, + Color? borderOpacity10, + Color? borderOpacity25, + Color? borderFocus, + Color? borderDisabled, + Color? borderError, + Color? borderWarning, + Color? borderSuccess, + Color? borderSelected, + Color? stateHover, + Color? statePressed, + Color? stateSelected, + Color? stateFocused, + Color? stateDisabled, + Color? systemText, + Color? systemScrollbar, + List? avatarPalette, + }) { + final _this = (this as StreamColorScheme); + + return StreamColorScheme.raw( + brand: brand ?? _this.brand, + accentPrimary: accentPrimary ?? _this.accentPrimary, + accentSuccess: accentSuccess ?? _this.accentSuccess, + accentWarning: accentWarning ?? _this.accentWarning, + accentError: accentError ?? _this.accentError, + accentNeutral: accentNeutral ?? _this.accentNeutral, + accentBlack: accentBlack ?? _this.accentBlack, + textPrimary: textPrimary ?? _this.textPrimary, + textSecondary: textSecondary ?? _this.textSecondary, + textTertiary: textTertiary ?? _this.textTertiary, + textDisabled: textDisabled ?? _this.textDisabled, + textInverse: textInverse ?? _this.textInverse, + textLink: textLink ?? _this.textLink, + textOnAccent: textOnAccent ?? _this.textOnAccent, + textOnDark: textOnDark ?? _this.textOnDark, + backgroundApp: backgroundApp ?? _this.backgroundApp, + backgroundSurface: backgroundSurface ?? _this.backgroundSurface, + backgroundSurfaceSubtle: + backgroundSurfaceSubtle ?? _this.backgroundSurfaceSubtle, + backgroundSurfaceStrong: + backgroundSurfaceStrong ?? _this.backgroundSurfaceStrong, + backgroundOverlay: backgroundOverlay ?? _this.backgroundOverlay, + backgroundOverlayLight: + backgroundOverlayLight ?? _this.backgroundOverlayLight, + backgroundOverlayDark: + backgroundOverlayDark ?? _this.backgroundOverlayDark, + backgroundDisabled: backgroundDisabled ?? _this.backgroundDisabled, + backgroundInverse: backgroundInverse ?? _this.backgroundInverse, + backgroundElevation0: backgroundElevation0 ?? _this.backgroundElevation0, + backgroundElevation1: backgroundElevation1 ?? _this.backgroundElevation1, + backgroundElevation2: backgroundElevation2 ?? _this.backgroundElevation2, + backgroundElevation3: backgroundElevation3 ?? _this.backgroundElevation3, + backgroundElevation4: backgroundElevation4 ?? _this.backgroundElevation4, + borderDefault: borderDefault ?? _this.borderDefault, + borderSubtle: borderSubtle ?? _this.borderSubtle, + borderStrong: borderStrong ?? _this.borderStrong, + borderOnDark: borderOnDark ?? _this.borderOnDark, + borderOnAccent: borderOnAccent ?? _this.borderOnAccent, + borderOnSurface: borderOnSurface ?? _this.borderOnSurface, + borderOpacity10: borderOpacity10 ?? _this.borderOpacity10, + borderOpacity25: borderOpacity25 ?? _this.borderOpacity25, + borderFocus: borderFocus ?? _this.borderFocus, + borderDisabled: borderDisabled ?? _this.borderDisabled, + borderError: borderError ?? _this.borderError, + borderWarning: borderWarning ?? _this.borderWarning, + borderSuccess: borderSuccess ?? _this.borderSuccess, + borderSelected: borderSelected ?? _this.borderSelected, + stateHover: stateHover ?? _this.stateHover, + statePressed: statePressed ?? _this.statePressed, + stateSelected: stateSelected ?? _this.stateSelected, + stateFocused: stateFocused ?? _this.stateFocused, + stateDisabled: stateDisabled ?? _this.stateDisabled, + systemText: systemText ?? _this.systemText, + systemScrollbar: systemScrollbar ?? _this.systemScrollbar, + avatarPalette: avatarPalette ?? _this.avatarPalette, + ); + } + + StreamColorScheme merge(StreamColorScheme? other) { + final _this = (this as StreamColorScheme); + + if (other == null || identical(_this, other)) { + return _this; + } + + if (!other.canMerge) { + return other; + } + + return copyWith( + brand: other.brand, + accentPrimary: other.accentPrimary, + accentSuccess: other.accentSuccess, + accentWarning: other.accentWarning, + accentError: other.accentError, + accentNeutral: other.accentNeutral, + accentBlack: other.accentBlack, + textPrimary: other.textPrimary, + textSecondary: other.textSecondary, + textTertiary: other.textTertiary, + textDisabled: other.textDisabled, + textInverse: other.textInverse, + textLink: other.textLink, + textOnAccent: other.textOnAccent, + textOnDark: other.textOnDark, + backgroundApp: other.backgroundApp, + backgroundSurface: other.backgroundSurface, + backgroundSurfaceSubtle: other.backgroundSurfaceSubtle, + backgroundSurfaceStrong: other.backgroundSurfaceStrong, + backgroundOverlay: other.backgroundOverlay, + backgroundOverlayLight: other.backgroundOverlayLight, + backgroundOverlayDark: other.backgroundOverlayDark, + backgroundDisabled: other.backgroundDisabled, + backgroundInverse: other.backgroundInverse, + backgroundElevation0: other.backgroundElevation0, + backgroundElevation1: other.backgroundElevation1, + backgroundElevation2: other.backgroundElevation2, + backgroundElevation3: other.backgroundElevation3, + backgroundElevation4: other.backgroundElevation4, + borderDefault: other.borderDefault, + borderSubtle: other.borderSubtle, + borderStrong: other.borderStrong, + borderOnDark: other.borderOnDark, + borderOnAccent: other.borderOnAccent, + borderOnSurface: other.borderOnSurface, + borderOpacity10: other.borderOpacity10, + borderOpacity25: other.borderOpacity25, + borderFocus: other.borderFocus, + borderDisabled: other.borderDisabled, + borderError: other.borderError, + borderWarning: other.borderWarning, + borderSuccess: other.borderSuccess, + borderSelected: other.borderSelected, + stateHover: other.stateHover, + statePressed: other.statePressed, + stateSelected: other.stateSelected, + stateFocused: other.stateFocused, + stateDisabled: other.stateDisabled, + systemText: other.systemText, + systemScrollbar: other.systemScrollbar, + avatarPalette: other.avatarPalette, + ); + } + + @override + bool operator ==(Object other) { + if (identical(this, other)) { + return true; + } + + if (other.runtimeType != runtimeType) { + return false; + } + + final _this = (this as StreamColorScheme); + final _other = (other as StreamColorScheme); + + return _other.brand == _this.brand && + _other.accentPrimary == _this.accentPrimary && + _other.accentSuccess == _this.accentSuccess && + _other.accentWarning == _this.accentWarning && + _other.accentError == _this.accentError && + _other.accentNeutral == _this.accentNeutral && + _other.accentBlack == _this.accentBlack && + _other.textPrimary == _this.textPrimary && + _other.textSecondary == _this.textSecondary && + _other.textTertiary == _this.textTertiary && + _other.textDisabled == _this.textDisabled && + _other.textInverse == _this.textInverse && + _other.textLink == _this.textLink && + _other.textOnAccent == _this.textOnAccent && + _other.textOnDark == _this.textOnDark && + _other.backgroundApp == _this.backgroundApp && + _other.backgroundSurface == _this.backgroundSurface && + _other.backgroundSurfaceSubtle == _this.backgroundSurfaceSubtle && + _other.backgroundSurfaceStrong == _this.backgroundSurfaceStrong && + _other.backgroundOverlay == _this.backgroundOverlay && + _other.backgroundOverlayLight == _this.backgroundOverlayLight && + _other.backgroundOverlayDark == _this.backgroundOverlayDark && + _other.backgroundDisabled == _this.backgroundDisabled && + _other.backgroundInverse == _this.backgroundInverse && + _other.backgroundElevation0 == _this.backgroundElevation0 && + _other.backgroundElevation1 == _this.backgroundElevation1 && + _other.backgroundElevation2 == _this.backgroundElevation2 && + _other.backgroundElevation3 == _this.backgroundElevation3 && + _other.backgroundElevation4 == _this.backgroundElevation4 && + _other.borderDefault == _this.borderDefault && + _other.borderSubtle == _this.borderSubtle && + _other.borderStrong == _this.borderStrong && + _other.borderOnDark == _this.borderOnDark && + _other.borderOnAccent == _this.borderOnAccent && + _other.borderOnSurface == _this.borderOnSurface && + _other.borderOpacity10 == _this.borderOpacity10 && + _other.borderOpacity25 == _this.borderOpacity25 && + _other.borderFocus == _this.borderFocus && + _other.borderDisabled == _this.borderDisabled && + _other.borderError == _this.borderError && + _other.borderWarning == _this.borderWarning && + _other.borderSuccess == _this.borderSuccess && + _other.borderSelected == _this.borderSelected && + _other.stateHover == _this.stateHover && + _other.statePressed == _this.statePressed && + _other.stateSelected == _this.stateSelected && + _other.stateFocused == _this.stateFocused && + _other.stateDisabled == _this.stateDisabled && + _other.systemText == _this.systemText && + _other.systemScrollbar == _this.systemScrollbar && + _other.avatarPalette == _this.avatarPalette; + } + + @override + int get hashCode { + final _this = (this as StreamColorScheme); + + return Object.hashAll([ + runtimeType, + _this.brand, + _this.accentPrimary, + _this.accentSuccess, + _this.accentWarning, + _this.accentError, + _this.accentNeutral, + _this.accentBlack, + _this.textPrimary, + _this.textSecondary, + _this.textTertiary, + _this.textDisabled, + _this.textInverse, + _this.textLink, + _this.textOnAccent, + _this.textOnDark, + _this.backgroundApp, + _this.backgroundSurface, + _this.backgroundSurfaceSubtle, + _this.backgroundSurfaceStrong, + _this.backgroundOverlay, + _this.backgroundOverlayLight, + _this.backgroundOverlayDark, + _this.backgroundDisabled, + _this.backgroundInverse, + _this.backgroundElevation0, + _this.backgroundElevation1, + _this.backgroundElevation2, + _this.backgroundElevation3, + _this.backgroundElevation4, + _this.borderDefault, + _this.borderSubtle, + _this.borderStrong, + _this.borderOnDark, + _this.borderOnAccent, + _this.borderOnSurface, + _this.borderOpacity10, + _this.borderOpacity25, + _this.borderFocus, + _this.borderDisabled, + _this.borderError, + _this.borderWarning, + _this.borderSuccess, + _this.borderSelected, + _this.stateHover, + _this.statePressed, + _this.stateSelected, + _this.stateFocused, + _this.stateDisabled, + _this.systemText, + _this.systemScrollbar, + _this.avatarPalette, + ]); + } +} + +mixin _$StreamAvatarColorPair { + bool get canMerge => true; + + static StreamAvatarColorPair? lerp( + StreamAvatarColorPair? a, + StreamAvatarColorPair? b, + double t, + ) { + if (identical(a, b)) { + return a; + } + + if (a == null) { + return t == 1.0 ? b : null; + } + + if (b == null) { + return t == 0.0 ? a : null; + } + + return StreamAvatarColorPair( + backgroundColor: Color.lerp(a.backgroundColor, b.backgroundColor, t)!, + foregroundColor: Color.lerp(a.foregroundColor, b.foregroundColor, t)!, + ); + } + + StreamAvatarColorPair copyWith({ + Color? backgroundColor, + Color? foregroundColor, + }) { + final _this = (this as StreamAvatarColorPair); + + return StreamAvatarColorPair( + backgroundColor: backgroundColor ?? _this.backgroundColor, + foregroundColor: foregroundColor ?? _this.foregroundColor, + ); + } + + StreamAvatarColorPair merge(StreamAvatarColorPair? other) { + final _this = (this as StreamAvatarColorPair); + + if (other == null || identical(_this, other)) { + return _this; + } + + if (!other.canMerge) { + return other; + } + + return copyWith( + backgroundColor: other.backgroundColor, + foregroundColor: other.foregroundColor, + ); + } + + @override + bool operator ==(Object other) { + if (identical(this, other)) { + return true; + } + + if (other.runtimeType != runtimeType) { + return false; + } + + final _this = (this as StreamAvatarColorPair); + final _other = (other as StreamAvatarColorPair); + + return _other.backgroundColor == _this.backgroundColor && + _other.foregroundColor == _this.foregroundColor; + } + + @override + int get hashCode { + final _this = (this as StreamAvatarColorPair); + + return Object.hash( + runtimeType, + _this.backgroundColor, + _this.foregroundColor, + ); + } +} diff --git a/packages/stream_core_flutter/lib/src/theme/semantics/stream_text_theme.dart b/packages/stream_core_flutter/lib/src/theme/semantics/stream_text_theme.dart new file mode 100644 index 0000000..088afbf --- /dev/null +++ b/packages/stream_core_flutter/lib/src/theme/semantics/stream_text_theme.dart @@ -0,0 +1,620 @@ +import 'package:flutter/foundation.dart'; +import 'package:flutter/material.dart'; +import 'package:theme_extensions_builder_annotation/theme_extensions_builder_annotation.dart'; + +import '../primitives/stream_typography.dart'; + +part 'stream_text_theme.g.theme.dart'; + +/// Semantic text theme for the Stream design system. +/// +/// [StreamTextTheme] provides semantic text styles built from [StreamTypography] +/// primitives. It includes styles for headings, body text, captions, metadata, +/// and numeric displays. +/// +/// {@tool snippet} +/// +/// Create a text theme: +/// +/// ```dart +/// final textTheme = StreamTextTheme(); +/// Text('Hello', style: textTheme.headingLg); +/// ``` +/// {@end-tool} +/// +/// See also: +/// +/// * [StreamTypography], which provides the primitive building blocks. +@immutable +@ThemeGen(constructor: 'raw') +class StreamTextTheme with _$StreamTextTheme { + /// Creates a [StreamTextTheme] with platform-specific values. + /// + /// If [platform] is null, uses [defaultTargetPlatform]. + /// Individual text styles can be overridden by providing them directly. + factory StreamTextTheme({ + TargetPlatform? platform, + StreamTypography? typography, + TextStyle? headingLg, + TextStyle? headingMd, + TextStyle? headingSm, + TextStyle? headingXs, + TextStyle? bodyDefault, + TextStyle? bodyEmphasis, + TextStyle? bodyLink, + TextStyle? bodyLinkEmphasis, + TextStyle? captionDefault, + TextStyle? captionEmphasis, + TextStyle? captionLink, + TextStyle? captionLinkEmphasis, + TextStyle? metadataDefault, + TextStyle? metadataEmphasis, + TextStyle? metadataLink, + TextStyle? metadataLinkEmphasis, + TextStyle? numericXl, + TextStyle? numericLg, + TextStyle? numericMd, + TextStyle? numericSm, + }) { + platform ??= defaultTargetPlatform; + typography ??= StreamTypography(platform: platform); + + final fontSize = typography.fontSize; + final lineHeight = typography.lineHeight; + final fontWeight = typography.fontWeight; + + // Heading styles + headingLg ??= TextStyle( + fontSize: fontSize.xl, + fontWeight: fontWeight.semibold, + height: lineHeight.relaxed / fontSize.xl, + fontStyle: FontStyle.normal, + decoration: TextDecoration.none, + ); + headingMd ??= TextStyle( + fontSize: fontSize.lg, + fontWeight: fontWeight.semibold, + height: lineHeight.normal / fontSize.lg, + fontStyle: FontStyle.normal, + decoration: TextDecoration.none, + ); + headingSm ??= TextStyle( + fontSize: fontSize.md, + fontWeight: fontWeight.semibold, + height: lineHeight.tight / fontSize.md, + fontStyle: FontStyle.normal, + decoration: TextDecoration.none, + ); + headingXs ??= TextStyle( + fontSize: fontSize.xs, + fontWeight: fontWeight.semibold, + height: lineHeight.tight / fontSize.xs, + fontStyle: FontStyle.normal, + decoration: TextDecoration.none, + ); + + // Body styles + bodyDefault ??= TextStyle( + fontSize: fontSize.md, + fontWeight: fontWeight.regular, + height: lineHeight.normal / fontSize.md, + fontStyle: FontStyle.normal, + decoration: TextDecoration.none, + ); + bodyEmphasis ??= TextStyle( + fontSize: fontSize.md, + fontWeight: fontWeight.semibold, + height: lineHeight.normal / fontSize.md, + fontStyle: FontStyle.normal, + decoration: TextDecoration.none, + ); + bodyLink ??= TextStyle( + fontSize: fontSize.md, + fontWeight: fontWeight.regular, + height: lineHeight.normal / fontSize.md, + fontStyle: FontStyle.normal, + decoration: TextDecoration.none, + ); + bodyLinkEmphasis ??= TextStyle( + fontSize: fontSize.md, + fontWeight: fontWeight.semibold, + height: lineHeight.normal / fontSize.md, + fontStyle: FontStyle.normal, + decoration: TextDecoration.none, + ); + + // Caption styles + captionDefault ??= TextStyle( + fontSize: fontSize.sm, + fontWeight: fontWeight.regular, + height: lineHeight.tight / fontSize.sm, + fontStyle: FontStyle.normal, + decoration: TextDecoration.none, + ); + captionEmphasis ??= TextStyle( + fontSize: fontSize.sm, + fontWeight: fontWeight.semibold, + height: lineHeight.tight / fontSize.sm, + fontStyle: FontStyle.normal, + decoration: TextDecoration.none, + ); + captionLink ??= TextStyle( + fontSize: fontSize.sm, + fontWeight: fontWeight.regular, + height: lineHeight.tight / fontSize.sm, + fontStyle: FontStyle.normal, + decoration: TextDecoration.none, + ); + captionLinkEmphasis ??= TextStyle( + fontSize: fontSize.sm, + fontWeight: fontWeight.semibold, + height: lineHeight.tight / fontSize.sm, + fontStyle: FontStyle.normal, + decoration: TextDecoration.none, + ); + + // Metadata styles + metadataDefault ??= TextStyle( + fontSize: fontSize.xs, + fontWeight: fontWeight.regular, + height: lineHeight.tight / fontSize.xs, + fontStyle: FontStyle.normal, + decoration: TextDecoration.none, + ); + metadataEmphasis ??= TextStyle( + fontSize: fontSize.xs, + fontWeight: fontWeight.semibold, + height: lineHeight.tight / fontSize.xs, + fontStyle: FontStyle.normal, + decoration: TextDecoration.none, + ); + metadataLink ??= TextStyle( + fontSize: fontSize.xs, + fontWeight: fontWeight.regular, + height: lineHeight.tight / fontSize.xs, + fontStyle: FontStyle.normal, + decoration: TextDecoration.none, + ); + metadataLinkEmphasis ??= TextStyle( + fontSize: fontSize.xs, + fontWeight: fontWeight.semibold, + height: lineHeight.tight / fontSize.xs, + fontStyle: FontStyle.normal, + decoration: TextDecoration.none, + ); + + // Numeric styles + numericXl ??= TextStyle( + fontSize: fontSize.sm, + fontWeight: fontWeight.bold, + height: 14 / fontSize.sm, + fontStyle: FontStyle.normal, + decoration: TextDecoration.none, + ); + numericLg ??= TextStyle( + fontSize: fontSize.xs, + fontWeight: fontWeight.bold, + height: 12 / fontSize.xs, + fontStyle: FontStyle.normal, + decoration: TextDecoration.none, + ); + numericMd ??= TextStyle( + fontSize: fontSize.xxs, + fontWeight: fontWeight.bold, + height: 10 / fontSize.xxs, + fontStyle: FontStyle.normal, + decoration: TextDecoration.none, + ); + numericSm ??= TextStyle( + fontSize: fontSize.micro, + fontWeight: fontWeight.bold, + height: 8 / fontSize.micro, + fontStyle: FontStyle.normal, + decoration: TextDecoration.none, + ); + + return .raw( + headingLg: headingLg, + headingMd: headingMd, + headingSm: headingSm, + headingXs: headingXs, + bodyDefault: bodyDefault, + bodyEmphasis: bodyEmphasis, + bodyLink: bodyLink, + bodyLinkEmphasis: bodyLinkEmphasis, + captionDefault: captionDefault, + captionEmphasis: captionEmphasis, + captionLink: captionLink, + captionLinkEmphasis: captionLinkEmphasis, + metadataDefault: metadataDefault, + metadataEmphasis: metadataEmphasis, + metadataLink: metadataLink, + metadataLinkEmphasis: metadataLinkEmphasis, + numericXl: numericXl, + numericLg: numericLg, + numericMd: numericMd, + numericSm: numericSm, + ); + } + + const StreamTextTheme.raw({ + required this.headingLg, + required this.headingMd, + required this.headingSm, + required this.headingXs, + required this.bodyDefault, + required this.bodyEmphasis, + required this.bodyLink, + required this.bodyLinkEmphasis, + required this.captionDefault, + required this.captionEmphasis, + required this.captionLink, + required this.captionLinkEmphasis, + required this.metadataDefault, + required this.metadataEmphasis, + required this.metadataLink, + required this.metadataLinkEmphasis, + required this.numericXl, + required this.numericLg, + required this.numericMd, + required this.numericSm, + }); + + /// Large heading text style. + /// + /// Uses semibold weight, xl font size, and relaxed line height. + final TextStyle headingLg; + + /// Medium heading text style. + /// + /// Uses semibold weight, lg font size, and normal line height. + final TextStyle headingMd; + + /// Small heading text style. + /// + /// Uses semibold weight, md font size, and tight line height. + final TextStyle headingSm; + + /// Extra small heading text style. + /// + /// Uses semibold weight, xs font size, and tight line height. + final TextStyle headingXs; + + /// Default body text style. + /// + /// Uses regular weight, md font size, and normal line height. + final TextStyle bodyDefault; + + /// Emphasized body text style. + /// + /// Uses semibold weight, md font size, and normal line height. + final TextStyle bodyEmphasis; + + /// Body link text style. + /// + /// Uses regular weight, md font size, and normal line height. + final TextStyle bodyLink; + + /// Emphasized body link text style. + /// + /// Uses semibold weight, md font size, and normal line height. + final TextStyle bodyLinkEmphasis; + + /// Default caption text style. + /// + /// Uses regular weight, sm font size, and tight line height. + final TextStyle captionDefault; + + /// Emphasized caption text style. + /// + /// Uses semibold weight, sm font size, and tight line height. + final TextStyle captionEmphasis; + + /// Caption link text style. + /// + /// Uses regular weight, sm font size, and tight line height. + final TextStyle captionLink; + + /// Emphasized caption link text style. + /// + /// Uses semibold weight, sm font size, and tight line height. + final TextStyle captionLinkEmphasis; + + /// Default metadata text style. + /// + /// Uses regular weight, xs font size, and tight line height. + final TextStyle metadataDefault; + + /// Emphasized metadata text style. + /// + /// Uses semibold weight, xs font size, and tight line height. + final TextStyle metadataEmphasis; + + /// Metadata link text style. + /// + /// Uses regular weight, xs font size, and tight line height. + final TextStyle metadataLink; + + /// Emphasized metadata link text style. + /// + /// Uses semibold weight, xs font size, and tight line height. + final TextStyle metadataLinkEmphasis; + + /// Extra large numeric text style. + /// + /// Uses bold weight and sm font size. Optimized for displaying numbers. + final TextStyle numericXl; + + /// Large numeric text style. + /// + /// Uses bold weight and xs font size. Optimized for displaying numbers. + final TextStyle numericLg; + + /// Medium numeric text style. + /// + /// Uses bold weight and xxs font size. Optimized for displaying numbers. + final TextStyle numericMd; + + /// Small numeric text style. + /// + /// Uses bold weight and micro font size. Optimized for displaying numbers. + final TextStyle numericSm; + + /// Linearly interpolates between this and another [StreamTextTheme]. + StreamTextTheme lerp(StreamTextTheme? other, double t) { + return _$StreamTextTheme.lerp(this, other, t)!; + } + + /// Creates a copy of this text theme but with the given fields replaced with + /// the new values. + /// + /// The [heightFactor] applies a multiplier to all line heights. + /// The [heightDelta] adds a fixed amount to all line heights after the factor. + /// The [fontSizeFactor] applies a multiplier to all font sizes. + /// The [fontSizeDelta] adds a fixed amount to all font sizes after the factor. + /// + /// {@tool snippet} + /// + /// Apply a color and font family to all text styles: + /// + /// ```dart + /// final textTheme = StreamTextTheme(); + /// final themed = textTheme.apply( + /// color: Colors.blue, + /// fontFamily: 'Roboto', + /// ); + /// ``` + /// {@end-tool} + StreamTextTheme apply({ + Color? color, + String? package, + String? fontFamily, + List? fontFamilyFallback, + double heightFactor = 1.0, + double heightDelta = 0.0, + double fontSizeFactor = 1.0, + double fontSizeDelta = 0.0, + TextDecoration? decoration, + }) => StreamTextTheme.raw( + headingLg: headingLg.apply( + color: color, + package: package, + fontFamily: fontFamily, + fontFamilyFallback: fontFamilyFallback, + heightFactor: heightFactor, + heightDelta: heightDelta, + fontSizeFactor: fontSizeFactor, + fontSizeDelta: fontSizeDelta, + decoration: decoration, + ), + headingMd: headingMd.apply( + color: color, + package: package, + fontFamily: fontFamily, + fontFamilyFallback: fontFamilyFallback, + heightFactor: heightFactor, + heightDelta: heightDelta, + fontSizeFactor: fontSizeFactor, + fontSizeDelta: fontSizeDelta, + decoration: decoration, + ), + headingSm: headingSm.apply( + color: color, + package: package, + fontFamily: fontFamily, + fontFamilyFallback: fontFamilyFallback, + heightFactor: heightFactor, + heightDelta: heightDelta, + fontSizeFactor: fontSizeFactor, + fontSizeDelta: fontSizeDelta, + decoration: decoration, + ), + headingXs: headingXs.apply( + color: color, + package: package, + fontFamily: fontFamily, + fontFamilyFallback: fontFamilyFallback, + heightFactor: heightFactor, + heightDelta: heightDelta, + fontSizeFactor: fontSizeFactor, + fontSizeDelta: fontSizeDelta, + decoration: decoration, + ), + bodyDefault: bodyDefault.apply( + color: color, + package: package, + fontFamily: fontFamily, + fontFamilyFallback: fontFamilyFallback, + heightFactor: heightFactor, + heightDelta: heightDelta, + fontSizeFactor: fontSizeFactor, + fontSizeDelta: fontSizeDelta, + decoration: decoration, + ), + bodyEmphasis: bodyEmphasis.apply( + color: color, + package: package, + fontFamily: fontFamily, + fontFamilyFallback: fontFamilyFallback, + heightFactor: heightFactor, + heightDelta: heightDelta, + fontSizeFactor: fontSizeFactor, + fontSizeDelta: fontSizeDelta, + decoration: decoration, + ), + bodyLink: bodyLink.apply( + color: color, + package: package, + fontFamily: fontFamily, + fontFamilyFallback: fontFamilyFallback, + heightFactor: heightFactor, + heightDelta: heightDelta, + fontSizeFactor: fontSizeFactor, + fontSizeDelta: fontSizeDelta, + decoration: decoration, + ), + bodyLinkEmphasis: bodyLinkEmphasis.apply( + color: color, + package: package, + fontFamily: fontFamily, + fontFamilyFallback: fontFamilyFallback, + heightFactor: heightFactor, + heightDelta: heightDelta, + fontSizeFactor: fontSizeFactor, + fontSizeDelta: fontSizeDelta, + decoration: decoration, + ), + captionDefault: captionDefault.apply( + color: color, + package: package, + fontFamily: fontFamily, + fontFamilyFallback: fontFamilyFallback, + heightFactor: heightFactor, + heightDelta: heightDelta, + fontSizeFactor: fontSizeFactor, + fontSizeDelta: fontSizeDelta, + decoration: decoration, + ), + captionEmphasis: captionEmphasis.apply( + color: color, + package: package, + fontFamily: fontFamily, + fontFamilyFallback: fontFamilyFallback, + heightFactor: heightFactor, + heightDelta: heightDelta, + fontSizeFactor: fontSizeFactor, + fontSizeDelta: fontSizeDelta, + decoration: decoration, + ), + captionLink: captionLink.apply( + color: color, + package: package, + fontFamily: fontFamily, + fontFamilyFallback: fontFamilyFallback, + heightFactor: heightFactor, + heightDelta: heightDelta, + fontSizeFactor: fontSizeFactor, + fontSizeDelta: fontSizeDelta, + decoration: decoration, + ), + captionLinkEmphasis: captionLinkEmphasis.apply( + color: color, + package: package, + fontFamily: fontFamily, + fontFamilyFallback: fontFamilyFallback, + heightFactor: heightFactor, + heightDelta: heightDelta, + fontSizeFactor: fontSizeFactor, + fontSizeDelta: fontSizeDelta, + decoration: decoration, + ), + metadataDefault: metadataDefault.apply( + color: color, + package: package, + fontFamily: fontFamily, + fontFamilyFallback: fontFamilyFallback, + heightFactor: heightFactor, + heightDelta: heightDelta, + fontSizeFactor: fontSizeFactor, + fontSizeDelta: fontSizeDelta, + decoration: decoration, + ), + metadataEmphasis: metadataEmphasis.apply( + color: color, + package: package, + fontFamily: fontFamily, + fontFamilyFallback: fontFamilyFallback, + heightFactor: heightFactor, + heightDelta: heightDelta, + fontSizeFactor: fontSizeFactor, + fontSizeDelta: fontSizeDelta, + decoration: decoration, + ), + metadataLink: metadataLink.apply( + color: color, + package: package, + fontFamily: fontFamily, + fontFamilyFallback: fontFamilyFallback, + heightFactor: heightFactor, + heightDelta: heightDelta, + fontSizeFactor: fontSizeFactor, + fontSizeDelta: fontSizeDelta, + decoration: decoration, + ), + metadataLinkEmphasis: metadataLinkEmphasis.apply( + color: color, + package: package, + fontFamily: fontFamily, + fontFamilyFallback: fontFamilyFallback, + heightFactor: heightFactor, + heightDelta: heightDelta, + fontSizeFactor: fontSizeFactor, + fontSizeDelta: fontSizeDelta, + decoration: decoration, + ), + numericXl: numericXl.apply( + color: color, + package: package, + fontFamily: fontFamily, + fontFamilyFallback: fontFamilyFallback, + heightFactor: heightFactor, + heightDelta: heightDelta, + fontSizeFactor: fontSizeFactor, + fontSizeDelta: fontSizeDelta, + decoration: decoration, + ), + numericLg: numericLg.apply( + color: color, + package: package, + fontFamily: fontFamily, + fontFamilyFallback: fontFamilyFallback, + heightFactor: heightFactor, + heightDelta: heightDelta, + fontSizeFactor: fontSizeFactor, + fontSizeDelta: fontSizeDelta, + decoration: decoration, + ), + numericMd: numericMd.apply( + color: color, + package: package, + fontFamily: fontFamily, + fontFamilyFallback: fontFamilyFallback, + heightFactor: heightFactor, + heightDelta: heightDelta, + fontSizeFactor: fontSizeFactor, + fontSizeDelta: fontSizeDelta, + decoration: decoration, + ), + numericSm: numericSm.apply( + color: color, + package: package, + fontFamily: fontFamily, + fontFamilyFallback: fontFamilyFallback, + heightFactor: heightFactor, + heightDelta: heightDelta, + fontSizeFactor: fontSizeFactor, + fontSizeDelta: fontSizeDelta, + decoration: decoration, + ), + ); +} diff --git a/packages/stream_core_flutter/lib/src/theme/semantics/stream_text_theme.g.theme.dart b/packages/stream_core_flutter/lib/src/theme/semantics/stream_text_theme.g.theme.dart new file mode 100644 index 0000000..63977f6 --- /dev/null +++ b/packages/stream_core_flutter/lib/src/theme/semantics/stream_text_theme.g.theme.dart @@ -0,0 +1,222 @@ +// dart format width=80 +// coverage:ignore-file +// GENERATED CODE - DO NOT MODIFY BY HAND +// ignore_for_file: type=lint, unused_element + +part of 'stream_text_theme.dart'; + +// ************************************************************************** +// ThemeGenGenerator +// ************************************************************************** + +mixin _$StreamTextTheme { + bool get canMerge => true; + + static StreamTextTheme? lerp( + StreamTextTheme? a, + StreamTextTheme? b, + double t, + ) { + if (identical(a, b)) { + return a; + } + + if (a == null) { + return t == 1.0 ? b : null; + } + + if (b == null) { + return t == 0.0 ? a : null; + } + + return StreamTextTheme.raw( + headingLg: TextStyle.lerp(a.headingLg, b.headingLg, t)!, + headingMd: TextStyle.lerp(a.headingMd, b.headingMd, t)!, + headingSm: TextStyle.lerp(a.headingSm, b.headingSm, t)!, + headingXs: TextStyle.lerp(a.headingXs, b.headingXs, t)!, + bodyDefault: TextStyle.lerp(a.bodyDefault, b.bodyDefault, t)!, + bodyEmphasis: TextStyle.lerp(a.bodyEmphasis, b.bodyEmphasis, t)!, + bodyLink: TextStyle.lerp(a.bodyLink, b.bodyLink, t)!, + bodyLinkEmphasis: TextStyle.lerp( + a.bodyLinkEmphasis, + b.bodyLinkEmphasis, + t, + )!, + captionDefault: TextStyle.lerp(a.captionDefault, b.captionDefault, t)!, + captionEmphasis: TextStyle.lerp(a.captionEmphasis, b.captionEmphasis, t)!, + captionLink: TextStyle.lerp(a.captionLink, b.captionLink, t)!, + captionLinkEmphasis: TextStyle.lerp( + a.captionLinkEmphasis, + b.captionLinkEmphasis, + t, + )!, + metadataDefault: TextStyle.lerp(a.metadataDefault, b.metadataDefault, t)!, + metadataEmphasis: TextStyle.lerp( + a.metadataEmphasis, + b.metadataEmphasis, + t, + )!, + metadataLink: TextStyle.lerp(a.metadataLink, b.metadataLink, t)!, + metadataLinkEmphasis: TextStyle.lerp( + a.metadataLinkEmphasis, + b.metadataLinkEmphasis, + t, + )!, + numericXl: TextStyle.lerp(a.numericXl, b.numericXl, t)!, + numericLg: TextStyle.lerp(a.numericLg, b.numericLg, t)!, + numericMd: TextStyle.lerp(a.numericMd, b.numericMd, t)!, + numericSm: TextStyle.lerp(a.numericSm, b.numericSm, t)!, + ); + } + + StreamTextTheme copyWith({ + TextStyle? headingLg, + TextStyle? headingMd, + TextStyle? headingSm, + TextStyle? headingXs, + TextStyle? bodyDefault, + TextStyle? bodyEmphasis, + TextStyle? bodyLink, + TextStyle? bodyLinkEmphasis, + TextStyle? captionDefault, + TextStyle? captionEmphasis, + TextStyle? captionLink, + TextStyle? captionLinkEmphasis, + TextStyle? metadataDefault, + TextStyle? metadataEmphasis, + TextStyle? metadataLink, + TextStyle? metadataLinkEmphasis, + TextStyle? numericXl, + TextStyle? numericLg, + TextStyle? numericMd, + TextStyle? numericSm, + }) { + final _this = (this as StreamTextTheme); + + return StreamTextTheme.raw( + headingLg: headingLg ?? _this.headingLg, + headingMd: headingMd ?? _this.headingMd, + headingSm: headingSm ?? _this.headingSm, + headingXs: headingXs ?? _this.headingXs, + bodyDefault: bodyDefault ?? _this.bodyDefault, + bodyEmphasis: bodyEmphasis ?? _this.bodyEmphasis, + bodyLink: bodyLink ?? _this.bodyLink, + bodyLinkEmphasis: bodyLinkEmphasis ?? _this.bodyLinkEmphasis, + captionDefault: captionDefault ?? _this.captionDefault, + captionEmphasis: captionEmphasis ?? _this.captionEmphasis, + captionLink: captionLink ?? _this.captionLink, + captionLinkEmphasis: captionLinkEmphasis ?? _this.captionLinkEmphasis, + metadataDefault: metadataDefault ?? _this.metadataDefault, + metadataEmphasis: metadataEmphasis ?? _this.metadataEmphasis, + metadataLink: metadataLink ?? _this.metadataLink, + metadataLinkEmphasis: metadataLinkEmphasis ?? _this.metadataLinkEmphasis, + numericXl: numericXl ?? _this.numericXl, + numericLg: numericLg ?? _this.numericLg, + numericMd: numericMd ?? _this.numericMd, + numericSm: numericSm ?? _this.numericSm, + ); + } + + StreamTextTheme merge(StreamTextTheme? other) { + final _this = (this as StreamTextTheme); + + if (other == null || identical(_this, other)) { + return _this; + } + + if (!other.canMerge) { + return other; + } + + return copyWith( + headingLg: _this.headingLg.merge(other.headingLg), + headingMd: _this.headingMd.merge(other.headingMd), + headingSm: _this.headingSm.merge(other.headingSm), + headingXs: _this.headingXs.merge(other.headingXs), + bodyDefault: _this.bodyDefault.merge(other.bodyDefault), + bodyEmphasis: _this.bodyEmphasis.merge(other.bodyEmphasis), + bodyLink: _this.bodyLink.merge(other.bodyLink), + bodyLinkEmphasis: _this.bodyLinkEmphasis.merge(other.bodyLinkEmphasis), + captionDefault: _this.captionDefault.merge(other.captionDefault), + captionEmphasis: _this.captionEmphasis.merge(other.captionEmphasis), + captionLink: _this.captionLink.merge(other.captionLink), + captionLinkEmphasis: _this.captionLinkEmphasis.merge( + other.captionLinkEmphasis, + ), + metadataDefault: _this.metadataDefault.merge(other.metadataDefault), + metadataEmphasis: _this.metadataEmphasis.merge(other.metadataEmphasis), + metadataLink: _this.metadataLink.merge(other.metadataLink), + metadataLinkEmphasis: _this.metadataLinkEmphasis.merge( + other.metadataLinkEmphasis, + ), + numericXl: _this.numericXl.merge(other.numericXl), + numericLg: _this.numericLg.merge(other.numericLg), + numericMd: _this.numericMd.merge(other.numericMd), + numericSm: _this.numericSm.merge(other.numericSm), + ); + } + + @override + bool operator ==(Object other) { + if (identical(this, other)) { + return true; + } + + if (other.runtimeType != runtimeType) { + return false; + } + + final _this = (this as StreamTextTheme); + final _other = (other as StreamTextTheme); + + return _other.headingLg == _this.headingLg && + _other.headingMd == _this.headingMd && + _other.headingSm == _this.headingSm && + _other.headingXs == _this.headingXs && + _other.bodyDefault == _this.bodyDefault && + _other.bodyEmphasis == _this.bodyEmphasis && + _other.bodyLink == _this.bodyLink && + _other.bodyLinkEmphasis == _this.bodyLinkEmphasis && + _other.captionDefault == _this.captionDefault && + _other.captionEmphasis == _this.captionEmphasis && + _other.captionLink == _this.captionLink && + _other.captionLinkEmphasis == _this.captionLinkEmphasis && + _other.metadataDefault == _this.metadataDefault && + _other.metadataEmphasis == _this.metadataEmphasis && + _other.metadataLink == _this.metadataLink && + _other.metadataLinkEmphasis == _this.metadataLinkEmphasis && + _other.numericXl == _this.numericXl && + _other.numericLg == _this.numericLg && + _other.numericMd == _this.numericMd && + _other.numericSm == _this.numericSm; + } + + @override + int get hashCode { + final _this = (this as StreamTextTheme); + + return Object.hashAll([ + runtimeType, + _this.headingLg, + _this.headingMd, + _this.headingSm, + _this.headingXs, + _this.bodyDefault, + _this.bodyEmphasis, + _this.bodyLink, + _this.bodyLinkEmphasis, + _this.captionDefault, + _this.captionEmphasis, + _this.captionLink, + _this.captionLinkEmphasis, + _this.metadataDefault, + _this.metadataEmphasis, + _this.metadataLink, + _this.metadataLinkEmphasis, + _this.numericXl, + _this.numericLg, + _this.numericMd, + _this.numericSm, + ]); + } +} diff --git a/packages/stream_core_flutter/lib/src/theme/stream_theme.dart b/packages/stream_core_flutter/lib/src/theme/stream_theme.dart new file mode 100644 index 0000000..f0d35e2 --- /dev/null +++ b/packages/stream_core_flutter/lib/src/theme/stream_theme.dart @@ -0,0 +1,366 @@ +// ignore_for_file: avoid_redundant_argument_values + +import 'package:flutter/foundation.dart'; +import 'package:flutter/material.dart'; +import 'package:theme_extensions_builder_annotation/theme_extensions_builder_annotation.dart'; + +import 'components/stream_audio_waveform_theme.dart'; +import 'components/stream_avatar_theme.dart'; +import 'components/stream_badge_count_theme.dart'; +import 'components/stream_badge_notification_theme.dart'; +import 'components/stream_button_theme.dart'; +import 'components/stream_checkbox_theme.dart'; +import 'components/stream_context_menu_action_theme.dart'; +import 'components/stream_context_menu_theme.dart'; +import 'components/stream_emoji_button_theme.dart'; +import 'components/stream_emoji_chip_theme.dart'; +import 'components/stream_input_theme.dart'; +import 'components/stream_list_tile_theme.dart'; +import 'components/stream_message_theme.dart'; +import 'components/stream_online_indicator_theme.dart'; +import 'components/stream_progress_bar_theme.dart'; +import 'components/stream_reactions_theme.dart'; +import 'primitives/stream_icons.dart'; +import 'primitives/stream_radius.dart'; +import 'primitives/stream_spacing.dart'; +import 'primitives/stream_typography.dart'; +import 'semantics/stream_box_shadow.dart'; +import 'semantics/stream_color_scheme.dart'; +import 'semantics/stream_text_theme.dart'; + +part 'stream_theme.g.theme.dart'; + +/// The main theme configuration for Stream design system. +/// +/// [StreamTheme] aggregates all design tokens and component themes into a +/// single theme object. It supports light, dark, and high contrast modes +/// with platform-aware defaults. +/// +/// {@tool snippet} +/// +/// Create a light theme: +/// +/// ```dart +/// final theme = StreamTheme.light(); +/// final primaryColor = theme.colorScheme.brand.shade500; +/// final spacing = theme.spacing.md; +/// ``` +/// {@end-tool} +/// {@tool snippet} +/// +/// Create a theme based on brightness: +/// +/// ```dart +/// final theme = StreamTheme(brightness: Brightness.dark); +/// ``` +/// {@end-tool} +/// +/// See also: +/// +/// * [StreamColorScheme], which defines semantic colors. +/// * [StreamTypography], which defines typography primitives. +/// * [StreamTextTheme], which defines semantic text styles. +/// * [StreamRadius], which defines border radius values. +/// * [StreamSpacing], which defines spacing values. +/// * [StreamBoxShadow], which defines elevation shadows. +/// * [StreamButtonThemeData], which defines button styles. +/// * [StreamAvatarThemeData], which defines avatar styles. +@immutable +@ThemeExtensions(constructor: 'raw', buildContextExtension: false) +class StreamTheme extends ThemeExtension with _$StreamTheme { + /// Creates a theme configuration. + /// + /// The theme is configured based on the given [brightness]. If [brightness] + /// is not provided, it defaults to [Brightness.light]. + /// + /// The [platform] parameter affects platform-specific defaults for + /// typography and radius. If not provided, it defaults to + /// [defaultTargetPlatform]. + /// + /// If [typography] is provided, it will be used to build [textTheme]. + /// + /// See also: + /// + /// * [StreamTheme.light], which creates a light theme. + /// * [StreamTheme.dark], which creates a dark theme. + factory StreamTheme({ + Brightness brightness = .light, + TargetPlatform? platform, + StreamIcons? icons, + StreamRadius? radius, + StreamSpacing? spacing, + StreamTypography? typography, + StreamColorScheme? colorScheme, + StreamTextTheme? textTheme, + StreamBoxShadow? boxShadow, + // Components themes + StreamAudioWaveformThemeData? audioWaveformTheme, + StreamAvatarThemeData? avatarTheme, + StreamBadgeCountThemeData? badgeCountTheme, + StreamBadgeNotificationThemeData? badgeNotificationTheme, + StreamButtonThemeData? buttonTheme, + StreamCheckboxThemeData? checkboxTheme, + StreamContextMenuThemeData? contextMenuTheme, + StreamContextMenuActionThemeData? contextMenuActionTheme, + StreamEmojiButtonThemeData? emojiButtonTheme, + StreamEmojiChipThemeData? emojiChipTheme, + StreamListTileThemeData? listTileTheme, + StreamMessageThemeData? messageTheme, + StreamInputThemeData? inputTheme, + StreamOnlineIndicatorThemeData? onlineIndicatorTheme, + StreamProgressBarThemeData? progressBarTheme, + StreamReactionsThemeData? reactionsTheme, + }) { + platform ??= defaultTargetPlatform; + final isDark = brightness == Brightness.dark; + + // Primitives + icons ??= const StreamIcons(); + radius ??= StreamRadius(platform: platform); + spacing ??= const StreamSpacing(); + typography ??= StreamTypography(platform: platform); + + // Semantics + colorScheme ??= isDark ? StreamColorScheme.dark() : StreamColorScheme.light(); + textTheme ??= StreamTextTheme(typography: typography).apply(color: colorScheme.systemText); + boxShadow ??= isDark ? StreamBoxShadow.dark() : StreamBoxShadow.light(); + + // Components + audioWaveformTheme ??= const StreamAudioWaveformThemeData(); + avatarTheme ??= const StreamAvatarThemeData(); + badgeCountTheme ??= const StreamBadgeCountThemeData(); + badgeNotificationTheme ??= const StreamBadgeNotificationThemeData(); + buttonTheme ??= const StreamButtonThemeData(); + checkboxTheme ??= const StreamCheckboxThemeData(); + contextMenuTheme ??= const StreamContextMenuThemeData(); + contextMenuActionTheme ??= const StreamContextMenuActionThemeData(); + emojiButtonTheme ??= const StreamEmojiButtonThemeData(); + emojiChipTheme ??= const StreamEmojiChipThemeData(); + listTileTheme ??= const StreamListTileThemeData(); + messageTheme ??= const StreamMessageThemeData(); + inputTheme ??= const StreamInputThemeData(); + onlineIndicatorTheme ??= const StreamOnlineIndicatorThemeData(); + progressBarTheme ??= const StreamProgressBarThemeData(); + reactionsTheme ??= const StreamReactionsThemeData(); + + return .raw( + brightness: brightness, + icons: icons, + radius: radius, + spacing: spacing, + typography: typography, + colorScheme: colorScheme, + textTheme: textTheme, + boxShadow: boxShadow, + audioWaveformTheme: audioWaveformTheme, + avatarTheme: avatarTheme, + badgeCountTheme: badgeCountTheme, + badgeNotificationTheme: badgeNotificationTheme, + buttonTheme: buttonTheme, + checkboxTheme: checkboxTheme, + contextMenuTheme: contextMenuTheme, + contextMenuActionTheme: contextMenuActionTheme, + emojiButtonTheme: emojiButtonTheme, + emojiChipTheme: emojiChipTheme, + listTileTheme: listTileTheme, + messageTheme: messageTheme, + inputTheme: inputTheme, + onlineIndicatorTheme: onlineIndicatorTheme, + progressBarTheme: progressBarTheme, + reactionsTheme: reactionsTheme, + ); + } + + /// Creates a dark theme configuration. + /// + /// This is a convenience factory that calls [StreamTheme] with + /// [Brightness.dark]. + factory StreamTheme.dark() => StreamTheme(brightness: .dark); + + /// Creates a light theme configuration. + /// + /// This is a convenience factory that calls [StreamTheme] with + /// [Brightness.light]. + factory StreamTheme.light() => StreamTheme(brightness: .light); + + const StreamTheme.raw({ + required this.brightness, + required this.icons, + required this.radius, + required this.spacing, + required this.typography, + required this.colorScheme, + required this.textTheme, + required this.boxShadow, + required this.audioWaveformTheme, + required this.avatarTheme, + required this.badgeCountTheme, + required this.badgeNotificationTheme, + required this.buttonTheme, + required this.checkboxTheme, + required this.contextMenuTheme, + required this.contextMenuActionTheme, + required this.emojiButtonTheme, + required this.emojiChipTheme, + required this.listTileTheme, + required this.messageTheme, + required this.inputTheme, + required this.onlineIndicatorTheme, + required this.progressBarTheme, + required this.reactionsTheme, + }); + + /// Returns the [StreamTheme] from the closest [Theme] ancestor. + /// + /// If no [StreamTheme] is found in the widget tree, a default theme is + /// returned based on the current [Theme]'s brightness (light or dark). + /// + /// {@tool snippet} + /// + /// Access the theme in a widget: + /// + /// ```dart + /// @override + /// Widget build(BuildContext context) { + /// final theme = StreamTheme.of(context); + /// return Container( + /// color: theme.colorScheme.backgroundPrimary, + /// padding: EdgeInsets.all(theme.spacing.md), + /// child: Text('Hello', style: theme.textTheme.bodyDefault), + /// ); + /// } + /// ``` + /// {@end-tool} + static StreamTheme of(BuildContext context) { + final theme = Theme.of(context); + final streamTheme = theme.extension(); + if (streamTheme != null) return streamTheme; + + return StreamTheme(brightness: theme.brightness); + } + + /// The brightness of this theme. + final Brightness brightness; + + /// The icons for this theme. + final StreamIcons icons; + + /// The border radius values for this theme. + final StreamRadius radius; + + /// The spacing values for this theme. + final StreamSpacing spacing; + + /// The typography primitives for this theme. + /// + /// Contains font sizes, line heights, and font weights. + /// Used to build [textTheme]. + final StreamTypography typography; + + /// The color scheme for this theme. + final StreamColorScheme colorScheme; + + /// The semantic text theme for this theme. + /// + /// Built from [typography] primitives. + final StreamTextTheme textTheme; + + /// The box shadow (elevation) values for this theme. + final StreamBoxShadow boxShadow; + + /// The audio waveform theme for this theme. + final StreamAudioWaveformThemeData audioWaveformTheme; + + /// The avatar theme for this theme. + final StreamAvatarThemeData avatarTheme; + + /// The badge count theme for this theme. + final StreamBadgeCountThemeData badgeCountTheme; + + /// The badge notification theme for this theme. + final StreamBadgeNotificationThemeData badgeNotificationTheme; + + /// The button theme for this theme. + final StreamButtonThemeData buttonTheme; + + /// The checkbox theme for this theme. + final StreamCheckboxThemeData checkboxTheme; + + /// The context menu theme for this theme. + final StreamContextMenuThemeData contextMenuTheme; + + /// The context menu action theme for this theme. + final StreamContextMenuActionThemeData contextMenuActionTheme; + + /// The emoji button theme for this theme. + final StreamEmojiButtonThemeData emojiButtonTheme; + + /// The emoji chip theme for this theme. + final StreamEmojiChipThemeData emojiChipTheme; + + /// The list tile theme for this theme. + final StreamListTileThemeData listTileTheme; + + /// The message theme for this theme. + final StreamMessageThemeData messageTheme; + + /// The input theme for this theme. + final StreamInputThemeData inputTheme; + + /// The online indicator theme for this theme. + final StreamOnlineIndicatorThemeData onlineIndicatorTheme; + + /// The progress bar theme for this theme. + final StreamProgressBarThemeData progressBarTheme; + + /// The reaction theme for this theme. + final StreamReactionsThemeData reactionsTheme; + + /// Creates a copy of this theme but with platform-dependent primitives + /// recomputed for the given [platform]. + /// + /// All other values including component-level theme customizations are + /// preserved. + /// + /// {@tool snippet} + /// + /// Apply iOS platform to an existing theme: + /// + /// ```dart + /// final theme = StreamTheme.light(); + /// final iosTheme = theme.applyPlatform(TargetPlatform.iOS); + /// ``` + /// {@end-tool} + StreamTheme applyPlatform(TargetPlatform platform) { + final newRadius = StreamRadius(platform: platform); + final newTypography = StreamTypography(platform: platform); + final newTextTheme = StreamTextTheme(typography: newTypography).apply(color: colorScheme.systemText); + + return StreamTheme.raw( + brightness: brightness, + icons: icons, + radius: newRadius, + spacing: spacing, + typography: newTypography, + colorScheme: colorScheme, + textTheme: newTextTheme, + boxShadow: boxShadow, + audioWaveformTheme: audioWaveformTheme, + avatarTheme: avatarTheme, + badgeCountTheme: badgeCountTheme, + badgeNotificationTheme: badgeNotificationTheme, + buttonTheme: buttonTheme, + checkboxTheme: checkboxTheme, + contextMenuTheme: contextMenuTheme, + contextMenuActionTheme: contextMenuActionTheme, + emojiButtonTheme: emojiButtonTheme, + emojiChipTheme: emojiChipTheme, + listTileTheme: listTileTheme, + messageTheme: messageTheme, + inputTheme: inputTheme, + onlineIndicatorTheme: onlineIndicatorTheme, + progressBarTheme: progressBarTheme, + reactionsTheme: reactionsTheme, + ); + } +} diff --git a/packages/stream_core_flutter/lib/src/theme/stream_theme.g.theme.dart b/packages/stream_core_flutter/lib/src/theme/stream_theme.g.theme.dart new file mode 100644 index 0000000..46d74ea --- /dev/null +++ b/packages/stream_core_flutter/lib/src/theme/stream_theme.g.theme.dart @@ -0,0 +1,239 @@ +// dart format width=80 +// coverage:ignore-file +// GENERATED CODE - DO NOT MODIFY BY HAND +// ignore_for_file: type=lint, unused_element + +part of 'stream_theme.dart'; + +// ************************************************************************** +// ThemeExtensionsGenerator +// ************************************************************************** + +mixin _$StreamTheme on ThemeExtension { + @override + ThemeExtension copyWith({ + Brightness? brightness, + StreamIcons? icons, + StreamRadius? radius, + StreamSpacing? spacing, + StreamTypography? typography, + StreamColorScheme? colorScheme, + StreamTextTheme? textTheme, + StreamBoxShadow? boxShadow, + StreamAudioWaveformThemeData? audioWaveformTheme, + StreamAvatarThemeData? avatarTheme, + StreamBadgeCountThemeData? badgeCountTheme, + StreamBadgeNotificationThemeData? badgeNotificationTheme, + StreamButtonThemeData? buttonTheme, + StreamCheckboxThemeData? checkboxTheme, + StreamContextMenuThemeData? contextMenuTheme, + StreamContextMenuActionThemeData? contextMenuActionTheme, + StreamEmojiButtonThemeData? emojiButtonTheme, + StreamEmojiChipThemeData? emojiChipTheme, + StreamListTileThemeData? listTileTheme, + StreamMessageThemeData? messageTheme, + StreamInputThemeData? inputTheme, + StreamOnlineIndicatorThemeData? onlineIndicatorTheme, + StreamProgressBarThemeData? progressBarTheme, + StreamReactionsThemeData? reactionsTheme, + }) { + final _this = (this as StreamTheme); + + return StreamTheme.raw( + brightness: brightness ?? _this.brightness, + icons: icons ?? _this.icons, + radius: radius ?? _this.radius, + spacing: spacing ?? _this.spacing, + typography: typography ?? _this.typography, + colorScheme: colorScheme ?? _this.colorScheme, + textTheme: textTheme ?? _this.textTheme, + boxShadow: boxShadow ?? _this.boxShadow, + audioWaveformTheme: audioWaveformTheme ?? _this.audioWaveformTheme, + avatarTheme: avatarTheme ?? _this.avatarTheme, + badgeCountTheme: badgeCountTheme ?? _this.badgeCountTheme, + badgeNotificationTheme: + badgeNotificationTheme ?? _this.badgeNotificationTheme, + buttonTheme: buttonTheme ?? _this.buttonTheme, + checkboxTheme: checkboxTheme ?? _this.checkboxTheme, + contextMenuTheme: contextMenuTheme ?? _this.contextMenuTheme, + contextMenuActionTheme: + contextMenuActionTheme ?? _this.contextMenuActionTheme, + emojiButtonTheme: emojiButtonTheme ?? _this.emojiButtonTheme, + emojiChipTheme: emojiChipTheme ?? _this.emojiChipTheme, + listTileTheme: listTileTheme ?? _this.listTileTheme, + messageTheme: messageTheme ?? _this.messageTheme, + inputTheme: inputTheme ?? _this.inputTheme, + onlineIndicatorTheme: onlineIndicatorTheme ?? _this.onlineIndicatorTheme, + progressBarTheme: progressBarTheme ?? _this.progressBarTheme, + reactionsTheme: reactionsTheme ?? _this.reactionsTheme, + ); + } + + @override + ThemeExtension lerp( + ThemeExtension? other, + double t, + ) { + if (other is! StreamTheme) { + return this; + } + + final _this = (this as StreamTheme); + + return StreamTheme.raw( + brightness: t < 0.5 ? _this.brightness : other.brightness, + icons: StreamIcons.lerp(_this.icons, other.icons, t)!, + radius: StreamRadius.lerp(_this.radius, other.radius, t)!, + spacing: StreamSpacing.lerp(_this.spacing, other.spacing, t)!, + typography: StreamTypography.lerp(_this.typography, other.typography, t)!, + colorScheme: + (_this.colorScheme.lerp(other.colorScheme, t) as StreamColorScheme), + textTheme: (_this.textTheme.lerp(other.textTheme, t) as StreamTextTheme), + boxShadow: StreamBoxShadow.lerp(_this.boxShadow, other.boxShadow, t)!, + audioWaveformTheme: StreamAudioWaveformThemeData.lerp( + _this.audioWaveformTheme, + other.audioWaveformTheme, + t, + )!, + avatarTheme: StreamAvatarThemeData.lerp( + _this.avatarTheme, + other.avatarTheme, + t, + )!, + badgeCountTheme: StreamBadgeCountThemeData.lerp( + _this.badgeCountTheme, + other.badgeCountTheme, + t, + )!, + badgeNotificationTheme: StreamBadgeNotificationThemeData.lerp( + _this.badgeNotificationTheme, + other.badgeNotificationTheme, + t, + )!, + buttonTheme: StreamButtonThemeData.lerp( + _this.buttonTheme, + other.buttonTheme, + t, + )!, + checkboxTheme: StreamCheckboxThemeData.lerp( + _this.checkboxTheme, + other.checkboxTheme, + t, + )!, + contextMenuTheme: StreamContextMenuThemeData.lerp( + _this.contextMenuTheme, + other.contextMenuTheme, + t, + )!, + contextMenuActionTheme: StreamContextMenuActionThemeData.lerp( + _this.contextMenuActionTheme, + other.contextMenuActionTheme, + t, + )!, + emojiButtonTheme: StreamEmojiButtonThemeData.lerp( + _this.emojiButtonTheme, + other.emojiButtonTheme, + t, + )!, + emojiChipTheme: StreamEmojiChipThemeData.lerp( + _this.emojiChipTheme, + other.emojiChipTheme, + t, + )!, + listTileTheme: StreamListTileThemeData.lerp( + _this.listTileTheme, + other.listTileTheme, + t, + )!, + messageTheme: t < 0.5 ? _this.messageTheme : other.messageTheme, + inputTheme: t < 0.5 ? _this.inputTheme : other.inputTheme, + onlineIndicatorTheme: StreamOnlineIndicatorThemeData.lerp( + _this.onlineIndicatorTheme, + other.onlineIndicatorTheme, + t, + )!, + progressBarTheme: StreamProgressBarThemeData.lerp( + _this.progressBarTheme, + other.progressBarTheme, + t, + )!, + reactionsTheme: StreamReactionsThemeData.lerp( + _this.reactionsTheme, + other.reactionsTheme, + t, + )!, + ); + } + + @override + bool operator ==(Object other) { + if (identical(this, other)) { + return true; + } + + if (other.runtimeType != runtimeType) { + return false; + } + + final _this = (this as StreamTheme); + final _other = (other as StreamTheme); + + return _other.brightness == _this.brightness && + _other.icons == _this.icons && + _other.radius == _this.radius && + _other.spacing == _this.spacing && + _other.typography == _this.typography && + _other.colorScheme == _this.colorScheme && + _other.textTheme == _this.textTheme && + _other.boxShadow == _this.boxShadow && + _other.audioWaveformTheme == _this.audioWaveformTheme && + _other.avatarTheme == _this.avatarTheme && + _other.badgeCountTheme == _this.badgeCountTheme && + _other.badgeNotificationTheme == _this.badgeNotificationTheme && + _other.buttonTheme == _this.buttonTheme && + _other.checkboxTheme == _this.checkboxTheme && + _other.contextMenuTheme == _this.contextMenuTheme && + _other.contextMenuActionTheme == _this.contextMenuActionTheme && + _other.emojiButtonTheme == _this.emojiButtonTheme && + _other.emojiChipTheme == _this.emojiChipTheme && + _other.listTileTheme == _this.listTileTheme && + _other.messageTheme == _this.messageTheme && + _other.inputTheme == _this.inputTheme && + _other.onlineIndicatorTheme == _this.onlineIndicatorTheme && + _other.progressBarTheme == _this.progressBarTheme && + _other.reactionsTheme == _this.reactionsTheme; + } + + @override + int get hashCode { + final _this = (this as StreamTheme); + + return Object.hashAll([ + runtimeType, + _this.brightness, + _this.icons, + _this.radius, + _this.spacing, + _this.typography, + _this.colorScheme, + _this.textTheme, + _this.boxShadow, + _this.audioWaveformTheme, + _this.avatarTheme, + _this.badgeCountTheme, + _this.badgeNotificationTheme, + _this.buttonTheme, + _this.checkboxTheme, + _this.contextMenuTheme, + _this.contextMenuActionTheme, + _this.emojiButtonTheme, + _this.emojiChipTheme, + _this.listTileTheme, + _this.messageTheme, + _this.inputTheme, + _this.onlineIndicatorTheme, + _this.progressBarTheme, + _this.reactionsTheme, + ]); + } +} diff --git a/packages/stream_core_flutter/lib/src/theme/stream_theme_extensions.dart b/packages/stream_core_flutter/lib/src/theme/stream_theme_extensions.dart new file mode 100644 index 0000000..3321b72 --- /dev/null +++ b/packages/stream_core_flutter/lib/src/theme/stream_theme_extensions.dart @@ -0,0 +1,120 @@ +import 'package:flutter/widgets.dart'; + +import 'components/stream_audio_waveform_theme.dart'; +import 'components/stream_avatar_theme.dart'; +import 'components/stream_badge_count_theme.dart'; +import 'components/stream_badge_notification_theme.dart'; +import 'components/stream_button_theme.dart'; +import 'components/stream_checkbox_theme.dart'; +import 'components/stream_context_menu_action_theme.dart'; +import 'components/stream_context_menu_theme.dart'; +import 'components/stream_emoji_button_theme.dart'; +import 'components/stream_emoji_chip_theme.dart'; +import 'components/stream_input_theme.dart'; +import 'components/stream_list_tile_theme.dart'; +import 'components/stream_message_theme.dart'; +import 'components/stream_online_indicator_theme.dart'; +import 'components/stream_progress_bar_theme.dart'; +import 'components/stream_reactions_theme.dart'; +import 'primitives/stream_icons.dart'; +import 'primitives/stream_radius.dart'; +import 'primitives/stream_spacing.dart'; +import 'primitives/stream_typography.dart'; +import 'semantics/stream_box_shadow.dart'; +import 'semantics/stream_color_scheme.dart'; +import 'semantics/stream_text_theme.dart'; +import 'stream_theme.dart'; + +/// Extension on [BuildContext] for convenient access to [StreamTheme]. +/// +/// {@tool snippet} +/// +/// Access theme properties directly from context: +/// +/// ```dart +/// @override +/// Widget build(BuildContext context) { +/// return Container( +/// color: context.streamColorScheme.backgroundPrimary, +/// padding: EdgeInsets.all(context.streamSpacing.md), +/// child: Text('Hello', style: context.streamTextTheme.bodyDefault), +/// ); +/// } +/// ``` +/// {@end-tool} +extension StreamThemeExtension on BuildContext { + /// Returns the [StreamTheme] from the closest ancestor. + /// + /// If no [StreamTheme] is found, returns a default theme based on + /// the current [Theme]'s brightness. + StreamTheme get streamTheme => StreamTheme.of(this); + + /// Returns the [StreamColorScheme] from the current theme. + StreamColorScheme get streamColorScheme => streamTheme.colorScheme; + + /// Returns the [StreamIcons] from the current theme. + StreamIcons get streamIcons => streamTheme.icons; + + /// Returns the [StreamTextTheme] from the current theme. + StreamTextTheme get streamTextTheme => streamTheme.textTheme; + + /// Returns the [StreamTypography] from the current theme. + StreamTypography get streamTypography => streamTheme.typography; + + /// Returns the [StreamRadius] from the current theme. + StreamRadius get streamRadius => streamTheme.radius; + + /// Returns the [StreamSpacing] from the current theme. + StreamSpacing get streamSpacing => streamTheme.spacing; + + /// Returns the [StreamBoxShadow] from the current theme. + StreamBoxShadow get streamBoxShadow => streamTheme.boxShadow; + + /// Returns the [StreamAudioWaveformThemeData] from the nearest ancestor. + StreamAudioWaveformThemeData get streamAudioWaveformTheme => StreamAudioWaveformTheme.of(this); + + /// Returns the [StreamAvatarThemeData] from the nearest ancestor. + StreamAvatarThemeData get streamAvatarTheme => StreamAvatarTheme.of(this); + + /// Returns the [StreamBadgeCountThemeData] from the nearest ancestor. + StreamBadgeCountThemeData get streamBadgeCountTheme => StreamBadgeCountTheme.of(this); + + /// Returns the [StreamBadgeNotificationThemeData] from the nearest ancestor. + StreamBadgeNotificationThemeData get streamBadgeNotificationTheme => StreamBadgeNotificationTheme.of(this); + + /// Returns the [StreamButtonThemeData] from the nearest ancestor. + StreamButtonThemeData get streamButtonTheme => StreamButtonTheme.of(this); + + /// Returns the [StreamCheckboxThemeData] from the nearest ancestor. + StreamCheckboxThemeData get streamCheckboxTheme => StreamCheckboxTheme.of(this); + + /// Returns the [StreamContextMenuThemeData] from the nearest ancestor. + StreamContextMenuThemeData get streamContextMenuTheme => StreamContextMenuTheme.of(this); + + /// Returns the [StreamContextMenuActionThemeData] from the nearest ancestor. + StreamContextMenuActionThemeData get streamContextMenuActionTheme => StreamContextMenuActionTheme.of(this); + + /// Returns the [StreamEmojiButtonThemeData] from the nearest ancestor. + StreamEmojiButtonThemeData get streamEmojiButtonTheme => StreamEmojiButtonTheme.of(this); + + /// Returns the [StreamEmojiChipThemeData] from the nearest ancestor. + StreamEmojiChipThemeData get streamEmojiChipTheme => StreamEmojiChipTheme.of(this); + + /// Returns the [StreamListTileThemeData] from the nearest ancestor. + StreamListTileThemeData get streamListTileTheme => StreamListTileTheme.of(this); + + /// Returns the [StreamMessageThemeData] from the nearest ancestor. + StreamMessageThemeData get streamMessageTheme => StreamMessageTheme.of(this); + + /// Returns the [StreamInputThemeData] from the nearest ancestor. + StreamInputThemeData get streamInputTheme => StreamInputTheme.of(this); + + /// Returns the [StreamOnlineIndicatorThemeData] from the nearest ancestor. + StreamOnlineIndicatorThemeData get streamOnlineIndicatorTheme => StreamOnlineIndicatorTheme.of(this); + + /// Returns the [StreamProgressBarThemeData] from the nearest ancestor. + StreamProgressBarThemeData get streamProgressBarTheme => StreamProgressBarTheme.of(this); + + /// Returns the [StreamReactionsThemeData] from the nearest ancestor. + StreamReactionsThemeData get streamReactionsTheme => StreamReactionsTheme.of(this); +} diff --git a/packages/stream_core_flutter/lib/stream_core_flutter.dart b/packages/stream_core_flutter/lib/stream_core_flutter.dart new file mode 100644 index 0000000..49b2112 --- /dev/null +++ b/packages/stream_core_flutter/lib/stream_core_flutter.dart @@ -0,0 +1,2 @@ +export 'src/components.dart'; +export 'src/theme.dart'; diff --git a/packages/stream_core_flutter/pubspec.yaml b/packages/stream_core_flutter/pubspec.yaml new file mode 100644 index 0000000..e5eb18c --- /dev/null +++ b/packages/stream_core_flutter/pubspec.yaml @@ -0,0 +1,35 @@ +name: stream_core_flutter +description: "A new Flutter package project." +version: 0.0.1 +homepage: + +environment: + sdk: ^3.10.0 + flutter: ">=3.38.1" + +dependencies: + cached_network_image: ^3.4.1 + collection: ^1.19.0 + flutter: + sdk: flutter + flutter_svg: ^2.2.3 + stream_core: ^0.4.0 + theme_extensions_builder_annotation: ^7.1.0 + +dev_dependencies: + alchemist: ^0.13.0 + build_runner: ^2.10.5 + flutter_test: + sdk: flutter + theme_extensions_builder: ^7.2.0 + +flutter: + uses-material-design: true + assets: + - assets/file_type/ + + fonts: + - family: Stream Icons + fonts: + - asset: packages/stream_core_flutter/fonts/stream_icons_font.otf + diff --git a/packages/stream_core_flutter/stream_icons.yaml b/packages/stream_core_flutter/stream_icons.yaml new file mode 100644 index 0000000..d3f415d --- /dev/null +++ b/packages/stream_core_flutter/stream_icons.yaml @@ -0,0 +1,19 @@ +# Stream Icons Generator Configuration +# +# Run: melos run generate:icons + +# Input +input_svg_dir: assets_source/icons/ + +# Output paths (relative to this config file) +output_font_file: lib/fonts/stream_icons_font.otf +output_file: lib/src/theme/primitives/stream_icons.dart +output_data_file: lib/src/theme/primitives/stream_icons.g.dart + +# Class names +class_name: StreamIcons +data_class_name: StreamIconData +package: stream_core_flutter + +# Font options +font_name: Stream Icons diff --git a/packages/stream_core_flutter/test/components/accessories/goldens/ci/stream_audio_waveform_dark_states.png b/packages/stream_core_flutter/test/components/accessories/goldens/ci/stream_audio_waveform_dark_states.png new file mode 100644 index 0000000..a5140bf Binary files /dev/null and b/packages/stream_core_flutter/test/components/accessories/goldens/ci/stream_audio_waveform_dark_states.png differ diff --git a/packages/stream_core_flutter/test/components/accessories/goldens/ci/stream_audio_waveform_light_states.png b/packages/stream_core_flutter/test/components/accessories/goldens/ci/stream_audio_waveform_light_states.png new file mode 100644 index 0000000..87fad47 Binary files /dev/null and b/packages/stream_core_flutter/test/components/accessories/goldens/ci/stream_audio_waveform_light_states.png differ diff --git a/packages/stream_core_flutter/test/components/accessories/goldens/ci/stream_audio_waveform_slider_custom_theme.png b/packages/stream_core_flutter/test/components/accessories/goldens/ci/stream_audio_waveform_slider_custom_theme.png new file mode 100644 index 0000000..76e8c24 Binary files /dev/null and b/packages/stream_core_flutter/test/components/accessories/goldens/ci/stream_audio_waveform_slider_custom_theme.png differ diff --git a/packages/stream_core_flutter/test/components/accessories/goldens/ci/stream_audio_waveform_slider_dark_states.png b/packages/stream_core_flutter/test/components/accessories/goldens/ci/stream_audio_waveform_slider_dark_states.png new file mode 100644 index 0000000..c64a036 Binary files /dev/null and b/packages/stream_core_flutter/test/components/accessories/goldens/ci/stream_audio_waveform_slider_dark_states.png differ diff --git a/packages/stream_core_flutter/test/components/accessories/goldens/ci/stream_audio_waveform_slider_light_states.png b/packages/stream_core_flutter/test/components/accessories/goldens/ci/stream_audio_waveform_slider_light_states.png new file mode 100644 index 0000000..1f2fa1a Binary files /dev/null and b/packages/stream_core_flutter/test/components/accessories/goldens/ci/stream_audio_waveform_slider_light_states.png differ diff --git a/packages/stream_core_flutter/test/components/accessories/stream_audio_waveform_golden_test.dart b/packages/stream_core_flutter/test/components/accessories/stream_audio_waveform_golden_test.dart new file mode 100644 index 0000000..c016b5f --- /dev/null +++ b/packages/stream_core_flutter/test/components/accessories/stream_audio_waveform_golden_test.dart @@ -0,0 +1,314 @@ +// ignore_for_file: avoid_redundant_argument_values + +import 'dart:math' as math; + +import 'package:alchemist/alchemist.dart'; +import 'package:flutter/material.dart'; +import 'package:flutter_test/flutter_test.dart'; +import 'package:stream_core_flutter/stream_core_flutter.dart'; + +final List _sampleWaveform = List.generate( + 120, + (i) => (math.sin(i * 0.15) * 0.3 + 0.5 + math.sin(i * 0.4) * 0.2).clamp(0.0, 1.0), +); + +void main() { + group('StreamAudioWaveformSlider Golden Tests', () { + goldenTest( + 'renders light theme states', + fileName: 'stream_audio_waveform_slider_light_states', + builder: () => GoldenTestGroup( + scenarioConstraints: const BoxConstraints(maxWidth: 300), + children: [ + GoldenTestScenario( + name: 'idle_no_progress', + child: _buildSliderInTheme( + StreamAudioWaveformSlider( + waveform: _sampleWaveform, + progress: 0, + onChanged: (_) {}, + ), + ), + ), + GoldenTestScenario( + name: 'idle_with_progress', + child: _buildSliderInTheme( + StreamAudioWaveformSlider( + waveform: _sampleWaveform, + progress: 0.4, + onChanged: (_) {}, + ), + ), + ), + GoldenTestScenario( + name: 'active_with_progress', + child: _buildSliderInTheme( + StreamAudioWaveformSlider( + waveform: _sampleWaveform, + progress: 0.5, + isActive: true, + onChanged: (_) {}, + ), + ), + ), + GoldenTestScenario( + name: 'active_full_progress', + child: _buildSliderInTheme( + StreamAudioWaveformSlider( + waveform: _sampleWaveform, + progress: 1, + isActive: true, + onChanged: (_) {}, + ), + ), + ), + GoldenTestScenario( + name: 'empty_waveform', + child: _buildSliderInTheme( + StreamAudioWaveformSlider( + waveform: const [], + progress: 0, + onChanged: (_) {}, + ), + ), + ), + ], + ), + ); + + goldenTest( + 'renders dark theme states', + fileName: 'stream_audio_waveform_slider_dark_states', + builder: () => GoldenTestGroup( + scenarioConstraints: const BoxConstraints(maxWidth: 300), + children: [ + GoldenTestScenario( + name: 'idle_no_progress', + child: _buildSliderInTheme( + StreamAudioWaveformSlider( + waveform: _sampleWaveform, + progress: 0, + onChanged: (_) {}, + ), + brightness: Brightness.dark, + ), + ), + GoldenTestScenario( + name: 'idle_with_progress', + child: _buildSliderInTheme( + StreamAudioWaveformSlider( + waveform: _sampleWaveform, + progress: 0.4, + onChanged: (_) {}, + ), + brightness: Brightness.dark, + ), + ), + GoldenTestScenario( + name: 'active_with_progress', + child: _buildSliderInTheme( + StreamAudioWaveformSlider( + waveform: _sampleWaveform, + progress: 0.5, + isActive: true, + onChanged: (_) {}, + ), + brightness: Brightness.dark, + ), + ), + GoldenTestScenario( + name: 'active_full_progress', + child: _buildSliderInTheme( + StreamAudioWaveformSlider( + waveform: _sampleWaveform, + progress: 1, + isActive: true, + onChanged: (_) {}, + ), + brightness: Brightness.dark, + ), + ), + ], + ), + ); + + goldenTest( + 'renders custom theme overrides', + fileName: 'stream_audio_waveform_slider_custom_theme', + builder: () => GoldenTestGroup( + scenarioConstraints: const BoxConstraints(maxWidth: 300), + children: [ + GoldenTestScenario( + name: 'custom_colors_idle', + child: _buildSliderInTheme( + StreamAudioWaveformTheme( + data: const StreamAudioWaveformThemeData( + color: Colors.purple, + progressColor: Colors.orange, + idleThumbColor: Colors.grey, + thumbBorderColor: Colors.black, + ), + child: StreamAudioWaveformSlider( + waveform: _sampleWaveform, + progress: 0.5, + onChanged: (_) {}, + ), + ), + ), + ), + GoldenTestScenario( + name: 'custom_colors_active', + child: _buildSliderInTheme( + StreamAudioWaveformTheme( + data: const StreamAudioWaveformThemeData( + color: Colors.purple, + progressColor: Colors.orange, + activeThumbColor: Colors.red, + thumbBorderColor: Colors.black, + ), + child: StreamAudioWaveformSlider( + waveform: _sampleWaveform, + progress: 0.5, + isActive: true, + onChanged: (_) {}, + ), + ), + ), + ), + ], + ), + ); + }); + + group('StreamAudioWaveform Golden Tests', () { + goldenTest( + 'renders light theme states', + fileName: 'stream_audio_waveform_light_states', + builder: () => GoldenTestGroup( + scenarioConstraints: const BoxConstraints(maxWidth: 300), + children: [ + GoldenTestScenario( + name: 'no_progress', + child: _buildWaveformInTheme( + StreamAudioWaveform( + waveform: _sampleWaveform, + progress: 0, + ), + ), + ), + GoldenTestScenario( + name: 'half_progress', + child: _buildWaveformInTheme( + StreamAudioWaveform( + waveform: _sampleWaveform, + progress: 0.5, + ), + ), + ), + GoldenTestScenario( + name: 'full_progress', + child: _buildWaveformInTheme( + StreamAudioWaveform( + waveform: _sampleWaveform, + progress: 1, + ), + ), + ), + GoldenTestScenario( + name: 'empty_waveform', + child: _buildWaveformInTheme( + const StreamAudioWaveform( + waveform: [], + progress: 0, + ), + ), + ), + ], + ), + ); + + goldenTest( + 'renders dark theme states', + fileName: 'stream_audio_waveform_dark_states', + builder: () => GoldenTestGroup( + scenarioConstraints: const BoxConstraints(maxWidth: 300), + children: [ + GoldenTestScenario( + name: 'no_progress', + child: _buildWaveformInTheme( + StreamAudioWaveform( + waveform: _sampleWaveform, + progress: 0, + ), + brightness: Brightness.dark, + ), + ), + GoldenTestScenario( + name: 'half_progress', + child: _buildWaveformInTheme( + StreamAudioWaveform( + waveform: _sampleWaveform, + progress: 0.5, + ), + brightness: Brightness.dark, + ), + ), + GoldenTestScenario( + name: 'full_progress', + child: _buildWaveformInTheme( + StreamAudioWaveform( + waveform: _sampleWaveform, + progress: 1, + ), + brightness: Brightness.dark, + ), + ), + ], + ), + ); + }); +} + +Widget _buildSliderInTheme( + Widget slider, { + Brightness brightness = Brightness.light, +}) { + final streamTheme = StreamTheme(brightness: brightness); + return Theme( + data: ThemeData( + brightness: brightness, + extensions: [streamTheme], + ), + child: Builder( + builder: (context) => Material( + color: StreamTheme.of(context).colorScheme.backgroundApp, + child: Padding( + padding: const EdgeInsets.all(8), + child: SizedBox(width: 280, height: 36, child: slider), + ), + ), + ), + ); +} + +Widget _buildWaveformInTheme( + Widget waveform, { + Brightness brightness = Brightness.light, +}) { + final streamTheme = StreamTheme(brightness: brightness); + return Theme( + data: ThemeData( + brightness: brightness, + extensions: [streamTheme], + ), + child: Builder( + builder: (context) => Material( + color: StreamTheme.of(context).colorScheme.backgroundApp, + child: Padding( + padding: const EdgeInsets.all(8), + child: SizedBox(width: 280, height: 32, child: waveform), + ), + ), + ), + ); +} diff --git a/packages/stream_core_flutter/test/components/badge/goldens/ci/stream_badge_notification_counts.png b/packages/stream_core_flutter/test/components/badge/goldens/ci/stream_badge_notification_counts.png new file mode 100644 index 0000000..f77fb2d Binary files /dev/null and b/packages/stream_core_flutter/test/components/badge/goldens/ci/stream_badge_notification_counts.png differ diff --git a/packages/stream_core_flutter/test/components/badge/goldens/ci/stream_badge_notification_dark_matrix.png b/packages/stream_core_flutter/test/components/badge/goldens/ci/stream_badge_notification_dark_matrix.png new file mode 100644 index 0000000..b84574c Binary files /dev/null and b/packages/stream_core_flutter/test/components/badge/goldens/ci/stream_badge_notification_dark_matrix.png differ diff --git a/packages/stream_core_flutter/test/components/badge/goldens/ci/stream_badge_notification_light_matrix.png b/packages/stream_core_flutter/test/components/badge/goldens/ci/stream_badge_notification_light_matrix.png new file mode 100644 index 0000000..3a2ccd2 Binary files /dev/null and b/packages/stream_core_flutter/test/components/badge/goldens/ci/stream_badge_notification_light_matrix.png differ diff --git a/packages/stream_core_flutter/test/components/badge/stream_badge_notification_golden_test.dart b/packages/stream_core_flutter/test/components/badge/stream_badge_notification_golden_test.dart new file mode 100644 index 0000000..4c91179 --- /dev/null +++ b/packages/stream_core_flutter/test/components/badge/stream_badge_notification_golden_test.dart @@ -0,0 +1,92 @@ +import 'package:alchemist/alchemist.dart'; +import 'package:flutter/material.dart'; +import 'package:flutter_test/flutter_test.dart'; +import 'package:stream_core_flutter/stream_core_flutter.dart'; + +void main() { + group('StreamBadgeNotification Golden Tests', () { + goldenTest( + 'renders light theme type and size matrix', + fileName: 'stream_badge_notification_light_matrix', + builder: () => GoldenTestGroup( + scenarioConstraints: const BoxConstraints(maxWidth: 100), + children: [ + for (final type in StreamBadgeNotificationType.values) + for (final size in StreamBadgeNotificationSize.values) + GoldenTestScenario( + name: '${type.name}_${size.name}', + child: _buildInTheme( + StreamBadgeNotification( + label: '1', + type: type, + size: size, + ), + ), + ), + ], + ), + ); + + goldenTest( + 'renders dark theme type and size matrix', + fileName: 'stream_badge_notification_dark_matrix', + builder: () => GoldenTestGroup( + scenarioConstraints: const BoxConstraints(maxWidth: 100), + children: [ + for (final type in StreamBadgeNotificationType.values) + for (final size in StreamBadgeNotificationSize.values) + GoldenTestScenario( + name: '${type.name}_${size.name}', + child: _buildInTheme( + StreamBadgeNotification( + label: '1', + type: type, + size: size, + ), + brightness: Brightness.dark, + ), + ), + ], + ), + ); + + goldenTest( + 'renders count variants correctly', + fileName: 'stream_badge_notification_counts', + builder: () => GoldenTestGroup( + scenarioConstraints: const BoxConstraints(maxWidth: 100), + children: [ + for (final count in ['1', '9', '25', '99', '99+']) + GoldenTestScenario( + name: 'count_$count', + child: _buildInTheme( + StreamBadgeNotification(label: count), + ), + ), + ], + ), + ); + }); +} + +Widget _buildInTheme( + Widget child, { + Brightness brightness = Brightness.light, +}) { + final streamTheme = StreamTheme(brightness: brightness); + return Theme( + data: ThemeData( + brightness: brightness, + extensions: [streamTheme], + ), + child: Builder( + builder: (context) => Material( + color: StreamTheme.of(context).colorScheme.backgroundApp, + child: Padding( + padding: const EdgeInsets.all(8), + child: Center(child: child), + ), + ), + ), + ); +} diff --git a/packages/stream_core_flutter/test/components/buttons/goldens/ci/stream_button_dark_matrix.png b/packages/stream_core_flutter/test/components/buttons/goldens/ci/stream_button_dark_matrix.png new file mode 100644 index 0000000..7faaf0d Binary files /dev/null and b/packages/stream_core_flutter/test/components/buttons/goldens/ci/stream_button_dark_matrix.png differ diff --git a/packages/stream_core_flutter/test/components/buttons/goldens/ci/stream_button_disabled.png b/packages/stream_core_flutter/test/components/buttons/goldens/ci/stream_button_disabled.png new file mode 100644 index 0000000..45cb603 Binary files /dev/null and b/packages/stream_core_flutter/test/components/buttons/goldens/ci/stream_button_disabled.png differ diff --git a/packages/stream_core_flutter/test/components/buttons/goldens/ci/stream_button_icon_only.png b/packages/stream_core_flutter/test/components/buttons/goldens/ci/stream_button_icon_only.png new file mode 100644 index 0000000..a60027e Binary files /dev/null and b/packages/stream_core_flutter/test/components/buttons/goldens/ci/stream_button_icon_only.png differ diff --git a/packages/stream_core_flutter/test/components/buttons/goldens/ci/stream_button_light_matrix.png b/packages/stream_core_flutter/test/components/buttons/goldens/ci/stream_button_light_matrix.png new file mode 100644 index 0000000..6195b78 Binary files /dev/null and b/packages/stream_core_flutter/test/components/buttons/goldens/ci/stream_button_light_matrix.png differ diff --git a/packages/stream_core_flutter/test/components/buttons/goldens/ci/stream_button_with_icons.png b/packages/stream_core_flutter/test/components/buttons/goldens/ci/stream_button_with_icons.png new file mode 100644 index 0000000..6cbbd5e Binary files /dev/null and b/packages/stream_core_flutter/test/components/buttons/goldens/ci/stream_button_with_icons.png differ diff --git a/packages/stream_core_flutter/test/components/buttons/stream_button_golden_test.dart b/packages/stream_core_flutter/test/components/buttons/stream_button_golden_test.dart new file mode 100644 index 0000000..2ad1f90 --- /dev/null +++ b/packages/stream_core_flutter/test/components/buttons/stream_button_golden_test.dart @@ -0,0 +1,170 @@ +// ignore_for_file: avoid_redundant_argument_values + +import 'package:alchemist/alchemist.dart'; +import 'package:flutter/material.dart'; +import 'package:flutter_test/flutter_test.dart'; +import 'package:stream_core_flutter/stream_core_flutter.dart'; + +void main() { + group('StreamButton Golden Tests', () { + goldenTest( + 'renders light theme matrix', + fileName: 'stream_button_light_matrix', + builder: () => GoldenTestGroup( + scenarioConstraints: const BoxConstraints(maxWidth: 400), + children: [ + for (final style in StreamButtonStyle.values) + for (final type in StreamButtonType.values) + for (final size in StreamButtonSize.values) + GoldenTestScenario( + name: '${style.name}_${type.name}_${size.name}', + child: _buildButtonInTheme( + StreamButton( + label: 'Button', + onTap: () {}, + style: style, + type: type, + size: size, + ), + ), + ), + ], + ), + ); + + goldenTest( + 'renders dark theme matrix', + fileName: 'stream_button_dark_matrix', + builder: () => GoldenTestGroup( + scenarioConstraints: const BoxConstraints(maxWidth: 400), + children: [ + for (final style in StreamButtonStyle.values) + for (final type in StreamButtonType.values) + for (final size in StreamButtonSize.values) + GoldenTestScenario( + name: '${style.name}_${type.name}_${size.name}', + child: _buildButtonInTheme( + StreamButton( + label: 'Button', + onTap: () {}, + style: style, + type: type, + size: size, + ), + brightness: Brightness.dark, + ), + ), + ], + ), + ); + + goldenTest( + 'renders button with icons correctly', + fileName: 'stream_button_with_icons', + builder: () => GoldenTestGroup( + scenarioConstraints: const BoxConstraints(maxWidth: 300), + children: [ + GoldenTestScenario( + name: 'icon left', + child: _buildButtonInTheme( + StreamButton( + label: 'Button', + onTap: () {}, + iconLeft: Icons.add, + ), + ), + ), + GoldenTestScenario( + name: 'icon right', + child: _buildButtonInTheme( + StreamButton( + label: 'Button', + onTap: () {}, + iconRight: Icons.arrow_forward, + ), + ), + ), + GoldenTestScenario( + name: 'both icons', + child: _buildButtonInTheme( + StreamButton( + label: 'Button', + onTap: () {}, + iconLeft: Icons.add, + iconRight: Icons.arrow_forward, + ), + ), + ), + ], + ), + ); + + goldenTest( + 'renders icon only button correctly', + fileName: 'stream_button_icon_only', + builder: () => GoldenTestGroup( + scenarioConstraints: const BoxConstraints(maxWidth: 300), + children: [ + for (final style in StreamButtonStyle.values) + for (final type in StreamButtonType.values) + GoldenTestScenario( + name: '${style.name}_${type.name}', + child: _buildButtonInTheme( + StreamButton.icon( + onTap: () {}, + style: style, + type: type, + icon: Icons.add, + ), + ), + ), + ], + ), + ); + + goldenTest( + 'renders disabled button correctly', + fileName: 'stream_button_disabled', + builder: () => GoldenTestGroup( + scenarioConstraints: const BoxConstraints(maxWidth: 300), + children: [ + for (final style in StreamButtonStyle.values) + for (final type in StreamButtonType.values) + GoldenTestScenario( + name: '${style.name}_${type.name}', + child: _buildButtonInTheme( + StreamButton( + label: 'Disabled', + onTap: null, + style: style, + type: type, + ), + ), + ), + ], + ), + ); + }); +} + +Widget _buildButtonInTheme( + Widget button, { + Brightness brightness = Brightness.light, +}) { + final streamTheme = StreamTheme(brightness: brightness); + return Theme( + data: ThemeData( + brightness: brightness, + extensions: [streamTheme], + ), + child: Builder( + builder: (context) => Material( + color: StreamTheme.of(context).colorScheme.backgroundApp, + child: Padding( + padding: const EdgeInsets.all(8), + child: button, + ), + ), + ), + ); +} diff --git a/packages/stream_core_flutter/test/components/message_composer/goldens/ci/message_composer_attachment_link_preview_dark_matrix.png b/packages/stream_core_flutter/test/components/message_composer/goldens/ci/message_composer_attachment_link_preview_dark_matrix.png new file mode 100644 index 0000000..8acc8dd Binary files /dev/null and b/packages/stream_core_flutter/test/components/message_composer/goldens/ci/message_composer_attachment_link_preview_dark_matrix.png differ diff --git a/packages/stream_core_flutter/test/components/message_composer/goldens/ci/message_composer_attachment_link_preview_light_matrix.png b/packages/stream_core_flutter/test/components/message_composer/goldens/ci/message_composer_attachment_link_preview_light_matrix.png new file mode 100644 index 0000000..4d0c3c0 Binary files /dev/null and b/packages/stream_core_flutter/test/components/message_composer/goldens/ci/message_composer_attachment_link_preview_light_matrix.png differ diff --git a/packages/stream_core_flutter/test/components/message_composer/goldens/ci/message_composer_attachment_reply_custom_matrix.png b/packages/stream_core_flutter/test/components/message_composer/goldens/ci/message_composer_attachment_reply_custom_matrix.png new file mode 100644 index 0000000..0e04c6c Binary files /dev/null and b/packages/stream_core_flutter/test/components/message_composer/goldens/ci/message_composer_attachment_reply_custom_matrix.png differ diff --git a/packages/stream_core_flutter/test/components/message_composer/goldens/ci/message_composer_attachment_reply_dark_matrix.png b/packages/stream_core_flutter/test/components/message_composer/goldens/ci/message_composer_attachment_reply_dark_matrix.png new file mode 100644 index 0000000..faea8dd Binary files /dev/null and b/packages/stream_core_flutter/test/components/message_composer/goldens/ci/message_composer_attachment_reply_dark_matrix.png differ diff --git a/packages/stream_core_flutter/test/components/message_composer/goldens/ci/message_composer_attachment_reply_light_matrix.png b/packages/stream_core_flutter/test/components/message_composer/goldens/ci/message_composer_attachment_reply_light_matrix.png new file mode 100644 index 0000000..00799be Binary files /dev/null and b/packages/stream_core_flutter/test/components/message_composer/goldens/ci/message_composer_attachment_reply_light_matrix.png differ diff --git a/packages/stream_core_flutter/test/components/message_composer/message_composer_attachment_link_preview_golden_test.dart b/packages/stream_core_flutter/test/components/message_composer/message_composer_attachment_link_preview_golden_test.dart new file mode 100644 index 0000000..96cf2f6 --- /dev/null +++ b/packages/stream_core_flutter/test/components/message_composer/message_composer_attachment_link_preview_golden_test.dart @@ -0,0 +1,211 @@ +// ignore_for_file: avoid_redundant_argument_values + +import 'dart:typed_data'; + +import 'package:alchemist/alchemist.dart'; +import 'package:flutter/material.dart'; +import 'package:flutter_test/flutter_test.dart'; +import 'package:stream_core_flutter/stream_core_flutter.dart'; + +void main() { + group('MessageComposerAttachmentLinkPreview Golden Tests', () { + goldenTest( + 'renders light theme matrix', + fileName: 'message_composer_attachment_link_preview_light_matrix', + builder: () => GoldenTestGroup( + scenarioConstraints: const BoxConstraints(maxWidth: 360), + children: [ + GoldenTestScenario( + name: 'full_no_remove', + child: _buildLinkPreviewInTheme( + const MessageComposerLinkPreviewAttachment( + title: 'Getting started with Stream', + subtitle: 'Build in-app messaging with our flexible SDKs.', + url: 'https://getstream.io/chat/docs/', + onRemovePressed: null, + ), + ), + ), + GoldenTestScenario( + name: 'full_with_remove', + child: _buildLinkPreviewInTheme( + MessageComposerLinkPreviewAttachment( + title: 'Getting started with Stream', + subtitle: 'Build in-app messaging with our flexible SDKs.', + url: 'https://getstream.io/chat/docs/', + onRemovePressed: () {}, + ), + ), + ), + GoldenTestScenario( + name: 'full_with_image_no_remove', + child: _buildLinkPreviewInTheme( + MessageComposerLinkPreviewAttachment( + title: 'Getting started with Stream', + subtitle: 'Build in-app messaging with our flexible SDKs.', + url: 'https://getstream.io/chat/docs/', + image: _placeholderImage, + onRemovePressed: null, + ), + ), + ), + GoldenTestScenario( + name: 'full_with_image_with_remove', + child: _buildLinkPreviewInTheme( + MessageComposerLinkPreviewAttachment( + title: 'Getting started with Stream', + subtitle: 'Build in-app messaging with our flexible SDKs.', + url: 'https://getstream.io/chat/docs/', + image: _placeholderImage, + onRemovePressed: () {}, + ), + ), + ), + GoldenTestScenario( + name: 'url_only_no_remove', + child: _buildLinkPreviewInTheme( + const MessageComposerLinkPreviewAttachment( + title: null, + subtitle: null, + url: 'https://getstream.io/', + onRemovePressed: null, + ), + ), + ), + GoldenTestScenario( + name: 'url_only_with_remove', + child: _buildLinkPreviewInTheme( + MessageComposerLinkPreviewAttachment( + title: null, + subtitle: null, + url: 'https://getstream.io/', + onRemovePressed: () {}, + ), + ), + ), + ], + ), + ); + + goldenTest( + 'renders dark theme matrix', + fileName: 'message_composer_attachment_link_preview_dark_matrix', + builder: () => GoldenTestGroup( + scenarioConstraints: const BoxConstraints(maxWidth: 360), + children: [ + GoldenTestScenario( + name: 'full_no_remove', + child: _buildLinkPreviewInTheme( + const MessageComposerLinkPreviewAttachment( + title: 'Getting started with Stream', + subtitle: 'Build in-app messaging with our flexible SDKs.', + url: 'https://getstream.io/chat/docs/', + onRemovePressed: null, + ), + brightness: Brightness.dark, + ), + ), + GoldenTestScenario( + name: 'full_with_remove', + child: _buildLinkPreviewInTheme( + MessageComposerLinkPreviewAttachment( + title: 'Getting started with Stream', + subtitle: 'Build in-app messaging with our flexible SDKs.', + url: 'https://getstream.io/chat/docs/', + onRemovePressed: () {}, + ), + brightness: Brightness.dark, + ), + ), + GoldenTestScenario( + name: 'full_with_image_no_remove', + child: _buildLinkPreviewInTheme( + MessageComposerLinkPreviewAttachment( + title: 'Getting started with Stream', + subtitle: 'Build in-app messaging with our flexible SDKs.', + url: 'https://getstream.io/chat/docs/', + image: _placeholderImage, + onRemovePressed: null, + ), + brightness: Brightness.dark, + ), + ), + GoldenTestScenario( + name: 'full_with_image_with_remove', + child: _buildLinkPreviewInTheme( + MessageComposerLinkPreviewAttachment( + title: 'Getting started with Stream', + subtitle: 'Build in-app messaging with our flexible SDKs.', + url: 'https://getstream.io/chat/docs/', + image: _placeholderImage, + onRemovePressed: () {}, + ), + brightness: Brightness.dark, + ), + ), + GoldenTestScenario( + name: 'url_only_no_remove', + child: _buildLinkPreviewInTheme( + const MessageComposerLinkPreviewAttachment( + title: null, + subtitle: null, + url: 'https://getstream.io/', + onRemovePressed: null, + ), + brightness: Brightness.dark, + ), + ), + GoldenTestScenario( + name: 'url_only_with_remove', + child: _buildLinkPreviewInTheme( + MessageComposerLinkPreviewAttachment( + title: null, + subtitle: null, + url: 'https://getstream.io/', + onRemovePressed: () {}, + ), + brightness: Brightness.dark, + ), + ), + ], + ), + ); + }); +} + +/// Minimal 1x1 PNG (transparent pixel) for deterministic golden tests. +final _placeholderImage = MemoryImage(Uint8List.fromList(_kTransparentPixelPng)); + +const _kTransparentPixelPng = [ + 0x89, 0x50, 0x4E, 0x47, 0x0D, 0x0A, 0x1A, 0x0A, // + 0x00, 0x00, 0x00, 0x0D, 0x49, 0x48, 0x44, 0x52, // + 0x00, 0x00, 0x00, 0x01, 0x00, 0x00, 0x00, 0x01, // + 0x08, 0x06, 0x00, 0x00, 0x00, 0x1F, 0x15, 0xC4, // + 0x89, 0x00, 0x00, 0x00, 0x0A, 0x49, 0x44, 0x41, // + 0x54, 0x78, 0x9C, 0x63, 0x00, 0x01, 0x00, 0x00, // + 0x05, 0x00, 0x01, 0x0D, 0x0A, 0x2D, 0xB4, 0x00, // + 0x00, 0x00, 0x00, 0x49, 0x45, 0x4E, 0x44, 0xAE, // + 0x42, 0x60, 0x82, // +]; + +Widget _buildLinkPreviewInTheme( + Widget linkPreview, { + Brightness brightness = Brightness.light, +}) { + final streamTheme = StreamTheme(brightness: brightness); + return Theme( + data: ThemeData( + brightness: brightness, + extensions: [streamTheme], + ), + child: Builder( + builder: (context) => Material( + color: StreamTheme.of(context).colorScheme.backgroundApp, + child: Padding( + padding: const EdgeInsets.all(8), + child: linkPreview, + ), + ), + ), + ); +} diff --git a/packages/stream_core_flutter/test/components/message_composer/message_composer_attachment_reply_golden_test.dart b/packages/stream_core_flutter/test/components/message_composer/message_composer_attachment_reply_golden_test.dart new file mode 100644 index 0000000..5a76147 --- /dev/null +++ b/packages/stream_core_flutter/test/components/message_composer/message_composer_attachment_reply_golden_test.dart @@ -0,0 +1,138 @@ +// ignore_for_file: avoid_redundant_argument_values + +import 'package:alchemist/alchemist.dart'; +import 'package:flutter/material.dart'; +import 'package:flutter_test/flutter_test.dart'; +import 'package:stream_core_flutter/stream_core_flutter.dart'; + +void main() { + group('MessageComposerAttachmentReply Golden Tests', () { + goldenTest( + 'renders light theme style matrix', + fileName: 'message_composer_attachment_reply_light_matrix', + builder: () => GoldenTestGroup( + scenarioConstraints: const BoxConstraints(maxWidth: 360), + children: [ + for (final style in ReplyStyle.values) + GoldenTestScenario( + name: '${style.name}_no_remove', + child: _buildReplyInTheme( + MessageComposerReplyAttachment( + title: 'Reply to John Doe', + subtitle: 'We had a great time during our holiday.', + onRemovePressed: null, + style: style, + ), + ), + ), + for (final style in ReplyStyle.values) + GoldenTestScenario( + name: '${style.name}_with_remove', + child: _buildReplyInTheme( + MessageComposerReplyAttachment( + title: 'Reply to John Doe', + subtitle: 'We had a great time during our holiday.', + onRemovePressed: () {}, + style: style, + ), + ), + ), + ], + ), + ); + + goldenTest( + 'renders dark theme style matrix', + fileName: 'message_composer_attachment_reply_dark_matrix', + builder: () => GoldenTestGroup( + scenarioConstraints: const BoxConstraints(maxWidth: 360), + children: [ + for (final style in ReplyStyle.values) + GoldenTestScenario( + name: '${style.name}_no_remove', + child: _buildReplyInTheme( + MessageComposerReplyAttachment( + title: 'Reply to John Doe', + subtitle: 'We had a great time during our holiday.', + onRemovePressed: null, + style: style, + ), + brightness: Brightness.dark, + ), + ), + for (final style in ReplyStyle.values) + GoldenTestScenario( + name: '${style.name}_with_remove', + child: _buildReplyInTheme( + MessageComposerReplyAttachment( + title: 'Reply to John Doe', + subtitle: 'We had a great time during our holiday.', + onRemovePressed: () {}, + style: style, + ), + brightness: Brightness.dark, + ), + ), + ], + ), + ); + + goldenTest( + 'renders custom theme style matrix', + fileName: 'message_composer_attachment_reply_custom_matrix', + builder: () => GoldenTestGroup( + scenarioConstraints: const BoxConstraints(maxWidth: 360), + children: [ + for (final style in ReplyStyle.values) + GoldenTestScenario( + name: style.name, + child: _buildReplyInTheme( + StreamMessageTheme( + data: const StreamMessageThemeData( + incoming: StreamMessageStyle( + backgroundColor: Colors.red, + replyIndicatorColor: Colors.green, + textColor: Colors.white, + ), + outgoing: StreamMessageStyle( + backgroundColor: Colors.blue, + replyIndicatorColor: Colors.yellow, + textColor: Colors.white, + ), + ), + child: MessageComposerReplyAttachment( + title: 'Reply to John Doe', + subtitle: 'We had a great time during our holiday.', + onRemovePressed: null, + style: style, + ), + ), + ), + ), + ], + ), + ); + }); +} + +Widget _buildReplyInTheme( + Widget reply, { + Brightness brightness = Brightness.light, +}) { + final streamTheme = StreamTheme(brightness: brightness); + return Theme( + data: ThemeData( + brightness: brightness, + extensions: [streamTheme], + ), + child: Builder( + builder: (context) => Material( + color: StreamTheme.of(context).colorScheme.backgroundApp, + child: Padding( + padding: const EdgeInsets.all(8), + child: reply, + ), + ), + ), + ); +} diff --git a/packages/stream_core_flutter/test/flutter_test_config.dart b/packages/stream_core_flutter/test/flutter_test_config.dart new file mode 100644 index 0000000..b689d05 --- /dev/null +++ b/packages/stream_core_flutter/test/flutter_test_config.dart @@ -0,0 +1,19 @@ +import 'dart:async'; +import 'dart:io'; + +import 'package:alchemist/alchemist.dart'; + +Future testExecutable(FutureOr Function() testMain) async { + final isRunningInCi = Platform.environment.containsKey('GITHUB_ACTIONS'); + + return AlchemistConfig.runWithConfig( + config: AlchemistConfig( + // Enable golden tests for CI environments and disable them for local environments. + ciGoldensConfig: CiGoldensConfig(enabled: isRunningInCi), + // Disable platform-specific goldens to ensure consistent results across + // different machines and CI environments. + platformGoldensConfig: PlatformGoldensConfig(enabled: !isRunningInCi), + ), + run: testMain, + ); +} diff --git a/pubspec.lock b/pubspec.lock index 6f5a39f..1843812 100644 --- a/pubspec.lock +++ b/pubspec.lock @@ -1,6 +1,22 @@ # Generated by pub # See https://dart.dev/tools/pub/glossary#lockfile packages: + _fe_analyzer_shared: + dependency: transitive + description: + name: _fe_analyzer_shared + sha256: "8d7ff3948166b8ec5da0fbb5962000926b8e02f2ed9b3e51d1738905fbd4c98d" + url: "https://pub.dev" + source: hosted + version: "93.0.0" + analyzer: + dependency: transitive + description: + name: analyzer + sha256: de7148ed2fcec579b19f122c1800933dfa028f6d9fd38a152b04b1516cec120b + url: "https://pub.dev" + source: hosted + version: "10.0.1" ansi_styles: dependency: transitive description: @@ -25,6 +41,30 @@ packages: url: "https://pub.dev" source: hosted version: "2.13.0" + boolean_selector: + dependency: transitive + description: + name: boolean_selector + sha256: "8aab1771e1243a5063b8b0ff68042d67334e3feab9e95b9490f9a6ebf73b42ea" + url: "https://pub.dev" + source: hosted + version: "2.1.2" + built_collection: + dependency: transitive + description: + name: built_collection + sha256: "376e3dd27b51ea877c28d525560790aee2e6fbb5f20e2f85d5081027d94e2100" + url: "https://pub.dev" + source: hosted + version: "5.1.1" + built_value: + dependency: transitive + description: + name: built_value + sha256: "7931c90b84bc573fef103548e354258ae4c9d28d140e41961df6843c5d60d4d8" + url: "https://pub.dev" + source: hosted + version: "8.12.3" charcode: dependency: transitive description: @@ -37,18 +77,18 @@ packages: dependency: transitive description: name: checked_yaml - sha256: feb6bed21949061731a7a75fc5d2aa727cf160b91af9a3e464c5e3a32e28b5ff + sha256: "959525d3162f249993882720d52b7e0c833978df229be20702b33d48d91de70f" url: "https://pub.dev" source: hosted - version: "2.0.3" + version: "2.0.4" cli_launcher: dependency: transitive description: name: cli_launcher - sha256: "5e7e0282b79e8642edd6510ee468ae2976d847a0a29b3916e85f5fa1bfe24005" + sha256: "17d2744fb9a254c49ec8eda582536abe714ea0131533e24389843a4256f82eac" url: "https://pub.dev" source: hosted - version: "0.3.1" + version: "0.3.2+1" cli_util: dependency: transitive description: @@ -57,14 +97,14 @@ packages: url: "https://pub.dev" source: hosted version: "0.4.2" - clock: - dependency: transitive + code_builder: + dependency: "direct dev" description: - name: clock - sha256: fddb70d9b5277016c77a80201021d40a2247104d9f4aa7bab7157b7e3f05b84b + name: code_builder + sha256: "6a6cab2ba4680d6423f34a9b972a4c9a94ebe1b62ecec4e1a1f2cba91fd1319d" url: "https://pub.dev" source: hosted - version: "1.1.2" + version: "4.11.1" collection: dependency: transitive description: @@ -77,10 +117,34 @@ packages: dependency: transitive description: name: conventional_commit - sha256: fad254feb6fb8eace2be18855176b0a4b97e0d50e416ff0fe590d5ba83735d34 + sha256: c40b1b449ce2a63fa2ce852f35e3890b1e182f5951819934c0e4a66254bc0dc3 url: "https://pub.dev" source: hosted - version: "0.6.1" + version: "0.6.1+1" + convert: + dependency: transitive + description: + name: convert + sha256: b30acd5944035672bc15c6b7a8b47d773e41e2f17de064350988c5d02adb1c68 + url: "https://pub.dev" + source: hosted + version: "3.1.2" + crypto: + dependency: transitive + description: + name: crypto + sha256: c8ea0233063ba03258fbcf2ca4d6dadfefe14f02fab57702265467a19f27fadf + url: "https://pub.dev" + source: hosted + version: "3.0.7" + dart_style: + dependency: transitive + description: + name: dart_style + sha256: "15a7db352c8fc6a4d2bc475ba901c25b39fe7157541da4c16eacce6f8be83e49" + url: "https://pub.dev" + source: hosted + version: "3.1.5" file: dependency: transitive description: @@ -89,6 +153,14 @@ packages: url: "https://pub.dev" source: hosted version: "7.0.1" + fixnum: + dependency: transitive + description: + name: fixnum + sha256: b6dc7065e46c974bc7c5f143080a6764ec7a4be6da1285ececdc37be96de53be + url: "https://pub.dev" + source: hosted + version: "1.1.1" glob: dependency: transitive description: @@ -109,10 +181,10 @@ packages: dependency: transitive description: name: http - sha256: "2c11f3f94c687ee9bad77c171151672986360b2b001d109814ee7140b2cf261b" + sha256: "87721a4a50b19c7f1d49001e51409bddc46303966ce89a65af4f4e6004896412" url: "https://pub.dev" source: hosted - version: "1.4.0" + version: "1.6.0" http_parser: dependency: transitive description: @@ -121,14 +193,14 @@ packages: url: "https://pub.dev" source: hosted version: "4.1.2" - intl: - dependency: transitive + icon_font_generator: + dependency: "direct dev" description: - name: intl - sha256: d6f56758b7d3014a48af9701c085700aac781a92a87a62b1333b46d8879661cf + name: icon_font_generator + sha256: ee807b461e5cd6c543cf55fd41298158837e18d70014dfeb6f7d285647e83235 url: "https://pub.dev" source: hosted - version: "0.19.0" + version: "4.1.0" io: dependency: transitive description: @@ -141,42 +213,82 @@ packages: dependency: transitive description: name: json_annotation - sha256: "1ce844379ca14835a50d2f019a3099f419082cfdd231cd86a142af94dd5c6bb1" + sha256: "805fa86df56383000f640384b282ce0cb8431f1a7a2396de92fb66186d8c57df" + url: "https://pub.dev" + source: hosted + version: "4.10.0" + logger: + dependency: transitive + description: + name: logger + sha256: a7967e31b703831a893bbc3c3dd11db08126fe5f369b5c648a36f821979f5be3 url: "https://pub.dev" source: hosted - version: "4.9.0" + version: "2.6.2" + matcher: + dependency: transitive + description: + name: matcher + sha256: "12956d0ad8390bbcc63ca2e1469c0619946ccb52809807067a7020d57e647aa6" + url: "https://pub.dev" + source: hosted + version: "0.12.18" melos: dependency: "direct dev" description: name: melos - sha256: "3f3ab3f902843d1e5a1b1a4dd39a4aca8ba1056f2d32fd8995210fa2843f646f" + sha256: "4280dc46bd5b741887cce1e67e5c1a6aaf3c22310035cf5bd33dceeeda62ed22" url: "https://pub.dev" source: hosted - version: "6.3.2" + version: "6.3.3" meta: dependency: transitive description: name: meta - sha256: "23f08335362185a5ea2ad3a4e597f1375e78bce8a040df5c600c8d3552ef2394" + sha256: "9f29b9bcc8ee287b1a31e0d01be0eae99a930dbffdaecf04b3f3d82a969f296f" url: "https://pub.dev" source: hosted - version: "1.17.0" + version: "1.18.1" mustache_template: dependency: transitive description: name: mustache_template - sha256: a46e26f91445bfb0b60519be280555b06792460b27b19e2b19ad5b9740df5d1c + sha256: "4326d0002ff58c74b9486990ccbdab08157fca3c996fe9e197aff9d61badf307" url: "https://pub.dev" source: hosted - version: "2.0.0" - path: + version: "2.0.3" + package_config: dependency: transitive + description: + name: package_config + sha256: f096c55ebb7deb7e384101542bfba8c52696c1b56fca2eb62827989ef2353bbc + url: "https://pub.dev" + source: hosted + version: "2.2.0" + path: + dependency: "direct dev" description: name: path sha256: "75cca69d1490965be98c73ceaea117e8a04dd21217b37b292c9ddbec0d955bc5" url: "https://pub.dev" source: hosted version: "1.9.1" + path_parsing: + dependency: transitive + description: + name: path_parsing + sha256: "883402936929eac138ee0a45da5b0f2c80f89913e6dc3bf77eb65b84b409c6ca" + url: "https://pub.dev" + source: hosted + version: "1.1.0" + petitparser: + dependency: transitive + description: + name: petitparser + sha256: "1a97266a94f7350d30ae522c0af07890c70b8e62c71e8e3920d1db4d23c057d1" + url: "https://pub.dev" + source: hosted + version: "7.0.1" platform: dependency: transitive description: @@ -189,18 +301,18 @@ packages: dependency: transitive description: name: pool - sha256: "20fe868b6314b322ea036ba325e6fc0711a22948856475e2c2b6306e8ab39c2a" + sha256: "978783255c543aa3586a1b3c21f6e9d720eb315376a915872c61ef8b5c20177d" url: "https://pub.dev" source: hosted - version: "1.5.1" + version: "1.5.2" process: dependency: transitive description: name: process - sha256: "44b4226c0afd4bc3b7c7e67d44c4801abd97103cf0c84609e2654b664ca2798c" + sha256: c6248e4526673988586e8c00bb22a49210c258dc91df5227d5da9748ecf79744 url: "https://pub.dev" source: hosted - version: "5.0.4" + version: "5.0.5" prompts: dependency: transitive description: @@ -221,10 +333,10 @@ packages: dependency: transitive description: name: pub_updater - sha256: "54e8dc865349059ebe7f163d6acce7c89eb958b8047e6d6e80ce93b13d7c9e60" + sha256: "739a0161d73a6974c0675b864fb0cf5147305f7b077b7f03a58fa7a9ab3e7e7d" url: "https://pub.dev" source: hosted - version: "0.4.0" + version: "0.5.0" pubspec_parse: dependency: transitive description: @@ -233,6 +345,14 @@ packages: url: "https://pub.dev" source: hosted version: "1.5.0" + recase: + dependency: "direct dev" + description: + name: recase + sha256: e4eb4ec2dcdee52dcf99cb4ceabaffc631d7424ee55e56f280bc039737f89213 + url: "https://pub.dev" + source: hosted + version: "4.1.0" source_span: dependency: transitive description: @@ -249,6 +369,14 @@ packages: url: "https://pub.dev" source: hosted version: "1.12.1" + stream_channel: + dependency: transitive + description: + name: stream_channel + sha256: "969e04c80b8bcdf826f8f16579c7b14d780458bd97f56d107d3950fdbeef059d" + url: "https://pub.dev" + source: hosted + version: "2.1.4" string_scanner: dependency: transitive description: @@ -265,6 +393,14 @@ packages: url: "https://pub.dev" source: hosted version: "1.2.2" + test_api: + dependency: transitive + description: + name: test_api + sha256: "93167629bfc610f71560ab9312acdda4959de4df6fac7492c89ff0d3886f6636" + url: "https://pub.dev" + source: hosted + version: "0.7.9" typed_data: dependency: transitive description: @@ -273,6 +409,22 @@ packages: url: "https://pub.dev" source: hosted version: "1.4.0" + vector_math: + dependency: transitive + description: + name: vector_math + sha256: d530bd74fea330e6e364cda7a85019c434070188383e1cd8d9777ee586914c5b + url: "https://pub.dev" + source: hosted + version: "2.2.0" + watcher: + dependency: transitive + description: + name: watcher + sha256: "1398c9f081a753f9226febe8900fce8f7d0a67163334e1c94a2438339d79d635" + url: "https://pub.dev" + source: hosted + version: "1.2.1" web: dependency: transitive description: @@ -281,8 +433,16 @@ packages: url: "https://pub.dev" source: hosted version: "1.1.1" - yaml: + xml: dependency: transitive + description: + name: xml + sha256: "971043b3a0d3da28727e40ed3e0b5d18b742fa5a68665cca88e74b7876d5e025" + url: "https://pub.dev" + source: hosted + version: "6.6.1" + yaml: + dependency: "direct dev" description: name: yaml sha256: b9da305ac7c39faa3f030eccd175340f968459dae4af175130b3fc47e40d76ce @@ -293,9 +453,9 @@ packages: dependency: transitive description: name: yaml_edit - sha256: fb38626579fb345ad00e674e2af3a5c9b0cc4b9bfb8fd7f7ff322c7c9e62aef5 + sha256: ec709065bb2c911b336853b67f3732dd13e0336bd065cc2f1061d7610ddf45e3 url: "https://pub.dev" source: hosted - version: "2.2.2" + version: "2.2.3" sdks: - dart: ">=3.6.2 <4.0.0" + dart: ">=3.10.0 <4.0.0" diff --git a/pubspec.yaml b/pubspec.yaml index ca55b7e..6e9eabd 100644 --- a/pubspec.yaml +++ b/pubspec.yaml @@ -1,7 +1,12 @@ name: stream_core_flutter_workspace environment: - sdk: ^3.6.2 + sdk: ^3.10.0 dev_dependencies: + code_builder: ^4.10.1 + icon_font_generator: ^4.1.0 melos: ^6.2.0 + path: ^1.9.0 + recase: ^4.1.0 + yaml: ^3.1.3 \ No newline at end of file diff --git a/scripts/generate_icons.dart b/scripts/generate_icons.dart new file mode 100644 index 0000000..779170e --- /dev/null +++ b/scripts/generate_icons.dart @@ -0,0 +1,499 @@ +/// Stream Icons Generator +/// +/// Generates an icon font and Dart classes from SVG files using configuration +/// from a YAML config file. +/// +/// Usage: +/// dart run scripts/generate_icons.dart +/// +/// Looks for 'stream_icons.yaml' in the current directory. +/// +/// This script: +/// 1. Reads configuration from the specified YAML file +/// 2. Reads SVG files from the configured source directory +/// 3. Generates an OTF font file +/// 4. Generates icon data class with icon constants +/// 5. Generates icon class for theme customization +/// 6. Runs build_runner to generate the theme extension mixin +library; + +import 'dart:io'; + +import 'package:code_builder/code_builder.dart'; +import 'package:icon_font_generator/icon_font_generator.dart'; +import 'package:path/path.dart' as p; +import 'package:recase/recase.dart'; +import 'package:yaml/yaml.dart'; + +// ============================================================================= +// Configuration +// ============================================================================= + +/// Configuration for the icon generator, loaded from stream_icons.yaml. +class IconGeneratorConfig { + const IconGeneratorConfig({ + required this.inputSvgDir, + required this.outputFontFile, + required this.outputFile, + required this.outputDataFile, + required this.fontName, + required this.className, + required this.dataClassName, + required this.package, + required this.normalize, + required this.ignoreShapes, + required this.recursive, + required this.format, + }); + + /// Loads configuration from a YAML file. + factory IconGeneratorConfig.fromYaml(String yamlPath) { + final file = File(yamlPath); + if (!file.existsSync()) { + throw IconGeneratorException('Configuration file not found: $yamlPath', exitCode: 2); + } + + final config = loadYaml(file.readAsStringSync()) as YamlMap; + final configDir = p.dirname(yamlPath); + + // Helper to resolve paths relative to the config file directory + String resolvePath(String key) { + final value = config[key] as String?; + if (value == null || value.isEmpty) { + throw IconGeneratorException('Missing required config: $key', exitCode: 2); + } + return p.normalize(p.join(configDir, value)); + } + + return IconGeneratorConfig( + inputSvgDir: resolvePath('input_svg_dir'), + outputFontFile: resolvePath('output_font_file'), + outputFile: resolvePath('output_file'), + outputDataFile: resolvePath('output_data_file'), + fontName: config['font_name'] as String? ?? 'Stream Icons', + className: config['class_name'] as String? ?? 'StreamIcons', + dataClassName: config['data_class_name'] as String? ?? 'StreamIconData', + package: config['package'] as String? ?? 'stream_core_flutter', + normalize: config['normalize'] as bool? ?? true, + ignoreShapes: config['ignore_shapes'] as bool? ?? true, + recursive: config['recursive'] as bool? ?? true, + format: config['format'] as bool? ?? true, + ); + } + + final String inputSvgDir; + final String outputFontFile; + final String outputFile; + final String outputDataFile; + final String fontName; + final String className; + final String dataClassName; + final String package; + final bool normalize; + final bool ignoreShapes; + final bool recursive; + final bool format; +} + +// ============================================================================= +// Main Entry Point +// ============================================================================= + +const _kDefaultConfigFile = 'stream_icons.yaml'; + +Future main(List args) async { + final stopwatch = Stopwatch()..start(); + + try { + final configPath = _resolveConfigPath(); + + _log('📄 Loading config: ${p.basename(configPath)}'); + final config = IconGeneratorConfig.fromYaml(configPath); + final configDir = p.dirname(configPath); + + await _generateIcons(config, configDir); + + _log('✅ Completed in ${stopwatch.elapsedMilliseconds}ms'); + } on IconGeneratorException catch (e) { + _logError(e.message); + exit(e.exitCode); + } catch (e, stack) { + _logError('Unexpected error: $e'); + _logError(stack.toString()); + exit(1); + } +} + +/// Resolves the config file path in current directory. +String _resolveConfigPath() { + final configPath = p.join(Directory.current.path, _kDefaultConfigFile); + + if (!File(configPath).existsSync()) { + throw const IconGeneratorException( + "Configuration file '$_kDefaultConfigFile' not found in current directory.", + exitCode: 66, + ); + } + + return configPath; +} + +// ============================================================================= +// Icon Generation +// ============================================================================= + +Future _generateIcons(IconGeneratorConfig config, String scriptDir) async { + // 1. Read SVG files + final svgMap = _readSvgFiles(config.inputSvgDir, config.recursive, scriptDir); + if (svgMap.isEmpty) { + throw const IconGeneratorException('No SVG files found', exitCode: 2); + } + + // 2. Generate font + _log('🔨 Generating font from ${svgMap.length} icons...', section: true); + final fontResult = svgToOtf( + svgMap: svgMap, + fontName: config.fontName, + normalize: config.normalize, + ignoreShapes: config.ignoreShapes, + ); + + // 3. Write font file + _ensureDirectoryExists(config.outputFontFile); + writeToFile(config.outputFontFile, fontResult.font); + _log(' └─ ${p.relative(config.outputFontFile, from: scriptDir)}'); + + // 4. Generate StreamIconData class + _log('📝 Generating Dart classes...', section: true); + var iconDataContent = generateFlutterClass( + glyphList: fontResult.glyphList, + familyName: fontResult.font.familyName, + className: config.dataClassName, + fontFileName: p.basename(config.outputFontFile), + package: config.package, + ); + iconDataContent = iconDataContent.replaceFirst( + "import 'package:flutter/widgets.dart';", + "part of '${p.basename(config.outputDataFile).replaceFirst('.g', '')}';", + ); + File(config.outputDataFile).writeAsStringSync(iconDataContent); + _log(' ├─ ${p.relative(config.outputDataFile, from: scriptDir)}'); + + // 5. Generate StreamIcons class + final iconEntries = _extractIconEntries(fontResult.glyphList); + final classContent = _generateClass( + iconEntries: iconEntries, + className: config.className, + dataClassName: config.dataClassName, + iconDataFileName: p.basename(config.outputDataFile), + outputFileName: p.basename(config.outputFile), + ); + File(config.outputFile).writeAsStringSync(classContent); + _log(' └─ ${p.relative(config.outputFile, from: scriptDir)}'); + + // 6. Run build_runner to generate theme mixin + _log('🔧 Running build_runner...', section: true); + final packageDir = config.outputFile.substring(0, config.outputFile.indexOf('/lib/')); + final buildResult = await Process.run( + 'dart', + ['run', 'build_runner', 'build', '--delete-conflicting-outputs'], + workingDirectory: packageDir, + ); + if (buildResult.exitCode != 0) { + _logError('build_runner failed:'); + _logError(buildResult.stderr.toString()); + throw IconGeneratorException('build_runner failed', exitCode: buildResult.exitCode); + } + _log(' └─ ${p.basename(config.outputFile).replaceFirst('.dart', '.g.theme.dart')}'); + + // 7. Format generated files + if (config.format) { + _log('✨ Formatting...', section: true); + final generatedThemeFile = config.outputFile.replaceFirst('.dart', '.g.theme.dart'); + await Process.run('dart', ['format', config.outputDataFile, config.outputFile, generatedThemeFile]); + } +} + +/// Reads all SVG files from a directory. +Map _readSvgFiles(String directory, bool recursive, String scriptDir) { + _log('🔍 Reading SVGs: ${p.relative(directory, from: scriptDir)}'); + + final dir = Directory(directory); + if (!dir.existsSync()) { + throw IconGeneratorException( + 'SVG source directory not found: $directory', + exitCode: 2, + ); + } + + final svgFiles = + dir + .listSync(recursive: recursive) + .whereType() + .where((f) => p.extension(f.path).toLowerCase() == '.svg') + .toList() + ..sort((a, b) => p.basename(a.path).compareTo(p.basename(b.path))); + + return { + for (final file in svgFiles) p.basenameWithoutExtension(file.path): file.readAsStringSync(), + }; +} + +/// Extracts icon entries from glyph list. +List _extractIconEntries(List glyphList) { + return glyphList + .where((g) => g.metadata.name?.isNotEmpty ?? false) + .map((g) => IconEntry.fromGlyphName(g.metadata.name!)) + .toList() + ..sort((a, b) => a.fieldName.compareTo(b.fieldName)); +} + +// ============================================================================= +// StreamIcons Class Generation +// ============================================================================= + +String _generateClass({ + required List iconEntries, + required String className, + required String dataClassName, + required String iconDataFileName, + required String outputFileName, +}) { + // Derive part file name (e.g., stream_icons.dart -> stream_icons.g.theme.dart) + final partThemeFileName = outputFileName.replaceFirst('.dart', '.g.theme.dart'); + + final clazz = Class( + (b) => b + ..docs.add(_buildClassDocs(className, dataClassName)) + ..annotations.addAll([refer('themeGen'), refer('immutable')]) + ..name = className + ..mixins.add(refer('_\$$className')) + ..constructors.add(_buildConstructor(iconEntries, dataClassName)) + ..fields.addAll(_buildFields(iconEntries)) + ..methods.addAll(_buildMethods(iconEntries, className)), + ); + + final library = Library( + (b) => b + ..comments.addAll([ + 'GENERATED CODE - DO NOT MODIFY BY HAND', + 'Generated by scripts/generate_icons.dart', + '', + 'To regenerate: melos run generate:icons', + ]) + ..directives.addAll([ + Directive.import('package:flutter/widgets.dart'), + Directive.import('package:theme_extensions_builder_annotation/theme_extensions_builder_annotation.dart'), + Directive.part(partThemeFileName), + Directive.part(iconDataFileName), + ]) + ..body.add(clazz), + ); + + final emitter = DartEmitter(useNullSafetySyntax: true); + return library.accept(emitter).toString(); +} + +Constructor _buildConstructor(List entries, String iconsClassName) { + return Constructor( + (c) => c + ..constant = true + ..docs.add('/// Creates an icon set with optional overrides.') + ..optionalParameters.addAll( + entries.map( + (e) => Parameter( + (p) => p + ..name = e.fieldName + ..named = true + ..toThis = true + ..defaultTo = Code('$iconsClassName.${e.constantName}'), + ), + ), + ), + ); +} + +Iterable _buildFields(List entries) { + return entries.map( + (e) => Field( + (f) => f + ..docs.add('/// The ${e.humanReadable} icon.') + ..modifier = FieldModifier.final$ + ..type = refer('IconData') + ..name = e.fieldName, + ), + ); +} + +Iterable _buildMethods(List entries, String className) { + return [ + // allIcons getter + Method( + (m) => m + ..docs.add(_allIconsDoc) + ..type = MethodType.getter + ..returns = refer('Map') + ..name = 'allIcons' + ..lambda = true + ..body = Code('{${entries.map((e) => "'${e.fieldName}': ${e.fieldName}").join(', ')}}'), + ), + // lerp static method + Method( + (m) => m + ..docs.add('/// Linearly interpolate between two [$className] objects.') + ..static = true + ..returns = refer('$className?') + ..name = 'lerp' + ..requiredParameters.addAll([ + Parameter( + (p) => p + ..name = 'a' + ..type = refer('$className?'), + ), + Parameter( + (p) => p + ..name = 'b' + ..type = refer('$className?'), + ), + Parameter( + (p) => p + ..name = 't' + ..type = refer('double'), + ), + ]) + ..lambda = true + ..body = Code('_\$$className.lerp(a, b, t)'), + ), + ]; +} + +// ============================================================================= +// Documentation Templates +// ============================================================================= + +String _buildClassDocs(String className, String iconsClassName) => + ''' +/// Provides customizable icons for the Stream design system. +/// +/// [$className] allows customization of icons used throughout Stream widgets. +/// Each icon is exposed as a field that defaults to the corresponding +/// [$iconsClassName] constant. +/// +/// {@tool snippet} +/// +/// Access icons via context: +/// +/// ```dart +/// final icon = context.streamIcons.settingsGear2; +/// ``` +/// {@end-tool} +/// +/// {@tool snippet} +/// +/// Override specific icons in [StreamTheme]: +/// +/// ```dart +/// StreamTheme( +/// icons: $className( +/// settingsGear2: Icons.settings_outlined, +/// lock: Icons.lock_outline, +/// ), +/// ) +/// ``` +/// {@end-tool} +/// +/// {@tool snippet} +/// +/// Use copyWith for partial overrides: +/// +/// ```dart +/// final customIcons = const $className().copyWith( +/// settingsGear2: Icons.settings_outlined, +/// ); +/// ``` +/// {@end-tool} +/// +/// See also: +/// +/// * [$iconsClassName], which contains the raw icon data constants. +/// * [StreamTheme], which accepts custom icons via the [icons] parameter.'''; + +const _allIconsDoc = ''' +/// A map of all available icons keyed by their field name. +/// +/// Useful for dynamic icon lookup by string name. +/// +/// ```dart +/// final icon = context.streamIcons.allIcons['settingsGear2']; +/// ```'''; + +// ============================================================================= +// Icon Entry Model +// ============================================================================= + +/// Represents a single icon with its naming variants. +class IconEntry { + const IconEntry({ + required this.fieldName, + required this.constantName, + required this.humanReadable, + }); + + /// Creates an entry from a glyph name (e.g., "__IconFlag2__"). + factory IconEntry.fromGlyphName(String glyphName) { + final sanitized = _sanitizeName(glyphName); + final withoutPrefix = sanitized.startsWith('Icon') ? sanitized.substring(4) : sanitized; + + return IconEntry( + fieldName: ReCase(withoutPrefix).camelCase, + constantName: 'icon${sanitized.startsWith('Icon') ? sanitized.substring(4) : ReCase(sanitized).pascalCase}', + humanReadable: ReCase(withoutPrefix).sentenceCase.toLowerCase(), + ); + } + + final String fieldName; + final String constantName; + final String humanReadable; + + /// Sanitizes a name to be a valid Dart identifier. + static String _sanitizeName(String name) { + return name + .replaceAll(RegExp(r'^_+|_+$'), '') // Remove leading/trailing underscores + .replaceAllMapped(RegExp(r'[-_](\d)'), (m) => m.group(1)!) // Remove separators before digits + .replaceAllMapped(RegExp('[-_]([a-zA-Z])'), (m) => m.group(1)!.toUpperCase()); // camelCase + } +} + +// ============================================================================= +// Utilities +// ============================================================================= + +/// Ensures the parent directory of a file exists. +void _ensureDirectoryExists(String filePath) { + final dir = Directory(p.dirname(filePath)); + if (!dir.existsSync()) { + dir.createSync(recursive: true); + } +} + +void _log(String message, {bool section = false}) { + if (section) stdout.writeln(); + stdout.writeln(message); +} + +void _logError(String message) => stderr.writeln('❌ $message'); + +// ============================================================================= +// Exceptions +// ============================================================================= + +/// Exception thrown by the icon generator. +class IconGeneratorException implements Exception { + const IconGeneratorException(this.message, {this.exitCode = 1}); + + final String message; + final int exitCode; + + @override + String toString() => message; +}